All the vulnerabilites related to Siemens - SIMATIC HMI KTP Mobile Panels
cve-2020-15798
Vulnerability from cvelistv5
▼ | URL | Tags |
---|---|---|
https://cert-portal.siemens.com/productcert/pdf/ssa-520004.pdf | x_refsource_MISC | |
https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02 | x_refsource_MISC | |
https://cert-portal.siemens.com/productcert/pdf/ssa-752103.pdf | x_refsource_CONFIRM |
{ "containers": { "adp": [ { "providerMetadata": { "dateUpdated": "2024-08-04T13:30:21.706Z", "orgId": "af854a3a-2127-422b-91ae-364da2661108", "shortName": "CVE" }, "references": [ { "tags": [ "x_refsource_MISC", "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-520004.pdf" }, { "tags": [ "x_refsource_MISC", "x_transferred" ], "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-752103.pdf" } ], "title": "CVE Program Container" } ], "cna": { "affected": [ { "product": "SIMATIC HMI Comfort Panels (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V16 Update 3a" } ] }, { "product": "SIMATIC HMI KTP Mobile Panels", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V16 Update 3a" } ] }, { "product": "SINAMICS GH150", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS GL150 (with option X30)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS GM150 (with option X30)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS SH150", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS SL150", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS SM120", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS SM150", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "product": "SINAMICS SM150i", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] } ], "descriptions": [ { "lang": "en", "value": "A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions \u003c V16 Update 3a), SIMATIC HMI KTP Mobile Panels (All versions \u003c V16 Update 3a), SINAMICS GH150 (All versions), SINAMICS GL150 (with option X30) (All versions), SINAMICS GM150 (with option X30) (All versions), SINAMICS SH150 (All versions), SINAMICS SL150 (All versions), SINAMICS SM120 (All versions), SINAMICS SM150 (All versions), SINAMICS SM150i (All versions). Affected devices with enabled telnet service do not require authentication for this service. This could allow a remote attacker to gain full access to the device. (ZDI-CAN-12046)" } ], "problemTypes": [ { "descriptions": [ { "cweId": "CWE-306", "description": "CWE-306: Missing Authentication for Critical Function", "lang": "en", "type": "CWE" } ] } ], "providerMetadata": { "dateUpdated": "2021-08-10T10:35:22", "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "shortName": "siemens" }, "references": [ { "tags": [ "x_refsource_MISC" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-520004.pdf" }, { "tags": [ "x_refsource_MISC" ], "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-752103.pdf" } ], "x_legacyV4Record": { "CVE_data_meta": { "ASSIGNER": "productcert@siemens.com", "ID": "CVE-2020-15798", "STATE": "PUBLIC" }, "affects": { "vendor": { "vendor_data": [ { "product": { "product_data": [ { "product_name": "SIMATIC HMI Comfort Panels (incl. SIPLUS variants)", "version": { "version_data": [ { "version_value": "All versions \u003c V16 Update 3a" } ] } }, { "product_name": "SIMATIC HMI KTP Mobile Panels", "version": { "version_data": [ { "version_value": "All versions \u003c V16 Update 3a" } ] } }, { "product_name": "SINAMICS GH150", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS GL150 (with option X30)", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS GM150 (with option X30)", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS SH150", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS SL150", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS SM120", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS SM150", "version": { "version_data": [ { "version_value": "All versions" } ] } }, { "product_name": "SINAMICS SM150i", "version": { "version_data": [ { "version_value": "All versions" } ] } } ] }, "vendor_name": "Siemens" } ] } }, "data_format": "MITRE", "data_type": "CVE", "data_version": "4.0", "description": { "description_data": [ { "lang": "eng", "value": "A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions \u003c V16 Update 3a), SIMATIC HMI KTP Mobile Panels (All versions \u003c V16 Update 3a), SINAMICS GH150 (All versions), SINAMICS GL150 (with option X30) (All versions), SINAMICS GM150 (with option X30) (All versions), SINAMICS SH150 (All versions), SINAMICS SL150 (All versions), SINAMICS SM120 (All versions), SINAMICS SM150 (All versions), SINAMICS SM150i (All versions). Affected devices with enabled telnet service do not require authentication for this service. This could allow a remote attacker to gain full access to the device. (ZDI-CAN-12046)" } ] }, "problemtype": { "problemtype_data": [ { "description": [ { "lang": "eng", "value": "CWE-306: Missing Authentication for Critical Function" } ] } ] }, "references": { "reference_data": [ { "name": "https://cert-portal.siemens.com/productcert/pdf/ssa-520004.pdf", "refsource": "MISC", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-520004.pdf" }, { "name": "https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02", "refsource": "MISC", "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02" }, { "name": "https://cert-portal.siemens.com/productcert/pdf/ssa-752103.pdf", "refsource": "CONFIRM", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-752103.pdf" } ] } } } }, "cveMetadata": { "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "assignerShortName": "siemens", "cveId": "CVE-2020-15798", "datePublished": "2021-02-09T15:38:17", "dateReserved": "2020-07-15T00:00:00", "dateUpdated": "2024-08-04T13:30:21.706Z", "state": "PUBLISHED" }, "dataType": "CVE_RECORD", "dataVersion": "5.1" }
cve-2019-10936
Vulnerability from cvelistv5
{ "containers": { "adp": [ { "affected": [ { "cpes": [ "cpe:2.3:o:siemens:dk_standard_ethernet_controller_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "dk_standard_ethernet_controller_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:ek-ertec_200_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "ek-ertec_200_firmware", "vendor": "siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:ek-ertec_200p_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "ek-ertec_200p_firmware", "vendor": "siemens", "versions": [ { "lessThan": "4.6", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_cfu_pa:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_cfu_pa", "vendor": "siemens", "versions": [ { "lessThan": "v1.2.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et200ecopn_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et200ecopn_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et200s_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et200s_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et_200al_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et_200al_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et_200m_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et_200m_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et_200mp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et_200mp_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v4.3.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et_200pro_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et_200pro_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et_200s_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et_200s_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_et_200sp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_et_200sp_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_hmi_comfort_outdoor_panels:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_hmi_comfort_outdoor_panels", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_pn\\/pn_coupler_6es7158-3ad01-0xa0:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_pn\\/pn_coupler_6es7158-3ad01-0xa0", "vendor": "siemens", "versions": [ { "lessThan": "v4.2.1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_profinet_driver:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_profinet_driver", "vendor": "siemens", "versions": [ { "lessThan": "v2.1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-300_cpu_314_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-300_cpu_314_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-300_cpu_315-2_dp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-300_cpu_315-2_dp_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-300_cpu_315f-2_dp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-300_cpu_315f-2_dp_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-300_cpu_317-2_dp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-300_cpu_317-2_dp_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-300_cpu_317-2_pn\\/dp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-300_cpu_317-2_pn\\/dp_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-300_cpu_319-3_pn\\/dp_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-300_cpu_319-3_pn\\/dp_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v3.2.17", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_s7-400_cpu_412-2_pn:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-400_cpu_412-2_pn", "vendor": "siemens", "versions": [ { "lessThan": "v7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_s7-400_cpu_414-3_pn\\/dp:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-400_cpu_414-3_pn\\/dp", "vendor": "siemens", "versions": [ { "lessThan": "v7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_s7-400_cpu_416-3_pn\\/dp:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-400_cpu_416-3_pn\\/dp", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "v7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-400_h_v6_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-400_h_v6_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "v6.0.9", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-400_pn\\/dp_v6_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-400_pn\\/dp_v6_firmware", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_s7-410_cpu_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-410_cpu_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v8.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_s7-1200_cpu:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-1200_cpu", "vendor": "siemens", "versions": [ { "lessThan": "v4.4.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_s7-1500_cpu:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-1500_cpu", "vendor": "siemens", "versions": [ { "lessThan": "v2.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_s7-1500_controller:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_s7-1500_controller", "vendor": "siemens", "versions": [ { "lessThan": "v2.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_tdc_cp51m1_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_tdc_cp51m1_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v1.1.8", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:o:siemens:simatic_tdc_cpu555_firmware:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_tdc_cpu555_firmware", "vendor": "siemens", "versions": [ { "lessThan": "v1.1.1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:a:siemens:simatic_winac_rtx_2010:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_winac_rtx_2010", "vendor": "siemens", "versions": [ { "lessThan": "v2010_sp3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:simatic_winac_rtx_\\(f\\)_2010:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "simatic_winac_rtx_\\(f\\)_2010", "vendor": "siemens", "versions": [ { "lessThan": "v2010_sp3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_dcm:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_dcm", "vendor": "siemens", "versions": [ { "lessThan": "v1.5_hf1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_dcp:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_dcp", "vendor": "siemens", "versions": [ { "lessThan": "v1.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_g110m:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_g110m", "vendor": "siemens", "versions": [ { "lessThan": "v4.7_sp10_hf5", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_g120:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_g120", "vendor": "siemens", "versions": [ { "lessThan": "v4.7_sp10_hf5", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_g130:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_g130", "vendor": "siemens", "versions": [ { "lessThan": "v4.8", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_g150:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_g150", "vendor": "siemens", "versions": [ { "lessThan": "v4.8", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_gh150:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_gh150", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_gl150:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_gl150", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_gm150:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_gm150", "vendor": "siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_s110:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_s110", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_s120:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_s120", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_sl150:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_sl150", "vendor": "siemens", "versions": [ { "lessThan": "v4.8", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_sl150:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_sl150", "vendor": "siemens", "versions": [ { "lessThan": "v4.7_hf33", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinamics_sm120:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinamics_sm120", "vendor": "siemens", "versions": [ { "lessThanOrEqual": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinumerik_828d:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinumerik_828d", "vendor": "siemens", "versions": [ { "lessThan": "v4.8_sp5", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:sinumerik_840d_sl:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "sinumerik_840d_sl", "vendor": "siemens", "versions": [ { "lessThan": "v4.8_sp6", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "cpes": [ "cpe:2.3:h:siemens:siplus_s7-300_cpu_314:-:*:*:*:*:*:*:*" ], "defaultStatus": "unknown", "product": "siplus_s7-300_cpu_314", "vendor": "siemens", "versions": [ { "lessThan": "v3.3.17", "status": "affected", "version": "0", "versionType": "custom" } ] } ], "metrics": [ { "other": { "content": { "id": "CVE-2019-10936", "options": [ { "Exploitation": "none" }, { "Automatable": "yes" }, { "Technical Impact": "partial" } ], "role": "CISA Coordinator", "timestamp": "2024-07-09T14:36:59.481395Z", "version": "2.0.3" }, "type": "ssvc" } } ], "providerMetadata": { "dateUpdated": "2024-07-09T15:59:12.602Z", "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0", "shortName": "CISA-ADP" }, "title": "CISA ADP Vulnrichment" }, { "providerMetadata": { "dateUpdated": "2024-08-04T22:40:15.253Z", "orgId": "af854a3a-2127-422b-91ae-364da2661108", "shortName": "CVE" }, "references": [ { "tags": [ "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-473245.pdf" }, { "tags": [ "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/html/ssa-473245.html" } ], "title": "CVE Program Container" } ], "cna": { "affected": [ { "defaultStatus": "unknown", "product": "Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.6 Patch 01" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC CFU PA", "vendor": "Siemens", "versions": [ { "lessThan": "V1.2.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200AL IM 157-1 PN", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200M (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200MP IM 155-5 PN BA", "vendor": "Siemens", "versions": [ { "lessThan": "V4.3.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200MP IM 155-5 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.4.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200MP IM 155-5 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200MP IM 155-5 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200pro IM 154-3 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200pro IM 154-4 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200pro IM 154-8 PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200pro IM 154-8F PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200pro IM 154-8FX PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200S IM 151-8 PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200S IM 151-8F PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN BA", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN HA (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V1.2.1" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN HS", "vendor": "Siemens", "versions": [ { "lessThan": "V4.0.1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN ST BA", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN ST BA", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN/2 HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP IM 155-6 PN/3 HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET 200SP Open Controller CPU 1515SP PC (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "lessThan": "V2.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 16DI, DC24V, 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 16DO DC24V/1,3A, 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 4AO U/I 4xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8 DIO, DC24V/1,3A, 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8 DO, DC24V/2A, 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8AI RTD/TC 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8AI; 4 U/I; 4 RTD/TC 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8DI, DC24V, 4xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8DI, DC24V, 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8DO, DC24V/0,5A, 4xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8DO, DC24V/1,3A, 4xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN, 8DO, DC24V/1,3A, 8xM12", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200ecoPN: IO-Link Master", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC ET200S (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC HMI Comfort Outdoor Panels (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC HMI Comfort Panels (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC HMI KTP Mobile Panels", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC PN/PN Coupler", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.2.1" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC PROFINET Driver", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V2.1" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-1200 CPU family (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.4.0" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-1500 CPU family (incl. related ET200 CPUs and SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V2.0" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-1500 Software Controller", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V2.0" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 314C-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 315-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 315F-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 315T-3 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 317-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 317F-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 317T-3 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 317TF-3 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 319-3 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-300 CPU 319F-3 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 CPU 412-2 PN V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 CPU 414-3 PN/DP V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 CPU 414F-3 PN/DP V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 CPU 416-3 PN/DP V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 CPU 416F-3 PN/DP V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 H V6 CPU family (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "lessThan": "V6.0.9", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-400 PN/DP V6 and below CPU family (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC S7-410 V8 CPU family (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V8.2.2" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC TDC CP51M1", "vendor": "Siemens", "versions": [ { "lessThan": "V1.1.8", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC TDC CPU555", "vendor": "Siemens", "versions": [ { "lessThan": "V1.1.1", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC WinAC RTX 2010", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V2010 SP3" } ] }, { "defaultStatus": "unknown", "product": "SIMATIC WinAC RTX F 2010", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V2010 SP3" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS DCM", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V1.5 HF1" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS DCP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V1.3" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS G110M V4.7 PN Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.7 SP10 HF5" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS G120 V4.7 PN Control Unit (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.7 SP10 HF5" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS G130 V4.7 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c 4.8" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS G150 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c 4.8" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS GH150 V4.7 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS GL150 V4.7 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS GM150 V4.7 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS S110 Control Unit", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS S120 V4.7 Control Unit (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS S150 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c 4.8" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS SL150 V4.7 Control Unit", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.7 HF33" } ] }, { "defaultStatus": "unknown", "product": "SINAMICS SM120 V4.7 Control Unit", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SINUMERIK 828D", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.8 SP5" } ] }, { "defaultStatus": "unknown", "product": "SINUMERIK 840D sl", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.8 SP6" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.4.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.4.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN HF T1 RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "V4.4.0", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN ST TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200MP IM 155-5 PN ST TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200S IM 151-8 PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200S IM 151-8F PN/DP CPU", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF T1 RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF T1 RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN HF TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "V4.2.2", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST BA", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST BA", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST BA TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST BA TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS ET 200SP IM 155-6 PN ST TX RAIL", "vendor": "Siemens", "versions": [ { "lessThan": "*", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS NET PN/PN Coupler", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V4.2.1" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-300 CPU 314C-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.3.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-300 CPU 315-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-300 CPU 315F-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-300 CPU 317-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-300 CPU 317F-2 PN/DP", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V3.2.17" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-400 CPU 414-3 PN/DP V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] }, { "defaultStatus": "unknown", "product": "SIPLUS S7-400 CPU 416-3 PN/DP V7", "vendor": "Siemens", "versions": [ { "lessThan": "V7.0.3", "status": "affected", "version": "0", "versionType": "custom" } ] } ], "descriptions": [ { "lang": "en", "value": "Affected devices improperly handle large amounts of specially crafted UDP packets.\r\n\r\nThis could allow an unauthenticated remote attacker to trigger a denial of service condition." } ], "metrics": [ { "cvssV3_1": { "baseScore": 7.5, "baseSeverity": "HIGH", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H/E:P/RL:O/RC:C", "version": "3.1" } } ], "problemTypes": [ { "descriptions": [ { "cweId": "CWE-400", "description": "CWE-400: Uncontrolled Resource Consumption", "lang": "en", "type": "CWE" } ] } ], "providerMetadata": { "dateUpdated": "2024-07-09T12:03:55.957Z", "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "shortName": "siemens" }, "references": [ { "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-473245.pdf" }, { "url": "https://cert-portal.siemens.com/productcert/html/ssa-473245.html" } ] } }, "cveMetadata": { "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "assignerShortName": "siemens", "cveId": "CVE-2019-10936", "datePublished": "2019-10-10T00:00:00", "dateReserved": "2019-04-08T00:00:00", "dateUpdated": "2024-08-04T22:40:15.253Z", "state": "PUBLISHED" }, "dataType": "CVE_RECORD", "dataVersion": "5.1" }
cve-2019-19276
Vulnerability from cvelistv5
▼ | URL | Tags |
---|---|---|
https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf | x_refsource_MISC |
{ "containers": { "adp": [ { "providerMetadata": { "dateUpdated": "2024-08-05T02:09:39.475Z", "orgId": "af854a3a-2127-422b-91ae-364da2661108", "shortName": "CVE" }, "references": [ { "tags": [ "x_refsource_MISC", "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf" } ], "title": "CVE Program Container" } ], "cna": { "affected": [ { "product": "SIMATIC HMI Comfort Panels 1st Generation (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V16 Update 4" } ] }, { "product": "SIMATIC HMI KTP Mobile Panels", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V16 Update 4" } ] } ], "descriptions": [ { "lang": "en", "value": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 1st Generation (incl. SIPLUS variants) (All versions \u003c V16 Update 4), SIMATIC HMI KTP Mobile Panels (All versions \u003c V16 Update 4). Specially crafted packets sent to port 161/udp can cause the SNMP service of affected devices to crash. A manual restart of the device is required to resume operation of the service." } ], "problemTypes": [ { "descriptions": [ { "cweId": "CWE-787", "description": "CWE-787: Out-of-bounds Write", "lang": "en", "type": "CWE" } ] } ], "providerMetadata": { "dateUpdated": "2021-05-12T13:18:21", "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "shortName": "siemens" }, "references": [ { "tags": [ "x_refsource_MISC" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf" } ], "x_legacyV4Record": { "CVE_data_meta": { "ASSIGNER": "productcert@siemens.com", "ID": "CVE-2019-19276", "STATE": "PUBLIC" }, "affects": { "vendor": { "vendor_data": [ { "product": { "product_data": [ { "product_name": "SIMATIC HMI Comfort Panels 1st Generation (incl. SIPLUS variants)", "version": { "version_data": [ { "version_value": "All versions \u003c V16 Update 4" } ] } }, { "product_name": "SIMATIC HMI KTP Mobile Panels", "version": { "version_data": [ { "version_value": "All versions \u003c V16 Update 4" } ] } } ] }, "vendor_name": "Siemens" } ] } }, "data_format": "MITRE", "data_type": "CVE", "data_version": "4.0", "description": { "description_data": [ { "lang": "eng", "value": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 1st Generation (incl. SIPLUS variants) (All versions \u003c V16 Update 4), SIMATIC HMI KTP Mobile Panels (All versions \u003c V16 Update 4). Specially crafted packets sent to port 161/udp can cause the SNMP service of affected devices to crash. A manual restart of the device is required to resume operation of the service." } ] }, "problemtype": { "problemtype_data": [ { "description": [ { "lang": "eng", "value": "CWE-787: Out-of-bounds Write" } ] } ] }, "references": { "reference_data": [ { "name": "https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf", "refsource": "MISC", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf" } ] } } } }, "cveMetadata": { "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "assignerShortName": "siemens", "cveId": "CVE-2019-19276", "datePublished": "2021-05-12T13:18:21", "dateReserved": "2019-11-26T00:00:00", "dateUpdated": "2024-08-05T02:09:39.475Z", "state": "PUBLISHED" }, "dataType": "CVE_RECORD", "dataVersion": "5.1" }
cve-2022-40227
Vulnerability from cvelistv5
{ "containers": { "adp": [ { "providerMetadata": { "dateUpdated": "2024-08-03T12:14:39.944Z", "orgId": "af854a3a-2127-422b-91ae-364da2661108", "shortName": "CVE" }, "references": [ { "tags": [ "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-384224.pdf" } ], "title": "CVE Program Container" } ], "cna": { "affected": [ { "product": "SIMATIC HMI Comfort Panels (incl. SIPLUS variants)", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 4" } ] }, { "product": "SIMATIC HMI KTP Mobile Panels", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 4" } ] }, { "product": "SIMATIC HMI KTP1200 Basic", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIMATIC HMI KTP400 Basic", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIMATIC HMI KTP700 Basic", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIMATIC HMI KTP900 Basic", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIPLUS HMI KTP1200 BASIC", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIPLUS HMI KTP400 BASIC", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIPLUS HMI KTP700 BASIC", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] }, { "product": "SIPLUS HMI KTP900 BASIC", "vendor": "Siemens", "versions": [ { "status": "affected", "version": "All versions \u003c V17 Update 5" } ] } ], "descriptions": [ { "lang": "en", "value": "A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions \u003c V17 Update 4), SIMATIC HMI KTP Mobile Panels (All versions \u003c V17 Update 4), SIMATIC HMI KTP1200 Basic (All versions \u003c V17 Update 5), SIMATIC HMI KTP400 Basic (All versions \u003c V17 Update 5), SIMATIC HMI KTP700 Basic (All versions \u003c V17 Update 5), SIMATIC HMI KTP900 Basic (All versions \u003c V17 Update 5), SIPLUS HMI KTP1200 BASIC (All versions \u003c V17 Update 5), SIPLUS HMI KTP400 BASIC (All versions \u003c V17 Update 5), SIPLUS HMI KTP700 BASIC (All versions \u003c V17 Update 5), SIPLUS HMI KTP900 BASIC (All versions \u003c V17 Update 5). Affected devices do not properly validate input sent to certain services over TCP. This could allow an unauthenticated remote attacker to cause a permanent denial of service condition (requiring a device reboot) by sending specially crafted TCP packets." } ], "problemTypes": [ { "descriptions": [ { "cweId": "CWE-20", "description": "CWE-20: Improper Input Validation", "lang": "en", "type": "CWE" } ] } ], "providerMetadata": { "dateUpdated": "2022-10-11T00:00:00", "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "shortName": "siemens" }, "references": [ { "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-384224.pdf" } ] } }, "cveMetadata": { "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77", "assignerShortName": "siemens", "cveId": "CVE-2022-40227", "datePublished": "2022-10-11T00:00:00", "dateReserved": "2022-09-08T00:00:00", "dateUpdated": "2024-08-03T12:14:39.944Z", "state": "PUBLISHED" }, "dataType": "CVE_RECORD", "dataVersion": "5.1" }
var-201812-0343
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 4" - 22" (All versions < V15 Update 4), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions < V15 Update 4), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 and KTP900F (All versions < V15 Update 4), SIMATIC WinCC Runtime Advanced (All versions < V15 Update 4), SIMATIC WinCC Runtime Professional (All versions < V15 Update 4), SIMATIC WinCC (TIA Portal) (All versions < V15 Update 4), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). A directory traversal vulnerability could allow to download arbitrary files from the device. The security vulnerability could be exploited by an attacker with network access to the integrated web server. No user interaction and no authentication is required to exploit the vulnerability. The vulnerability impacts the confidentiality of the device. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains a path traversal vulnerability.Information may be obtained. Siemens SIMATIC Panels is prone to following security vulnerabilities: 1. An open-redirection vulnerability 2. A directory-traversal vulnerability Remote attackers may use a specially crafted request with directory-traversal sequences ('../') to retrieve arbitrary files from the affected system in the context of the application or by constructing a crafted URI and enticing a user to follow it and when an unsuspecting victim follows the link, they may be redirected to an attacker-controlled site. are all HMI software used by Siemens in Germany to control and monitor machines and equipment
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201812-0343", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic wincc \\", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi comfort panels", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi mp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic wincc runtime", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi op", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi tp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime professional sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime professional sp2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime professional sp1 upd2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime professional sp update", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "1319" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime advanced sp1 upd2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced sp1 upd5", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc update", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v135" }, { "model": "simatic wincc sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v12" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v120" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v110" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15" }, { "model": "simatic wincc update", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v136" }, { "model": "simatic wincc sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v13" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v13" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v10" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "22" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi comfort panels sp1 upd2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic hmi comfort panels sp1 upd5", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi classic devices", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime professional update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc runtime advanced update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi ktp mobile panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi comfort panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi comfort outdoor panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" } ], "sources": [ { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "NVD", "id": "CVE-2018-13812" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp400f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_%28tia_portal%29", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:wincc_runtime_advanced", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_runtime_professional", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-014525" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Hosni Tounsi from Carthage Red Team", "sources": [ { "db": "BID", "id": "105922" } ], "trust": 0.3 }, "cve": "CVE-2018-13812", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.0, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 10.0, "id": "CVE-2018-13812", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:L/Au:N/C:P/I:N/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 5.0, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 10.0, "id": "VHN-123909", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:L/AU:N/C:P/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 7.5, "baseSeverity": "HIGH", "confidentialityImpact": "HIGH", "exploitabilityScore": 3.9, "id": "CVE-2018-13812", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.8, "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-13812", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2018-13812", "trust": 0.8, "value": "High" }, { "author": "CNNVD", "id": "CNNVD-201811-482", "trust": 0.6, "value": "HIGH" }, { "author": "VULHUB", "id": "VHN-123909", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-123909" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "CNNVD", "id": "CNNVD-201811-482" }, { "db": "NVD", "id": "CVE-2018-13812" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 4\" - 22\" (All versions \u003c V15 Update 4), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions \u003c V15 Update 4), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 and KTP900F (All versions \u003c V15 Update 4), SIMATIC WinCC Runtime Advanced (All versions \u003c V15 Update 4), SIMATIC WinCC Runtime Professional (All versions \u003c V15 Update 4), SIMATIC WinCC (TIA Portal) (All versions \u003c V15 Update 4), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). A directory traversal vulnerability could allow to download arbitrary files from the device. The security vulnerability could be exploited by an attacker with network access to the integrated web server. No user interaction and no authentication is required to exploit the vulnerability. The vulnerability impacts the confidentiality of the device. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains a path traversal vulnerability.Information may be obtained. Siemens SIMATIC Panels is prone to following security vulnerabilities:\n1. An open-redirection vulnerability\n2. A directory-traversal vulnerability\nRemote attackers may use a specially crafted request with directory-traversal sequences (\u0027../\u0027) to retrieve arbitrary files from the affected system in the context of the application or by constructing a crafted URI and enticing a user to follow it and when an unsuspecting victim follows the link, they may be redirected to an attacker-controlled site. are all HMI software used by Siemens in Germany to control and monitor machines and equipment", "sources": [ { "db": "NVD", "id": "CVE-2018-13812" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "BID", "id": "105922" }, { "db": "VULHUB", "id": "VHN-123909" } ], "trust": 1.98 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-13812", "trust": 2.8 }, { "db": "BID", "id": "105922", "trust": 2.0 }, { "db": "SIEMENS", "id": "SSA-233109", "trust": 1.7 }, { "db": "ICS CERT", "id": "ICSA-18-317-08", "trust": 1.7 }, { "db": "JVNDB", "id": "JVNDB-2018-014525", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201811-482", "trust": 0.7 }, { "db": "VULHUB", "id": "VHN-123909", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-123909" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "CNNVD", "id": "CNNVD-201811-482" }, { "db": "NVD", "id": "CVE-2018-13812" } ] }, "id": "VAR-201812-0343", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-123909" } ], "trust": 0.7819701471428571 }, "last_update_date": "2024-08-14T15:12:58.695000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-233109", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-233109.pdf" }, { "title": "Multiple Siemens Product path traversal vulnerability fixes", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=86883" } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "CNNVD", "id": "CNNVD-201811-482" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-22", "trust": 1.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-123909" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "NVD", "id": "CVE-2018-13812" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 1.7, "url": "http://www.securityfocus.com/bid/105922" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-233109.pdf" }, { "trust": 1.7, "url": "https://ics-cert.us-cert.gov/advisories/icsa-18-317-08" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-13812" }, { "trust": 0.8, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-13812" }, { "trust": 0.3, "url": "http://subscriber.communications.siemens.com/" } ], "sources": [ { "db": "VULHUB", "id": "VHN-123909" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "CNNVD", "id": "CNNVD-201811-482" }, { "db": "NVD", "id": "CVE-2018-13812" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-123909" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "db": "CNNVD", "id": "CNNVD-201811-482" }, { "db": "NVD", "id": "CVE-2018-13812" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-12-13T00:00:00", "db": "VULHUB", "id": "VHN-123909" }, { "date": "2018-11-14T00:00:00", "db": "BID", "id": "105922" }, { "date": "2019-03-26T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "date": "2018-11-15T00:00:00", "db": "CNNVD", "id": "CNNVD-201811-482" }, { "date": "2018-12-13T16:29:00.290000", "db": "NVD", "id": "CVE-2018-13812" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-10-09T00:00:00", "db": "VULHUB", "id": "VHN-123909" }, { "date": "2018-11-14T00:00:00", "db": "BID", "id": "105922" }, { "date": "2019-03-26T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-014525" }, { "date": "2019-10-17T00:00:00", "db": "CNNVD", "id": "CNNVD-201811-482" }, { "date": "2019-10-09T23:34:33.327000", "db": "NVD", "id": "CVE-2018-13812" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201811-482" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "plural SIMATIC Path traversal vulnerability in products", "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-014525" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "path traversal", "sources": [ { "db": "CNNVD", "id": "CNNVD-201811-482" } ], "trust": 0.6 } }
var-201905-0115
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 4" - 22" (All versions < V15.1 Update 1), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions < V15.1 Update 1), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F (All versions < V15.1 Update 1), SIMATIC WinCC Runtime Advanced (All versions < V15.1 Update 1), SIMATIC WinCC Runtime Professional (All versions < V15.1 Update 1), SIMATIC WinCC (TIA Portal) (All versions < V15.1 Update 1), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The integrated web server could allow Cross-Site Scripting (XSS) attacks if an attacker is able to modify particular parts of the device configuration via SNMP. The security vulnerability could be exploited by an attacker with network access to the affected system. Successful exploitation requires system privileges and user interaction. An attacker could use the vulnerability to compromise confidentiality and the integrity of the affected system. At the stage of publishing this security advisory no public exploitation is known. plural SIMATIC The product contains a cross-site scripting vulnerability.Information may be obtained and information may be altered. Multiple Siemens Products are prone to following security vulnerabilities: 1. An information-disclosure vulnerability 2. A cross-site-scripting vulnerability 3. A security vulnerability An attacker may leverage these issues to obtain potentially sensitive information and to execute arbitrary script code in the browser of an unsuspecting user in the context of the affected site. This may allow the attacker to steal cookie-based authentication credentials and to launch other attacks. Siemens SIMATIC WinCC, etc. are all products of Siemens (Siemens) in Germany. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. Siemens SIMATIC HMI Comfort Panels is a touch panel device. Siemens SIMATIC HMI Comfort Outdoor Panels is a touch panel device specially designed for outdoor use. The vulnerability stems from the lack of correct validation of client data in WEB applications
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201905-0115", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic wincc \\", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi mp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic wincc runtime", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi op", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi tp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15.1" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi classic devices", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime professional update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v15.11" }, { "model": "simatic wincc runtime advanced update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic wincc update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v15.11" }, { "model": "simatic hmi ktp mobile update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic hmi comfort panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic hmi comfort outdoor panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" } ], "sources": [ { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "NVD", "id": "CVE-2019-6577" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp400f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:wincc_runtime_advanced", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_runtime_professional", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004634" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens ProductCERT reported these vulnerabilities to NCCIC.,Siemens ProductCERT", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-588" } ], "trust": 0.6 }, "cve": "CVE-2019-6577", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "SINGLE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 3.5, "confidentialityImpact": "NONE", "exploitabilityScore": 6.8, "id": "CVE-2019-6577", "impactScore": 2.9, "integrityImpact": "PARTIAL", "severity": "LOW", "trust": 1.8, "vectorString": "AV:N/AC:M/Au:S/C:N/I:P/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "SINGLE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 3.5, "confidentialityImpact": "NONE", "exploitabilityScore": 6.8, "id": "VHN-158012", "impactScore": 2.9, "integrityImpact": "PARTIAL", "severity": "LOW", "trust": 0.1, "vectorString": "AV:N/AC:M/AU:S/C:N/I:P/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.4, "baseSeverity": "MEDIUM", "confidentialityImpact": "LOW", "exploitabilityScore": 2.3, "id": "CVE-2019-6577", "impactScore": 2.7, "integrityImpact": "LOW", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.8, "userInteraction": "REQUIRED", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:L/UI:R/S:C/C:L/I:L/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2019-6577", "trust": 1.0, "value": "MEDIUM" }, { "author": "NVD", "id": "CVE-2019-6577", "trust": 0.8, "value": "Medium" }, { "author": "CNNVD", "id": "CNNVD-201905-588", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-158012", "trust": 0.1, "value": "LOW" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-158012" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "CNNVD", "id": "CNNVD-201905-588" }, { "db": "NVD", "id": "CVE-2019-6577" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 4\" - 22\" (All versions \u003c V15.1 Update 1), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions \u003c V15.1 Update 1), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F (All versions \u003c V15.1 Update 1), SIMATIC WinCC Runtime Advanced (All versions \u003c V15.1 Update 1), SIMATIC WinCC Runtime Professional (All versions \u003c V15.1 Update 1), SIMATIC WinCC (TIA Portal) (All versions \u003c V15.1 Update 1), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The integrated web server could allow Cross-Site Scripting (XSS) attacks if an attacker is able to modify particular parts of the device configuration via SNMP. The security vulnerability could be exploited by an attacker with network access to the affected system. Successful exploitation requires system privileges and user interaction. An attacker could use the vulnerability to compromise confidentiality and the integrity of the affected system. At the stage of publishing this security advisory no public exploitation is known. plural SIMATIC The product contains a cross-site scripting vulnerability.Information may be obtained and information may be altered. Multiple Siemens Products are prone to following security vulnerabilities:\n1. An information-disclosure vulnerability\n2. A cross-site-scripting vulnerability\n3. A security vulnerability\nAn attacker may leverage these issues to obtain potentially sensitive information and to execute arbitrary script code in the browser of an unsuspecting user in the context of the affected site. This may allow the attacker to steal cookie-based authentication credentials and to launch other attacks. Siemens SIMATIC WinCC, etc. are all products of Siemens (Siemens) in Germany. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. Siemens SIMATIC HMI Comfort Panels is a touch panel device. Siemens SIMATIC HMI Comfort Outdoor Panels is a touch panel device specially designed for outdoor use. The vulnerability stems from the lack of correct validation of client data in WEB applications", "sources": [ { "db": "NVD", "id": "CVE-2019-6577" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "BID", "id": "108412" }, { "db": "VULHUB", "id": "VHN-158012" } ], "trust": 1.98 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2019-6577", "trust": 2.8 }, { "db": "ICS CERT", "id": "ICSA-19-134-09", "trust": 2.8 }, { "db": "BID", "id": "108412", "trust": 2.0 }, { "db": "SIEMENS", "id": "SSA-804486", "trust": 1.7 }, { "db": "JVNDB", "id": "JVNDB-2019-004634", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201905-588", "trust": 0.7 }, { "db": "ICS CERT", "id": "ICSA-19-134-02", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1716.2", "trust": 0.6 }, { "db": "CNVD", "id": "CNVD-2021-54365", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-158012", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158012" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "CNNVD", "id": "CNNVD-201905-588" }, { "db": "NVD", "id": "CVE-2019-6577" } ] }, "id": "VAR-201905-0115", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-158012" } ], "trust": 0.753329633 }, "last_update_date": "2024-08-14T13:26:21.741000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-804486", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-804486.pdf" }, { "title": "Siemens SIMATIC Panels and WinCC Fixes for cross-site scripting vulnerabilities", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=92738" } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "CNNVD", "id": "CNNVD-201905-588" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-79", "trust": 1.9 }, { "problemtype": "CWE-80", "trust": 1.0 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158012" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "NVD", "id": "CVE-2019-6577" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.3, "url": "http://www.securityfocus.com/bid/108412" }, { "trust": 1.9, "url": "https://www.us-cert.gov/ics/advisories/icsa-19-134-09" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-804486.pdf" }, { "trust": 1.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-6577" }, { "trust": 0.9, "url": "http://subscriber.communications.siemens.com/" }, { "trust": 0.9, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-134-09" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-6577" }, { "trust": 0.6, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-134-02-0" }, { "trust": 0.6, "url": "https://vigilance.fr/vulnerability/simatic-wincc-multiple-vulnerabilities-29288" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/80946" } ], "sources": [ { "db": "VULHUB", "id": "VHN-158012" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "CNNVD", "id": "CNNVD-201905-588" }, { "db": "NVD", "id": "CVE-2019-6577" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-158012" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "db": "CNNVD", "id": "CNNVD-201905-588" }, { "db": "NVD", "id": "CVE-2019-6577" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-14T00:00:00", "db": "VULHUB", "id": "VHN-158012" }, { "date": "2019-05-14T00:00:00", "db": "BID", "id": "108412" }, { "date": "2019-06-05T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "date": "2019-05-14T00:00:00", "db": "CNNVD", "id": "CNNVD-201905-588" }, { "date": "2019-05-14T20:29:04.623000", "db": "NVD", "id": "CVE-2019-6577" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-22T00:00:00", "db": "VULHUB", "id": "VHN-158012" }, { "date": "2019-05-14T00:00:00", "db": "BID", "id": "108412" }, { "date": "2019-07-09T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-004634" }, { "date": "2019-05-23T00:00:00", "db": "CNNVD", "id": "CNNVD-201905-588" }, { "date": "2019-05-22T16:29:01.823000", "db": "NVD", "id": "CVE-2019-6577" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-588" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "plural SIMATIC Product cross-site scripting vulnerability", "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004634" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "XSS", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-588" } ], "trust": 0.6 } }
var-201801-1711
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis of the data cache. Two vulnerabilities are identified, known as "Variant 3a" and "Variant 4". CPUhardware is a set of firmware that runs in the CPU (Central Processing Unit) for managing and controlling the CPU. The Spectre vulnerability exists in the CPU processor core. Because Intel does not separate low-privileged applications from accessing kernel memory, an attacker can use a malicious application to obtain private data that should be quarantined. Attackers can exploit this issue to obtain sensitive information that may aid in further attacks. Intel and ARM CPU chips have an information disclosure vulnerability, which originates from a flaw in the processor data boundary mechanism. The following products and versions are affected: ARM Cortex-A75; Intel Xeon E5-1650 v3, v2, v4; Xeon E3-1265l v2, v3, v4; Xeon E3-1245 v2, v3, v5, v6; Xeon X7542 wait. X-Scanned-By: MIMEDefang 2.79 on 10.5.11.13 X-Greylist: Sender IP whitelisted, not delayed by milter-greylist-4.5.16 (mx1.redhat.com [10.5.110.27]); Thu, 04 Jan 2018 01:01:25 +0000 (UTC)
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1
===================================================================== Red Hat Security Advisory
Synopsis: Important: kernel security update Advisory ID: RHSA-2018:0007-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:0007 Issue date: 2018-01-03 =====================================================================
- Summary:
An update for kernel is now available for Red Hat Enterprise Linux 7.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux Client (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Client Optional (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64 Red Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64 Red Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64 Red Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Workstation Optional (v. 7) - x86_64
Security Fix(es):
An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of instructions (a commonly used performance optimization). There are three primary variants of the issue which differ in the way the speculative execution can be exploited.
Note: This issue is present in hardware and cannot be fully fixed via software update. The updated kernel packages provide software mitigation for this hardware issue at a cost of potential performance penalty.
Variant CVE-2017-5753 triggers the speculative execution by performing a bounds-check bypass. It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory accesses may cause allocation into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to cross the syscall boundary and read privileged memory by conducting targeted cache side-channel attacks. (CVE-2017-5753, Important)
Variant CVE-2017-5715 triggers the speculative execution by utilizing branch target injection. It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory accesses may cause allocation into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to cross the syscall and guest/host boundaries and read privileged memory by conducting targeted cache side-channel attacks. (CVE-2017-5715, Important)
Variant CVE-2017-5754 relies on the fact that, on impacted microprocessors, during speculative execution of instruction permission faults, exception generation triggered by a faulting access is suppressed until the retirement of the whole instruction block. In a combination with the fact that memory accesses may populate the cache even when the block is being dropped and never committed (executed), an unprivileged local attacker could use this flaw to read privileged (kernel space) memory by conducting targeted cache side-channel attacks. (CVE-2017-5754, Important)
Note: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64 microprocessors are not affected by this issue.
Red Hat would like to thank Google Project Zero for reporting these issues.
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
The system must be rebooted for this update to take effect.
- Bugs fixed (https://bugzilla.redhat.com/):
1519778 - CVE-2017-5753 hw: cpu: speculative execution bounds-check bypass 1519780 - CVE-2017-5715 hw: cpu: speculative execution branch target injection 1519781 - CVE-2017-5754 hw: cpu: speculative execution permission faults handling
- Package List:
Red Hat Enterprise Linux Client (v. 7):
Source: kernel-3.10.0-693.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm kernel-doc-3.10.0-693.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-headers-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm perf-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Client Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode (v. 7):
Source: kernel-3.10.0-693.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm kernel-doc-3.10.0-693.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-headers-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm perf-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Server (v. 7):
Source: kernel-3.10.0-693.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm kernel-doc-3.10.0-693.11.6.el7.noarch.rpm
ppc64: kernel-3.10.0-693.11.6.el7.ppc64.rpm kernel-bootwrapper-3.10.0-693.11.6.el7.ppc64.rpm kernel-debug-3.10.0-693.11.6.el7.ppc64.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm kernel-debug-devel-3.10.0-693.11.6.el7.ppc64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-693.11.6.el7.ppc64.rpm kernel-devel-3.10.0-693.11.6.el7.ppc64.rpm kernel-headers-3.10.0-693.11.6.el7.ppc64.rpm kernel-tools-3.10.0-693.11.6.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm kernel-tools-libs-3.10.0-693.11.6.el7.ppc64.rpm perf-3.10.0-693.11.6.el7.ppc64.rpm perf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm python-perf-3.10.0-693.11.6.el7.ppc64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm
ppc64le: kernel-3.10.0-693.11.6.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debug-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-693.11.6.el7.ppc64le.rpm kernel-devel-3.10.0-693.11.6.el7.ppc64le.rpm kernel-headers-3.10.0-693.11.6.el7.ppc64le.rpm kernel-tools-3.10.0-693.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm kernel-tools-libs-3.10.0-693.11.6.el7.ppc64le.rpm perf-3.10.0-693.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm python-perf-3.10.0-693.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm
s390x: kernel-3.10.0-693.11.6.el7.s390x.rpm kernel-debug-3.10.0-693.11.6.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.s390x.rpm kernel-debug-devel-3.10.0-693.11.6.el7.s390x.rpm kernel-debuginfo-3.10.0-693.11.6.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-693.11.6.el7.s390x.rpm kernel-devel-3.10.0-693.11.6.el7.s390x.rpm kernel-headers-3.10.0-693.11.6.el7.s390x.rpm kernel-kdump-3.10.0-693.11.6.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-693.11.6.el7.s390x.rpm kernel-kdump-devel-3.10.0-693.11.6.el7.s390x.rpm perf-3.10.0-693.11.6.el7.s390x.rpm perf-debuginfo-3.10.0-693.11.6.el7.s390x.rpm python-perf-3.10.0-693.11.6.el7.s390x.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.s390x.rpm
x86_64: kernel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-headers-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm perf-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Server Optional (v. 7):
ppc64: kernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-693.11.6.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm kernel-tools-libs-devel-3.10.0-693.11.6.el7.ppc64.rpm perf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debug-devel-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-693.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-693.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm
x86_64: kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Workstation (v. 7):
Source: kernel-3.10.0-693.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm kernel-doc-3.10.0-693.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-devel-3.10.0-693.11.6.el7.x86_64.rpm kernel-headers-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm perf-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Workstation Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iD8DBQFaTXxVXlSAg2UNWIIRAnGZAKCCDXCEpNliyl378yhPHJ11vj74bwCdFc9+ 0mPrmOPm1+0ayOnwPiH6wmA= =fBN+ -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . 6.6) - noarch, x86_64
- -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
Note: the current version of the following document is available here: https://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us
SUPPORT COMMUNICATION - SECURITY BULLETIN
Document ID: hpesbhf03805en_us Version: 4
HPESBHF03805 rev.4 - Certain HPE products using Microprocessors from Intel, AMD, and ARM, with Speculative Execution, Elevation of Privilege and Information Disclosure.
NOTICE: The information in this Security Bulletin should be acted upon as soon as possible.
Release Date: 2018-01-10 Last Updated: 2018-01-09
Potential Security Impact: Local: Disclosure of Information, Elevation of Privilege
Source: Hewlett Packard Enterprise, Product Security Response Team
VULNERABILITY SUMMARY On January 3 2018, side-channel security vulnerabilities involving speculative execution were publicly disclosed. These vulnerabilities may impact the listed HPE products, potentially leading to information disclosure and elevation of privilege. Mitigation and resolution of these vulnerabilities may call for both an operating system update, provided by the OS vendor, and a system ROM update from HPE.
Note:
- This issue takes advantage of techniques commonly used in many modern processor architectures.
-
For further information, microprocessor vendors have provided security advisories:
References:
- PSRT110634
- PSRT110633
- PSRT110632
- CVE-2017-5715 - aka Spectre, branch target injection
- CVE-2017-5753 - aka Spectre, bounds check bypass
- CVE-2017-5754 - aka Meltdown, rogue data cache load, memory access permission check performed after kernel memory read
SUPPORTED SOFTWARE VERSIONS*: ONLY impacted versions are listed.
- HPE ProLiant DL380 Gen10 Server prior to v1.28
- HPE ProLiant DL180 Gen10 Server prior to v1.28
- HPE ProLiant DL160 Gen10 Server prior to v1.28
- HPE ProLiant DL360 Gen10 Server prior to v1.28
- HPE ProLiant ML110 Gen10 Server prior to v1.28
- HPE ProLiant DL580 Gen10 Server prior to v1.28
- HPE ProLiant DL560 Gen10 Server prior to v1.28
- HPE ProLiant DL120 Gen10 Server prior to v1.28
- HPE ProLiant ML350 Gen10 Server prior to v1.28
- HPE ProLiant XL450 Gen10 Server prior to v1.28
- HPE ProLiant XL170r Gen10 Server prior to v1.28
- HPE ProLiant BL460c Gen10 Server Blade prior to v1.28
- HPE ProLiant XL230a Gen9 Server prior to v2.54
- HPE ProLiant XL230k Gen10 Server prior to v1.28
- HPE ProLiant XL730f Gen9 Server prior to v2.54
- HPE ProLiant XL740f Gen9 Server prior to v2.54
- HPE ProLiant XL750f Gen9 Server prior to v2.54
- HPE ProLiant XL170r Gen9 Server prior to v2.54
- HP ProLiant DL60 Gen9 Server prior to v2.54
- HPE ProLiant XL450 Gen9 Server prior to v2.54
- HP ProLiant DL160 Gen9 Server prior to v2.54
- HPE Apollo 4200 Gen9 Server prior to v2.54
- HP ProLiant BL460c Gen9 Server Blade prior to v2.54
- HP ProLiant ML110 Gen9 Server prior to v2.54
- HP ProLiant ML150 Gen9 Server prior to v2.54
- HPE ProLiant ML350 Gen9 Server prior to v2.54
- HP ProLiant DL380 Gen9 Server prior to v2.54
- HP ProLiant DL120 Gen9 Server prior to v2.54
- HPE ProLiant DL560 Gen9 Server prior to v2.54
- HPE ProLiant XL270d Gen9 Special Server prior to v2.54
- HP ProLiant BL660c Gen9 Server prior to v2.54
- HPE ProLiant m710x Server Cartridge prior to v1.60
- HPE ProLiant DL20 Gen9 Server prior to v2.52
- HPE ProLiant DL385 Gen10 Server prior to v1.04
- HPE Synergy 660 Gen9 Compute Module prior to v2.54
- HPE Synergy 480 Gen10 Compute Module prior to v1.28
- HPE Synergy 480 Gen9 Compute Module prior to v2.54
- HPE ProLiant ML30 Gen9 Server prior to v2.52
- HPE ProLiant XL190r Gen10 Server prior to v1.28
- HPE ProLiant XL250a Gen9 Server prior to v2.54
- HPE ProLiant XL190r Gen9 Server prior to v2.54
- HP ProLiant DL80 Gen9 Server prior to v2.54
- HPE ProLiant DL180 Gen9 Server prior to v2.54
- HPE ProLiant XL270d Gen9 Accelerator Tray 2U Configure-to-order Server prior to v2.54
- HPE ProLiant WS460c Gen9 Workstation prior to v2.54
- HPE ProLiant DL580 Gen9 Special Server prior to v2.54
- HPE Synergy 680 Gen9 Compute Modules prior to v2.54
- HPE ProLiant XL260a Gen9 Server prior to 1/22/2018
- HPE ProLiant m510 Server Cartridge prior to 1/22/2018
- HPE ProLiant m710p Server Cartridge prior to 12/12/2017
- HP ProLiant m350 Server Cartridge prior to 12/12/2017
- HP ProLiant m300 Server Cartridge prior to 12/12/2017
- HP ProLiant ML350e Gen8 Server prior to 12/12/2017
- HPE ProLiant ML350e Gen8 v2 Server prior to 12/12/2017
- HP ProLiant BL460c Gen8 Server prior to 12/12/2017
- HP ProLiant BL660c Gen8 Server prior to 12/12/2017
- HPE ProLiant SL4540 Gen8 1 Node Server prior to 12/12/2017
- HP ProLiant DL380e Gen8 Server prior to 12/12/2017
- HP ProLiant DL360e Gen8 Server prior to 12/12/2017
- HP ProLiant ML350p Gen8 Server prior to 12/12/2017
- HP ProLiant DL360p Gen8 Server prior to 12/12/2017
- HP ProLiant DL380p Gen8 Server prior to 12/12/2017
- HP ProLiant DL320e Gen8 Server prior to 12/12/2017
- HPE ProLiant DL320e Gen8 v2 Server prior to 12/12/2017
- HP ProLiant ML310e Gen8 Server prior to 12/12/2017
- HPE ProLiant ML310e Gen8 v2 Server prior to 12/12/2017
- HP ProLiant DL160 Gen8 Server prior to 12/12/2017
- HP ProLiant SL270s Gen8 Server prior to 12/12/2017
- HP ProLiant SL250s Gen8 Server prior to 12/12/2017
- HP ProLiant SL230s Gen8 Server prior to 12/12/2017
- HP ProLiant DL560 Gen8 Server prior to 12/12/2017
- HPE ProLiant SL210t Gen8 Server prior to 12/12/2017
- HP ProLiant DL580 Gen8 Server prior to 12/12/2017 (v1.98)
- HP ProLiant ML10 Server prior to 12/12/2017
- HP ProLiant m710 Server Cartridge prior to 12/12/2017 (v1.60)
- HPE Synergy Composer prior to 12/12/2017
- HPE Integrity Superdome X with BL920s Blades prior to 8.8.6
- HPE Superdome Flex Server prior to 2.3.110
- HP ProLiant DL360 Gen9 Server prior to v2.54
- HPE Synergy 620 Gen9 Compute Module prior to v2.54
- HPE ProLiant Thin Micro TM200 Server prior to 1/16/2017
- HPE ProLiant ML350 Gen10 Server prior to v1.28
- HP ProLiant BL420c Gen8 Server prior to 12/12/2017
- HPE ProLiant ML10 v2 Server prior to 12/12/2017
- HPE ProLiant MicroServer Gen8 prior to 12/12/2017
- HPE Synergy 660 Gen10 Compute Module prior to v1.28
BACKGROUND
CVSS Base Metrics ================= Reference, CVSS V3 Score/Vector, CVSS V2 Score/Vector
CVE-2017-5715
8.2 CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:C/C:H/I:L/A:N
6.8 (AV:A/AC:L/Au:N/C:C/I:P/A:N)
CVE-2017-5753
5.0 CVSS:3.0/AV:A/AC:H/PR:L/UI:R/S:C/C:L/I:L/A:L
5.4 (AV:A/AC:M/Au:N/C:P/I:P/A:P)
CVE-2017-5754
7.5 CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N
7.8 (AV:N/AC:L/Au:N/C:C/I:N/A:N)
Information on CVSS is documented in
HPE Customer Notice HPSN-2008-002 here:
https://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-c01345499
RESOLUTION
HPE has made the following system ROM updates which include an updated microcode to resolve the vulnerability:
-
HPE has provided a customer bulletin https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-a00039267en_us with specific instructions to obtain the udpated sytem ROM
-
Note:
- CVE-2017-5715 requires that the System ROM be updated and a vendor supplied operating system update be applied as well.
- For CVE-2017-5753, CVE-2017-5754 require only updates of a vendor supplied operating system.
- HPE will continue to add additional products to the list. Not all listed products have updated system ROMs yet. Impacted products awaiting system ROM updates are marked TBS (to be supplied).
HISTORY
Version:1 (rev.1) - 4 January 2018 Initial release
Version:2 (rev.2) - 5 January 2018 Added additional impacted products
Version:3 (rev.3) - 10 January 2018 Added more impacted products
Version:4 (rev.4) - 9 January 2018 Fixed product ID
Third Party Security Patches: Third party security patches that are to be installed on systems running Hewlett Packard Enterprise (HPE) software products should be applied in accordance with the customer's patch management policy.
Support: For issues about implementing the recommendations of this Security Bulletin, contact normal HPE Services support channel. For other issues about the content of this Security Bulletin, send e-mail to security-alert@hpe.com.
Report: To report a potential security vulnerability for any HPE supported product: Web form: https://www.hpe.com/info/report-security-vulnerability Email: security-alert@hpe.com
Subscribe: To initiate a subscription to receive future HPE Security Bulletin alerts via Email: http://www.hpe.com/support/Subscriber_Choice
Security Bulletin Archive: A list of recently released Security Bulletins is available here: http://www.hpe.com/support/Security_Bulletin_Archive
Software Product Category: The Software Product Category is represented in the title by the two characters following HPSB.
3C = 3COM 3P = 3rd Party Software GN = HPE General Software HF = HPE Hardware and Firmware MU = Multi-Platform Software NS = NonStop Servers OV = OpenVMS PV = ProCurve ST = Storage Software UX = HP-UX
Copyright 2016 Hewlett Packard Enterprise
Hewlett Packard Enterprise shall not be liable for technical or editorial errors or omissions contained herein. The information provided is provided "as is" without warranty of any kind. To the extent permitted by law, neither HP or its affiliates, subcontractors or suppliers will be liable for incidental,special or consequential damages including downtime cost; lost profits; damages relating to the procurement of substitute products or services; or damages for loss of data, or software restoration. The information in this document is subject to change without notice. Hewlett Packard Enterprise and the names of Hewlett Packard Enterprise products referenced herein are trademarks of Hewlett Packard Enterprise in the United States and other countries. Other product and company names mentioned herein may be trademarks of their respective owners. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA512
============================================================================= FreeBSD-SA-18:03.speculative_execution Security Advisory The FreeBSD Project
Topic: Speculative Execution Vulnerabilities
Category: core Module: kernel Announced: 2018-03-14 Credits: Jann Horn (Google Project Zero); Werner Haas, Thomas Prescher (Cyberus Technology); Daniel Gruss, Moritz Lipp, Stefan Mangard, Michael Schwarz (Graz University of Technology); Paul Kocher; Daniel Genkin (University of Pennsylvania and University of Maryland), Mike Hamburg (Rambus); Yuval Yarom (University of Adelaide and Data6) Affects: All supported versions of FreeBSD. Corrected: 2018-02-17 18:00:01 UTC (stable/11, 11.1-STABLE) 2018-03-14 04:00:00 UTC (releng/11.1, 11.1-RELEASE-p8) CVE Name: CVE-2017-5715, CVE-2017-5754
Special Note: Speculative execution vulnerability mitigation is a work in progress. This advisory addresses the most significant issues for FreeBSD 11.1 on amd64 CPUs. We expect to update this advisory to include 10.x for amd64 CPUs. Future FreeBSD releases will address this issue on i386 and other CPUs. freebsd-update will include changes on i386 as part of this update due to common code changes shared between amd64 and i386, however it contains no functional changes for i386 (in particular, it does not mitigate the issue on i386).
For general information regarding FreeBSD Security Advisories,
including descriptions of the fields above, security branches, and the
following sections, please visit
II. Problem Description
A number of issues relating to speculative execution were found last year and publicly announced January 3rd. Two of these, known as Meltdown and Spectre V2, are addressed here.
CVE-2017-5754 (Meltdown)
This issue relies on an affected CPU speculatively executing instructions beyond a faulting instruction. When this happens, changes to architectural state are not committed, but observable changes may be left in micro- architectural state (for example, cache). This may be used to infer privileged data.
CVE-2017-5715 (Spectre V2)
Spectre V2 uses branch target injection to speculatively execute kernel code at an address under the control of an attacker.
III. Impact
An attacker may be able to read secret data from the kernel or from a process when executing untrusted code (for example, in a web browser).
IV. Workaround
No workaround is available.
V. Solution
Perform one of the following:
1) Upgrade your vulnerable system to a supported FreeBSD stable or release / security branch (releng) dated after the correction date, and reboot.
2) To update your vulnerable system via a binary patch:
Systems running a RELEASE version of FreeBSD on the i386 or amd64 platforms can be updated via the freebsd-update(8) utility, followed by a reboot into the new kernel:
freebsd-update fetch
freebsd-update install
shutdown -r now
3) To update your vulnerable system via a source code patch:
The following patches have been verified to apply to the applicable FreeBSD release branches.
a) Download the relevant patch from the location below, and verify the detached PGP signature using your PGP utility.
[FreeBSD 11.1]
fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch
fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch.asc
gpg --verify speculative_execution-amd64-11.patch.asc
b) Apply the patch. Execute the following commands as root:
cd /usr/src
patch < /path/to/patch
c) Recompile your kernel as described in
VI. Correction details
CVE-2017-5754 (Meltdown)
The mitigation is known as Page Table Isolation (PTI). PTI largely separates kernel and user mode page tables, so that even during speculative execution most of the kernel's data is unmapped and not accessible. A positive result is definitive (that is, the vulnerability exists with certainty). A negative result indicates either that the CPU is not affected, or that the test is not capable of demonstrating the issue on the CPU (and may need to be modified).
A patched kernel will automatically enable PTI on Intel CPUs. The status can be checked via the vm.pmap.pti sysctl:
sysctl vm.pmap.pti
vm.pmap.pti: 1
The default setting can be overridden by setting the loader tunable vm.pmap.pti to 1 or 0 in /boot/loader.conf. This setting takes effect only at boot.
PTI introduces a performance regression. The observed performance loss is significant in microbenchmarks of system call overhead, but is much smaller for many real workloads.
CVE-2017-5715 (Spectre V2)
There are two common mitigations for Spectre V2. This patch includes a mitigation using Indirect Branch Restricted Speculation, a feature available via a microcode update from processor manufacturers. The alternate mitigation, Retpoline, is a feature available in newer compilers. The feasibility of applying Retpoline to stable branches and/or releases is under investigation.
The patch includes the IBRS mitigation for Spectre V2. To use the mitigation the system must have an updated microcode; with older microcode a patched kernel will function without the mitigation.
IBRS can be disabled via the hw.ibrs_disable sysctl (and tunable), and the status can be checked via the hw.ibrs_active sysctl. IBRS may be enabled or disabled at runtime. Additional detail on microcode updates will follow.
The following list contains the correction revision numbers for each affected branch.
Branch/path Revision
stable/11/ r329462 releng/11.1/ r330908
To see which files were modified by a particular revision, run the following command, replacing NNNNNN with the revision number, on a machine with Subversion installed:
svn diff -cNNNNNN --summarize svn://svn.freebsd.org/base
Or visit the following URL, replacing NNNNNN with the revision number:
VII. 6.7) - i386, ppc64, s390x, x86_64
Security Fix(es):
-
hw: cpu: speculative execution permission faults handling (CVE-2017-5754)
-
Kernel: error in exception handling leads to DoS (CVE-2018-8897)
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section.
Bug Fix(es):
-
The kernel build requirements have been updated to the GNU Compiler Collection (GCC) compiler version that has the support for Retpolines. The Retpolines mechanism is a software construct that leverages specific knowledge of the underlying hardware to mitigate the branch target injection, also known as Spectre variant 2 vulnerability described in CVE-2017-5715. (BZ#1554253)
CVE-2017-5754
Multiple researchers have discovered a vulnerability in Intel
processors, enabling an attacker controlling an unprivileged
process to read memory from arbitrary addresses, including from
the kernel and all other processes running on the system.
This specific attack has been named Meltdown and is addressed in
the Linux kernel for the Intel x86-64 architecture by a patch set
named Kernel Page Table Isolation, enforcing a near complete
separation of the kernel and userspace address maps and preventing
the attack. This solution might have a performance impact, and can
be disabled at boot time by passing `pti=off' to the kernel
command line.
CVE-2017-8824
Mohamed Ghannam discovered that the DCCP implementation did not
correctly manage resources when a socket is disconnected and
reconnected, potentially leading to a use-after-free.
CVE-2017-16538
Andrey Konovalov reported that the dvb-usb-lmedm04 media driver
did not correctly handle some error conditions during
initialisation.
CVE-2017-16939
Mohamed Ghannam reported (through Beyond Security's SecuriTeam
Secure Disclosure program) that the IPsec (xfrm) implementation
did not correctly handle some failure cases when dumping policy
information through netlink.
CVE-2017-17448
Kevin Cernekee discovered that the netfilter subsystem allowed
users with the CAP_NET_ADMIN capability in any user namespace, not
just the root namespace, to enable and disable connection tracking
helpers. This could lead to denial of service, violation of
network security policy, or have other impact.
CVE-2017-17449
Kevin Cernekee discovered that the netlink subsystem allowed
users with the CAP_NET_ADMIN capability in any user namespace
to monitor netlink traffic in all net namespaces, not just
those owned by that user namespace.
CVE-2017-17450
Kevin Cernekee discovered that the xt_osf module allowed users
with the CAP_NET_ADMIN capability in any user namespace to modify
the global OS fingerprint list.
CVE-2017-17558
Andrey Konovalov reported that that USB core did not correctly
handle some error conditions during initialisation.
CVE-2017-17741
Dmitry Vyukov reported that the KVM implementation for x86 would
over-read data from memory when emulating an MMIO write if the
kvm_mmio tracepoint was enabled.
CVE-2017-17805
Dmitry Vyukov reported that the KVM implementation for x86 would
over-read data from memory when emulating an MMIO write if the
kvm_mmio tracepoint was enabled.
CVE-2017-17807
Eric Biggers discovered that the KEYS subsystem lacked a check for
write permission when adding keys to a process's default keyring.
CVE-2017-1000410
Ben Seri reported that the Bluetooth subsystem did not correctly
handle short EFS information elements in L2CAP messages.
For the oldstable distribution (jessie), these problems have been fixed in version 3.16.51-3+deb8u1.
For the detailed security status of linux please refer to its security tracker page at: https://security-tracker.debian.org/tracker/linux
Further information about Debian Security Advisories, how to apply these updates to your system and frequently asked questions can be found at: https://www.debian.org/security/
Mailing list: debian-security-announce@lists.debian.org -----BEGIN PGP SIGNATURE-----
iQKTBAEBCgB9FiEERkRAmAjBceBVMd3uBUy48xNDz0QFAlpU5cRfFIAAAAAALgAo aXNzdWVyLWZwckBub3RhdGlvbnMub3BlbnBncC5maWZ0aGhvcnNlbWFuLm5ldDQ2 NDQ0MDk4MDhDMTcxRTA1NTMxRERFRTA1NENCOEYzMTM0M0NGNDQACgkQBUy48xND z0Qsnw//euNWKwOR4R+JFEyKECrS5GHFzLdj1kpion3oGGZyyJ8VjmVv+MombQPk xk17ge5QWl44CMzXlkE6QREdrXQfed49us9O6CzS2BPwV/QWsoUc7WLmqYD0OQmh c5/RqvkzUfXzEJ7efLzChXAs94RB0A9kOKoRxNrXfdhvevM+FumB17dErIrT2nxP KcX3Tyh05twrJqCnbNIo189LDexKfEyAN9pnwBekknzXB0V3zmvPwebVz85v1I8p aiWSXX9EjWvVeZG31XDOysEcrwO4T71zqCgPxPeurAOVTJNvK0B8je7wFBD9ayoy PFNdykxRUBA9rBJ8Aoi3zcZBJYxTYBzOKDUkPaO/80mflsN6yDCaWwQ+antyuQ8y jO02bAEZiKmpsuclKvK48rfvtoFqXsp6WhO1NoWnmpFvsxXN0DdqKRB60rycrMMA Q2wLYnPX2QNRNdxtkJ0D380VkTdPjJT4yOPM4UuIJ1S7jwzVcQKnu8VswdFey0nq k42DigyVQryZd1elqiyGWWtNkJ9BRscSgkpCAfEUo2XCR61wEXu7aOHGksPuTTZr 2FJGIa4OR1dAc2pPGy7CUWYnloGwSCCq7F85bi6v5KG7YnHlic/XnJva+hT+0lGT 1HQlCKU9bicaLL0GIK9Qt5vaUseZLWiOXMHU6JKvo/y6AL3FHnI= =Ozoc -----END PGP SIGNATURE----- . ========================================================================== Ubuntu Security Notice USN-3583-1 February 23, 2018
linux vulnerabilities
A security issue affects these releases of Ubuntu and its derivatives:
- Ubuntu 14.04 LTS
Summary:
Several security issues were fixed in the Linux kernel.
Software Description: - linux: Linux kernel
Details:
It was discovered that an out-of-bounds write vulnerability existed in the Flash-Friendly File System (f2fs) in the Linux kernel. An attacker could construct a malicious file system that, when mounted, could cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-0750)
It was discovered that a race condition leading to a use-after-free vulnerability existed in the ALSA PCM subsystem of the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-0861)
It was discovered that the KVM implementation in the Linux kernel allowed passthrough of the diagnostic I/O port 0x80. An attacker in a guest VM could use this to cause a denial of service (system crash) in the host OS. (CVE-2017-1000407)
Bo Zhang discovered that the netlink wireless configuration interface in the Linux kernel did not properly validate attributes when handling certain requests. A local attacker with the CAP_NET_ADMIN could use this to cause a denial of service (system crash). (CVE-2017-12153)
Vitaly Mayatskikh discovered that the SCSI subsystem in the Linux kernel did not properly track reference counts when merging buffers. A local attacker could use this to cause a denial of service (memory exhaustion). (CVE-2017-12190)
It was discovered that the key management subsystem in the Linux kernel did not properly restrict key reads on negatively instantiated keys. A local attacker could use this to cause a denial of service (system crash). (CVE-2017-12192)
It was discovered that an integer overflow existed in the sysfs interface for the QLogic 24xx+ series SCSI driver in the Linux kernel. A local privileged attacker could use this to cause a denial of service (system crash). (CVE-2017-14051)
Otto Ebeling discovered that the memory manager in the Linux kernel did not properly check the effective UID in some situations. (CVE-2017-14140)
It was discovered that the ATI Radeon framebuffer driver in the Linux kernel did not properly initialize a data structure returned to user space. (CVE-2017-14156)
ChunYu Wang discovered that the iSCSI transport implementation in the Linux kernel did not properly validate data structures. A local attacker could use this to cause a denial of service (system crash). (CVE-2017-14489)
James Patrick-Evans discovered a race condition in the LEGO USB Infrared Tower driver in the Linux kernel. A physically proximate attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-15102)
ChunYu Wang discovered that a use-after-free vulnerability existed in the SCTP protocol implementation in the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code, (CVE-2017-15115)
It was discovered that the key management subsystem in the Linux kernel did not properly handle NULL payloads with non-zero length values. A local attacker could use this to cause a denial of service (system crash). (CVE-2017-15274)
It was discovered that the Bluebooth Network Encapsulation Protocol (BNEP) implementation in the Linux kernel did not validate the type of socket passed in the BNEPCONNADD ioctl(). A local attacker with the CAP_NET_ADMIN privilege could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-15868)
Andrey Konovalov discovered a use-after-free vulnerability in the USB serial console driver in the Linux kernel. A physically proximate attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-16525)
It was discovered that the netfilter passive OS fingerprinting (xt_osf) module did not properly perform access control checks. A local attacker could improperly modify the systemwide OS fingerprint list. (CVE-2017-17450)
It was discovered that the HMAC implementation did not validate the state of the underlying cryptographic hash algorithm. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-17806)
Denys Fedoryshchenko discovered a use-after-free vulnerability in the netfilter xt_TCPMSS filter of the Linux kernel. A remote attacker could use this to cause a denial of service (system crash). (CVE-2017-18017)
Gareth Evans discovered that the shm IPC subsystem in the Linux kernel did not properly restrict mapping page zero. A local privileged attacker could use this to execute arbitrary code. (CVE-2017-5669)
It was discovered that an integer overflow vulnerability existing in the IPv6 implementation in the Linux kernel. A local attacker could use this to cause a denial of service (infinite loop). (CVE-2017-7542)
Tommi Rantala and Brad Spengler discovered that the memory manager in the Linux kernel did not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism. A local attacker with access to /dev/mem could use this to expose sensitive information or possibly execute arbitrary code. (CVE-2017-7889)
Mohamed Ghannam discovered a use-after-free vulnerability in the DCCP protocol implementation in the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-8824)
Mohamed Ghannam discovered a null pointer dereference in the RDS (Reliable Datagram Sockets) protocol implementation of the Linux kernel. A local attacker could use this to cause a denial of service (system crash). (CVE-2018-5333)
ee3/4ePS discovered that a race condition existed in loop block device implementation in the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2018-5344)
USN-3524-1 mitigated CVE-2017-5754 (Meltdown) for the amd64 architecture in Ubuntu 14.04 LTS. This update provides the corresponding mitigations for the ppc64el architecture. This flaw is known as Meltdown. (CVE-2017-5754)
Update instructions:
The problem can be corrected by updating your system to the following package versions:
Ubuntu 14.04 LTS: linux-image-3.13.0-142-generic 3.13.0-142.191 linux-image-3.13.0-142-generic-lpae 3.13.0-142.191 linux-image-3.13.0-142-lowlatency 3.13.0-142.191 linux-image-3.13.0-142-powerpc-e500 3.13.0-142.191 linux-image-3.13.0-142-powerpc-e500mc 3.13.0-142.191 linux-image-3.13.0-142-powerpc-smp 3.13.0-142.191 linux-image-3.13.0-142-powerpc64-emb 3.13.0-142.191 linux-image-3.13.0-142-powerpc64-smp 3.13.0-142.191 linux-image-generic 3.13.0.142.152 linux-image-generic-lpae 3.13.0.142.152 linux-image-lowlatency 3.13.0.142.152 linux-image-powerpc-e500 3.13.0.142.152 linux-image-powerpc-e500mc 3.13.0.142.152 linux-image-powerpc-smp 3.13.0.142.152 linux-image-powerpc64-emb 3.13.0.142.152 linux-image-powerpc64-smp 3.13.0.142.152
After a standard system update you need to reboot your computer to make all the necessary changes.
ATTENTION: Due to an unavoidable ABI change the kernel updates have been given a new version number, which requires you to recompile and reinstall all third party kernel modules you might have installed. Unless you manually uninstalled the standard kernel metapackages (e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual, linux-powerpc), a standard system upgrade will automatically perform this as well.
References: https://usn.ubuntu.com/usn/usn-3583-1 CVE-2017-0750, CVE-2017-0861, CVE-2017-1000407, CVE-2017-12153, CVE-2017-12190, CVE-2017-12192, CVE-2017-14051, CVE-2017-14140, CVE-2017-14156, CVE-2017-14489, CVE-2017-15102, CVE-2017-15115, CVE-2017-15274, CVE-2017-15868, CVE-2017-16525, CVE-2017-17450, CVE-2017-17806, CVE-2017-18017, CVE-2017-5669, CVE-2017-5754, CVE-2017-7542, CVE-2017-7889, CVE-2017-8824, CVE-2018-5333, CVE-2018-5344
Package Information: https://launchpad.net/ubuntu/+source/linux/3.13.0-142.191
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201801-1711", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "550" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2516" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100e" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2900" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3405" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2620m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610me" }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4158u" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3245" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5618" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6146" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400" }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4720hq" }, { "model": "xeon e3 1125c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2558" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3680" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2550" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4308u" }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y75" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7295" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610y" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6287u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "840qm" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350h" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2520m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5649" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030y" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5549" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3840qm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6260u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "470um" }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3689y" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1850" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3150" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6006u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2300" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2508" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2629m" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5607" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2467m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2637m" }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620ue" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770t" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3520m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2115c" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7550" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710mq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4765t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2718" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2435m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120me" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3690" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2102" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2807" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5557u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4005u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3820qm" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5287u" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3000" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2655le" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2675qm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240t" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3230m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520m" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3235rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qe" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2348m" }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4910mq" }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y57" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790s" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430um" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1750" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2840" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2715qe" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "990x" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380m" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2810" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5250u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5680" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2125" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3670" }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710hq" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2730" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y31" }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4220y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3227u" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "390m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5630" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2830" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4250u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675c" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "661" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4012y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "530" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850hq" }, { "model": "xeon e3 1275", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712mq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5630" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4422e" }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3115c" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860hq" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7235" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340m" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3010" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7285" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3050" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3338" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300u" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2510e" }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4410e" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y30" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1800" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2410m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5020u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3380m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820qm" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517ue" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y54" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4800mq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700hq" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4760hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130f" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560m" }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3437u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4400e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6150" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2930" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6267u" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440hq" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7520" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2365m" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2430m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4258u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5575r" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702ec" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670k" }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700hq" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3750" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640lm" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "670" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570r" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6200u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980x" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qm" }, { "model": "xeon bronze 3104", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520um" }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4025u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4260u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100te" }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210f" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5518" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3708" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6132" }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3808" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675r" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3537u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "880" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700mq" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3667u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540um" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2760qm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5675" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5667" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4750hq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3558" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6144" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3555le" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690" }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3229y" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2640m" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2537m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500k" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600k" }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "820qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5550u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5645" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4785t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6128" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2338" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148f" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2308" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2630qm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6157u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3225" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2815" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8650u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790k" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2316" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702mq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "450m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7560" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450s" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770r" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "610e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3475s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3630qm" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3350p" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850eq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560um" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5640" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2710qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3632qm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5687" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5119t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5118" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3060" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138f" }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qm" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3265rk" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6685r" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6350hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4550u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5157u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440eq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5660" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "370m" }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300y" }, { "model": "xeon e3 1220", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2550k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2635qm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7555" }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7660u" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4100" }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2340ue" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4510u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2557m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4288u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3439y" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6585r" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5672" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660ue" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5015u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660lm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2375m" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590t" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3710" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2357m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8600k" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220t" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6320" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2540m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "970" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y30" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210h" }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3160" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6098p" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "655k" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500te" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3538" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2758" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3110m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142f" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5528" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860qm" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3230rk" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3510" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3355" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7540" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3200rk" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870hq" }, { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "75" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "480m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680um" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2850" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2105" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4120u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5690" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2820" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5603" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8550u" }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134m" }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940xm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2518" }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5620" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3350" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2610ue" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4558u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y51" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3205rk" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2130" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3360m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5677" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660" }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1900" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330te" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3130" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6402p" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y70" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700eq" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3540" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3740qm" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920xm" }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250" }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570te" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670r" }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "875k" }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100t" }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2806" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2920" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5640" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670qm" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330m" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4578u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3317u" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10a" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2367m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120t" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100u" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3710" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7920hq" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2350" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3540m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3427u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5010u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x6550" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138t" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10c" }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402ec" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6136" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3308" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5609" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5005u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2700k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100h" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "580m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4202y" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620lm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330" }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330um" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2940" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2350m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4810mq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2720qm" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870s" }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4000m" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3687u" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3295rk" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6360u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4722hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700eq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7542" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3337u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qe" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "350m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2390t" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7560u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8250u" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4980hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8100" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4102e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2617m" }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6442eq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700k" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2530" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4960hq" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4900mq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "720qm" }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2657m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2677m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6167u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500t" }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100" }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3635qm" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3700" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6152" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5257u" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112e" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "460m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5200u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770te" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700ec" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7600u" }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "975" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130t" }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620le" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2808" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820eq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4500u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7567u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7545" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4302y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2649m" }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3339y" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3445" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "930" }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770hq" }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5638" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030u" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5509" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2738" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "xeon bronze 3106", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200h" }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2320" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2515e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5750hq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5647" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700hq" }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2358" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3758" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5539" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4771" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450p" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3130m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770t" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hk" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6154" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2920xm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5950hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2960xm" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "960" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2805" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2377m" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712hq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3320m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2538" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y71" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4278u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5650" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4020y" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2312m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7530" }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5650u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "650" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2370m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217ue" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5300u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2405s" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5122" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2750" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "965" }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370t" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y32" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3520" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2328m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775c" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5606" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "740qm" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3508" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5670" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3720qm" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2380p" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2910" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y75" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qe" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6102e" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240" }, { "model": "windows for 32-bit systems sp1", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "7" }, { "model": "windows for x64-based systems sp1", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "7" }, { "model": "edge", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "0" }, { "model": "internet explorer", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "11" }, { "model": "windows for x64-based systems", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "8.10" }, { "model": "windows for 32-bit systems", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "8.10" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "1015110" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.9, "vendor": "microsoft", "version": "1015110" }, { "model": "esxi", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "5.5" }, { "model": "workstation", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "12.5.7" }, { "model": "workstation", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "12.5.5" }, { "model": "workstation", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "12.5.3" }, { "model": "workstation", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "12.0" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.5.8" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.5.6" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.5.4" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.5.2" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.1.1" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.1" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.0.2" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.0.1" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.5.5" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.5" }, { "model": "fusion", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "8.0" }, { "model": "esxi", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "6.5" }, { "model": "esxi", "scope": "eq", "trust": 0.9, "vendor": "vmware", "version": "6.0" }, { "model": null, "scope": null, "trust": 0.8, "vendor": "amd", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "arm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "apple", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "cisco", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell emc", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "fortinet", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hp", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hitachi", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ibm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "microsoft", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "qualcomm incorporated", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "red hat", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "suse linux", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "synology", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ubuntu", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "vmware", "version": null }, { "model": "hat enterprise linux desktop", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "windows server r2", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2008" }, { "model": "hat enterprise linux", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "hat enterprise linux workstation", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "hat enterprise linux server", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "windows windows server", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2012" }, { "model": "windows", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "8.1" }, { "model": null, "scope": "eq", "trust": 0.6, "vendor": "google", "version": "v8" }, { "model": "windows server r2", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2012" }, { "model": "windows server", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2016" }, { "model": "windows for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "10" }, { "model": "windows for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "10" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101511" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101511" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101607" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101607" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101703" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101703" }, { "model": "hat enterprise linux workstation", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7" }, { "model": "hat enterprise linux server", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7" }, { "model": "hat enterprise linux desktop", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7" }, { "model": "tvos", "scope": "lt", "trust": 0.6, "vendor": "apple", "version": "11.2" }, { "model": "ios", "scope": "lt", "trust": 0.6, "vendor": "apple", "version": "11.2" }, { "model": "xeon cpu e5-1650", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "hat enterprise linux server tus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.4" }, { "model": "hat enterprise linux server tus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.2" }, { "model": "hat enterprise linux server tus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6.6" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.4" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.2" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.3" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6.6" }, { "model": "macos", "scope": "lt", "trust": 0.6, "vendor": "apple", "version": "10.13.2" }, { "model": "cloud services platform", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "2100" }, { "model": "vbond orchestrator", "scope": null, "trust": 0.6, "vendor": "cisco", "version": null }, { "model": "vedge cloud", "scope": null, "trust": 0.6, "vendor": "cisco", "version": null }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "5000" }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "2000" }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "100" }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "1000" }, { "model": "enterprise linux server year extended update support", "scope": "eq", "trust": 0.6, "vendor": "redhat", "version": "-47.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1689.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.924.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1049.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.9.110.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375127" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.51" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.117" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.166" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.891.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.15" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.27" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.306.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1012" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1005.0" }, { "model": "enterprise linux", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1039" }, { "model": "enterprise linux server", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.434.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.702.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1311.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.687.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.155" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.365.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.879.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.317.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.926.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.47255" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.39" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.1.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1077.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.366.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "44.0.2403.157" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.530.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.58" }, { "model": "facsmelody", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.122" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.15" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.366.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1036.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1308.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.633.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.769.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.127" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.785.0" }, { "model": "facscanto ii clinical", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.225" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.90" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.11" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.385.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.319.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.908.0" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.366.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.204" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.2.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.219" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.374.0" }, { "model": "pyxis ecostation system", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.23" }, { "model": "facscanto ii", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.40" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1043" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.604.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.150" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.756.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.34" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.886.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.123" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.342" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.51" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.233" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.955.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1082.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.760.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.110" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1658.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.368.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.594.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.118" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.743.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1285.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "62.0.3202.97" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.96365" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "43.0.2357.130" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "63.0.3239.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.83" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.816.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.393.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.362.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.618.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.628.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.815.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.423.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "62.0.3202.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.802.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.323.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.804.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.370.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.203" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.805.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.789.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.32" }, { "model": "totalys slideprep", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "41.0.2272" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.315" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.512.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.109" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.0.5" }, { "model": "simatic ipc427e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.901.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1285.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.729.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.23" }, { "model": "chrome os beta", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.9.130.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.483.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.467.0" }, { "model": "phoenix", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "1000" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.200" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.10" }, { "model": "facslink interface", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.25" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.452.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.9.128.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "40.0.2214.111" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1017" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.727.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.748.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.302.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.379.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.654.0" }, { "model": "phoenix m50", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.32" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.119" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.334.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.110" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.862.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.0" }, { "model": "facsjazz", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.303" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "40.0.2214.91" }, { "model": "enterprise linux server extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-6.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.458.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.95" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.721.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.404.0" }, { "model": "linux ia-64", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "46.0.2490" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.90" }, { "model": "sql server for 32-bit systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "201240" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.335.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1030" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.132" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.336" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.32" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.602.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.211" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.750.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1049.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.104" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1058.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.79" }, { "model": "sql server for x64-based systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "201240" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.415.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.931.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.115" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.722.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.32" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.520.0" }, { "model": "vm virtualbox", "scope": "ne", "trust": 0.3, "vendor": "oracle", "version": "5.1.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1022" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.651.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.109" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.476.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1055.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1670.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.354.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.222.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.690.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.570.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.347.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.13" }, { "model": "vsphere integrated containers", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "1.2" }, { "model": "sinumerik d sl ncu730.3", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "840" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.11" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.344" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.412.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.634.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.329.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1085.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.664.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.26" }, { "model": "sinumerik d sl ncu730.3b", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "840" }, { "model": "lsr ii", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.83" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.596.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.69" }, { "model": "unified computing system", "scope": "eq", "trust": 0.3, "vendor": "cisco", "version": "3.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.730.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1060.0" }, { "model": "pyxis supply roller", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.40" }, { "model": "facscount", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.610.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.422.0" }, { "model": "windows server", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20160" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.299.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.31" }, { "model": "linux amd64", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1036.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.371.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.56" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1668.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.107" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.615.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.599.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.99" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.452.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.102" }, { "model": "enterprise mrg", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.12" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.2.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.92" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.6" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1675.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.50" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.873.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.301.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.116" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.2.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.366.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.794.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.42" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.781.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "53.0.2785.143" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1298.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.157.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.134" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.554.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.775.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.631.0" }, { "model": "communications lsms", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "13.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.125" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.477.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.941.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.335.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.516.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.430.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1684.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.457.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1289.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1008.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.943.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.609.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364160" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.211.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.582.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.589.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.575.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1671.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1663.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.356.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1280.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.21" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.122" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.726.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.667.3" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1034.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "60.0.3112.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.32" }, { "model": "rowa dose", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.716.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.480.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.45" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.700.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.28" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.154" }, { "model": "xen", "scope": "eq", "trust": 0.3, "vendor": "xen", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1684.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1652.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.627.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.826.0" }, { "model": "identity manager", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "2.7" }, { "model": "chrome ~~~andr", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "40.0.2214.89" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.581.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.544.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.130" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1041" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.336.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.10" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.11" }, { "model": "simatic s7-1518-4 pn/dp odk", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "52.0.2743.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "53.0.2785.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1295.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.922.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.638.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1049.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.219" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "41.0.2272.118" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.910.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.149" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1686.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.90" }, { "model": "simatic ipc427d", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.671.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.366.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1055.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.424.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.898.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.478.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.107" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.465.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.540.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.57" }, { "model": "vsphere integrated containers", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "1.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.46" }, { "model": "sql server for 32-bit systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20123" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1004.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.136" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.935.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.821.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.212.1" }, { "model": "max", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.492.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.923.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "42.0.2311" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.547.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.536.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.948.0" }, { "model": "sql server for x64-based systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20123" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.74" }, { "model": "enterprise linux for ibm z systems extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.114" }, { "model": "pyxis duostation", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1024.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.784.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.2.149.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.16" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.15" }, { "model": "windows server for 32-bit systems sp2", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "2008" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "46.0.2490.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1017.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.683.0" }, { "model": "kernel", "scope": "eq", "trust": 0.3, "vendor": "linux", "version": "4.9.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.425.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.486.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.747.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.450.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.4" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.333" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.775.2" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "1017090" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.99" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1077.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1300.0" }, { "model": "linux s/390", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.32" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.889.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1028" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.133" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.773.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.26" }, { "model": "vios", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "2.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.157" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.739.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.4" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.19" }, { "model": "influx", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.404.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.2491059" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.159.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1028.0" }, { "model": "chrome os", "scope": "ne", "trust": 0.3, "vendor": "google", "version": "65.0.3325.167" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1013" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.658.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.159" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1023" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.761.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.369.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.690.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.16" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.24" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.660.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "57.0.2987.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.511.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1676.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.108" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.137" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1669.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.587.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.437.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.16" }, { "model": "enterprise linux server", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.321.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "39.0.2171.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.48" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.861.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.524.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.717.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.9" }, { "model": "sql server r2 for x64-based systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "200830" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.880.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.607.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.471.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.923.1" }, { "model": "simatic ipc477d", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.9" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.126" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.450.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.89" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "7.3.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.309.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.232" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.778.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.447.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.4.154.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.655.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.115" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.579.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1008" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.694.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.669.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1671.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.67" }, { "model": "simatic s7-1500 software controller", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.702.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "47.0.2526.80" }, { "model": "x-series xos", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "11.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.190.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.400.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.31" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.1.5" }, { "model": "epicenter", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.592.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.902.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.444.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.104" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1272.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.548.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1017.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.954.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.640.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "53.0.2785.103" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.110" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.759.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.587.1" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "7.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1305.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.314.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.69" }, { "model": "simatic ipc677d", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.13" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.24" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.7" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.125" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1661.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.662.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.149" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.833.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.119" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1281.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.810.0" }, { "model": "simotion p320-4e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.871.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.31" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.51" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364160" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1681.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.41" }, { "model": "nexus 6p", "scope": null, "trust": 0.3, "vendor": "google", "version": null }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.649.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.354.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.316.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.692.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.83" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.122" }, { "model": "servers sw", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "x861.0" }, { "model": "enterprise linux for power big endian", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.17" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.630.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.3.154.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.885.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.569.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.89" }, { "model": "simatic itp3000", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.962.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1675.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.306.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "59.0.3071.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.295.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.123" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.318.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.619.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1004" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1033" }, { "model": "simatic ipc627c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1044" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.160" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1679.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.23" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "60.0.3112.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.70" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.51" }, { "model": "enterprise linux for scientific computing", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.539.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.661.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.91" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.939.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.474.0" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-6.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.110" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.893.1" }, { "model": "security analytics", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "7.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.99" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "48.0.2564.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.507.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.883.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.306" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.62" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.348.0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.507.2" }, { "model": "windows server r2 for itanium-based systems sp1", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "2008" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.120" }, { "model": "simatic itp1000", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.935.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.705.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1082.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.122" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1016.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.395.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.118" }, { "model": "ruggedcom rx1400 vpe", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.776.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1305.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.72" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "59.0.3071.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1075.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "43.0.2357.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.172" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.117" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.535.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.443.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.296.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.107" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.776.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.96379" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.217" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.900.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1074.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.126" }, { "model": "x-series xos", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "10.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.611.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.407.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.57" }, { "model": "pyxis medstation es", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.892.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.51" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.518.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.346.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1658.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.897.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.421.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.132" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.56" }, { "model": "pyxis stockstation system", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.0" }, { "model": "simotion p320-4s", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "36.0.1985.143" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1003.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.927.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.382.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "49.0.2623.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.55" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.462.0" }, { "model": "simatic ipc827d", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1021.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.77" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.16" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.818.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.645.0" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.126" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.23" }, { "model": "chrome ~~~and", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "38.0.2125.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1065.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.674.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.905.0" }, { "model": "aix", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "7.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.169" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.531.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.23" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1284.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.115" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1040.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.35" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.939.0" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "1017030" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.758.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.19" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.99" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.184" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.154" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.112" }, { "model": "windows for 32-bit systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "48.0.2564.109" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.344" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.419.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.672.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.608.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.135" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.675.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.222.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.117" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.755.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1072.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.437.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.435.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.215" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.63" }, { "model": "pyxis medication administration", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.617.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1019.0" }, { "model": "enterprise linux for real time", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.685.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.312" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.110" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.63" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.699.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.453.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.961.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.202" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.341" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1058" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "56.0.2924.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1662.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1669.3" }, { "model": "facsverse", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1054" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.506.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.132" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.16" }, { "model": "kiestra tla/wca", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.168" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1286.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.703.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.668.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.744.0" }, { "model": "internet explorer", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "57.0.2987.133" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1078.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.328.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.91" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.381.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.144" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1283.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.711.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.109" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.330" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.21" }, { "model": "malware analysis appliance", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "4.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.511.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.686.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.147" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.797.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.14443" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.521.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.46" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.0" }, { "model": "pyxis cathrack", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.774.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.458.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.350.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.803.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.49" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.155" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.623.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.345.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.215" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.28" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1001.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.859.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.686.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1674.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.930.0" }, { "model": "pyxis specimen collection verification", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.6" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.50" }, { "model": "windows server r2 for x64-based systems sp1", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "2008" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.562.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "55.0.2883.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.798.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.227" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.302" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.416.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1077.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.59" }, { "model": "gencell clic", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.111" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.647.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "59.0.3071.115" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.937.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.90" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.123" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.277.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.350.1" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-6.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.136" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.27" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.12" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.867.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.329" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.746.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1287.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.753.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.59" }, { "model": "chrome beta", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1038.0" }, { "model": "identity manager", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "2.7.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.288.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.7" }, { "model": "bactec fx", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.496.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.109" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.294.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.728.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1036.7" }, { "model": "chrome beta", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.824.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.706.0" }, { "model": "lyse wash assistant", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.453.0" }, { "model": "linux mips", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.585.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.557.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.80" }, { "model": "enterprise linux eus compute node", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.549.0" }, { "model": "macos", "scope": "eq", "trust": 0.3, "vendor": "apple", "version": "10.12.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.111" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.314.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.207" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.440.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.343.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1053.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.957.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.52" }, { "model": "identity manager", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "3.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.573.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1055" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.806.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.13" }, { "model": "unified computing system", "scope": "eq", "trust": 0.3, "vendor": "cisco", "version": "2.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.356.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.863.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.652.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.29" }, { "model": "simatic ipc227e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.33" }, { "model": "macos", "scope": "eq", "trust": 0.3, "vendor": "apple", "version": "10.13.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.719.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.952.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.401.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.495.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1019" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.872.0" }, { "model": "simatic hmi comfort pro panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1022.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.36" }, { "model": "enterprise linux for ibm z systems", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "46.0.2490.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.153" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.341.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.11" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.223" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1657.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1273.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.46" }, { "model": "rowa vmax system", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1274.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.954.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1056.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1303.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1015" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.714.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.8" }, { "model": "pyxis parx", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.150" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.230" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.67" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.172" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.942.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.50" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375125" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.128" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.720.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.904.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.222.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.212" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.500.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.116" }, { "model": "pyxis nursing data collection", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.22" }, { "model": "security analytics", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "7.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1659.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1052.0" }, { "model": "content analysis", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "2.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.305.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.89" }, { "model": "data innovations", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1034" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.145" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.646.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.911.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.697.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.222" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.593.0" }, { "model": "sql server for 32-bit systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "200840" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.667.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.928.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.20" }, { "model": "ios", "scope": "eq", "trust": 0.3, "vendor": "apple", "version": "11.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.339.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1060.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.626.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1031.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.80" }, { "model": "facslyric", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.37" }, { "model": "facscanto 10-color", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.708.0" }, { "model": null, "scope": "eq", "trust": 0.3, "vendor": "google", "version": "v80" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.161" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.559.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.625.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1009.0" }, { "model": "facsduet sample prep", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.680.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.326" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1062.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.203" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.659.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.881.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.800.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.37599" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.330.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1001" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1056" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.33" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.96" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.768.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.82" }, { "model": "windows server for itanium-based systems sp2", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "2008" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.871.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1010.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.31" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.10.140.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1304.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.670.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.378.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.551.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1281.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.0" }, { "model": "sinumerik d sl ncu720.3", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "840" }, { "model": "sinumerik panels wtih integrated tcu", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1037" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.2" }, { "model": "pyxis parassist system", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "50.0.2661.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1060" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.126" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.611.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.547.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.300.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.509.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.387.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.382.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.290.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22" }, { "model": "vcenter server", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.33" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.2.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.386.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1056.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1670.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.839.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1281.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1277.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.38" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.764.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.616.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.66" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.82" }, { "model": "enterprise linux for power big endian", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.4.154.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "45.0.2454" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.564.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1046" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.50" }, { "model": "sql server for 32-bit systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "201420" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1081.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.868.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.19" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.9.126.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.220" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.42" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.397.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.70" }, { "model": "enterprise linux for power big endian extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.99" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.50" }, { "model": "sql server for x64-based systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "201420" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.491.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1054.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1017.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.535.1" }, { "model": "enterprise linux server year extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-47.2" }, { "model": "enterprise linux for scientific computing", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1289.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "53.0.2785.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.825.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.814.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.600.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.566.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.132" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.137" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "50.0.2661.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.877.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.860.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.475.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1070.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.958.1" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.94" }, { "model": "simatic ipc847c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "enterprise linux", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.415.1" }, { "model": "enterprise linux eus compute node", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.108" }, { "model": "simatic itp1000", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v23.01.03" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1020.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.614.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.57" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.344.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.34" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.235" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.156.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.111" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.715.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.55" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.505.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1063.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.286.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.723.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.134" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.725.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.224" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.672.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.358.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.151" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.754.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.107" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1007" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1659.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.783.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1047" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1052" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.78" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.51" }, { "model": "simatic ipc277e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1690.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.308" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.820.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1044.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.109" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.343" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.432.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.731.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.249.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.560.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.819.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.324.0" }, { "model": "enterprise linux for power big endian extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1048" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.125" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1032.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.162" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.433.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.117" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.201" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.612.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "38.0.2125.122" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.153" }, { "model": "linux ia-32", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.4.154.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.201" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1687.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.22" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.903.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.672.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.733.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.749.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.762.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.719.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.12" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.271.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.813.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.7" }, { "model": "assurity linc", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.237" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.36" }, { "model": "linux powerpc", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.53" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.211" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.622.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.673.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.1" }, { "model": "accuri c6 plus", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "simatic ipc477c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1063.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.187" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1055.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.383.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.790.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.465.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.319" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.658.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "48.0.2564.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "51.0.2704.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1668.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.7" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.932.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.13" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.34" }, { "model": "pyxis infant care verification", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.41" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "49.0.2623.108" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1064.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.686.0" }, { "model": "pyxis supplystation", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1651.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1003.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.95" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.322.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.391.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.107" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.6" }, { "model": "identity manager", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "2.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1664.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.89" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "64.0.3282.167" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1031" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "58.0.3029.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1007.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.40" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.326.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.62" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1680.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.603.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.39" }, { "model": "sinema remote connect", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.686.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.213" }, { "model": "x-series xos", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "9.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.32" }, { "model": "simatic field pg m5", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "22.1.5" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1010" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.337" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.51" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.15" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.27" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.170" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.33" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1051" }, { "model": "linux sparc", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.119" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.896.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.152" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.417.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.218" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.334" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.657.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1049" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.331" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.667.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1057" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1673.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.689.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.152" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1288.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.390.0" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.0.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1655.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.707.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1011.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1081.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.50" }, { "model": "fusion", "scope": "ne", "trust": 0.3, "vendor": "vmware", "version": "8.5.9" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1067.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.44" }, { "model": "communications lsms", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "13.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.536.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1664.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.801.0" }, { "model": "rowa smart", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1048.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.807.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.865.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1296.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.481.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.489.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "51.0.2704.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.121" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.97" }, { "model": "pixel xl", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.47" }, { "model": "windows server", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.5" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "45.0.2454.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "60.0.3080.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "59.0.3071.104" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.96" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.572.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.356.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1055.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.786.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "36.0.1985.122" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1039.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.447.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.836.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.23" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "7.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.642.1" }, { "model": "lsrfortessa", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "x-200" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.216" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.591.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "45.0.2454.101" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.99" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.107" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.168" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1012.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.278.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.413.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.580.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.123" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.146" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1305.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.513.0" }, { "model": "enterprise linux server extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.2.149.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1042" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.158.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.761.1" }, { "model": "windows server r2", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20120" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.45" }, { "model": "sinumerik pcu", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "50.5" }, { "model": "enterprise linux for ibm z systems", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.130" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.765.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.100" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.108" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.553.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.494.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.745.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.484.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1061.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.829.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.360.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.482.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1309.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.76" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.14" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "sql server for x64-based systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20170" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.27" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "46.0.2490.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.677.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.890.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.437.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "47.0.2526.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.770.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.30" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "64.0.3282.134" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.364.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.507.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "47.0.2526.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.349.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "58.0.3029.96" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.450.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.322.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.83" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1297.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1026" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1068.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.33" }, { "model": "simatic ipc627d", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.762.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.369.1" }, { "model": "simatic ipc427c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.723.1" }, { "model": "enterprise linux server year extended upd", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-47.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.83" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.884.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1038" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.83" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1068.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.621.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.310" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1006" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.811.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.499.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.709.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.96" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.882.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1002.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "60.0.3112.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.384.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.111" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.118" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.157.2" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.134" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.721.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.76" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.529.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.503.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.563.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.24" }, { "model": "chrome beta", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.193.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.771.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.603.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.8" }, { "model": "enterprise linux for power little endian extended update supp", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.906.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.169.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.114" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.202" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.363.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.60" }, { "model": "simatic ipc547e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1306.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.601.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.52" }, { "model": "panel designer", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.812.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.944.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.635.0" }, { "model": "simatic s7-1518f-4 pn/dp odk", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.96" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "48.0.2564.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1660.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1047.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1036.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.44" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.37" }, { "model": "vsphere integrated containers", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "1.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.473.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.441.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1012.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1040" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1037.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "40.0.2214.115" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.104" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.53" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.426.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.752.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.43" }, { "model": "nexus", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5x" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.834.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.327.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1654.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.112" }, { "model": "aix", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "6.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.401.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.493.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.216" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.1.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.103" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "64.0.3282.144" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "59.0.3071.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.327" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.186" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.956.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1662.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.49" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.9" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1183.0" }, { "model": "sinumerik tcu", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "30.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.217" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.2491036" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.108" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.522.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "49.0.2623.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.23" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.5" }, { "model": "sinumerik d sl ncu720.3b", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "840" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1305.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.12" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "61.0.3163.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.622.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.159" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1062.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.2.152.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.556.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.450.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.119" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.161" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.772.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.322.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.125" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1059.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.398.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.404.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.140" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.531.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "47.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.53" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.321" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.870.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1006.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1653.1" }, { "model": "pyxis anesthesia es", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.204" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.58" }, { "model": "enterprise linux for power little endian extended update supp", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.551.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1083.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.152" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "62.0.3202.89" }, { "model": "aix", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.301" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.335" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.695.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1021" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1688.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.325" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.732.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1290.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.26" }, { "model": "vcloud usage meter", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "3.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.712.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "49.0.2566.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1286.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.152" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.558.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.2" }, { "model": "simatic ipc827c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.822.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.665.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.629.0" }, { "model": "sql server r2 for 32-bit systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "200830" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1012.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.339" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.109" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.335.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.763.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.947.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1276.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.168" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.878.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.42" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.542.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1663.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.837.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1014" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.529.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.70" }, { "model": "simatic ipc847d", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.324" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.929.0" }, { "model": "simatic ipc547g", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.510.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.3.1549" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.410.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.787.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.323" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.292.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.405.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.212.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.684.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.796.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.2.153.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.35" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.9.134.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.121" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1076.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.123" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1307.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.928.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.757.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.360.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.15" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.79" }, { "model": "facscelesta", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.20" }, { "model": "enterprise linux for ibm z systems extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-6.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.249.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.31" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.118" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "50.0.2661.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.832.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1066.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.702.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.316" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.514.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1284.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.221.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.403.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.55" }, { "model": "simatic field pg m5", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "43.0.2357" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.304.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1018.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.360.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1278.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.229" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.572.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.146" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.139" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.22" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1282.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1057.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.47" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.303.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.80" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3" }, { "model": "pyxis scrubstation system", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.20" }, { "model": "pyxis anesthesia system", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "35000" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.436.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1030.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.44" }, { "model": "xeon cpu e5-1650", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.340" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1689.2" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.889.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.343" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.531.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.679.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.300" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.893.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.644.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.70" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.173" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.570.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.17" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.536.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.313.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.351.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.31" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.933.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.887.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1288.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.36" }, { "model": "content analysis", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "2.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1498.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.793.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.151" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1301.0" }, { "model": "facsvia", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "pixel c", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.205" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.29" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.8" }, { "model": "vcenter server", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1043.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1000.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.317" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.204" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.909.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.118" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.886.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.14" }, { "model": "simatic ipc477e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.318" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.96" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.115" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.936.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.488.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.526.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.808.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.287.0" }, { "model": "mac os", "scope": "eq", "trust": 0.3, "vendor": "apple", "version": "x10.11.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.584.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1042.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.302.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.369.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.907.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.29" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.86" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1685.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.108" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.823.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.791.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.577.0" }, { "model": "macos", "scope": "ne", "trust": 0.3, "vendor": "apple", "version": "10.13.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "44.0.2403.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1061.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.91" }, { "model": "simatic ipc347e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.676.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.210" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.525.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.490.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.681.0" }, { "model": "viper lt", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "pyxis procedurestation", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.495.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.500.0" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.0.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.309" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.97" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.3" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.214" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1050" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.135" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.11" }, { "model": "aix", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "7.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.416.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.950.0" }, { "model": "sql server for x64-based systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "200840" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "7.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.613.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.182.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1276.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.163" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1281.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1049.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.304" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.162" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.305" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.862.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.464.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.70" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.682.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.940.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.22" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.119" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1683.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.151" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.376.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1077.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1025" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.921.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.155" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.538.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.519.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1041.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.69" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "1017030" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.561.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1306.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1311.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.586.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.928.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.766.0" }, { "model": "simatic ipc677c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.34" }, { "model": "vcloud usage meter", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "3.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.740.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.125" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.603.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "40.0.2214.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.529.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.830.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.399.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.203" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.126" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.795.0" }, { "model": "vm virtualbox", "scope": "ne", "trust": 0.3, "vendor": "oracle", "version": "5.2.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.131" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.687.1" }, { "model": "chrome beta", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.249.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.335.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.925.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.499.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.864.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.69" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "38.0.2125.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.447.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1076.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.117" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.458.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.208" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1682.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.959.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.2.149.27" }, { "model": "servers sw", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "x862.0" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.624.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.156" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.639.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.612.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "42.0.2311.135" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1293.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1668.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1654.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.73" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.698.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1079.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.338" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.71" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.598.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1287.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.30" }, { "model": "simatic ipc377e", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.894.0" }, { "model": "virtualization host", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.737.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1061" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.906.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.954.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1284.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.237" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.445.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.214" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.514.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1444.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1672.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.275.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.52" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.121" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.827.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.7" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.320" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "58.0.3029.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.28" }, { "model": "tvos", "scope": "eq", "trust": 0.3, "vendor": "apple", "version": "11.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.311" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.693.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.736.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1069.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1668.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1019.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.606.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.438.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.775.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.120" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.209" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.113" }, { "model": "sql server for x64-based systems service pack", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "201610" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1299.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.226" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.869.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.738.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.102" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.231" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.32" }, { "model": "enterprise linux eus compute node", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.13" }, { "model": "sql server for x64-based systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "20160" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.578.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.121" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.958.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.380.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.21" }, { "model": "vsphere data protection", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.1.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.809.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.50" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1681.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.361.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1036.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1018" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.4.154.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.701.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.780.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.605.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1051.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.49" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.663.0" }, { "model": "pyxis ciisafe -workstation", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.537.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1275.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.133" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.96" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1046.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.122" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1062" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.934.0" }, { "model": "simatic hmi basic panels 2nd generation", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.928.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.490.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1020" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.469.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1080.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.67" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.951.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.130" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.414.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.52" }, { "model": "unified computing system", "scope": "eq", "trust": 0.3, "vendor": "cisco", "version": "3.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.332" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.81" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.5" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.108" }, { "model": "simatic field pg m4", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.115" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.688.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1050.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.479.0" }, { "model": "pyxis parx handheld", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.960.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.838.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.394.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.41" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.718.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.503.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.890.1" }, { "model": "kernel", "scope": "eq", "trust": 0.3, "vendor": "linux", "version": "4.14.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1057.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "41.0.2272.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.528.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.25" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1676.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.2491064" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.84" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.105" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1023.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.325.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1010.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.724.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.335.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.431.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "3.0.195.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.498.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.51" }, { "model": "facscalibur", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.612.3" }, { "model": "facscanto 10-color clinical", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.406.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.938.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.515.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1294.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.36" }, { "model": "viper xtr", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.445.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.409.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.775.4" }, { "model": "android", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.315.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.119" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.54" }, { "model": "enterprise linux for power little endian", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.21" }, { "model": "facsaria i/ii/iii", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.741.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.170.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.588.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.59" }, { "model": "windows server for x64-based systems sp2", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "2008" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1045.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.799.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.511.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.104" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1073.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.152" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.792.0" }, { "model": "pyxis medstation", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "40000" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1667.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.322" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1279.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.169.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.272.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.97" }, { "model": "pyxis medstation", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "35000" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.411.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.47" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.367.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1016" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1045" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.106" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.634.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.454.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1029.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.337.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.507.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1032" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1302.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.118" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.827.0" }, { "model": "lsrfortessa", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.642.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.945.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.151" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "52.0.2743.116" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.107" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1666.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "44.0.2403" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.895.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.355.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.6" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "57.0.2987.137" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.21" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.95" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.308.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.44" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.13" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1272.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.234" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.21" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.171" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.104" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.0" }, { "model": "pixel xl", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.103" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.650.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "51.0.2704.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.338.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.451.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.135" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.59" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "22" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.156" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1301.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.222.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.58" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.868.0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.536.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1304.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.4" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1671.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1017.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.15" }, { "model": "pyxis cubie replenishment station", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.6" }, { "model": "facssample prep assistant iii", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.40" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.427.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1024" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.276.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.117" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.307.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.112" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.933.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.121" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.642.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.574.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.936.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "2.0.172.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.317.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "39.0.2171.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.320.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.946.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.888.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.37" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.5" }, { "model": "security analytics", "scope": "eq", "trust": 0.3, "vendor": "bluecoat", "version": "7.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1307.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.224.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1678.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.33" }, { "model": "ruggedcom ape", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.97" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.704.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.149" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.60" }, { "model": "bactec fx40", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.24" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1035" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.288.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1291.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.68" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9" }, { "model": "vcloud usage meter", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "3.3.3" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.32" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.60" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "29.0.1547.57" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.43" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.59" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.223.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.632.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.158" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.154" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.328" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.889.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.777.2" }, { "model": "simatic et 200sp open controller", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.34" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.899.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.39" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1029" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.571.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.23" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.79" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "1016070" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1677.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.19" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.76" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.911.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.734.0" }, { "model": "kernel", "scope": "ne", "trust": 0.3, "vendor": "linux", "version": "4.14.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.954.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.667.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1310.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.34" }, { "model": "pyxis transfusion verification", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.9.131.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.342" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.93" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.35" }, { "model": "vrealize automation", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "6.2.4.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.485.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.678.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.372.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.27" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.77" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.949.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.638.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "54.0.2840.99" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.450.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.392.0" }, { "model": "enterprise linux server extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.212" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.19" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.302.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1063" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.710.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.206" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.289.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.96" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1685.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.568.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.735.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.487.0" }, { "model": "workstation", "scope": "ne", "trust": 0.3, "vendor": "vmware", "version": "12.5.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.302.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.129" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.124" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.9" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.590.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.827.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.23" }, { "model": "carrier routing system 6.6.0.base", "scope": null, "trust": 0.3, "vendor": "cisco", "version": null }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.89" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.332.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.49" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.107" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.953.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.666.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1071.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1013.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.83" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.73" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "61.0.3163.113" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.0.275.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.340.0" }, { "model": "facsaria fusion", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.373.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.46" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.87" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.32" }, { "model": "linux arm", "scope": "eq", "trust": 0.3, "vendor": "debian", "version": "6.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.30" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.0" }, { "model": "vsphere integrated containers", "scope": "eq", "trust": 0.3, "vendor": "vmware", "version": "1.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1036.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.50" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.353.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.408.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "61.0.3163.79" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.43" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.84" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.5" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.461.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.51" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.470.0" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.16" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1285.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.446.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.88" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.357.0" }, { "model": "enterprise linux for power big endian extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-6.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.459.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.541.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.221" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.64" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.31" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.333.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.779.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.6" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.57" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "1.0.154.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.9" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.307" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.121" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.127" }, { "model": "chrome beta mac", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.20" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1027" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.396.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.110" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.428.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.42" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.29" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.612.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.95" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1035.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.767.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.891.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.460.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.14" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1001.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.87" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.18" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.466.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1053" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.74" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.25" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.45" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.455.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1014.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.5" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.220" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.210" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.21" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.449.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.142" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.911.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.620.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.4" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.10" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.497.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "33.0.1750.82" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.576.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "28.0.1500.61" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1015.0" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.87" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "42.0.2311.90" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.213" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1010.2" }, { "model": "vsphere integrated containers", "scope": "ne", "trust": 0.3, "vendor": "vmware", "version": "1.3.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.13" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "16.0.912.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.148" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.36" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1682.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.437.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.99" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.751.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.636.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.91" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.313" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.360.5" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "40.0.2214.114" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "65.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.64" }, { "model": "windows for x64-based systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "100" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1670.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.456.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.874.12" }, { "model": "enterprise linux", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "37.0.2062.65" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.47" }, { "model": "communications lsms", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "13.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.831.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.18" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.111" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.67" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.375.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.550.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1305.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.583.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.317.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.595.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1009" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "34.0.1847.131" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.108" }, { "model": "proliant dl385 gen10 server", "scope": "eq", "trust": 0.3, "vendor": "hp", "version": "1.02" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "23.0.1271.17" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "0.3.154.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.94" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "15.0.866.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.34" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "52.0.2743.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.48" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1673.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.35" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.11" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "30.0.1599.101" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.72" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.85" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.47" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.131" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.15" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.128" }, { "model": "enterprise linux server year extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-47.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.342.8" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1700.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.5" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.653.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.63" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "32.0.1656.1" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "48.0.2564.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "22.0.1229.92" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "17.0.963.35" }, { "model": "vm virtualbox", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "5.0.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.713.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.643.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.597.62" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.22" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1057.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.7" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "8.0.552.228" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "53.0.2785.144" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.2" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.5" }, { "model": "bactec", "scope": "eq", "trust": 0.3, "vendor": "bd", "version": "9120/92400" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.28" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.504.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.517.44" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1312.12" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.767.1" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "24.0.1292.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1058.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "62.0.3202.75" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "18.0.1025.129" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "12.0.742.21" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "26.0.1410.35" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "31.0.1650.52" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.41" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "20.0.1132.54" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.218" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.418.4" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.68" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "1016070" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.359.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1084.26" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.205" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.78" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.565.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "7.0.536.3" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "9.0.567.0" }, { "model": "vm server for", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "x863.2" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "5.0.37586" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.835.33" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "13.0.782.238" }, { "model": "chrome os", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "25.0.1364.98" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "6.0.472.56" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "27.0.1453.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.656.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.696.55" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "21.0.1180.53" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "4.1.249.1011" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "10.0.648.66" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "19.0.1033.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "35.0.1916.38" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "14.0.788.0" }, { "model": "chrome", "scope": "eq", "trust": 0.3, "vendor": "google", "version": "11.0.691.0" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "BID", "id": "102378" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Red Hat", "sources": [ { "db": "PACKETSTORM", "id": "145642" }, { "db": "PACKETSTORM", "id": "145667" }, { "db": "PACKETSTORM", "id": "147539" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "145654" } ], "trust": 0.5 }, "cve": "CVE-2017-5754", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CVE-2017-5754", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.0, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CNVD-2018-00303", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-113957", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.1, "id": "CVE-2017-5754", "impactScore": 4.0, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2017-5754", "trust": 1.0, "value": "MEDIUM" }, { "author": "CNVD", "id": "CNVD-2018-00303", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-113957", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis of the data cache. Two vulnerabilities are identified, known as \"Variant 3a\" and \"Variant 4\". CPUhardware is a set of firmware that runs in the CPU (Central Processing Unit) for managing and controlling the CPU. The Spectre vulnerability exists in the CPU processor core. Because Intel does not separate low-privileged applications from accessing kernel memory, an attacker can use a malicious application to obtain private data that should be quarantined. \nAttackers can exploit this issue to obtain sensitive information that may aid in further attacks. Intel and ARM CPU chips have an information disclosure vulnerability, which originates from a flaw in the processor data boundary mechanism. The following products and versions are affected: ARM Cortex-A75; Intel Xeon E5-1650 v3, v2, v4; Xeon E3-1265l v2, v3, v4; Xeon E3-1245 v2, v3, v5, v6; Xeon X7542 wait. X-Scanned-By: MIMEDefang 2.79 on 10.5.11.13\nX-Greylist: Sender IP whitelisted, not delayed by milter-greylist-4.5.16 (mx1.redhat.com [10.5.110.27]); Thu, 04 Jan 2018 01:01:25 +0000 (UTC)\n\n\n-----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n=====================================================================\n Red Hat Security Advisory\n\nSynopsis: Important: kernel security update\nAdvisory ID: RHSA-2018:0007-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:0007\nIssue date: 2018-01-03\n=====================================================================\n\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Client Optional (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64\nRed Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64\nRed Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 7) - x86_64\n\n3. \n\nSecurity Fix(es):\n\nAn industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of instructions (a commonly\nused performance optimization). There are three primary variants of the\nissue which differ in the way the speculative execution can be exploited. \n\nNote: This issue is present in hardware and cannot be fully fixed via\nsoftware update. The updated kernel packages provide software mitigation\nfor this hardware issue at a cost of potential performance penalty. \n\nVariant CVE-2017-5753 triggers the speculative execution by performing a\nbounds-check bypass. It relies on the presence of a precisely-defined\ninstruction sequence in the privileged code as well as the fact that memory\naccesses may cause allocation into the microprocessor\u0027s data cache even for\nspeculatively executed instructions that never actually commit (retire). As\na result, an unprivileged attacker could use this flaw to cross the syscall\nboundary and read privileged memory by conducting targeted cache\nside-channel attacks. (CVE-2017-5753, Important)\n\nVariant CVE-2017-5715 triggers the speculative execution by utilizing\nbranch target injection. It relies on the presence of a precisely-defined\ninstruction sequence in the privileged code as well as the fact that memory\naccesses may cause allocation into the microprocessor\u0027s data cache even for\nspeculatively executed instructions that never actually commit (retire). As\na result, an unprivileged attacker could use this flaw to cross the syscall\nand guest/host boundaries and read privileged memory by conducting targeted\ncache side-channel attacks. (CVE-2017-5715, Important)\n\nVariant CVE-2017-5754 relies on the fact that, on impacted microprocessors,\nduring speculative execution of instruction permission faults, exception\ngeneration triggered by a faulting access is suppressed until the\nretirement of the whole instruction block. In a combination with the fact\nthat memory accesses may populate the cache even when the block is being\ndropped and never committed (executed), an unprivileged local attacker\ncould use this flaw to read privileged (kernel space) memory by conducting\ntargeted cache side-channel attacks. (CVE-2017-5754, Important)\n\nNote: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64\nmicroprocessors are not affected by this issue. \n\nRed Hat would like to thank Google Project Zero for reporting these issues. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\nThe system must be rebooted for this update to take effect. \n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1519778 - CVE-2017-5753 hw: cpu: speculative execution bounds-check bypass\n1519780 - CVE-2017-5715 hw: cpu: speculative execution branch target injection\n1519781 - CVE-2017-5754 hw: cpu: speculative execution permission faults handling\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\nkernel-3.10.0-693.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-693.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm\nperf-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Client Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\nkernel-3.10.0-693.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-693.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm\nperf-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\nkernel-3.10.0-693.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-693.11.6.el7.noarch.rpm\n\nppc64:\nkernel-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-bootwrapper-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debug-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-devel-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-headers-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-tools-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-tools-libs-3.10.0-693.11.6.el7.ppc64.rpm\nperf-3.10.0-693.11.6.el7.ppc64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\npython-perf-3.10.0-693.11.6.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\n\nppc64le:\nkernel-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debug-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-devel-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-headers-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-tools-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-693.11.6.el7.ppc64le.rpm\nperf-3.10.0-693.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\npython-perf-3.10.0-693.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-693.11.6.el7.s390x.rpm\nkernel-debug-3.10.0-693.11.6.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.s390x.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.s390x.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-693.11.6.el7.s390x.rpm\nkernel-devel-3.10.0-693.11.6.el7.s390x.rpm\nkernel-headers-3.10.0-693.11.6.el7.s390x.rpm\nkernel-kdump-3.10.0-693.11.6.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-693.11.6.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-693.11.6.el7.s390x.rpm\nperf-3.10.0-693.11.6.el7.s390x.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.s390x.rpm\npython-perf-3.10.0-693.11.6.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.s390x.rpm\n\nx86_64:\nkernel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm\nperf-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 7):\n\nppc64:\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\nkernel-tools-libs-devel-3.10.0-693.11.6.el7.ppc64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.ppc64.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-693.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\nkernel-3.10.0-693.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-693.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.11.6.el7.x86_64.rpm\nperf-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.11.6.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niD8DBQFaTXxVXlSAg2UNWIIRAnGZAKCCDXCEpNliyl378yhPHJ11vj74bwCdFc9+\n0mPrmOPm1+0ayOnwPiH6wmA=\n=fBN+\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. 6.6) - noarch, x86_64\n\n3. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\nNote: the current version of the following document is available here:\nhttps://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us\n\nSUPPORT COMMUNICATION - SECURITY BULLETIN\n\nDocument ID: hpesbhf03805en_us\nVersion: 4\n\nHPESBHF03805 rev.4 - Certain HPE products using Microprocessors from Intel,\nAMD, and ARM, with Speculative Execution, Elevation of Privilege and\nInformation Disclosure. \n\nNOTICE: The information in this Security Bulletin should be acted upon as\nsoon as possible. \n\nRelease Date: 2018-01-10\nLast Updated: 2018-01-09\n\nPotential Security Impact: Local: Disclosure of Information, Elevation of\nPrivilege\n\nSource: Hewlett Packard Enterprise, Product Security Response Team\n\nVULNERABILITY SUMMARY\nOn January 3 2018, side-channel security vulnerabilities involving\nspeculative execution were publicly disclosed. These vulnerabilities may\nimpact the listed HPE products, potentially leading to information disclosure\nand elevation of privilege. Mitigation and resolution of these\nvulnerabilities may call for both an operating system update, provided by the\nOS vendor, and a system ROM update from HPE. \n\n\n**Note:**\n\n * This issue takes advantage of techniques commonly used in many modern\nprocessor architectures. \n * For further information, microprocessor vendors have provided security\nadvisories:\n \n - Intel:\n\u003chttps://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026langu\ngeid=en-fr\u003e\n - AMD: \u003chttp://www.amd.com/en/corporate/speculative-execution\u003e\n - ARM: \u003chttps://developer.arm.com/support/security-update\u003e\n\nReferences:\n\n - PSRT110634\n - PSRT110633\n - PSRT110632\n - CVE-2017-5715 - aka Spectre, branch target injection\n - CVE-2017-5753 - aka Spectre, bounds check bypass\n - CVE-2017-5754 - aka Meltdown, rogue data cache load, memory access\npermission check performed after kernel memory read\n\nSUPPORTED SOFTWARE VERSIONS*: ONLY impacted versions are listed. \n\n - HPE ProLiant DL380 Gen10 Server prior to v1.28\n - HPE ProLiant DL180 Gen10 Server prior to v1.28\n - HPE ProLiant DL160 Gen10 Server prior to v1.28\n - HPE ProLiant DL360 Gen10 Server prior to v1.28\n - HPE ProLiant ML110 Gen10 Server prior to v1.28\n - HPE ProLiant DL580 Gen10 Server prior to v1.28\n - HPE ProLiant DL560 Gen10 Server prior to v1.28\n - HPE ProLiant DL120 Gen10 Server prior to v1.28\n - HPE ProLiant ML350 Gen10 Server prior to v1.28\n - HPE ProLiant XL450 Gen10 Server prior to v1.28\n - HPE ProLiant XL170r Gen10 Server prior to v1.28\n - HPE ProLiant BL460c Gen10 Server Blade prior to v1.28\n - HPE ProLiant XL230a Gen9 Server prior to v2.54\n - HPE ProLiant XL230k Gen10 Server prior to v1.28\n - HPE ProLiant XL730f Gen9 Server prior to v2.54\n - HPE ProLiant XL740f Gen9 Server prior to v2.54\n - HPE ProLiant XL750f Gen9 Server prior to v2.54\n - HPE ProLiant XL170r Gen9 Server prior to v2.54\n - HP ProLiant DL60 Gen9 Server prior to v2.54\n - HPE ProLiant XL450 Gen9 Server prior to v2.54\n - HP ProLiant DL160 Gen9 Server prior to v2.54\n - HPE Apollo 4200 Gen9 Server prior to v2.54\n - HP ProLiant BL460c Gen9 Server Blade prior to v2.54\n - HP ProLiant ML110 Gen9 Server prior to v2.54\n - HP ProLiant ML150 Gen9 Server prior to v2.54 \n - HPE ProLiant ML350 Gen9 Server prior to v2.54\n - HP ProLiant DL380 Gen9 Server prior to v2.54\n - HP ProLiant DL120 Gen9 Server prior to v2.54\n - HPE ProLiant DL560 Gen9 Server prior to v2.54\n - HPE ProLiant XL270d Gen9 Special Server prior to v2.54\n - HP ProLiant BL660c Gen9 Server prior to v2.54\n - HPE ProLiant m710x Server Cartridge prior to v1.60\n - HPE ProLiant DL20 Gen9 Server prior to v2.52\n - HPE ProLiant DL385 Gen10 Server prior to v1.04\n - HPE Synergy 660 Gen9 Compute Module prior to v2.54\n - HPE Synergy 480 Gen10 Compute Module prior to v1.28\n - HPE Synergy 480 Gen9 Compute Module prior to v2.54\n - HPE ProLiant ML30 Gen9 Server prior to v2.52\n - HPE ProLiant XL190r Gen10 Server prior to v1.28\n - HPE ProLiant XL250a Gen9 Server prior to v2.54\n - HPE ProLiant XL190r Gen9 Server prior to v2.54\n - HP ProLiant DL80 Gen9 Server prior to v2.54\n - HPE ProLiant DL180 Gen9 Server prior to v2.54\n - HPE ProLiant XL270d Gen9 Accelerator Tray 2U Configure-to-order Server\nprior to v2.54\n - HPE ProLiant WS460c Gen9 Workstation prior to v2.54\n - HPE ProLiant DL580 Gen9 Special Server prior to v2.54\n - HPE Synergy 680 Gen9 Compute Modules prior to v2.54\n - HPE ProLiant XL260a Gen9 Server prior to 1/22/2018\n - HPE ProLiant m510 Server Cartridge prior to 1/22/2018\n - HPE ProLiant m710p Server Cartridge prior to 12/12/2017\n - HP ProLiant m350 Server Cartridge prior to 12/12/2017\n - HP ProLiant m300 Server Cartridge prior to 12/12/2017\n - HP ProLiant ML350e Gen8 Server prior to 12/12/2017\n - HPE ProLiant ML350e Gen8 v2 Server prior to 12/12/2017\n - HP ProLiant BL460c Gen8 Server prior to 12/12/2017\n - HP ProLiant BL660c Gen8 Server prior to 12/12/2017\n - HPE ProLiant SL4540 Gen8 1 Node Server prior to 12/12/2017\n - HP ProLiant DL380e Gen8 Server prior to 12/12/2017\n - HP ProLiant DL360e Gen8 Server prior to 12/12/2017\n - HP ProLiant ML350p Gen8 Server prior to 12/12/2017\n - HP ProLiant DL360p Gen8 Server prior to 12/12/2017\n - HP ProLiant DL380p Gen8 Server prior to 12/12/2017\n - HP ProLiant DL320e Gen8 Server prior to 12/12/2017\n - HPE ProLiant DL320e Gen8 v2 Server prior to 12/12/2017\n - HP ProLiant ML310e Gen8 Server prior to 12/12/2017\n - HPE ProLiant ML310e Gen8 v2 Server prior to 12/12/2017\n - HP ProLiant DL160 Gen8 Server prior to 12/12/2017\n - HP ProLiant SL270s Gen8 Server prior to 12/12/2017\n - HP ProLiant SL250s Gen8 Server prior to 12/12/2017\n - HP ProLiant SL230s Gen8 Server prior to 12/12/2017\n - HP ProLiant DL560 Gen8 Server prior to 12/12/2017\n - HPE ProLiant SL210t Gen8 Server prior to 12/12/2017\n - HP ProLiant DL580 Gen8 Server prior to 12/12/2017 (v1.98)\n - HP ProLiant ML10 Server prior to 12/12/2017\n - HP ProLiant m710 Server Cartridge prior to 12/12/2017 (v1.60)\n - HPE Synergy Composer prior to 12/12/2017\n - HPE Integrity Superdome X with BL920s Blades prior to 8.8.6\n - HPE Superdome Flex Server prior to 2.3.110\n - HP ProLiant DL360 Gen9 Server prior to v2.54\n - HPE Synergy 620 Gen9 Compute Module prior to v2.54\n - HPE ProLiant Thin Micro TM200 Server prior to 1/16/2017\n - HPE ProLiant ML350 Gen10 Server prior to v1.28\n - HP ProLiant BL420c Gen8 Server prior to 12/12/2017\n - HPE ProLiant ML10 v2 Server prior to 12/12/2017\n - HPE ProLiant MicroServer Gen8 prior to 12/12/2017\n - HPE Synergy 660 Gen10 Compute Module prior to v1.28\n\nBACKGROUND\n\n CVSS Base Metrics\n =================\n Reference, CVSS V3 Score/Vector, CVSS V2 Score/Vector\n\n CVE-2017-5715\n 8.2 CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:C/C:H/I:L/A:N\n 6.8 (AV:A/AC:L/Au:N/C:C/I:P/A:N)\n\n CVE-2017-5753\n 5.0 CVSS:3.0/AV:A/AC:H/PR:L/UI:R/S:C/C:L/I:L/A:L\n 5.4 (AV:A/AC:M/Au:N/C:P/I:P/A:P)\n\n CVE-2017-5754\n 7.5 CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N\n 7.8 (AV:N/AC:L/Au:N/C:C/I:N/A:N)\n\n Information on CVSS is documented in\n HPE Customer Notice HPSN-2008-002 here:\n\nhttps://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-c01345499\n\nRESOLUTION\n\nHPE has made the following system ROM updates which include an updated\nmicrocode to resolve the vulnerability:\n\n * HPE has provided a customer bulletin\n\u003chttps://support.hpe.com/hpsc/doc/public/display?docId=emr_na-a00039267en_us\u003e\nwith specific instructions to obtain the udpated sytem ROM\n \n - Note:\n \n + CVE-2017-5715 requires that the System ROM be updated and a vendor\nsupplied operating system update be applied as well. \n + For CVE-2017-5753, CVE-2017-5754 require only updates of a vendor\nsupplied operating system. \n + HPE will continue to add additional products to the list. Not all\nlisted products have updated system ROMs yet. Impacted products awaiting\nsystem ROM updates are marked TBS (to be supplied). \n\nHISTORY\n\nVersion:1 (rev.1) - 4 January 2018 Initial release\n\nVersion:2 (rev.2) - 5 January 2018 Added additional impacted products\n\nVersion:3 (rev.3) - 10 January 2018 Added more impacted products\n\nVersion:4 (rev.4) - 9 January 2018 Fixed product ID\n\n\nThird Party Security Patches: Third party security patches that are to be\ninstalled on systems running Hewlett Packard Enterprise (HPE) software\nproducts should be applied in accordance with the customer\u0027s patch management\npolicy. \n\nSupport: For issues about implementing the recommendations of this Security\nBulletin, contact normal HPE Services support channel. For other issues about\nthe content of this Security Bulletin, send e-mail to security-alert@hpe.com. \n\nReport: To report a potential security vulnerability for any HPE supported\nproduct:\n Web form: https://www.hpe.com/info/report-security-vulnerability\n Email: security-alert@hpe.com\n\nSubscribe: To initiate a subscription to receive future HPE Security Bulletin\nalerts via Email: http://www.hpe.com/support/Subscriber_Choice\n\nSecurity Bulletin Archive: A list of recently released Security Bulletins is\navailable here: http://www.hpe.com/support/Security_Bulletin_Archive\n\nSoftware Product Category: The Software Product Category is represented in\nthe title by the two characters following HPSB. \n\n3C = 3COM\n3P = 3rd Party Software\nGN = HPE General Software\nHF = HPE Hardware and Firmware\nMU = Multi-Platform Software\nNS = NonStop Servers\nOV = OpenVMS\nPV = ProCurve\nST = Storage Software\nUX = HP-UX\n\nCopyright 2016 Hewlett Packard Enterprise\n\nHewlett Packard Enterprise shall not be liable for technical or editorial\nerrors or omissions contained herein. The information provided is provided\n\"as is\" without warranty of any kind. To the extent permitted by law, neither\nHP or its affiliates, subcontractors or suppliers will be liable for\nincidental,special or consequential damages including downtime cost; lost\nprofits; damages relating to the procurement of substitute products or\nservices; or damages for loss of data, or software restoration. The\ninformation in this document is subject to change without notice. Hewlett\nPackard Enterprise and the names of Hewlett Packard Enterprise products\nreferenced herein are trademarks of Hewlett Packard Enterprise in the United\nStates and other countries. Other product and company names mentioned herein\nmay be trademarks of their respective owners. \n-----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA512\n\n=============================================================================\nFreeBSD-SA-18:03.speculative_execution Security Advisory\n The FreeBSD Project\n\nTopic: Speculative Execution Vulnerabilities\n\nCategory: core\nModule: kernel\nAnnounced: 2018-03-14\nCredits: Jann Horn (Google Project Zero); Werner Haas, Thomas\n Prescher (Cyberus Technology); Daniel Gruss, Moritz Lipp,\n Stefan Mangard, Michael Schwarz (Graz University of\n Technology); Paul Kocher; Daniel Genkin (University of\n Pennsylvania and University of Maryland), Mike Hamburg\n (Rambus); Yuval Yarom (University of Adelaide and Data6)\nAffects: All supported versions of FreeBSD. \nCorrected: 2018-02-17 18:00:01 UTC (stable/11, 11.1-STABLE)\n 2018-03-14 04:00:00 UTC (releng/11.1, 11.1-RELEASE-p8)\nCVE Name: CVE-2017-5715, CVE-2017-5754\n\nSpecial Note:\tSpeculative execution vulnerability mitigation is a work\n in progress. This advisory addresses the most significant\n issues for FreeBSD 11.1 on amd64 CPUs. We expect to update\n this advisory to include 10.x for amd64 CPUs. Future FreeBSD\n releases will address this issue on i386 and other CPUs. \n freebsd-update will include changes on i386 as part of this\n update due to common code changes shared between amd64 and\n i386, however it contains no functional changes for i386 (in\n particular, it does not mitigate the issue on i386). \n\nFor general information regarding FreeBSD Security Advisories,\nincluding descriptions of the fields above, security branches, and the\nfollowing sections, please visit \u003cURL:https://security.FreeBSD.org/\u003e. \n\nII. Problem Description\n\nA number of issues relating to speculative execution were found last year\nand publicly announced January 3rd. Two of these, known as Meltdown and\nSpectre V2, are addressed here. \n\nCVE-2017-5754 (Meltdown)\n- ------------------------\n\nThis issue relies on an affected CPU speculatively executing instructions\nbeyond a faulting instruction. When this happens, changes to architectural\nstate are not committed, but observable changes may be left in micro-\narchitectural state (for example, cache). This may be used to infer\nprivileged data. \n\nCVE-2017-5715 (Spectre V2)\n- --------------------------\n\nSpectre V2 uses branch target injection to speculatively execute kernel code\nat an address under the control of an attacker. \n\nIII. Impact\n\nAn attacker may be able to read secret data from the kernel or from a\nprocess when executing untrusted code (for example, in a web browser). \n\nIV. Workaround\n\nNo workaround is available. \n\nV. Solution\n\nPerform one of the following:\n\n1) Upgrade your vulnerable system to a supported FreeBSD stable or\nrelease / security branch (releng) dated after the correction date,\nand reboot. \n\n2) To update your vulnerable system via a binary patch:\n\nSystems running a RELEASE version of FreeBSD on the i386 or amd64\nplatforms can be updated via the freebsd-update(8) utility, followed\nby a reboot into the new kernel:\n\n# freebsd-update fetch\n# freebsd-update install\n# shutdown -r now\n\n3) To update your vulnerable system via a source code patch:\n\nThe following patches have been verified to apply to the applicable\nFreeBSD release branches. \n\na) Download the relevant patch from the location below, and verify the\ndetached PGP signature using your PGP utility. \n\n[FreeBSD 11.1]\n# fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch\n# fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch.asc\n# gpg --verify speculative_execution-amd64-11.patch.asc\n\nb) Apply the patch. Execute the following commands as root:\n\n# cd /usr/src\n# patch \u003c /path/to/patch\n\nc) Recompile your kernel as described in\n\u003cURL:https://www.FreeBSD.org/handbook/kernelconfig.html\u003e and reboot the\nsystem. \n\nVI. Correction details\n\nCVE-2017-5754 (Meltdown)\n- ------------------------\n\nThe mitigation is known as Page Table Isolation (PTI). PTI largely separates\nkernel and user mode page tables, so that even during speculative execution\nmost of the kernel\u0027s data is unmapped and not accessible. A positive result is definitive\n(that is, the vulnerability exists with certainty). A negative result\nindicates either that the CPU is not affected, or that the test is not\ncapable of demonstrating the issue on the CPU (and may need to be modified). \n\nA patched kernel will automatically enable PTI on Intel CPUs. The status can\nbe checked via the vm.pmap.pti sysctl:\n\n# sysctl vm.pmap.pti\nvm.pmap.pti: 1\n\nThe default setting can be overridden by setting the loader tunable\nvm.pmap.pti to 1 or 0 in /boot/loader.conf. This setting takes effect only\nat boot. \n\nPTI introduces a performance regression. The observed performance loss is\nsignificant in microbenchmarks of system call overhead, but is much smaller\nfor many real workloads. \n\nCVE-2017-5715 (Spectre V2)\n- --------------------------\n\nThere are two common mitigations for Spectre V2. This patch includes a\nmitigation using Indirect Branch Restricted Speculation, a feature available\nvia a microcode update from processor manufacturers. The alternate\nmitigation, Retpoline, is a feature available in newer compilers. The\nfeasibility of applying Retpoline to stable branches and/or releases is under\ninvestigation. \n\nThe patch includes the IBRS mitigation for Spectre V2. To use the mitigation\nthe system must have an updated microcode; with older microcode a patched\nkernel will function without the mitigation. \n\nIBRS can be disabled via the hw.ibrs_disable sysctl (and tunable), and the\nstatus can be checked via the hw.ibrs_active sysctl. IBRS may be enabled or\ndisabled at runtime. Additional detail on microcode updates will follow. \n\nThe following list contains the correction revision numbers for each\naffected branch. \n\nBranch/path Revision\n- -------------------------------------------------------------------------\nstable/11/ r329462\nreleng/11.1/ r330908\n- -------------------------------------------------------------------------\n\nTo see which files were modified by a particular revision, run the\nfollowing command, replacing NNNNNN with the revision number, on a\nmachine with Subversion installed:\n\n# svn diff -cNNNNNN --summarize svn://svn.freebsd.org/base\n\nOr visit the following URL, replacing NNNNNN with the revision number:\n\n\u003cURL:https://svnweb.freebsd.org/base?view=revision\u0026revision=NNNNNN\u003e\n\nVII. 6.7) - i386, ppc64, s390x, x86_64\n\n3. \n\nSecurity Fix(es):\n\n* hw: cpu: speculative execution permission faults handling (CVE-2017-5754)\n\n* Kernel: error in exception handling leads to DoS (CVE-2018-8897)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n\nBug Fix(es):\n\n* The kernel build requirements have been updated to the GNU Compiler\nCollection (GCC) compiler version that has the support for Retpolines. The\nRetpolines mechanism is a software construct that leverages specific\nknowledge of the underlying hardware to mitigate the branch target\ninjection, also known as Spectre variant 2 vulnerability described in\nCVE-2017-5715. (BZ#1554253)\n\n4. \n\nCVE-2017-5754\n\n Multiple researchers have discovered a vulnerability in Intel\n processors, enabling an attacker controlling an unprivileged\n process to read memory from arbitrary addresses, including from\n the kernel and all other processes running on the system. \n\n This specific attack has been named Meltdown and is addressed in\n the Linux kernel for the Intel x86-64 architecture by a patch set\n named Kernel Page Table Isolation, enforcing a near complete\n separation of the kernel and userspace address maps and preventing\n the attack. This solution might have a performance impact, and can\n be disabled at boot time by passing `pti=off\u0027 to the kernel\n command line. \n\nCVE-2017-8824\n\n Mohamed Ghannam discovered that the DCCP implementation did not\n correctly manage resources when a socket is disconnected and\n reconnected, potentially leading to a use-after-free. \n\nCVE-2017-16538\n\n Andrey Konovalov reported that the dvb-usb-lmedm04 media driver\n did not correctly handle some error conditions during\n initialisation. \n\nCVE-2017-16939\n\n Mohamed Ghannam reported (through Beyond Security\u0027s SecuriTeam\n Secure Disclosure program) that the IPsec (xfrm) implementation\n did not correctly handle some failure cases when dumping policy\n information through netlink. \n\nCVE-2017-17448\n\n Kevin Cernekee discovered that the netfilter subsystem allowed\n users with the CAP_NET_ADMIN capability in any user namespace, not\n just the root namespace, to enable and disable connection tracking\n helpers. This could lead to denial of service, violation of\n network security policy, or have other impact. \n\nCVE-2017-17449\n\n Kevin Cernekee discovered that the netlink subsystem allowed\n users with the CAP_NET_ADMIN capability in any user namespace\n to monitor netlink traffic in all net namespaces, not just\n those owned by that user namespace. \n\nCVE-2017-17450\n\n Kevin Cernekee discovered that the xt_osf module allowed users\n with the CAP_NET_ADMIN capability in any user namespace to modify\n the global OS fingerprint list. \n\nCVE-2017-17558\n\n Andrey Konovalov reported that that USB core did not correctly\n handle some error conditions during initialisation. \n\nCVE-2017-17741\n\n Dmitry Vyukov reported that the KVM implementation for x86 would\n over-read data from memory when emulating an MMIO write if the\n kvm_mmio tracepoint was enabled. \n\nCVE-2017-17805\n\n Dmitry Vyukov reported that the KVM implementation for x86 would\n over-read data from memory when emulating an MMIO write if the\n kvm_mmio tracepoint was enabled. \n\nCVE-2017-17807\n\n Eric Biggers discovered that the KEYS subsystem lacked a check for\n write permission when adding keys to a process\u0027s default keyring. \n\nCVE-2017-1000410\n\n Ben Seri reported that the Bluetooth subsystem did not correctly\n handle short EFS information elements in L2CAP messages. \n\nFor the oldstable distribution (jessie), these problems have been fixed\nin version 3.16.51-3+deb8u1. \n\nFor the detailed security status of linux please refer to its security\ntracker page at:\nhttps://security-tracker.debian.org/tracker/linux\n\nFurther information about Debian Security Advisories, how to apply\nthese updates to your system and frequently asked questions can be\nfound at: https://www.debian.org/security/\n\nMailing list: debian-security-announce@lists.debian.org\n-----BEGIN PGP SIGNATURE-----\n\niQKTBAEBCgB9FiEERkRAmAjBceBVMd3uBUy48xNDz0QFAlpU5cRfFIAAAAAALgAo\naXNzdWVyLWZwckBub3RhdGlvbnMub3BlbnBncC5maWZ0aGhvcnNlbWFuLm5ldDQ2\nNDQ0MDk4MDhDMTcxRTA1NTMxRERFRTA1NENCOEYzMTM0M0NGNDQACgkQBUy48xND\nz0Qsnw//euNWKwOR4R+JFEyKECrS5GHFzLdj1kpion3oGGZyyJ8VjmVv+MombQPk\nxk17ge5QWl44CMzXlkE6QREdrXQfed49us9O6CzS2BPwV/QWsoUc7WLmqYD0OQmh\nc5/RqvkzUfXzEJ7efLzChXAs94RB0A9kOKoRxNrXfdhvevM+FumB17dErIrT2nxP\nKcX3Tyh05twrJqCnbNIo189LDexKfEyAN9pnwBekknzXB0V3zmvPwebVz85v1I8p\naiWSXX9EjWvVeZG31XDOysEcrwO4T71zqCgPxPeurAOVTJNvK0B8je7wFBD9ayoy\nPFNdykxRUBA9rBJ8Aoi3zcZBJYxTYBzOKDUkPaO/80mflsN6yDCaWwQ+antyuQ8y\njO02bAEZiKmpsuclKvK48rfvtoFqXsp6WhO1NoWnmpFvsxXN0DdqKRB60rycrMMA\nQ2wLYnPX2QNRNdxtkJ0D380VkTdPjJT4yOPM4UuIJ1S7jwzVcQKnu8VswdFey0nq\nk42DigyVQryZd1elqiyGWWtNkJ9BRscSgkpCAfEUo2XCR61wEXu7aOHGksPuTTZr\n2FJGIa4OR1dAc2pPGy7CUWYnloGwSCCq7F85bi6v5KG7YnHlic/XnJva+hT+0lGT\n1HQlCKU9bicaLL0GIK9Qt5vaUseZLWiOXMHU6JKvo/y6AL3FHnI=\n=Ozoc\n-----END PGP SIGNATURE-----\n. ==========================================================================\nUbuntu Security Notice USN-3583-1\nFebruary 23, 2018\n\nlinux vulnerabilities\n==========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 14.04 LTS\n\nSummary:\n\nSeveral security issues were fixed in the Linux kernel. \n\nSoftware Description:\n- linux: Linux kernel\n\nDetails:\n\nIt was discovered that an out-of-bounds write vulnerability existed in the\nFlash-Friendly File System (f2fs) in the Linux kernel. An attacker could\nconstruct a malicious file system that, when mounted, could cause a denial\nof service (system crash) or possibly execute arbitrary code. \n(CVE-2017-0750)\n\nIt was discovered that a race condition leading to a use-after-free\nvulnerability existed in the ALSA PCM subsystem of the Linux kernel. A\nlocal attacker could use this to cause a denial of service (system crash)\nor possibly execute arbitrary code. (CVE-2017-0861)\n\nIt was discovered that the KVM implementation in the Linux kernel allowed\npassthrough of the diagnostic I/O port 0x80. An attacker in a guest VM\ncould use this to cause a denial of service (system crash) in the host OS. \n(CVE-2017-1000407)\n\nBo Zhang discovered that the netlink wireless configuration interface in\nthe Linux kernel did not properly validate attributes when handling certain\nrequests. A local attacker with the CAP_NET_ADMIN could use this to cause a\ndenial of service (system crash). (CVE-2017-12153)\n\nVitaly Mayatskikh discovered that the SCSI subsystem in the Linux kernel\ndid not properly track reference counts when merging buffers. A local\nattacker could use this to cause a denial of service (memory exhaustion). \n(CVE-2017-12190)\n\nIt was discovered that the key management subsystem in the Linux kernel did\nnot properly restrict key reads on negatively instantiated keys. A local\nattacker could use this to cause a denial of service (system crash). \n(CVE-2017-12192)\n\nIt was discovered that an integer overflow existed in the sysfs interface\nfor the QLogic 24xx+ series SCSI driver in the Linux kernel. A local\nprivileged attacker could use this to cause a denial of service (system\ncrash). (CVE-2017-14051)\n\nOtto Ebeling discovered that the memory manager in the Linux kernel did not\nproperly check the effective UID in some situations. (CVE-2017-14140)\n\nIt was discovered that the ATI Radeon framebuffer driver in the Linux\nkernel did not properly initialize a data structure returned to user space. (CVE-2017-14156)\n\nChunYu Wang discovered that the iSCSI transport implementation in the Linux\nkernel did not properly validate data structures. A local attacker could\nuse this to cause a denial of service (system crash). (CVE-2017-14489)\n\nJames Patrick-Evans discovered a race condition in the LEGO USB Infrared\nTower driver in the Linux kernel. A physically proximate attacker could use\nthis to cause a denial of service (system crash) or possibly execute\narbitrary code. (CVE-2017-15102)\n\nChunYu Wang discovered that a use-after-free vulnerability existed in the\nSCTP protocol implementation in the Linux kernel. A local attacker could\nuse this to cause a denial of service (system crash) or possibly execute\narbitrary code, (CVE-2017-15115)\n\nIt was discovered that the key management subsystem in the Linux kernel did\nnot properly handle NULL payloads with non-zero length values. A local\nattacker could use this to cause a denial of service (system crash). \n(CVE-2017-15274)\n\nIt was discovered that the Bluebooth Network Encapsulation Protocol (BNEP)\nimplementation in the Linux kernel did not validate the type of socket\npassed in the BNEPCONNADD ioctl(). A local attacker with the CAP_NET_ADMIN\nprivilege could use this to cause a denial of service (system crash) or\npossibly execute arbitrary code. (CVE-2017-15868)\n\nAndrey Konovalov discovered a use-after-free vulnerability in the USB\nserial console driver in the Linux kernel. A physically proximate attacker\ncould use this to cause a denial of service (system crash) or possibly\nexecute arbitrary code. (CVE-2017-16525)\n\nIt was discovered that the netfilter passive OS fingerprinting (xt_osf)\nmodule did not properly perform access control checks. A local attacker\ncould improperly modify the systemwide OS fingerprint list. \n(CVE-2017-17450)\n\nIt was discovered that the HMAC implementation did not validate the state\nof the underlying cryptographic hash algorithm. A local attacker could use\nthis to cause a denial of service (system crash) or possibly execute\narbitrary code. (CVE-2017-17806)\n\nDenys Fedoryshchenko discovered a use-after-free vulnerability in the\nnetfilter xt_TCPMSS filter of the Linux kernel. A remote attacker could use\nthis to cause a denial of service (system crash). (CVE-2017-18017)\n\nGareth Evans discovered that the shm IPC subsystem in the Linux kernel did\nnot properly restrict mapping page zero. A local privileged attacker could\nuse this to execute arbitrary code. (CVE-2017-5669)\n\nIt was discovered that an integer overflow vulnerability existing in the\nIPv6 implementation in the Linux kernel. A local attacker could use this to\ncause a denial of service (infinite loop). (CVE-2017-7542)\n\nTommi Rantala and Brad Spengler discovered that the memory manager in the\nLinux kernel did not properly enforce the CONFIG_STRICT_DEVMEM protection\nmechanism. A local attacker with access to /dev/mem could use this to\nexpose sensitive information or possibly execute arbitrary code. \n(CVE-2017-7889)\n\nMohamed Ghannam discovered a use-after-free vulnerability in the DCCP\nprotocol implementation in the Linux kernel. A local attacker could use\nthis to cause a denial of service (system crash) or possibly execute\narbitrary code. (CVE-2017-8824)\n\nMohamed Ghannam discovered a null pointer dereference in the RDS (Reliable\nDatagram Sockets) protocol implementation of the Linux kernel. A local\nattacker could use this to cause a denial of service (system crash). \n(CVE-2018-5333)\n\nee3/4ePS discovered that a race condition existed in loop block device\nimplementation in the Linux kernel. A local attacker could use this to\ncause a denial of service (system crash) or possibly execute arbitrary\ncode. (CVE-2018-5344)\n\nUSN-3524-1 mitigated CVE-2017-5754 (Meltdown) for the amd64\narchitecture in Ubuntu 14.04 LTS. This update provides the\ncorresponding mitigations for the ppc64el architecture. This flaw is known as Meltdown. \n (CVE-2017-5754)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 14.04 LTS:\n linux-image-3.13.0-142-generic 3.13.0-142.191\n linux-image-3.13.0-142-generic-lpae 3.13.0-142.191\n linux-image-3.13.0-142-lowlatency 3.13.0-142.191\n linux-image-3.13.0-142-powerpc-e500 3.13.0-142.191\n linux-image-3.13.0-142-powerpc-e500mc 3.13.0-142.191\n linux-image-3.13.0-142-powerpc-smp 3.13.0-142.191\n linux-image-3.13.0-142-powerpc64-emb 3.13.0-142.191\n linux-image-3.13.0-142-powerpc64-smp 3.13.0-142.191\n linux-image-generic 3.13.0.142.152\n linux-image-generic-lpae 3.13.0.142.152\n linux-image-lowlatency 3.13.0.142.152\n linux-image-powerpc-e500 3.13.0.142.152\n linux-image-powerpc-e500mc 3.13.0.142.152\n linux-image-powerpc-smp 3.13.0.142.152\n linux-image-powerpc64-emb 3.13.0.142.152\n linux-image-powerpc64-smp 3.13.0.142.152\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes. \n\nATTENTION: Due to an unavoidable ABI change the kernel updates have\nbeen given a new version number, which requires you to recompile and\nreinstall all third party kernel modules you might have installed. \nUnless you manually uninstalled the standard kernel metapackages\n(e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual,\nlinux-powerpc), a standard system upgrade will automatically perform\nthis as well. \n\nReferences:\n https://usn.ubuntu.com/usn/usn-3583-1\n CVE-2017-0750, CVE-2017-0861, CVE-2017-1000407, CVE-2017-12153,\n CVE-2017-12190, CVE-2017-12192, CVE-2017-14051, CVE-2017-14140,\n CVE-2017-14156, CVE-2017-14489, CVE-2017-15102, CVE-2017-15115,\n CVE-2017-15274, CVE-2017-15868, CVE-2017-16525, CVE-2017-17450,\n CVE-2017-17806, CVE-2017-18017, CVE-2017-5669, CVE-2017-5754,\n CVE-2017-7542, CVE-2017-7889, CVE-2017-8824, CVE-2018-5333,\n CVE-2018-5344\n\nPackage Information:\n https://launchpad.net/ubuntu/+source/linux/3.13.0-142.191\n\n", "sources": [ { "db": "NVD", "id": "CVE-2017-5754" }, { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "BID", "id": "102378" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "PACKETSTORM", "id": "145642" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145810" }, { "db": "PACKETSTORM", "id": "145667" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "147539" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "PACKETSTORM", "id": "145799" }, { "db": "PACKETSTORM", "id": "146534" } ], "trust": 3.51 }, "exploit_availability": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "reference": "https://www.scap.org.cn/vuln/vhn-113957", "trust": 0.1, "type": "unknown" } ], "sources": [ { "db": "VULHUB", "id": "VHN-113957" } ] }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2017-5754", "trust": 3.1 }, { "db": "CERT/CC", "id": "VU#584653", "trust": 2.2 }, { "db": "BID", "id": "102378", "trust": 2.0 }, { "db": "CERT/CC", "id": "VU#180049", "trust": 1.9 }, { "db": "SECTRACK", "id": "1040071", "trust": 1.1 }, { "db": "SIEMENS", "id": "SSA-608355", "trust": 1.1 }, { "db": "LENOVO", "id": "LEN-18282", "trust": 1.1 }, { "db": "BID", "id": "106128", "trust": 1.1 }, { "db": "CERT@VDE", "id": "VDE-2018-003", "trust": 1.1 }, { "db": "CERT@VDE", "id": "VDE-2018-002", "trust": 1.1 }, { "db": "USCERT", "id": "TA18-141A", "trust": 0.8 }, { "db": "CNVD", "id": "CNVD-2018-00303", "trust": 0.6 }, { "db": "ICS CERT ALERT", "id": "ICS-ALERT-18-011-01E", "trust": 0.3 }, { "db": "ICS CERT ALERT", "id": "ICS-ALERT-18-011-01C", "trust": 0.3 }, { "db": "JUNIPER", "id": "JSA10842", "trust": 0.3 }, { "db": "SIEMENS", "id": "SSA-168644", "trust": 0.3 }, { "db": "JVN", "id": "JVNVU93823979", "trust": 0.3 }, { "db": "PACKETSTORM", "id": "145810", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "145824", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145794", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145804", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145836", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146067", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145796", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145795", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145695", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145811", "trust": 0.1 }, { "db": "CNNVD", "id": "CNNVD-201801-151", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-113957", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145642", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145964", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145667", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145809", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146762", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147539", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145651", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145654", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145799", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146534", "trust": 0.1 } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "BID", "id": "102378" }, { "db": "PACKETSTORM", "id": "145642" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145810" }, { "db": "PACKETSTORM", "id": "145667" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "147539" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "PACKETSTORM", "id": "145799" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "id": "VAR-201801-1711", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" } ], "trust": 1.3069532926666667 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "Network device" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-00303" } ] }, "last_update_date": "2024-09-19T21:53:35.827000Z", "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-200", "trust": 1.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-113957" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.2, "url": "http://www.kb.cert.org/vuls/id/584653" }, { "trust": 1.9, "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "trust": 1.8, "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "trust": 1.7, "url": "http://www.securityfocus.com/bid/102378" }, { "trust": 1.6, "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "trust": 1.6, "url": "https://support.apple.com//ht208394" }, { "trust": 1.6, "url": "http://www.dell.com/support/speculative-store-bypass" }, { "trust": 1.4, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180104-cpusidechannel" }, { "trust": 1.4, "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "trust": 1.4, "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "trust": 1.4, "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180002" }, { "trust": 1.4, "url": "https://support.hpe.com/hpsc/doc/public/display?docid=emr_na-hpesbhf03805en_us" }, { "trust": 1.4, "url": "https://meltdownattack.com/" }, { "trust": 1.4, "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" }, { "trust": 1.1, "url": "http://www.securityfocus.com/bid/106128" }, { "trust": 1.1, "url": "https://www.kb.cert.org/vuls/id/180049" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "trust": 1.1, "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2018-001.txt" }, { "trust": 1.1, "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2019-003.txt" }, { "trust": 1.1, "url": "https://aws.amazon.com/de/security/security-bulletins/aws-2018-013/" }, { "trust": 1.1, "url": "https://cdrdv2.intel.com/v1/dl/getcontent/685358" }, { "trust": 1.1, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "trust": 1.1, "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "trust": 1.1, "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "trust": 1.1, "url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0" }, { "trust": 1.1, "url": "https://help.ecostruxureit.com/display/public/uadco8x/struxureware+data+center+operation+software+vulnerability+fixes" }, { "trust": 1.1, "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "trust": 1.1, "url": "https://source.android.com/security/bulletin/2018-04-01" }, { "trust": 1.1, "url": "https://support.citrix.com/article/ctx231399" }, { "trust": 1.1, "url": "https://support.citrix.com/article/ctx234679" }, { "trust": 1.1, "url": "https://support.f5.com/csp/article/k91229003" }, { "trust": 1.1, "url": "https://support.lenovo.com/us/en/solutions/len-18282" }, { "trust": 1.1, "url": "https://www.codeaurora.org/security-bulletin/2018/07/02/july-2018-code-aurora-security-bulletin" }, { "trust": 1.1, "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "trust": 1.1, "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "trust": 1.1, "url": "https://www.synology.com/support/security/synology_sa_18_01" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4078" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4082" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4120" }, { "trust": 1.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-18:03.speculative_execution.asc" }, { "trust": 1.1, "url": "https://security.gentoo.org/glsa/201810-06" }, { "trust": 1.1, "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "trust": 1.1, "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "trust": 1.1, "url": "https://www.oracle.com/security-alerts/cpuapr2020.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/01/msg00004.html" }, { "trust": 1.1, "url": "https://access.redhat.com/errata/rhsa-2018:0292" }, { "trust": 1.1, "url": "http://www.securitytracker.com/id/1040071" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3522-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3522-3/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3522-4/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3523-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3523-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3524-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3525-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3540-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3541-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3583-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3597-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3597-2/" }, { "trust": 1.0, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026docid=emr_na-hpesbhf03871en_us" }, { "trust": 0.8, "url": "https://vuls.cert.org/confluence/display/wiki/vulnerabilities+associated+with+cpu+speculative+execution" }, { "trust": 0.8, "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "trust": 0.8, "url": "https://developer.amd.com/wp-content/resources/124441_amd64_speculativestorebypassdisable_whitepaper_final.pdf" }, { "trust": 0.8, "url": "https://www.us-cert.gov/ncas/alerts/ta18-141a" }, { "trust": 0.8, "url": "http://cwe.mitre.org/data/definitions/208.html" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/c5/63/336996-speculative-execution-side-channel-mitigations.pdf" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/b9/f9/336983-intel-analysis-of-speculative-execution-side-channels-white-paper.pdf" }, { "trust": 0.8, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180521-cpusidechannel" }, { "trust": 0.8, "url": "https://fortiguard.com/psirt/fg-ir-18-002" }, { "trust": 0.8, "url": "https://support.hp.com/us-en/document/c06001626" }, { "trust": 0.8, "url": "http://www.hitachi.com/hirt/publications/hirt-pub18001/" }, { "trust": 0.8, "url": "https://www.ibm.com/blogs/psirt/potential-impact-processors-power-family/" }, { "trust": 0.8, "url": "https://docs.microsoft.com/en-us/cpp/security/developer-guidance-speculative-execution" }, { "trust": 0.8, "url": "https://access.redhat.com/security/vulnerabilities/ssbd" }, { "trust": 0.8, "url": "https://www.suse.com/support/kb/doc/?id=7022937" }, { "trust": 0.8, "url": "https://www.synology.com/en-global/support/security/synology_sa_18_23" }, { "trust": 0.8, "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/variant4" }, { "trust": 0.8, "url": "https://kb.vmware.com/s/article/54951" }, { "trust": 0.8, "url": "https://aws.amazon.com/security/security-bulletins/aws-2018-015/" }, { "trust": 0.8, "url": "https://access.redhat.com/security/cve/cve-2017-5754" }, { "trust": 0.6, "url": "https://www.bleepingcomputer.com/news/security/list-of-meltdown-and-spectre-vulnerability-advisories-patches-and-updates/" }, { "trust": 0.6, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5754" }, { "trust": 0.5, "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce" }, { "trust": 0.5, "url": "https://access.redhat.com/articles/11258" }, { "trust": 0.5, "url": "https://bugzilla.redhat.com/):" }, { "trust": 0.5, "url": "https://access.redhat.com/security/team/key/" }, { "trust": 0.5, "url": "https://access.redhat.com/security/team/contact/" }, { "trust": 0.5, "url": "https://access.redhat.com/security/updates/classification/#important" }, { "trust": 0.4, "url": "https://access.redhat.com/errata/rhsa-2018:0007" }, { "trust": 0.4, "url": "https://access.redhat.com/errata/rhsa-2018:0017" }, { "trust": 0.4, "url": "https://access.redhat.com/security/cve/cve-2017-5753" }, { "trust": 0.4, "url": "https://access.redhat.com/security/cve/cve-2017-5715" }, { "trust": 0.3, "url": "http://www.amd.com/en-gb" }, { "trust": 0.3, "url": "https://www.arm.com/" }, { "trust": 0.3, "url": "http://www.intel.com/content/www/us/en/homepage.html" }, { "trust": 0.3, "url": "https://newsroom.intel.com/news/intel-responds-to-security-research-findings/" }, { "trust": 0.3, "url": "https://lwn.net/articles/738975/" }, { "trust": 0.3, "url": "https://kb.juniper.net/infocenter/index?page=content\u0026id=jsa10842\u0026cat=sirt_1\u0026actp=list" }, { "trust": 0.3, "url": "https://support.apple.com/en-us/ht208394" }, { "trust": 0.3, "url": "https://www.chromium.org/home/chromium-security/ssca" }, { "trust": 0.3, "url": "https://www.amd.com/en/corporate/speculative-execution" }, { "trust": 0.3, "url": "https://source.android.com/security/bulletin/2018-01-01" }, { "trust": 0.3, "url": "https://lists.apple.com/archives/security-announce/2018/jan/msg00001.html" }, { "trust": 0.3, "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1519781" }, { "trust": 0.3, "url": "https://support.google.com/faqs/answer/7622138" }, { "trust": 0.3, "url": "http://aix.software.ibm.com/aix/efixes/security/spectre_meltdown_advisory.asc" }, { "trust": 0.3, "url": "https://ics-cert.us-cert.gov/alerts/ics-alert-18-011-01c" }, { "trust": 0.3, "url": "https://ics-cert.us-cert.gov/alerts/ics-alert-18-011-01e" }, { "trust": 0.3, "url": "https://securityadvisories.paloaltonetworks.com/home/detail/120" }, { "trust": 0.3, "url": "https://jvn.jp/vu/jvnvu93823979/index.html" }, { "trust": 0.3, "url": "https://www.reddit.com/r/linux/comments/7npnd4/kernel_41411_is_out_with_patches_for_intel_cpu/" }, { "trust": 0.3, "url": "http://www.oracle.com/technetwork/security-advisory/cpujan2018-3236628.html" }, { "trust": 0.3, "url": "https://www.oracle.com/technetwork/topics/security/ovmbulletinapr2018-4431088.html" }, { "trust": 0.3, "url": "http://www.bd.com/en-us/support/product-security-and-privacy/product-security-bulletin-for-meltdown-and-spectre-update-1" }, { "trust": 0.3, "url": "https://googleprojectzero.blogspot.in/2018/01/reading-privileged-memory-with-side.html" }, { "trust": 0.3, "url": "https://access.redhat.com/errata/rhsa-2018:0008" }, { "trust": 0.3, "url": "https://access.redhat.com/errata/rhsa-2018:0009" }, { "trust": 0.3, "url": "https://access.redhat.com/errata/rhsa-2018:0010" }, { "trust": 0.3, "url": "https://access.redhat.com/errata/rhsa-2018:0011" }, { "trust": 0.3, "url": "https://access.redhat.com/errata/rhsa-2018:0016" }, { "trust": 0.3, "url": "https://www.symantec.com/security-center/network-protection-security-advisories/sa161" }, { "trust": 0.3, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-168644.pdf" }, { "trust": 0.3, "url": "https://chromereleases.googleblog.com/2018/03/stable-channel-update-for-chrome-os_19.html" }, { "trust": 0.3, "url": "https://lists.vmware.com/pipermail/security-announce/2018/000397.html" }, { "trust": 0.3, "url": "https://www.vmware.com/security/advisories/vmsa-2018-0007.html" }, { "trust": 0.3, "url": "https://developer.arm.com/support/security-update" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5715" }, { "trust": 0.2, "url": "https://support.hpe.com/hpsc/doc/public/display?docid=emr_na-a00039267en_us\u003e" }, { "trust": 0.2, "url": "https://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026langu" }, { "trust": 0.2, "url": "https://h20564.www2.hpe.com/hpsc/doc/public/display?docid=emr_na-hpesbhf03805en_us" }, { "trust": 0.2, "url": "http://www.hpe.com/support/security_bulletin_archive" }, { "trust": 0.2, "url": "https://www.hpe.com/info/report-security-vulnerability" }, { "trust": 0.2, "url": "http://www.hpe.com/support/subscriber_choice" }, { "trust": 0.2, "url": "https://developer.arm.com/support/security-update\u003e" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5753" }, { "trust": 0.2, "url": "http://www.amd.com/en/corporate/speculative-execution\u003e" }, { "trust": 0.2, "url": "https://h20564.www2.hpe.com/hpsc/doc/public/display?docid=emr_na-c01345499" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17806" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-8824" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-1000407" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15868" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17450" }, { "trust": 0.1, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026amp;docid=emr_na-hpesbhf03871en_us" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3524-1" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3524-2" }, { "trust": 0.1, "url": "https://security.freebsd.org/patches/sa-18:03/speculative_execution-amd64-11.patch" }, { "trust": 0.1, "url": "https://security.freebsd.org/\u003e." }, { "trust": 0.1, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5715\u003e" }, { "trust": 0.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-18:03.speculative_execution.asc\u003e" }, { "trust": 0.1, "url": "https://www.freebsd.org/handbook/kernelconfig.html\u003e" }, { "trust": 0.1, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5754\u003e" }, { "trust": 0.1, "url": "https://svnweb.freebsd.org/base?view=revision\u0026revision=nnnnnn\u003e" }, { "trust": 0.1, "url": "https://github.com/dag-erling/meltdown." }, { "trust": 0.1, "url": "https://security.freebsd.org/patches/sa-18:03/speculative_execution-amd64-11.patch.asc" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-8897" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-8897" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:1346" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0018" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0020" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-16939" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17741" }, { "trust": 0.1, "url": "https://www.debian.org/security/faq" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-16538" }, { "trust": 0.1, "url": "https://security-tracker.debian.org/tracker/linux" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-1000410" }, { "trust": 0.1, "url": "https://www.debian.org/security/" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17448" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17807" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17805" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17558" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17449" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-0750" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12192" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12153" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5344" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14140" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7889" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14489" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-0861" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5333" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15274" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15115" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux/3.13.0-142.191" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14156" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-16525" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18017" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15102" }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3583-1" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7542" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14051" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5669" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12190" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "BID", "id": "102378" }, { "db": "PACKETSTORM", "id": "145642" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145810" }, { "db": "PACKETSTORM", "id": "145667" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "147539" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "PACKETSTORM", "id": "145799" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "BID", "id": "102378" }, { "db": "PACKETSTORM", "id": "145642" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145810" }, { "db": "PACKETSTORM", "id": "145667" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "147539" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "PACKETSTORM", "id": "145799" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-05-21T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-01-04T00:00:00", "db": "CNVD", "id": "CNVD-2018-00303" }, { "date": "2018-01-04T00:00:00", "db": "VULHUB", "id": "VHN-113957" }, { "date": "2018-01-03T00:00:00", "db": "BID", "id": "102378" }, { "date": "2018-01-04T01:21:13", "db": "PACKETSTORM", "id": "145642" }, { "date": "2018-01-18T20:41:22", "db": "PACKETSTORM", "id": "145964" }, { "date": "2018-01-11T02:32:44", "db": "PACKETSTORM", "id": "145810" }, { "date": "2018-01-04T17:53:11", "db": "PACKETSTORM", "id": "145667" }, { "date": "2018-01-11T02:31:24", "db": "PACKETSTORM", "id": "145809" }, { "date": "2018-03-14T14:01:12", "db": "PACKETSTORM", "id": "146762" }, { "date": "2018-05-08T23:52:05", "db": "PACKETSTORM", "id": "147539" }, { "date": "2018-01-04T17:50:36", "db": "PACKETSTORM", "id": "145651" }, { "date": "2018-01-04T17:51:10", "db": "PACKETSTORM", "id": "145654" }, { "date": "2018-01-10T00:58:51", "db": "PACKETSTORM", "id": "145799" }, { "date": "2018-02-23T16:10:12", "db": "PACKETSTORM", "id": "146534" }, { "date": "2018-01-04T13:29:00.303000", "db": "NVD", "id": "CVE-2017-5754" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-06-19T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-01-11T00:00:00", "db": "CNVD", "id": "CNVD-2018-00303" }, { "date": "2021-11-19T00:00:00", "db": "VULHUB", "id": "VHN-113957" }, { "date": "2019-04-17T07:00:00", "db": "BID", "id": "102378" }, { "date": "2021-11-19T18:15:08.547000", "db": "NVD", "id": "CVE-2017-5754" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "local", "sources": [ { "db": "BID", "id": "102378" }, { "db": "PACKETSTORM", "id": "145810" }, { "db": "PACKETSTORM", "id": "146534" } ], "trust": 0.5 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "CPU hardware utilizing speculative execution may be vulnerable to cache side-channel attacks", "sources": [ { "db": "CERT/CC", "id": "VU#180049" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Design Error", "sources": [ { "db": "BID", "id": "102378" } ], "trust": 0.3 } }
var-201910-1595
Vulnerability from variot
Affected devices improperly handle large amounts of specially crafted UDP packets.
This could allow an unauthenticated remote attacker to trigger a denial of service condition. Several Siemens products are vulnerable to resource exhaustion.Denial of service (DoS) May be in a state. Siemens SIMATIC CFU PA and so on are the products of Germany's Siemens company. Siemens SIMATIC CFU PA is a compact field device. SIMATIC ET 200AL is a distributed I / O system module. SIMATIC ET 200M is a modular I / O system module for control cabinets for high density channel applications. A vulnerability has been identified in Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200 (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P (All versions), SIMATIC CFU PA (All versions < V1.2.0), SIMATIC ET 200AL (All versions), SIMATIC ET 200M (All versions), SIMATIC ET 200MP IM 155-5 PN BA (All versions < V4.3.0), SIMATIC ET 200MP IM 155-5 PN HF (All versions), SIMATIC ET 200MP IM 155-5 PN ST (All versions), SIMATIC ET 200S (All versions), SIMATIC ET 200SP IM 155-6 PN BA (All versions), SIMATIC ET 200SP IM 155-6 PN HA (All versions), SIMATIC ET 200SP IM 155-6 PN HF (All versions < V4.2.2), SIMATIC ET 200SP IM 155-6 PN HS (All versions), SIMATIC ET 200SP IM 155-6 PN ST (All versions), SIMATIC ET 200SP IM 155-6 PN/2 HF (All versions < V4.2.2), SIMATIC ET 200SP IM 155-6 PN/3 HF (All versions < V4.2.1), SIMATIC ET 200ecoPN (except 6ES7148-6JD00-0AB0 and 6ES7146-6FF00-0AB0) (All versions), SIMATIC ET 200pro (All versions), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions), SIMATIC HMI Comfort Panels 4" - 22" (All versions), SIMATIC HMI KTP Mobile Panels (All versions), SIMATIC PN/PN Coupler (All versions), SIMATIC PROFINET Driver (All versions < V2.1), SIMATIC S7-1200 CPU family (incl. F) (All versions), SIMATIC S7-1500 CPU family (incl. F) (All versions < V2.0), SIMATIC S7-300 CPU family (incl. F) (All versions), SIMATIC S7-400 PN/DP V7 (incl. F) (All versions), SIMATIC S7-400 V6 (incl F) and below (All versions), SIMATIC S7-400H V6 (All versions < V6.0.9), SIMATIC S7-410 V8 (All versions), SIMATIC WinAC RTX (F) 2010 (All versions < SIMATIC WinAC RTX 2010 SP3), SINAMICS DCM (All versions < V1.5 HF1), SINAMICS DCP (All versions), SINAMICS G110M V4.7 (PN Control Unit) (All versions < V4.7 SP10 HF5), SINAMICS G120 V4.7 (PN Control Unit) (All versions < V4.7 SP10 HF5), SINAMICS G130 V4.7 (Control Unit) (All versions < 4.8), SINAMICS G150 (Control Unit) (All versions < 4.8), SINAMICS GH150 V4.7 (Control Unit) (All versions), SINAMICS GL150 V4.7 (Control Unit) (All versions), SINAMICS GM150 V4.7 (Control Unit) (All versions), SINAMICS S110 (Control Unit) (All versions), SINAMICS S120 V4.7 (Control Unit) (All versions), SINAMICS S150 (Control Unit) (All versions < 4.8), SINAMICS SL150 V4.7 (Control Unit) (All versions < V4.7 HF33), SINAMICS SM120 V4.7 (Control Unit) (All versions), SINUMERIK 828D (All versions < V4.8 SP5), SINUMERIK 840D sl (All versions). The security vulnerability could be exploited by an attacker with network access to the affected systems. Successful exploitation requires no system privileges and no user interaction. An attacker could use the vulnerability to compromise availability of the device. At the time of advisory publication no public exploitation of this security vulnerability was known. Siemens SIMATIC S7-1500 CPU, etc. SIMATIC S7-1500 CPU is a CPU (central processing unit) module. SIMATIC S7-1500 is a programmable logic controller. SINUMERIK 840D sl is a set of advanced machine tool numerical control system. The following products and versions are affected: Siemens SIMATIC S7-1500 CPU series (including: related ET200 CPUs and SIPLUS variants); SIMATIC S7-1500 Software Controller; SIMATIC TDC CP51M1; SIMATIC TDC CPU555; SINAMICS DCM, etc
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201910-1595", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic cfu pa", "scope": "lt", "trust": 1.6, "vendor": "siemens", "version": "1.2.0" }, { "model": "simatic profinet driver", "scope": "lt", "trust": 1.6, "vendor": "siemens", "version": "2.1" }, { "model": "dk standard ethernet controller", "scope": null, "trust": 1.4, "vendor": "siemens", "version": null }, { "model": "simatic et 200al", "scope": null, "trust": 1.4, "vendor": "siemens", "version": null }, { "model": "simatic et 200m", "scope": null, "trust": 1.4, "vendor": "siemens", "version": null }, { "model": "simatic et 200s", "scope": null, "trust": 1.4, "vendor": "siemens", "version": null }, { "model": null, "scope": "eq", "trust": 1.0, "vendor": "sinumerik 828d", "version": "4.8" }, { "model": "simatic s7-1500 cpu 1512c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "sinamics sl150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.7" }, { "model": "simatic s7-400 dp v7", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi comfort panels 22\\\"", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics g150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "simatic s7-1200 cpu 1211c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.4.0" }, { "model": "ek-ertec 200", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics g130", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "simatic et 200sp im 155-6 pn\\/2 hf", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.2.2" }, { "model": "simatic s7-1200 cpu 1212c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.4.0" }, { "model": "simatic s7-1200 cpu", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.4.0" }, { "model": "sinamics gm150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics dcp", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.3" }, { "model": "simatic s7-1500s cpu", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic s7-1500 cpu 1511c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic et 200m", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic s7-1500t cpu", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic s7-300 cpu 314", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "sinamics dcm", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.5" }, { "model": "simatic et 200ecopn", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinumerik 828d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics sl150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.7" }, { "model": "sinumerik 840d sl", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic et 200s", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic et 200sp im 155-6 pn hf", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.2.2" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic winac rtx \\", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "2010" }, { "model": "simatic s7-300 cpu 318-2", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "simatic et 200mp im 155-5 pn hf", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.4.0" }, { "model": "simatic pn\\/pn coupler", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.2.1" }, { "model": "sinamics g120", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics g110m", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.7" }, { "model": "simatic et 200pro", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic et 200mp im 155-5 pn ba", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.3.0" }, { "model": "sinamics s120", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "simatic hmi comfort panels 4\\\"", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic s7-1500 cpu 1518", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "sinamics dcm", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "1.5" }, { "model": "simatic s7-300 cpu 313", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "simatic et 200sp im 155-6 pn ha", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics g120", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics sm120", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "simatic et 200al", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic s7-1200 cpu 1214c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.4.0" }, { "model": "simatic et 200sp im 155-6 pn hs", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic et 200mp im 155-5 pn st", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics s120", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "simatic et 200sp im 155-6 pn ba", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "ek-ertec 200p", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.6" }, { "model": "dk standard ethernet controller", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics s110", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic s7-1500 cpu", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic s7-300 cpu 315-2 dp", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "sinamics s150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "sinumerik 828d", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic s7-300 cpu 312 ifm", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "simatic s7-400 v6", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.0.9" }, { "model": "simatic et 200sp im 155-6 pn\\/3 hf", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.2.1" }, { "model": "sinamics g110m", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.7" }, { "model": "simatic s7-400 pn v7", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics g150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "simatic s7-300 cpu 316-2 dp", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "simatic et 200sp im 155-6 pn st", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics g130", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "ek-ertec 200p", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.6" }, { "model": "simatic s7-400h v6", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.0.9" }, { "model": "simatic s7-300 cpu 315", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "sinamics gl150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics gm150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic s7-410 v8", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "8.2.2" }, { "model": "simatic s7-300 cpu 314 ifm", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "simatic s7-300 cpu", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "simatic hmi comfort outdoor panels 15\\\"", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics gl150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics s150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "simatic hmi comfort outdoor panels 7\\\"", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic winac rtx \\", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2010" }, { "model": "ek-ertec 200", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "ek-ertec 200p p", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic cfu pa", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic et 200mp im 155-5 pn ba", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic et 200mp im 155-5 pn hf", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic et 200mp im 155-5 pn st", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic s7-1200 cpu family", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "ek-ertec", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "200" }, { "model": "ek-ertec 200p", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic et 200mp im pn ba", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-5\u003c4.2.3" }, { "model": "simatic et 200mp im pn hf", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-5" }, { "model": "simatic et 200mp im pn st", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-5" }, { "model": "simatic et 200sp im pn ba", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6" }, { "model": "simatic et 200sp im pn ha", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6" }, { "model": "simatic et 200sp im pn hf", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6\u003c4.2.2" }, { "model": "simatic et 200sp im pn hs", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6" }, { "model": "simatic et 200sp im pn st", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6" }, { "model": "simatic et 200sp im pn/2 hf", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6\u003c4.2.2" }, { "model": "simatic et 200sp im pn/3 hf", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "155-6\u003c4.2.1" }, { "model": "simatic et 200ecopn", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic et 200pro", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort outdoor panels 7\" \u0026 15\"", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels 4\" 22\"", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic pn/pn coupler", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-1500 cpu family", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-300 cpu family", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-400 pn/dp", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v7" }, { "model": "simatic s7-400 and below", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v6" }, { "model": "simatic s7-400h", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v6\u003c6.0.9" }, { "model": "simatic s7-410", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v8" }, { "model": "simatic winac rtx", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "2010" }, { "model": "sinamics dcm", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics dcp", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics g110m sp10 hf5", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7\u003cv4.7" }, { "model": "sinamics g120 sp10 hf5", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7\u003cv4.7" }, { "model": "sinamics g130", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinamics g150", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics gh150", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinamics gl150", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinamics gm150", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinamics s110", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics s120", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinamics s150", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics sl150", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinamics sm120", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v4.7" }, { "model": "sinumerik 828d sp5", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v4.8" }, { "model": "sinumerik 840d sl", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "dk standard ethernet controller", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200s", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn ba", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn ha", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn hf", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn hs", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn st", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn 2 hf", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200sp im 155 6 pn 3 hf", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200ecopn", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200pro", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "ek ertec 200", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort outdoor panels 7", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort outdoor panels 15", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort panels 4", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort panels 22", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic pn pn coupler", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic profinet driver", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1200 cpu", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1200 cpu 1211c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1200 cpu 1212c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "ek ertec 200p", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1200 cpu 1214c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500 cpu", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500s cpu", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500t cpu", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500 cpu 1518", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500 cpu 1511c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500 cpu 1512c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 312 ifm", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 313", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic cfu pa", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 314", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 314 ifm", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 315", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 315 2 dp", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 316 2 dp", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300 cpu 318 2", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 400 pn v7", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 400 dp v7", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 400 v6", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 400h v6", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200al", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 410 v8", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic winac rtx f 2010", "version": null }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics dcm", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics dcm", "version": "1.5" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics dcp", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics g110m", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics g120", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics g130", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics g150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics gl150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics gm150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200m", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics s110", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics s120", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics s150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics sl150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics sm120", "version": null }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinumerik 828d", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinumerik 840d sl", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200mp im 155 5 pn ba", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200mp im 155 5 pn hf", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200mp im 155 5 pn st", "version": "*" } ], "sources": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "NVD", "id": "CVE-2019-10936" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:dk_standard_ethernet_controller_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:ek-ertec_200_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:ek-ertec_200p_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_cfu_pa_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200al_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200m_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200mp_im_155-5_pn_ba_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200mp_im_155-5_pn_hf_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200mp_im_155-5_pn_st_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200s_firmware", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-010605" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens reported this vulnerability to CISA.", "sources": [ { "db": "CNNVD", "id": "CNNVD-201910-639" } ], "trust": 0.6 }, "cve": "CVE-2019-10936", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CVE-2019-10936", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CNVD-2019-36853", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "IVD", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "ea2714fa-253a-4380-82d5-35652a5540fb", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.2, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.9 [IVD]" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "VHN-142532", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:L/AU:N/C:N/I:N/A:P", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "HIGH", "baseScore": 7.5, "baseSeverity": "HIGH", "confidentialityImpact": "NONE", "exploitabilityScore": 3.9, "id": "CVE-2019-10936", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 2.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.1" }, { "attackComplexity": "Low", "attackVector": "Network", "author": "NVD", "availabilityImpact": "High", "baseScore": 7.5, "baseSeverity": "High", "confidentialityImpact": "None", "exploitabilityScore": null, "id": "CVE-2019-10936", "impactScore": null, "integrityImpact": "None", "privilegesRequired": "None", "scope": "Unchanged", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2019-10936", "trust": 1.0, "value": "HIGH" }, { "author": "productcert@siemens.com", "id": "CVE-2019-10936", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2019-10936", "trust": 0.8, "value": "High" }, { "author": "CNVD", "id": "CNVD-2019-36853", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-201910-639", "trust": 0.6, "value": "HIGH" }, { "author": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb", "trust": 0.2, "value": "HIGH" }, { "author": "VULHUB", "id": "VHN-142532", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "VULHUB", "id": "VHN-142532" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "CNNVD", "id": "CNNVD-201910-639" }, { "db": "NVD", "id": "CVE-2019-10936" }, { "db": "NVD", "id": "CVE-2019-10936" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Affected devices improperly handle large amounts of specially crafted UDP packets. \r\n\r\nThis could allow an unauthenticated remote attacker to trigger a denial of service condition. Several Siemens products are vulnerable to resource exhaustion.Denial of service (DoS) May be in a state. Siemens SIMATIC CFU PA and so on are the products of Germany\u0027s Siemens company. Siemens SIMATIC CFU PA is a compact field device. SIMATIC ET 200AL is a distributed I / O system module. SIMATIC ET 200M is a modular I / O system module for control cabinets for high density channel applications. A vulnerability has been identified in Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200 (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P (All versions), SIMATIC CFU PA (All versions \u003c V1.2.0), SIMATIC ET 200AL (All versions), SIMATIC ET 200M (All versions), SIMATIC ET 200MP IM 155-5 PN BA (All versions \u003c V4.3.0), SIMATIC ET 200MP IM 155-5 PN HF (All versions), SIMATIC ET 200MP IM 155-5 PN ST (All versions), SIMATIC ET 200S (All versions), SIMATIC ET 200SP IM 155-6 PN BA (All versions), SIMATIC ET 200SP IM 155-6 PN HA (All versions), SIMATIC ET 200SP IM 155-6 PN HF (All versions \u003c V4.2.2), SIMATIC ET 200SP IM 155-6 PN HS (All versions), SIMATIC ET 200SP IM 155-6 PN ST (All versions), SIMATIC ET 200SP IM 155-6 PN/2 HF (All versions \u003c V4.2.2), SIMATIC ET 200SP IM 155-6 PN/3 HF (All versions \u003c V4.2.1), SIMATIC ET 200ecoPN (except 6ES7148-6JD00-0AB0 and 6ES7146-6FF00-0AB0) (All versions), SIMATIC ET 200pro (All versions), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions), SIMATIC HMI Comfort Panels 4\" - 22\" (All versions), SIMATIC HMI KTP Mobile Panels (All versions), SIMATIC PN/PN Coupler (All versions), SIMATIC PROFINET Driver (All versions \u003c V2.1), SIMATIC S7-1200 CPU family (incl. F) (All versions), SIMATIC S7-1500 CPU family (incl. F) (All versions \u003c V2.0), SIMATIC S7-300 CPU family (incl. F) (All versions), SIMATIC S7-400 PN/DP V7 (incl. F) (All versions), SIMATIC S7-400 V6 (incl F) and below (All versions), SIMATIC S7-400H V6 (All versions \u003c V6.0.9), SIMATIC S7-410 V8 (All versions), SIMATIC WinAC RTX (F) 2010 (All versions \u003c SIMATIC WinAC RTX 2010 SP3), SINAMICS DCM (All versions \u003c V1.5 HF1), SINAMICS DCP (All versions), SINAMICS G110M V4.7 (PN Control Unit) (All versions \u003c V4.7 SP10 HF5), SINAMICS G120 V4.7 (PN Control Unit) (All versions \u003c V4.7 SP10 HF5), SINAMICS G130 V4.7 (Control Unit) (All versions \u003c 4.8), SINAMICS G150 (Control Unit) (All versions \u003c 4.8), SINAMICS GH150 V4.7 (Control Unit) (All versions), SINAMICS GL150 V4.7 (Control Unit) (All versions), SINAMICS GM150 V4.7 (Control Unit) (All versions), SINAMICS S110 (Control Unit) (All versions), SINAMICS S120 V4.7 (Control Unit) (All versions), SINAMICS S150 (Control Unit) (All versions \u003c 4.8), SINAMICS SL150 V4.7 (Control Unit) (All versions \u003c V4.7 HF33), SINAMICS SM120 V4.7 (Control Unit) (All versions), SINUMERIK 828D (All versions \u003c V4.8 SP5), SINUMERIK 840D sl (All versions). The security vulnerability could be exploited by an attacker with network access to the affected systems. Successful exploitation requires no system privileges and no user interaction. An attacker could use the vulnerability to compromise availability of the device. At the time of advisory publication no public exploitation of this security vulnerability was known. Siemens SIMATIC S7-1500 CPU, etc. SIMATIC S7-1500 CPU is a CPU (central processing unit) module. SIMATIC S7-1500 is a programmable logic controller. SINUMERIK 840D sl is a set of advanced machine tool numerical control system. The following products and versions are affected: Siemens SIMATIC S7-1500 CPU series (including: related ET200 CPUs and SIPLUS variants); SIMATIC S7-1500 Software Controller; SIMATIC TDC CP51M1; SIMATIC TDC CPU555; SINAMICS DCM, etc", "sources": [ { "db": "NVD", "id": "CVE-2019-10936" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "VULHUB", "id": "VHN-142532" } ], "trust": 2.43 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2019-10936", "trust": 3.3 }, { "db": "SIEMENS", "id": "SSA-473245", "trust": 1.7 }, { "db": "ICS CERT", "id": "ICSA-19-283-02", "trust": 1.4 }, { "db": "CNNVD", "id": "CNNVD-201910-639", "trust": 0.9 }, { "db": "CNVD", "id": "CNVD-2019-36853", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2019-010605", "trust": 0.8 }, { "db": "AUSCERT", "id": "ESB-2019.3813", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.3813.3", "trust": 0.6 }, { "db": "IVD", "id": "EA2714FA-253A-4380-82D5-35652A5540FB", "trust": 0.2 }, { "db": "VULHUB", "id": "VHN-142532", "trust": 0.1 } ], "sources": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "VULHUB", "id": "VHN-142532" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "CNNVD", "id": "CNNVD-201910-639" }, { "db": "NVD", "id": "CVE-2019-10936" } ] }, "id": "VAR-201910-1595", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "VULHUB", "id": "VHN-142532" } ], "trust": 1.6334674204444446 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "ICS" ], "sub_category": null, "trust": 0.8 } ], "sources": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNVD", "id": "CNVD-2019-36853" } ] }, "last_update_date": "2024-08-14T15:38:42.839000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-473245", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-473245.pdf" }, { "title": "Patch for Multiple Siemens Product Denial of Service Vulnerabilities (CNVD-2019-36853)", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/186551" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-400", "trust": 1.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-142532" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "NVD", "id": "CVE-2019-10936" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-473245.pdf" }, { "trust": 1.4, "url": "https://www.us-cert.gov/ics/advisories/icsa-19-283-02" }, { "trust": 1.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-10936" }, { "trust": 1.2, "url": "https://vigilance.fr/vulnerability/simatic-denial-of-service-via-profinet-udp-packets-30562" }, { "trust": 1.0, "url": "https://cert-portal.siemens.com/productcert/html/ssa-473245.html" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-10936" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.3813/" }, { "trust": 0.6, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-19-283-02" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.3813.3/" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "VULHUB", "id": "VHN-142532" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "CNNVD", "id": "CNNVD-201910-639" }, { "db": "NVD", "id": "CVE-2019-10936" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNVD", "id": "CNVD-2019-36853" }, { "db": "VULHUB", "id": "VHN-142532" }, { "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "db": "CNNVD", "id": "CNNVD-201910-639" }, { "db": "NVD", "id": "CVE-2019-10936" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-10-23T00:00:00", "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "date": "2019-10-23T00:00:00", "db": "CNVD", "id": "CNVD-2019-36853" }, { "date": "2019-10-10T00:00:00", "db": "VULHUB", "id": "VHN-142532" }, { "date": "2019-10-17T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "date": "2019-10-09T00:00:00", "db": "CNNVD", "id": "CNNVD-201910-639" }, { "date": "2019-10-10T14:15:14.707000", "db": "NVD", "id": "CVE-2019-10936" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-10-23T00:00:00", "db": "CNVD", "id": "CNVD-2019-36853" }, { "date": "2023-01-10T00:00:00", "db": "VULHUB", "id": "VHN-142532" }, { "date": "2019-11-15T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-010605" }, { "date": "2023-05-10T00:00:00", "db": "CNNVD", "id": "CNNVD-201910-639" }, { "date": "2024-07-09T12:15:04.630000", "db": "NVD", "id": "CVE-2019-10936" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201910-639" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Multiple Siemens products vulnerable to resource depletion", "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-010605" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Resource management error", "sources": [ { "db": "IVD", "id": "ea2714fa-253a-4380-82d5-35652a5540fb" }, { "db": "CNNVD", "id": "CNNVD-201910-639" } ], "trust": 0.8 } }
var-201812-0344
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 4" - 22" (All versions < V15 Update 4), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions < V15 Update 4), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 and KTP900F (All versions < V15 Update 4), SIMATIC WinCC Runtime Advanced (All versions < V15 Update 4), SIMATIC WinCC Runtime Professional (All versions < V15 Update 4), SIMATIC WinCC (TIA Portal) (All versions < V15 Update 4), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The webserver of affected HMI devices may allow URL redirections to untrusted websites. An attacker must trick a valid user who is authenticated to the device into clicking on a malicious link to exploit the vulnerability. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains an open redirect vulnerability.Information may be obtained and information may be altered. Siemens SIMATIC HMI Comfort Panels are all Germany's Siemens (Siemens) company HMI software for control and monitoring of machines and equipment.
The webserver in several Siemens products has an open redirection vulnerability. Siemens SIMATIC Panels is prone to following security vulnerabilities: 1. An open-redirection vulnerability 2. A directory-traversal vulnerability Remote attackers may use a specially crafted request with directory-traversal sequences ('../') to retrieve arbitrary files from the affected system in the context of the application or by constructing a crafted URI and enticing a user to follow it and when an unsuspecting victim follows the link, they may be redirected to an attacker-controlled site
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201812-0344", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic wincc \\", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi comfort panels", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi mp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic wincc runtime", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi op", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi tp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lte", "trust": 1.0, "vendor": "siemens", "version": "15.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi classic devices", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort outdoor panels 7\" \u0026 15\" update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi comfort panels 4\"-22\" update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi ktp mobile panels update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc runtime advanced update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc runtime professional update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "154" }, { "model": null, "scope": "eq", "trust": 0.4, "vendor": "simatic wincc runtime", "version": "*" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime professional sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime professional sp2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime professional sp1 upd2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime professional sp update", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "1319" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime advanced sp1 upd2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced sp1 upd5", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc update", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v135" }, { "model": "simatic wincc sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v12" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v120" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v110" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15" }, { "model": "simatic wincc update", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v136" }, { "model": "simatic wincc sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v13" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v13" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v10" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "22" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi comfort panels sp1 upd2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic hmi comfort panels sp1 upd5", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi classic devices", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime professional update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc runtime advanced update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic wincc update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi ktp mobile panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi comfort panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi comfort outdoor panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort panels", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi mp", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi op", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort outdoor panels", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp400f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp700", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp700f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp900", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp900f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic wincc tia portal", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi tp", "version": "*" } ], "sources": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "NVD", "id": "CVE-2018-13813" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp400f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_%28tia_portal%29", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:wincc_runtime_advanced", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_runtime_professional", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-014526" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Hosni Tounsi from Carthage Red Team", "sources": [ { "db": "BID", "id": "105922" } ], "trust": 0.3 }, "cve": "CVE-2018-13813", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.8, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 8.6, "id": "CVE-2018-13813", "impactScore": 4.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:M/Au:N/C:P/I:P/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 7.8, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CNVD-2018-24247", "impactScore": 6.9, "integrityImpact": "COMPLETE", "severity": "HIGH", "trust": 0.6, "vectorString": "AV:N/AC:L/Au:N/C:N/I:C/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "IVD", "availabilityImpact": "NONE", "baseScore": 7.8, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "e30112c1-39ab-11e9-9eae-000c29342cb1", "impactScore": 6.9, "integrityImpact": "COMPLETE", "severity": "HIGH", "trust": 0.2, "vectorString": "AV:N/AC:L/Au:N/C:N/I:C/A:N", "version": "2.9 [IVD]" }, { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 5.8, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 8.6, "id": "VHN-123910", "impactScore": 4.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:M/AU:N/C:P/I:P/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 8.1, "baseSeverity": "HIGH", "confidentialityImpact": "HIGH", "exploitabilityScore": 2.8, "id": "CVE-2018-13813", "impactScore": 5.2, "integrityImpact": "HIGH", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.8, "userInteraction": "REQUIRED", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-13813", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2018-13813", "trust": 0.8, "value": "High" }, { "author": "CNVD", "id": "CNVD-2018-24247", "trust": 0.6, "value": "HIGH" }, { "author": "CNNVD", "id": "CNNVD-201811-483", "trust": 0.6, "value": "HIGH" }, { "author": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1", "trust": 0.2, "value": "HIGH" }, { "author": "VULHUB", "id": "VHN-123910", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "VULHUB", "id": "VHN-123910" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "CNNVD", "id": "CNNVD-201811-483" }, { "db": "NVD", "id": "CVE-2018-13813" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 4\" - 22\" (All versions \u003c V15 Update 4), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions \u003c V15 Update 4), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 and KTP900F (All versions \u003c V15 Update 4), SIMATIC WinCC Runtime Advanced (All versions \u003c V15 Update 4), SIMATIC WinCC Runtime Professional (All versions \u003c V15 Update 4), SIMATIC WinCC (TIA Portal) (All versions \u003c V15 Update 4), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The webserver of affected HMI devices may allow URL redirections to untrusted websites. An attacker must trick a valid user who is authenticated to the device into clicking on a malicious link to exploit the vulnerability. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains an open redirect vulnerability.Information may be obtained and information may be altered. Siemens SIMATIC HMI Comfort Panels are all Germany\u0027s Siemens (Siemens) company HMI software for control and monitoring of machines and equipment. \n\nThe webserver in several Siemens products has an open redirection vulnerability. Siemens SIMATIC Panels is prone to following security vulnerabilities:\n1. An open-redirection vulnerability\n2. A directory-traversal vulnerability\nRemote attackers may use a specially crafted request with directory-traversal sequences (\u0027../\u0027) to retrieve arbitrary files from the affected system in the context of the application or by constructing a crafted URI and enticing a user to follow it and when an unsuspecting victim follows the link, they may be redirected to an attacker-controlled site", "sources": [ { "db": "NVD", "id": "CVE-2018-13813" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "BID", "id": "105922" }, { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "VULHUB", "id": "VHN-123910" } ], "trust": 2.7 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-13813", "trust": 3.6 }, { "db": "SIEMENS", "id": "SSA-233109", "trust": 2.3 }, { "db": "ICS CERT", "id": "ICSA-18-317-08", "trust": 2.3 }, { "db": "BID", "id": "105922", "trust": 2.0 }, { "db": "CNNVD", "id": "CNNVD-201811-483", "trust": 0.9 }, { "db": "CNVD", "id": "CNVD-2018-24247", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2018-014526", "trust": 0.8 }, { "db": "IVD", "id": "E30112C1-39AB-11E9-9EAE-000C29342CB1", "trust": 0.2 }, { "db": "VULHUB", "id": "VHN-123910", "trust": 0.1 } ], "sources": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "VULHUB", "id": "VHN-123910" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "CNNVD", "id": "CNNVD-201811-483" }, { "db": "NVD", "id": "CVE-2018-13813" } ] }, "id": "VAR-201812-0344", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "VULHUB", "id": "VHN-123910" } ], "trust": 1.59359887875 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "ICS" ], "sub_category": null, "trust": 0.8 } ], "sources": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-24247" } ] }, "last_update_date": "2024-08-14T15:12:58.652000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-233109", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-233109.pdf" }, { "title": "Patch for Multiple Siemens products open redirection vulnerability", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/176377" }, { "title": "Multiple Siemens Product security vulnerabilities", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=86884" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "CNNVD", "id": "CNNVD-201811-483" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-601", "trust": 1.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-123910" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "NVD", "id": "CVE-2018-13813" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.3, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-233109.pdf" }, { "trust": 2.3, "url": "https://ics-cert.us-cert.gov/advisories/icsa-18-317-08" }, { "trust": 1.7, "url": "http://www.securityfocus.com/bid/105922" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-13813" }, { "trust": 0.8, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-13813" }, { "trust": 0.3, "url": "http://subscriber.communications.siemens.com/" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "VULHUB", "id": "VHN-123910" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "CNNVD", "id": "CNNVD-201811-483" }, { "db": "NVD", "id": "CVE-2018-13813" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-24247" }, { "db": "VULHUB", "id": "VHN-123910" }, { "db": "BID", "id": "105922" }, { "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "db": "CNNVD", "id": "CNNVD-201811-483" }, { "db": "NVD", "id": "CVE-2018-13813" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-11-29T00:00:00", "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "date": "2018-11-29T00:00:00", "db": "CNVD", "id": "CNVD-2018-24247" }, { "date": "2018-12-13T00:00:00", "db": "VULHUB", "id": "VHN-123910" }, { "date": "2018-11-14T00:00:00", "db": "BID", "id": "105922" }, { "date": "2019-03-26T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "date": "2018-11-15T00:00:00", "db": "CNNVD", "id": "CNNVD-201811-483" }, { "date": "2018-12-13T16:29:00.320000", "db": "NVD", "id": "CVE-2018-13813" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-08-22T00:00:00", "db": "CNVD", "id": "CNVD-2018-24247" }, { "date": "2019-10-09T00:00:00", "db": "VULHUB", "id": "VHN-123910" }, { "date": "2018-11-14T00:00:00", "db": "BID", "id": "105922" }, { "date": "2019-03-26T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-014526" }, { "date": "2019-10-17T00:00:00", "db": "CNNVD", "id": "CNNVD-201811-483" }, { "date": "2019-10-09T23:34:33.607000", "db": "NVD", "id": "CVE-2018-13813" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201811-483" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "plural SIMATIC Open redirect vulnerability in products", "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-014526" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Input validation error", "sources": [ { "db": "IVD", "id": "e30112c1-39ab-11e9-9eae-000c29342cb1" }, { "db": "BID", "id": "105922" }, { "db": "CNNVD", "id": "CNNVD-201811-483" } ], "trust": 1.1 } }
var-202103-1464
Vulnerability from variot
An OpenSSL TLS server may crash if sent a maliciously crafted renegotiation ClientHello message from a client. If a TLSv1.2 renegotiation ClientHello omits the signature_algorithms extension (where it was present in the initial ClientHello), but includes a signature_algorithms_cert extension then a NULL pointer dereference will result, leading to a crash and a denial of service attack. A server is only vulnerable if it has TLSv1.2 and renegotiation enabled (which is the default configuration). OpenSSL TLS clients are not impacted by this issue. All OpenSSL 1.1.1 versions are affected by this issue. Users of these versions should upgrade to OpenSSL 1.1.1k. OpenSSL 1.0.2 is not impacted by this issue. Fixed in OpenSSL 1.1.1k (Affected 1.1.1-1.1.1j). OpenSSL is an open source general encryption library of the Openssl team that can implement the Secure Sockets Layer (SSLv2/v3) and Transport Layer Security (TLSv1) protocols. The product supports a variety of encryption algorithms, including symmetric ciphers, hash algorithms, secure hash algorithms, etc. Description:
Windows Container Support for Red Hat OpenShift allows you to deploy Windows container workloads running on Windows Server containers.
Bug Fix(es):
-
WMCO patch pub-key-hash annotation to Linux node (BZ#1945248)
-
LoadBalancer Service type with invalid external loadbalancer IP breaks the datapath (BZ#1952917)
-
Telemetry info not completely available to identify windows nodes (BZ#1955319)
-
WMCO incorrectly shows node as ready after a failed configuration (BZ#1956412)
-
kube-proxy service terminated unexpectedly after recreated LB service (BZ#1963263)
-
Solution:
For Windows Machine Config Operator upgrades, see the following documentation:
https://docs.openshift.com/container-platform/4.7/windows_containers/window s-node-upgrades.html
- Bugs fixed (https://bugzilla.redhat.com/):
1945248 - WMCO patch pub-key-hash annotation to Linux node 1946538 - CVE-2021-25736 kubernetes: LoadBalancer Service type don't create a HNS policy for empty or invalid external loadbalancer IP, what could lead to MITM 1952917 - LoadBalancer Service type with invalid external loadbalancer IP breaks the datapath 1955319 - Telemetry info not completely available to identify windows nodes 1956412 - WMCO incorrectly shows node as ready after a failed configuration 1963263 - kube-proxy service terminated unexpectedly after recreated LB service
- Bugs fixed (https://bugzilla.redhat.com/):
1897635 - CVE-2020-28362 golang: math/big: panic during recursive division of very large numbers 1918750 - CVE-2021-3114 golang: crypto/elliptic: incorrect operations on the P-224 curve
- JIRA issues fixed (https://issues.jboss.org/):
TRACING-1725 - Elasticsearch operator reports x509 errors communicating with ElasticSearch in OpenShift Service Mesh project
- Description:
Red Hat OpenShift Container Platform is Red Hat's cloud computing Kubernetes application platform solution designed for on-premise or private cloud deployments.
Security Fix(es):
-
jackson-databind: arbitrary code execution in slf4j-ext class (CVE-2018-14718)
-
jackson-databind: arbitrary code execution in blaze-ds-opt and blaze-ds-core classes (CVE-2018-14719)
-
jackson-databind: improper polymorphic deserialization in axis2-transport-jms class (CVE-2018-19360)
-
jackson-databind: improper polymorphic deserialization in openjpa class (CVE-2018-19361)
-
jackson-databind: improper polymorphic deserialization in jboss-common-core class (CVE-2018-19362)
-
jackson-databind: default typing mishandling leading to remote code execution (CVE-2019-14379)
-
jackson-databind: Serialization gadgets in com.pastdev.httpcomponents.configuration.JndiConfiguration (CVE-2020-24750)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.PerUserPoolDataSource (CVE-2020-35490)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.SharedPoolDataSource (CVE-2020-35491)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool (CVE-2020-35728)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to oadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36179)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36180)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36181)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36182)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool (CVE-2020-36183)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource (CVE-2020-36184)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource (CVE-2020-36185)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource (CVE-2020-36186)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource (CVE-2020-36187)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource (CVE-2020-36188)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSourc e (CVE-2020-36189)
-
jackson-databind: mishandles the interaction between serialization gadgets and typing, related to javax.swing (CVE-2021-20190)
-
jackson-databind: exfiltration/XXE in some JDK classes (CVE-2018-14720)
-
jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class (CVE-2018-14721)
For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section. See the following advisory for the container images for this release:
https://access.redhat.com/errata/RHBA-2021:1232
All OpenShift Container Platform 4.6 users are advised to upgrade to these updated packages and images when they are available in the appropriate release channel. To check for available updates, use the OpenShift Console or the CLI oc command. Instructions for upgrading a cluster are available at https://docs.openshift.com/container-platform/4.6/updating/updating-cluster - -between-minor.html#understanding-upgrade-channels_updating-cluster-between - -minor
For OpenShift Container Platform 4.6 see the following documentation, which will be updated shortly for this release, for important instructions on how to upgrade your cluster and fully apply this asynchronous errata update:
https://docs.openshift.com/container-platform/4.6/release_notes/ocp-4-6-rel ease-notes.html
Details on how to access this content are available at https://docs.openshift.com/container-platform/4.6/updating/updating-cluster - -cli.html
- Bugs fixed (https://bugzilla.redhat.com/):
1666415 - CVE-2018-14718 jackson-databind: arbitrary code execution in slf4j-ext class 1666418 - CVE-2018-14719 jackson-databind: arbitrary code execution in blaze-ds-opt and blaze-ds-core classes 1666423 - CVE-2018-14720 jackson-databind: exfiltration/XXE in some JDK classes 1666428 - CVE-2018-14721 jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class 1666482 - CVE-2018-19360 jackson-databind: improper polymorphic deserialization in axis2-transport-jms class 1666484 - CVE-2018-19361 jackson-databind: improper polymorphic deserialization in openjpa class 1666489 - CVE-2018-19362 jackson-databind: improper polymorphic deserialization in jboss-common-core class 1737517 - CVE-2019-14379 jackson-databind: default typing mishandling leading to remote code execution 1859004 - Sometimes the eventrouter couldn't gather event logs. 1882310 - CVE-2020-24750 jackson-databind: Serialization gadgets in com.pastdev.httpcomponents.configuration.JndiConfiguration 1909266 - CVE-2020-35490 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.PerUserPoolDataSource 1909269 - CVE-2020-35491 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.SharedPoolDataSource 1911502 - CVE-2020-35728 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool 1913871 - CVE-2020-36179 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to oadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS 1913872 - CVE-2020-36180 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS 1913874 - CVE-2020-36181 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS 1913926 - CVE-2020-36182 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS 1913927 - CVE-2020-36183 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool 1913928 - CVE-2020-36184 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource 1913929 - CVE-2020-36185 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource 1913931 - CVE-2020-36186 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource 1913933 - CVE-2020-36187 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource 1913934 - CVE-2020-36188 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource 1913937 - CVE-2020-36189 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSource 1916633 - CVE-2021-20190 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to javax.swing 1925361 - [4.6] ClusterLogForwarder namespace-specific log forwarding does not work as expected 1950894 - Placeholder bug for OCP 4.6.0 extras release
Bug fix:
-
RHACM 2.0.10 images (BZ #1940452)
-
Bugs fixed (https://bugzilla.redhat.com/):
1940452 - RHACM 2.0.10 images 1944286 - CVE-2021-23358 nodejs-underscore: Arbitrary code execution via the template function
- Description:
Red Hat Advanced Cluster Management for Kubernetes 2.1.6 images
Red Hat Advanced Cluster Management for Kubernetes provides the capabilities to address common challenges that administrators and site reliability engineers face as they work across a range of public and private cloud environments. Clusters and applications are all visible and managed from a single console—with security policy built in.
Bug fixes:
-
RHACM 2.1.6 images (BZ#1940581)
-
When generating the import cluster string, it can include unescaped characters (BZ#1934184)
-
Bugs fixed (https://bugzilla.redhat.com/):
1853652 - CVE-2020-14040 golang.org/x/text: possibility to trigger an infinite loop in encoding/unicode could lead to crash 1929338 - CVE-2020-35149 mquery: Code injection via merge or clone operation 1934184 - When generating the import cluster string, it can include unescaped characters 1940581 - RHACM 2.1.6 images
- -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
====================================================================
Red Hat Security Advisory
Synopsis: Important: Red Hat JBoss Core Services Apache HTTP Server 2.4.37 SP7 security update Advisory ID: RHSA-2021:1199-01 Product: Red Hat JBoss Core Services Advisory URL: https://access.redhat.com/errata/RHSA-2021:1199 Issue date: 2021-04-14 CVE Names: CVE-2021-3449 CVE-2021-3450 ==================================================================== 1. Summary:
Updated packages that provide Red Hat JBoss Core Services Pack Apache Server 2.4.37 and fix several bugs, and add various enhancements are now available for Red Hat Enterprise Linux 7.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat JBoss Core Services on RHEL 7 Server - noarch, ppc64, x86_64
- Description:
This release adds the new Apache HTTP Server 2.4.37 Service Pack 7 packages that are part of the JBoss Core Services offering.
This release serves as a replacement for Red Hat JBoss Core Services Pack Apache Server 2.4.37 Service Pack 6 and includes bug fixes and enhancements. Refer to the Release Notes for information on the most significant bug fixes and enhancements included in this release.
Security fix(es):
- openssl: NULL pointer dereference in signature_algorithms processing (CVE-2021-3449)
- openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT (CVE-2021-3450)
For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section.
- Solution:
Before applying this update, make sure all previously released errata relevant to your system have been applied.
For details on how to apply this update, refer to:
https://access.redhat.com/articles/11258
- Bugs fixed (https://bugzilla.redhat.com/):
1941547 - CVE-2021-3450 openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT 1941554 - CVE-2021-3449 openssl: NULL pointer dereference in signature_algorithms processing
- Package List:
Red Hat JBoss Core Services on RHEL 7 Server:
Source: jbcs-httpd24-httpd-2.4.37-70.jbcs.el7.src.rpm jbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.src.rpm jbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.src.rpm jbcs-httpd24-mod_jk-1.2.48-13.redhat_1.jbcs.el7.src.rpm jbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.src.rpm jbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.src.rpm jbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.src.rpm jbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.src.rpm jbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.src.rpm jbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.src.rpm
noarch: jbcs-httpd24-httpd-manual-2.4.37-70.jbcs.el7.noarch.rpm
ppc64: jbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.ppc64.rpm jbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.ppc64.rpm jbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.ppc64.rpm jbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.ppc64.rpm
x86_64: jbcs-httpd24-httpd-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-debuginfo-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-devel-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-selinux-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-tools-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_cluster-native-debuginfo-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_jk-ap24-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_jk-debuginfo-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_jk-manual-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_ldap-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_proxy_html-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_security-debuginfo-2.9.2-60.GA.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_session-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_ssl-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.x86_64.rpm jbcs-httpd24-nghttp2-debuginfo-1.39.2-37.jbcs.el7.x86_64.rpm jbcs-httpd24-nghttp2-devel-1.39.2-37.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-debuginfo-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-devel-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-libs-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-perl-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-static-1.1.1g-6.jbcs.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/cve/CVE-2021-3449 https://access.redhat.com/security/cve/CVE-2021-3450 https://access.redhat.com/security/updates/classification/#important
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2021 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iQIVAwUBYHcQ4tzjgjWX9erEAQg5Zg/9FciPflU5YnbBIktqUgZAzkgIaZf3cp/A vYQu1D/5oRwfvcdbhtzgYBVB5Ha+Ut1QQRHix/3QkD2v4+pF2eAnfe6TN2ftgKyJ Qw1oOs0HGdUzSkxboZESkTGiSmaCLT7fn7dHvJ1cH0rfQx7ngYRPGLPAbSHqOaQZ gkRYTZGl+jBG/a91XBMoa+QRFT0+yQX4ps2oEGiMWZMIfWOrC4iU9NnudR1CDGE7 SWzDmjAIKP2xjfi6UVwTuuq64ROju9ginT5KPwj42Btfatnj6nTF4CIoWyfBm9LK CLBXeJOfjQUB/vjiTeLh47d1rMt7H5Jjck8imL6nfdAkzG+SKQA3yxjHztdmEFyX aDQR6T5X2lPBPdtHE0qaunS5lb/XRWh7xTQ3k34iTYvIN2wd2KqP78TwXSMEKWlV ddGQul2vakBXn4C2waTvuJE6JvvwS4Q8zQ1plpW1uOuGIRn1XAxJWV+Wkmt5eBg6 AbyXUMM7pLKiUNP1L0k7nKKx5Ta3HlnpvOpXMDlvccxwEAWoVqZ+nrmUe9bG67DK 1yEp/DR/XpKLPjCwBEW+i+nZUSpTyKe3+J962KoSJ/HISVRZaicBmGiQDCKCEbPr hnhoDO+7Y0A1GlmAd3ZkHu+k97louMpIkRsghdZ7el3D1Hx2EhP/HSQqHI5QCyMl qQeHglPylHU=m11c -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://listman.redhat.com/mailman/listinfo/rhsa-announce . Description:
Red Hat JBoss Web Server is a fully integrated and certified set of components for hosting Java web applications. It is comprised of the Apache HTTP Server, the Apache Tomcat Servlet container, Apache Tomcat Connector (mod_jk), JBoss HTTP Connector (mod_cluster), Hibernate, and the Tomcat Native library
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-202103-1464", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic pdm", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "9.1.0.7" }, { "model": "node.js", "scope": "lte", "trust": 1.0, "vendor": "nodejs", "version": "14.14.0" }, { "model": "scalance w700", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "6.5" }, { "model": "multi-domain management", "scope": "eq", "trust": 1.0, "vendor": "checkpoint", "version": "r81" }, { "model": "web gateway cloud service", "scope": "eq", "trust": 1.0, "vendor": "mcafee", "version": "10.1.1" }, { "model": "simatic logon", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "1.5" }, { "model": "web gateway cloud service", "scope": "eq", "trust": 1.0, "vendor": "mcafee", "version": "9.2.10" }, { "model": "log correlation engine", "scope": "lt", "trust": 1.0, "vendor": "tenable", "version": "6.0.9" }, { "model": "simatic mv500", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic net cp1243-7 lte eu", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "graalvm", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "20.3.1.2" }, { "model": "primavera unifier", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "17.12" }, { "model": "graalvm", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "19.3.5" }, { "model": "freebsd", "scope": "eq", "trust": 1.0, "vendor": "freebsd", "version": "12.2" }, { "model": "tenable.sc", "scope": "gte", "trust": 1.0, "vendor": "tenable", "version": "5.13.0" }, { "model": "simatic pcs neo", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "scalance s602", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "4.1" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "node.js", "scope": "lte", "trust": 1.0, "vendor": "nodejs", "version": "12.12.0" }, { "model": "node.js", "scope": "lte", "trust": 1.0, "vendor": "nodejs", "version": "10.24.0" }, { "model": "simatic rf185c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinec infrastructure network services", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.0.1.1" }, { "model": "nessus", "scope": "lte", "trust": 1.0, "vendor": "tenable", "version": "8.13.1" }, { "model": "nessus network monitor", "scope": "eq", "trust": 1.0, "vendor": "tenable", "version": "5.11.0" }, { "model": "mysql server", "scope": "gte", "trust": 1.0, "vendor": "oracle", "version": "8.0.15" }, { "model": "openssl", "scope": "lt", "trust": 1.0, "vendor": "openssl", "version": "1.1.1k" }, { "model": "primavera unifier", "scope": "gte", "trust": 1.0, "vendor": "oracle", "version": "17.7" }, { "model": "simatic net cp 1543sp-1", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2.1" }, { "model": "zfs storage appliance kit", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.8" }, { "model": "sinamics connect 300", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "nessus network monitor", "scope": "eq", "trust": 1.0, "vendor": "tenable", "version": "5.12.1" }, { "model": "tim 1531 irc", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.2" }, { "model": "scalance s623", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "4.1" }, { "model": "simatic net cp 1243-8 irc", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "oncommand workflow automation", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "essbase", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "21.2" }, { "model": "simatic net cp1243-7 lte us", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "sinec nms", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "1.0" }, { "model": "sinema server", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "scalance m-800", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "6.2" }, { "model": "fedora", "scope": "eq", "trust": 1.0, "vendor": "fedoraproject", "version": "34" }, { "model": "simatic rf166c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "oncommand insight", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "simatic s7-1200 cpu 1215 fc", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic cp 1242-7 gprs v2", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "simatic hmi basic panels 2nd generation", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic rf186c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "14.0.0" }, { "model": "simatic s7-1200 cpu 1211c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "jd edwards enterpriseone tools", "scope": "lt", "trust": 1.0, "vendor": "oracle", "version": "9.2.6.0" }, { "model": "ruggedcom rcm1224", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "6.2" }, { "model": "peoplesoft enterprise peopletools", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.58" }, { "model": "sma100", "scope": "lt", "trust": 1.0, "vendor": "sonicwall", "version": "10.2.1.0-17sv" }, { "model": "scalance sc-600", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "peoplesoft enterprise peopletools", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.57" }, { "model": "web gateway", "scope": "eq", "trust": 1.0, "vendor": "mcafee", "version": "10.1.1" }, { "model": "simatic rf186ci", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "web gateway", "scope": "eq", "trust": 1.0, "vendor": "mcafee", "version": "9.2.10" }, { "model": "openssl", "scope": "gte", "trust": 1.0, "vendor": "openssl", "version": "1.1.1" }, { "model": "communications communications policy management", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "12.6.0.0.0" }, { "model": "simatic process historian opc ua server", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2019" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "12.0.0" }, { "model": "primavera unifier", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "21.12" }, { "model": "simatic rf188ci", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic net cp 1545-1", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "1.0" }, { "model": "graalvm", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "21.0.0.2" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "10.13.0" }, { "model": "mysql server", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "8.0.23" }, { "model": "simatic net cp 1543-1", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2.2" }, { "model": "scalance lpe9403", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic net cp 1243-1", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "scalance s615", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "6.2" }, { "model": "simatic net cp 1543-1", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.0" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "12.13.0" }, { "model": "scalance xb-200", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.3" }, { "model": "scalance xf-200ba", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.3" }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "9.0" }, { "model": "simatic cloud connect 7", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "1.1" }, { "model": "secure backup", "scope": "lt", "trust": 1.0, "vendor": "oracle", "version": "18.1.0.1.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic s7-1200 cpu 1215c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "scalance s627-2m", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "4.1" }, { "model": "tenable.sc", "scope": "lte", "trust": 1.0, "vendor": "tenable", "version": "5.17.0" }, { "model": "simatic s7-1200 cpu 1214c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "mysql server", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "5.7.33" }, { "model": "node.js", "scope": "lte", "trust": 1.0, "vendor": "nodejs", "version": "10.12.0" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "14.15.0" }, { "model": "cloud volumes ontap mediator", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "simatic cloud connect 7", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "nessus network monitor", "scope": "eq", "trust": 1.0, "vendor": "tenable", "version": "5.13.0" }, { "model": "simatic rf360r", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "tim 1531 irc", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic logon", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "1.6.0.2" }, { "model": "sinec pni", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "scalance xr524-8c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.4" }, { "model": "nessus network monitor", "scope": "eq", "trust": 1.0, "vendor": "tenable", "version": "5.12.0" }, { "model": "jd edwards world security", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "a9.4" }, { "model": "simatic s7-1200 cpu 1212c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinumerik opc ua server", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "scalance xm-400", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.4" }, { "model": "primavera unifier", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "19.12" }, { "model": "simatic s7-1500 cpu 1518-4 pn\\/dp mfp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "10.0" }, { "model": "tia administrator", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "node.js", "scope": "lt", "trust": 1.0, "vendor": "nodejs", "version": "15.14.0" }, { "model": "e-series performance analyzer", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "simatic s7-1200 cpu 1214 fc", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "mysql connectors", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "8.0.23" }, { "model": "scalance xc-200", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.3" }, { "model": "quantum security gateway", "scope": "eq", "trust": 1.0, "vendor": "checkpoint", "version": "r80.40" }, { "model": "nessus network monitor", "scope": "eq", "trust": 1.0, "vendor": "tenable", "version": "5.11.1" }, { "model": "quantum security management", "scope": "eq", "trust": 1.0, "vendor": "checkpoint", "version": "r80.40" }, { "model": "web gateway", "scope": "eq", "trust": 1.0, "vendor": "mcafee", "version": "8.2.19" }, { "model": "active iq unified manager", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "sonicos", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": "7.0.1.0" }, { "model": "scalance xp-200", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.3" }, { "model": "scalance xr-300wg", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.3" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "ontap select deploy administration utility", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "quantum security gateway", "scope": "eq", "trust": 1.0, "vendor": "checkpoint", "version": "r81" }, { "model": "quantum security management", "scope": "eq", "trust": 1.0, "vendor": "checkpoint", "version": "r81" }, { "model": "simatic wincc telecontrol", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "primavera unifier", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "20.12" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "15.0.0" }, { "model": "scalance s612", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "4.1" }, { "model": "simatic net cp 1542sp-1 irc", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2.1" }, { "model": "santricity smi-s provider", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "scalance xr528-6m", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.4" }, { "model": "node.js", "scope": "lt", "trust": 1.0, "vendor": "nodejs", "version": "12.22.1" }, { "model": "sma100", "scope": "gte", "trust": 1.0, "vendor": "sonicwall", "version": "10.2.0.0" }, { "model": "snapcenter", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "web gateway cloud service", "scope": "eq", "trust": 1.0, "vendor": "mcafee", "version": "8.2.19" }, { "model": "mysql workbench", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "8.0.23" }, { "model": "peoplesoft enterprise peopletools", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.59" }, { "model": "capture client", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": "3.5" }, { "model": "scalance xr552-12", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.4" }, { "model": "simatic pcs 7 telecontrol", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic rf188c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "enterprise manager for storage management", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "13.4.0.0" }, { "model": "scalance xr526-8c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "6.4" }, { "model": "scalance w1700", "scope": "gte", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic s7-1200 cpu 1217c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "node.js", "scope": "gte", "trust": 1.0, "vendor": "nodejs", "version": "10.0.0" }, { "model": "secure global desktop", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "5.6" }, { "model": "node.js", "scope": "lt", "trust": 1.0, "vendor": "nodejs", "version": "14.16.1" }, { "model": "storagegrid", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "simatic s7-1200 cpu 1212fc", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic cp 1242-7 gprs v2", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "multi-domain management", "scope": "eq", "trust": 1.0, "vendor": "checkpoint", "version": "r80.40" } ], "sources": [ { "db": "NVD", "id": "CVE-2021-3449" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Red Hat", "sources": [ { "db": "PACKETSTORM", "id": "163257" }, { "db": "PACKETSTORM", "id": "163267" }, { "db": "PACKETSTORM", "id": "163276" }, { "db": "PACKETSTORM", "id": "162350" }, { "db": "PACKETSTORM", "id": "162383" }, { "db": "PACKETSTORM", "id": "162337" }, { "db": "PACKETSTORM", "id": "162196" }, { "db": "PACKETSTORM", "id": "162201" } ], "trust": 0.8 }, "cve": "CVE-2021-3449", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "PARTIAL", "baseScore": 4.3, "confidentialityImpact": "NONE", "exploitabilityScore": 8.6, "id": "CVE-2021-3449", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.0, "vectorString": "AV:N/AC:M/Au:N/C:N/I:N/A:P", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "PARTIAL", "baseScore": 4.3, "confidentialityImpact": "NONE", "exploitabilityScore": 8.6, "id": "VHN-388130", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:M/AU:N/C:N/I:N/A:P", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "HIGH", "baseScore": 5.9, "baseSeverity": "MEDIUM", "confidentialityImpact": "NONE", "exploitabilityScore": 2.2, "id": "CVE-2021-3449", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.1" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2021-3449", "trust": 1.0, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-388130", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-388130" }, { "db": "NVD", "id": "CVE-2021-3449" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "An OpenSSL TLS server may crash if sent a maliciously crafted renegotiation ClientHello message from a client. If a TLSv1.2 renegotiation ClientHello omits the signature_algorithms extension (where it was present in the initial ClientHello), but includes a signature_algorithms_cert extension then a NULL pointer dereference will result, leading to a crash and a denial of service attack. A server is only vulnerable if it has TLSv1.2 and renegotiation enabled (which is the default configuration). OpenSSL TLS clients are not impacted by this issue. All OpenSSL 1.1.1 versions are affected by this issue. Users of these versions should upgrade to OpenSSL 1.1.1k. OpenSSL 1.0.2 is not impacted by this issue. Fixed in OpenSSL 1.1.1k (Affected 1.1.1-1.1.1j). OpenSSL is an open source general encryption library of the Openssl team that can implement the Secure Sockets Layer (SSLv2/v3) and Transport Layer Security (TLSv1) protocols. The product supports a variety of encryption algorithms, including symmetric ciphers, hash algorithms, secure hash algorithms, etc. Description:\n\nWindows Container Support for Red Hat OpenShift allows you to deploy\nWindows container workloads running on Windows Server containers. \n\nBug Fix(es):\n\n* WMCO patch pub-key-hash annotation to Linux node (BZ#1945248)\n\n* LoadBalancer Service type with invalid external loadbalancer IP breaks\nthe datapath (BZ#1952917)\n\n* Telemetry info not completely available to identify windows nodes\n(BZ#1955319)\n\n* WMCO incorrectly shows node as ready after a failed configuration\n(BZ#1956412)\n\n* kube-proxy service terminated unexpectedly after recreated LB service\n(BZ#1963263)\n\n3. Solution:\n\nFor Windows Machine Config Operator upgrades, see the following\ndocumentation:\n\nhttps://docs.openshift.com/container-platform/4.7/windows_containers/window\ns-node-upgrades.html\n\n4. Bugs fixed (https://bugzilla.redhat.com/):\n\n1945248 - WMCO patch pub-key-hash annotation to Linux node\n1946538 - CVE-2021-25736 kubernetes: LoadBalancer Service type don\u0027t create a HNS policy for empty or invalid external loadbalancer IP, what could lead to MITM\n1952917 - LoadBalancer Service type with invalid external loadbalancer IP breaks the datapath\n1955319 - Telemetry info not completely available to identify windows nodes\n1956412 - WMCO incorrectly shows node as ready after a failed configuration\n1963263 - kube-proxy service terminated unexpectedly after recreated LB service\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1897635 - CVE-2020-28362 golang: math/big: panic during recursive division of very large numbers\n1918750 - CVE-2021-3114 golang: crypto/elliptic: incorrect operations on the P-224 curve\n\n5. JIRA issues fixed (https://issues.jboss.org/):\n\nTRACING-1725 - Elasticsearch operator reports x509 errors communicating with ElasticSearch in OpenShift Service Mesh project\n\n6. Description:\n\nRed Hat OpenShift Container Platform is Red Hat\u0027s cloud computing\nKubernetes application platform solution designed for on-premise or private\ncloud deployments. \n\nSecurity Fix(es):\n\n* jackson-databind: arbitrary code execution in slf4j-ext class\n(CVE-2018-14718)\n\n* jackson-databind: arbitrary code execution in blaze-ds-opt and\nblaze-ds-core classes (CVE-2018-14719)\n\n* jackson-databind: improper polymorphic deserialization in\naxis2-transport-jms class (CVE-2018-19360)\n\n* jackson-databind: improper polymorphic deserialization in openjpa class\n(CVE-2018-19361)\n\n* jackson-databind: improper polymorphic deserialization in\njboss-common-core class (CVE-2018-19362)\n\n* jackson-databind: default typing mishandling leading to remote code\nexecution (CVE-2019-14379)\n\n* jackson-databind: Serialization gadgets in\ncom.pastdev.httpcomponents.configuration.JndiConfiguration (CVE-2020-24750)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.commons.dbcp2.datasources.PerUserPoolDataSource (CVE-2020-35490)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.commons.dbcp2.datasources.SharedPoolDataSource (CVE-2020-35491)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\ncom.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool\n(CVE-2020-35728)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\noadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36179)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36180)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36181)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36182)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool (CVE-2020-36183)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource\n(CVE-2020-36184)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource\n(CVE-2020-36185)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource\n(CVE-2020-36186)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource\n(CVE-2020-36187)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\ncom.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource\n(CVE-2020-36188)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\ncom.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSourc\ne (CVE-2020-36189)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to javax.swing (CVE-2021-20190)\n\n* jackson-databind: exfiltration/XXE in some JDK classes (CVE-2018-14720)\n\n* jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class\n(CVE-2018-14721)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. See the following advisory for the container images for\nthis release:\n\nhttps://access.redhat.com/errata/RHBA-2021:1232\n\nAll OpenShift Container Platform 4.6 users are advised to upgrade to these\nupdated packages and images when they are available in the appropriate\nrelease channel. To check for available updates, use the OpenShift Console\nor the CLI oc command. Instructions for upgrading a cluster are available\nat\nhttps://docs.openshift.com/container-platform/4.6/updating/updating-cluster\n- -between-minor.html#understanding-upgrade-channels_updating-cluster-between\n- -minor\n\nFor OpenShift Container Platform 4.6 see the following documentation, which\nwill be updated shortly for this release, for important instructions on how\nto upgrade your cluster and fully apply this asynchronous errata update:\n\nhttps://docs.openshift.com/container-platform/4.6/release_notes/ocp-4-6-rel\nease-notes.html\n\nDetails on how to access this content are available at\nhttps://docs.openshift.com/container-platform/4.6/updating/updating-cluster\n- -cli.html\n\n4. Bugs fixed (https://bugzilla.redhat.com/):\n\n1666415 - CVE-2018-14718 jackson-databind: arbitrary code execution in slf4j-ext class\n1666418 - CVE-2018-14719 jackson-databind: arbitrary code execution in blaze-ds-opt and blaze-ds-core classes\n1666423 - CVE-2018-14720 jackson-databind: exfiltration/XXE in some JDK classes\n1666428 - CVE-2018-14721 jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class\n1666482 - CVE-2018-19360 jackson-databind: improper polymorphic deserialization in axis2-transport-jms class\n1666484 - CVE-2018-19361 jackson-databind: improper polymorphic deserialization in openjpa class\n1666489 - CVE-2018-19362 jackson-databind: improper polymorphic deserialization in jboss-common-core class\n1737517 - CVE-2019-14379 jackson-databind: default typing mishandling leading to remote code execution\n1859004 - Sometimes the eventrouter couldn\u0027t gather event logs. \n1882310 - CVE-2020-24750 jackson-databind: Serialization gadgets in com.pastdev.httpcomponents.configuration.JndiConfiguration\n1909266 - CVE-2020-35490 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.PerUserPoolDataSource\n1909269 - CVE-2020-35491 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.SharedPoolDataSource\n1911502 - CVE-2020-35728 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool\n1913871 - CVE-2020-36179 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to oadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS\n1913872 - CVE-2020-36180 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS\n1913874 - CVE-2020-36181 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS\n1913926 - CVE-2020-36182 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS\n1913927 - CVE-2020-36183 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool\n1913928 - CVE-2020-36184 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource\n1913929 - CVE-2020-36185 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource\n1913931 - CVE-2020-36186 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource\n1913933 - CVE-2020-36187 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource\n1913934 - CVE-2020-36188 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource\n1913937 - CVE-2020-36189 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSource\n1916633 - CVE-2021-20190 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to javax.swing\n1925361 - [4.6] ClusterLogForwarder namespace-specific log forwarding does not work as expected\n1950894 - Placeholder bug for OCP 4.6.0 extras release\n\n5. \n\nBug fix:\n\n* RHACM 2.0.10 images (BZ #1940452)\n\n3. Bugs fixed (https://bugzilla.redhat.com/):\n\n1940452 - RHACM 2.0.10 images\n1944286 - CVE-2021-23358 nodejs-underscore: Arbitrary code execution via the template function\n\n5. Description:\n\nRed Hat Advanced Cluster Management for Kubernetes 2.1.6 images\n\nRed Hat Advanced Cluster Management for Kubernetes provides the\ncapabilities to address common challenges that administrators and site\nreliability engineers face as they work across a range of public and\nprivate cloud environments. Clusters and applications are all visible and\nmanaged from a single console\u2014with security policy built in. \n\nBug fixes:\n\n* RHACM 2.1.6 images (BZ#1940581)\n\n* When generating the import cluster string, it can include unescaped\ncharacters (BZ#1934184)\n\n3. Bugs fixed (https://bugzilla.redhat.com/):\n\n1853652 - CVE-2020-14040 golang.org/x/text: possibility to trigger an infinite loop in encoding/unicode could lead to crash\n1929338 - CVE-2020-35149 mquery: Code injection via merge or clone operation\n1934184 - When generating the import cluster string, it can include unescaped characters\n1940581 - RHACM 2.1.6 images\n\n5. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n==================================================================== \nRed Hat Security Advisory\n\nSynopsis: Important: Red Hat JBoss Core Services Apache HTTP Server 2.4.37 SP7 security update\nAdvisory ID: RHSA-2021:1199-01\nProduct: Red Hat JBoss Core Services\nAdvisory URL: https://access.redhat.com/errata/RHSA-2021:1199\nIssue date: 2021-04-14\nCVE Names: CVE-2021-3449 CVE-2021-3450\n====================================================================\n1. Summary:\n\nUpdated packages that provide Red Hat JBoss Core Services Pack Apache\nServer 2.4.37 and fix several bugs, and add various enhancements are now\navailable for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat JBoss Core Services on RHEL 7 Server - noarch, ppc64, x86_64\n\n3. Description:\n\nThis release adds the new Apache HTTP Server 2.4.37 Service Pack 7 packages\nthat are part of the JBoss Core Services offering. \n\nThis release serves as a replacement for Red Hat JBoss Core Services Pack\nApache Server 2.4.37 Service Pack 6 and includes bug fixes and\nenhancements. Refer to the Release Notes for information on the most\nsignificant bug fixes and enhancements included in this release. \n\nSecurity fix(es):\n\n* openssl: NULL pointer dereference in signature_algorithms processing\n(CVE-2021-3449)\n* openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT\n(CVE-2021-3450)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. \n\n4. Solution:\n\nBefore applying this update, make sure all previously released errata\nrelevant to your system have been applied. \n\nFor details on how to apply this update, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1941547 - CVE-2021-3450 openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT\n1941554 - CVE-2021-3449 openssl: NULL pointer dereference in signature_algorithms processing\n\n6. Package List:\n\nRed Hat JBoss Core Services on RHEL 7 Server:\n\nSource:\njbcs-httpd24-httpd-2.4.37-70.jbcs.el7.src.rpm\njbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.src.rpm\njbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.src.rpm\njbcs-httpd24-mod_jk-1.2.48-13.redhat_1.jbcs.el7.src.rpm\njbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.src.rpm\njbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.src.rpm\njbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.src.rpm\njbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.src.rpm\njbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.src.rpm\njbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.src.rpm\n\nnoarch:\njbcs-httpd24-httpd-manual-2.4.37-70.jbcs.el7.noarch.rpm\n\nppc64:\njbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.ppc64.rpm\njbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.ppc64.rpm\njbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.ppc64.rpm\njbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.ppc64.rpm\n\nx86_64:\njbcs-httpd24-httpd-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-debuginfo-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-devel-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-selinux-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-tools-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_cluster-native-debuginfo-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_jk-ap24-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_jk-debuginfo-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_jk-manual-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_ldap-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_proxy_html-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_security-debuginfo-2.9.2-60.GA.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_session-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_ssl-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.x86_64.rpm\njbcs-httpd24-nghttp2-debuginfo-1.39.2-37.jbcs.el7.x86_64.rpm\njbcs-httpd24-nghttp2-devel-1.39.2-37.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-debuginfo-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-devel-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-libs-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-perl-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-static-1.1.1g-6.jbcs.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2021-3449\nhttps://access.redhat.com/security/cve/CVE-2021-3450\nhttps://access.redhat.com/security/updates/classification/#important\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2021 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBYHcQ4tzjgjWX9erEAQg5Zg/9FciPflU5YnbBIktqUgZAzkgIaZf3cp/A\nvYQu1D/5oRwfvcdbhtzgYBVB5Ha+Ut1QQRHix/3QkD2v4+pF2eAnfe6TN2ftgKyJ\nQw1oOs0HGdUzSkxboZESkTGiSmaCLT7fn7dHvJ1cH0rfQx7ngYRPGLPAbSHqOaQZ\ngkRYTZGl+jBG/a91XBMoa+QRFT0+yQX4ps2oEGiMWZMIfWOrC4iU9NnudR1CDGE7\nSWzDmjAIKP2xjfi6UVwTuuq64ROju9ginT5KPwj42Btfatnj6nTF4CIoWyfBm9LK\nCLBXeJOfjQUB/vjiTeLh47d1rMt7H5Jjck8imL6nfdAkzG+SKQA3yxjHztdmEFyX\naDQR6T5X2lPBPdtHE0qaunS5lb/XRWh7xTQ3k34iTYvIN2wd2KqP78TwXSMEKWlV\nddGQul2vakBXn4C2waTvuJE6JvvwS4Q8zQ1plpW1uOuGIRn1XAxJWV+Wkmt5eBg6\nAbyXUMM7pLKiUNP1L0k7nKKx5Ta3HlnpvOpXMDlvccxwEAWoVqZ+nrmUe9bG67DK\n1yEp/DR/XpKLPjCwBEW+i+nZUSpTyKe3+J962KoSJ/HISVRZaicBmGiQDCKCEbPr\nhnhoDO+7Y0A1GlmAd3ZkHu+k97louMpIkRsghdZ7el3D1Hx2EhP/HSQqHI5QCyMl\nqQeHglPylHU=m11c\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://listman.redhat.com/mailman/listinfo/rhsa-announce\n. Description:\n\nRed Hat JBoss Web Server is a fully integrated and certified set of\ncomponents for hosting Java web applications. It is comprised of the Apache\nHTTP Server, the Apache Tomcat Servlet container, Apache Tomcat Connector\n(mod_jk), JBoss HTTP Connector (mod_cluster), Hibernate, and the Tomcat\nNative library", "sources": [ { "db": "NVD", "id": "CVE-2021-3449" }, { "db": "VULHUB", "id": "VHN-388130" }, { "db": "PACKETSTORM", "id": "163257" }, { "db": "PACKETSTORM", "id": "163267" }, { "db": "PACKETSTORM", "id": "163276" }, { "db": "PACKETSTORM", "id": "162350" }, { "db": "PACKETSTORM", "id": "162383" }, { "db": "PACKETSTORM", "id": "162337" }, { "db": "PACKETSTORM", "id": "162196" }, { "db": "PACKETSTORM", "id": "162201" } ], "trust": 1.71 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2021-3449", "trust": 1.9 }, { "db": "TENABLE", "id": "TNS-2021-06", "trust": 1.1 }, { "db": "TENABLE", "id": "TNS-2021-09", "trust": 1.1 }, { "db": "TENABLE", "id": "TNS-2021-05", "trust": 1.1 }, { "db": "TENABLE", "id": "TNS-2021-10", "trust": 1.1 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2021/03/28/3", "trust": 1.1 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2021/03/27/2", "trust": 1.1 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2021/03/28/4", "trust": 1.1 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2021/03/27/1", "trust": 1.1 }, { "db": "SIEMENS", "id": "SSA-772220", "trust": 1.1 }, { "db": "SIEMENS", "id": "SSA-389290", "trust": 1.1 }, { "db": "PULSESECURE", "id": "SA44845", "trust": 1.1 }, { "db": "MCAFEE", "id": "SB10356", "trust": 1.1 }, { "db": "PACKETSTORM", "id": "163257", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "162350", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "162383", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "162337", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "162196", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "162201", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "162197", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162114", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162076", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162041", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162013", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162183", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162699", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162151", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162189", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162172", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "161984", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162307", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "162200", "trust": 0.1 }, { "db": "SEEBUG", "id": "SSVID-99170", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-388130", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "163267", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "163276", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-388130" }, { "db": "PACKETSTORM", "id": "163257" }, { "db": "PACKETSTORM", "id": "163267" }, { "db": "PACKETSTORM", "id": "163276" }, { "db": "PACKETSTORM", "id": "162350" }, { "db": "PACKETSTORM", "id": "162383" }, { "db": "PACKETSTORM", "id": "162337" }, { "db": "PACKETSTORM", "id": "162196" }, { "db": "PACKETSTORM", "id": "162201" }, { "db": "NVD", "id": "CVE-2021-3449" } ] }, "id": "VAR-202103-1464", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-388130" } ], "trust": 0.69085685 }, "last_update_date": "2024-09-19T22:06:59.925000Z", "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-476", "trust": 1.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-388130" }, { "db": "NVD", "id": "CVE-2021-3449" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 1.1, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-openssl-2021-ghy28djd" }, { "trust": 1.1, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-389290.pdf" }, { "trust": 1.1, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-772220.pdf" }, { "trust": 1.1, "url": "https://kb.pulsesecure.net/articles/pulse_security_advisories/sa44845" }, { "trust": 1.1, "url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2021-0013" }, { "trust": 1.1, "url": "https://security.netapp.com/advisory/ntap-20210326-0006/" }, { "trust": 1.1, "url": "https://security.netapp.com/advisory/ntap-20210513-0002/" }, { "trust": 1.1, "url": "https://www.openssl.org/news/secadv/20210325.txt" }, { "trust": 1.1, "url": "https://www.tenable.com/security/tns-2021-05" }, { "trust": 1.1, "url": "https://www.tenable.com/security/tns-2021-06" }, { "trust": 1.1, "url": "https://www.tenable.com/security/tns-2021-09" }, { "trust": 1.1, "url": "https://www.tenable.com/security/tns-2021-10" }, { "trust": 1.1, "url": "https://www.debian.org/security/2021/dsa-4875" }, { "trust": 1.1, "url": "https://security.gentoo.org/glsa/202103-03" }, { "trust": 1.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-21:07.openssl.asc" }, { "trust": 1.1, "url": "https://www.oracle.com//security-alerts/cpujul2021.html" }, { "trust": 1.1, "url": "https://www.oracle.com/security-alerts/cpuapr2021.html" }, { "trust": 1.1, "url": "https://www.oracle.com/security-alerts/cpuapr2022.html" }, { "trust": 1.1, "url": "https://www.oracle.com/security-alerts/cpujul2022.html" }, { "trust": 1.1, "url": "https://www.oracle.com/security-alerts/cpuoct2021.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2021/08/msg00029.html" }, { "trust": 1.1, "url": "http://www.openwall.com/lists/oss-security/2021/03/27/1" }, { "trust": 1.1, "url": "http://www.openwall.com/lists/oss-security/2021/03/27/2" }, { "trust": 1.1, "url": "http://www.openwall.com/lists/oss-security/2021/03/28/3" }, { "trust": 1.1, "url": "http://www.openwall.com/lists/oss-security/2021/03/28/4" }, { "trust": 1.0, "url": "https://git.openssl.org/gitweb/?p=openssl.git%3ba=commitdiff%3bh=fb9fa6b51defd48157eeb207f52181f735d96148" }, { "trust": 1.0, "url": "https://kc.mcafee.com/corporate/index?page=content\u0026id=sb10356" }, { "trust": 1.0, "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/ccbfllvqvilivgzmbjl3ixzgkwqisynp/" }, { "trust": 1.0, "url": "https://security.netapp.com/advisory/ntap-20240621-0006/" }, { "trust": 0.8, "url": "https://listman.redhat.com/mailman/listinfo/rhsa-announce" }, { "trust": 0.8, "url": "https://access.redhat.com/security/team/contact/" }, { "trust": 0.8, "url": "https://access.redhat.com/security/cve/cve-2021-3449" }, { "trust": 0.8, "url": "https://bugzilla.redhat.com/):" }, { "trust": 0.7, "url": "https://access.redhat.com/security/cve/cve-2021-3450" }, { "trust": 0.6, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3449" }, { "trust": 0.5, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3450" }, { "trust": 0.5, "url": "https://access.redhat.com/security/cve/cve-2021-20305" }, { "trust": 0.5, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-20305" }, { "trust": 0.5, "url": "https://access.redhat.com/security/updates/classification/#moderate" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2019-25013" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-29362" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-29361" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2019-2708" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-8286" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8284" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-28196" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-15358" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-15358" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-8927" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-13434" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2017-14502" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-29362" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8285" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-8285" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14502" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8286" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-29363" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2019-9169" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2016-10228" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27618" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8927" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-3842" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-13434" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-2708" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-13776" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2016-10228" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-29363" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-24977" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2019-3842" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-13776" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-25013" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-8231" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-9169" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2021-3326" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8231" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2021-27219" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-8284" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-24977" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-29361" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-27618" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28196" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28362" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2020-28362" }, { "trust": 0.3, "url": "https://access.redhat.com/security/updates/classification/#important" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27219" }, { "trust": 0.2, "url": "https://issues.jboss.org/):" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-26116" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-23336" }, { "trust": 0.2, "url": "https://docs.openshift.com/container-platform/4.7/jaeger/jaeger_install/rhb" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-3114" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2020-26116" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2020-27619" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23336" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-3177" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27619" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27363" }, { "trust": 0.2, "url": "https://access.redhat.com/documentation/en-us/red_hat_advanced_cluster_mana" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-3347" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2020-28374" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-27364" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-26708" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27365" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-0466" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2020-27152" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-27363" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27152" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3347" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-27365" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2020-0466" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27364" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28374" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2021-26708" }, { "trust": 0.2, "url": "https://access.redhat.com/security/team/key/" }, { "trust": 0.2, "url": "https://access.redhat.com/articles/11258" }, { "trust": 0.1, "url": "https://git.openssl.org/gitweb/?p=openssl.git;a=commitdiff;h=fb9fa6b51defd48157eeb207f52181f735d96148" }, { "trust": 0.1, "url": "https://kc.mcafee.com/corporate/index?page=content\u0026amp;id=sb10356" }, { "trust": 0.1, "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/ccbfllvqvilivgzmbjl3ixzgkwqisynp/" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-25736" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:2130" }, { "trust": 0.1, "url": "https://docs.openshift.com/container-platform/4.7/windows_containers/window" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3326" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2021-25736" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:2532" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3114" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28500" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-28500" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-13949" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:2543" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-13949" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2021-23337" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36189" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-19360" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36188" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-14379" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14720" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14718" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2021-20190" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14718" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36179" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-19361" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36185" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35490" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14719" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14719" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36180" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14720" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-35491" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-35490" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-35728" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36180" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36181" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35491" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36182" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36183" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36186" }, { "trust": 0.1, "url": "https://docs.openshift.com/container-platform/4.6/updating/updating-cluster" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-19360" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-24750" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36187" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-19362" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36183" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-19362" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36188" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14721" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36179" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36182" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36185" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14721" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-24750" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36186" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36187" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36189" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:1230" }, { "trust": 0.1, "url": "https://docs.openshift.com/container-platform/4.6/release_notes/ocp-4-6-rel" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-36184" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36181" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36184" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-20190" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhba-2021:1232" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-19361" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35728" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-14379" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2021-23358" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-15586" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23358" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-16845" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-16845" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-15586" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:1448" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-20218" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2021-20218" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3121" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:1369" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2021-3121" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35149" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-35149" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2020-14040" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2020-14040" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:1199" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2021:1202" } ], "sources": [ { "db": "VULHUB", "id": "VHN-388130" }, { "db": "PACKETSTORM", "id": "163257" }, { "db": "PACKETSTORM", "id": "163267" }, { "db": "PACKETSTORM", "id": "163276" }, { "db": "PACKETSTORM", "id": "162350" }, { "db": "PACKETSTORM", "id": "162383" }, { "db": "PACKETSTORM", "id": "162337" }, { "db": "PACKETSTORM", "id": "162196" }, { "db": "PACKETSTORM", "id": "162201" }, { "db": "NVD", "id": "CVE-2021-3449" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-388130" }, { "db": "PACKETSTORM", "id": "163257" }, { "db": "PACKETSTORM", "id": "163267" }, { "db": "PACKETSTORM", "id": "163276" }, { "db": "PACKETSTORM", "id": "162350" }, { "db": "PACKETSTORM", "id": "162383" }, { "db": "PACKETSTORM", "id": "162337" }, { "db": "PACKETSTORM", "id": "162196" }, { "db": "PACKETSTORM", "id": "162201" }, { "db": "NVD", "id": "CVE-2021-3449" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2021-03-25T00:00:00", "db": "VULHUB", "id": "VHN-388130" }, { "date": "2021-06-23T15:44:15", "db": "PACKETSTORM", "id": "163257" }, { "date": "2021-06-23T16:08:25", "db": "PACKETSTORM", "id": "163267" }, { "date": "2021-06-24T17:54:53", "db": "PACKETSTORM", "id": "163276" }, { "date": "2021-04-27T15:37:46", "db": "PACKETSTORM", "id": "162350" }, { "date": "2021-04-29T14:37:49", "db": "PACKETSTORM", "id": "162383" }, { "date": "2021-04-26T19:21:56", "db": "PACKETSTORM", "id": "162337" }, { "date": "2021-04-15T13:49:54", "db": "PACKETSTORM", "id": "162196" }, { "date": "2021-04-15T13:50:39", "db": "PACKETSTORM", "id": "162201" }, { "date": "2021-03-25T15:15:13.450000", "db": "NVD", "id": "CVE-2021-3449" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2022-08-29T00:00:00", "db": "VULHUB", "id": "VHN-388130" }, { "date": "2024-06-21T19:15:19.710000", "db": "NVD", "id": "CVE-2021-3449" } ] }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Red Hat Security Advisory 2021-2130-01", "sources": [ { "db": "PACKETSTORM", "id": "163257" } ], "trust": 0.1 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "code execution", "sources": [ { "db": "PACKETSTORM", "id": "163276" }, { "db": "PACKETSTORM", "id": "162350" }, { "db": "PACKETSTORM", "id": "162383" } ], "trust": 0.3 } }
var-201812-0345
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 4" - 22" (All versions < V14), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions < V14), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 and KTP900F (All versions < V14), SIMATIC WinCC Runtime Advanced (All versions < V14), SIMATIC WinCC Runtime Professional (All versions < V14), SIMATIC WinCC (TIA Portal) (All versions < V14), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The integrated web server (port 80/tcp and port 443/tcp) of the affected devices could allow an attacker to inject HTTP headers. An attacker must trick a valid user who is authenticated to the device into clicking on a malicious link to exploit the vulnerability. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains an input validation vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Siemens SIMATIC Panels and SIMATIC WinCC (TIA Portal) are products of Siemens AG, Germany. Siemens SIMATIC Panels is a human interface panel. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. A code injection vulnerability exists in Siemens SIMATIC Panels and SIMATIC WinCC (TIA Portal), which can be exploited by an attacker to inject HTTP headers with malicious links. Multiple Siemens Products are prone to an HTTP header-injection vulnerability because it fails to sufficiently sanitize user input. This may aid in further attacks
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201812-0345", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic hmi op", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi mp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi tp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic wincc \\", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic wincc runtime", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "14.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels 4\" 22\"", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "-\u003c14" }, { "model": "simatic hmi comfort outdoor panels 7\\\" and 15\\\"", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "14" }, { "model": "simatic hmi ktp mobile panels", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime advanced", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime professional", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "14" }, { "model": null, "scope": "eq", "trust": 0.4, "vendor": "simatic wincc runtime", "version": "*" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v120" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v110" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v13" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v10" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "22" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "13" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "12" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi classic devices", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime professional", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "14" }, { "model": "simatic wincc runtime advanced", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v14" }, { "model": "simatic wincc", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v14" }, { "model": "simatic hmi ktp mobile panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "154" }, { "model": "simatic hmi comfort panels", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "14" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort panels", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi mp", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi op", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort outdoor panels", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp400f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp700", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp700f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp900", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp900f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic wincc tia portal", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi tp", "version": "*" } ], "sources": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "BID", "id": "105931" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "NVD", "id": "CVE-2018-13814" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp400f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_%28tia_portal%29", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:wincc_runtime_advanced", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_runtime_professional", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-014527" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "The vendor reported this issue.", "sources": [ { "db": "BID", "id": "105931" } ], "trust": 0.3 }, "cve": "CVE-2018-13814", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "PARTIAL", "baseScore": 6.8, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 8.6, "id": "CVE-2018-13814", "impactScore": 6.4, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:M/Au:N/C:P/I:P/A:P", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CNVD-2018-25432", "impactScore": 2.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:N/AC:L/Au:N/C:N/I:P/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "IVD", "availabilityImpact": "NONE", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "7d80ae62-463f-11e9-b905-000c29342cb1", "impactScore": 2.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 0.2, "vectorString": "AV:N/AC:L/Au:N/C:N/I:P/A:N", "version": "2.9 [IVD]" }, { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "PARTIAL", "baseScore": 6.8, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 8.6, "id": "VHN-123911", "impactScore": 6.4, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:M/AU:N/C:P/I:P/A:P", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "HIGH", "baseScore": 8.8, "baseSeverity": "HIGH", "confidentialityImpact": "HIGH", "exploitabilityScore": 2.8, "id": "CVE-2018-13814", "impactScore": 5.9, "integrityImpact": "HIGH", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.8, "userInteraction": "REQUIRED", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-13814", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2018-13814", "trust": 0.8, "value": "High" }, { "author": "CNVD", "id": "CNVD-2018-25432", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-201811-488", "trust": 0.6, "value": "HIGH" }, { "author": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1", "trust": 0.2, "value": "HIGH" }, { "author": "VULHUB", "id": "VHN-123911", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "VULHUB", "id": "VHN-123911" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "CNNVD", "id": "CNNVD-201811-488" }, { "db": "NVD", "id": "CVE-2018-13814" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 4\" - 22\" (All versions \u003c V14), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions \u003c V14), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 and KTP900F (All versions \u003c V14), SIMATIC WinCC Runtime Advanced (All versions \u003c V14), SIMATIC WinCC Runtime Professional (All versions \u003c V14), SIMATIC WinCC (TIA Portal) (All versions \u003c V14), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The integrated web server (port 80/tcp and port 443/tcp) of the affected devices could allow an attacker to inject HTTP headers. An attacker must trick a valid user who is authenticated to the device into clicking on a malicious link to exploit the vulnerability. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains an input validation vulnerability.Information is obtained, information is altered, and service operation is disrupted (DoS) There is a possibility of being put into a state. Siemens SIMATIC Panels and SIMATIC WinCC (TIA Portal) are products of Siemens AG, Germany. Siemens SIMATIC Panels is a human interface panel. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. A code injection vulnerability exists in Siemens SIMATIC Panels and SIMATIC WinCC (TIA Portal), which can be exploited by an attacker to inject HTTP headers with malicious links. Multiple Siemens Products are prone to an HTTP header-injection vulnerability because it fails to sufficiently sanitize user input. This may aid in further attacks", "sources": [ { "db": "NVD", "id": "CVE-2018-13814" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "BID", "id": "105931" }, { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "VULHUB", "id": "VHN-123911" } ], "trust": 2.7 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-13814", "trust": 3.6 }, { "db": "ICS CERT", "id": "ICSA-18-317-03", "trust": 2.3 }, { "db": "BID", "id": "105931", "trust": 2.0 }, { "db": "SIEMENS", "id": "SSA-944083", "trust": 1.7 }, { "db": "CNNVD", "id": "CNNVD-201811-488", "trust": 0.9 }, { "db": "CNVD", "id": "CNVD-2018-25432", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2018-014527", "trust": 0.8 }, { "db": "IVD", "id": "7D80AE62-463F-11E9-B905-000C29342CB1", "trust": 0.2 }, { "db": "SEEBUG", "id": "SSVID-98853", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-123911", "trust": 0.1 } ], "sources": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "VULHUB", "id": "VHN-123911" }, { "db": "BID", "id": "105931" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "CNNVD", "id": "CNNVD-201811-488" }, { "db": "NVD", "id": "CVE-2018-13814" } ] }, "id": "VAR-201812-0345", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "VULHUB", "id": "VHN-123911" } ], "trust": 1.53801620375 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "ICS" ], "sub_category": null, "trust": 0.8 } ], "sources": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-25432" } ] }, "last_update_date": "2024-08-14T14:57:01.106000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-944083", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-944083.pdf" }, { "title": "Patch for Siemens SIMATIC Panels and SIMATIC WinCC code injection vulnerability", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/147353" }, { "title": "Siemens SIMATIC Panels and SIMATIC WinCC Fixes for code injection vulnerabilities", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=86889" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "CNNVD", "id": "CNNVD-201811-488" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-20", "trust": 1.9 }, { "problemtype": "CWE-113", "trust": 1.0 } ], "sources": [ { "db": "VULHUB", "id": "VHN-123911" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "NVD", "id": "CVE-2018-13814" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.3, "url": "https://ics-cert.us-cert.gov/advisories/icsa-18-317-03" }, { "trust": 1.7, "url": "http://www.securityfocus.com/bid/105931" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-944083.pdf" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-13814" }, { "trust": 0.8, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-13814" }, { "trust": 0.3, "url": "http://subscriber.communications.siemens.com/" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "VULHUB", "id": "VHN-123911" }, { "db": "BID", "id": "105931" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "CNNVD", "id": "CNNVD-201811-488" }, { "db": "NVD", "id": "CVE-2018-13814" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "VULHUB", "id": "VHN-123911" }, { "db": "BID", "id": "105931" }, { "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "db": "CNNVD", "id": "CNNVD-201811-488" }, { "db": "NVD", "id": "CVE-2018-13814" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-12-14T00:00:00", "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "date": "2018-12-14T00:00:00", "db": "CNVD", "id": "CNVD-2018-25432" }, { "date": "2018-12-13T00:00:00", "db": "VULHUB", "id": "VHN-123911" }, { "date": "2018-11-13T00:00:00", "db": "BID", "id": "105931" }, { "date": "2019-03-26T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "date": "2018-11-15T00:00:00", "db": "CNNVD", "id": "CNNVD-201811-488" }, { "date": "2018-12-13T16:29:00.350000", "db": "NVD", "id": "CVE-2018-13814" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-12-14T00:00:00", "db": "CNVD", "id": "CNVD-2018-25432" }, { "date": "2019-10-09T00:00:00", "db": "VULHUB", "id": "VHN-123911" }, { "date": "2018-11-13T00:00:00", "db": "BID", "id": "105931" }, { "date": "2019-03-26T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-014527" }, { "date": "2019-10-17T00:00:00", "db": "CNNVD", "id": "CNNVD-201811-488" }, { "date": "2019-10-09T23:34:33.873000", "db": "NVD", "id": "CVE-2018-13814" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201811-488" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens SIMATIC Panels and SIMATIC WinCC code injection vulnerability", "sources": [ { "db": "CNVD", "id": "CNVD-2018-25432" }, { "db": "CNNVD", "id": "CNNVD-201811-488" } ], "trust": 1.2 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Input validation error", "sources": [ { "db": "IVD", "id": "7d80ae62-463f-11e9-b905-000c29342cb1" }, { "db": "BID", "id": "105931" }, { "db": "CNNVD", "id": "CNNVD-201811-488" } ], "trust": 1.1 } }
var-201904-0174
Vulnerability from variot
The webserver of the affected devices contains a vulnerability that may lead to a denial of service condition. An attacker may cause a denial of service situation which leads to a restart of the webserver of the affected device.
The security vulnerability could be exploited by an attacker with network access to the affected systems. Successful exploitation requires no system privileges and no user interaction. An attacker could use the vulnerability to compromise availability of the device. Multiple Siemens products contain input validation vulnerabilities.Service operation interruption (DoS) There is a possibility of being put into a state. SiemensCP, SIAMTIC, SIMOCODE, SINAMICS, SITOP and TIM are all devices manufactured by Siemens. Multiple Siemens products are prone to an unspecified denial-of-service vulnerability. Attackers can exploit this issue to cause a denial-of-service condition, denying service to legitimate users. A vulnerability has been identified in CP1604, CP1616, SIMATIC CP343-1 Advanced, SIMATIC CP443-1, SIMATIC CP443-1 Advanced, SIMATIC CP443-1 OPC UA, SIMATIC ET 200 SP Open Controller CPU 1515SP PC, SIMATIC ET 200 SP Open Controller CPU 1515SP PC2, SIMATIC HMI Comfort Outdoor Panels 7" & 15", SIMATIC HMI Comfort Panels 4" - 22", SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F, SIMATIC IPC DiagMonitor, SIMATIC RF181-EIP, SIMATIC RF182C, SIMATIC RF185C, SIMATIC RF186C, SIMATIC RF188C, SIMATIC RF600R, SIMATIC S7-1500 CPU family, SIMATIC S7-1500 Software Controller, SIMATIC S7-300 CPU family, SIMATIC S7-400 PN (incl. F) V6 and below, SIMATIC S7-400 PN/DP V7 (incl. F), SIMATIC S7-PLCSIM Advanced, SIMATIC Teleservice Adapter IE Advanced, SIMATIC Teleservice Adapter IE Basic, SIMATIC Teleservice Adapter IE Standard, SIMATIC WinAC RTX (F) 2010, SIMATIC WinCC Runtime Advanced, SIMOCODE pro V EIP, SIMOCODE pro V PN, SINAMICS G130 V4.6 (Control Unit), SINAMICS G130 V4.7 (Control Unit), SINAMICS G130 V4.7 SP1 (Control Unit), SINAMICS G130 V4.8 (Control Unit), SINAMICS G130 V5.1 (Control Unit), SINAMICS G130 V5.1 SP1 (Control Unit), SINAMICS G150 V4.6 (Control Unit), SINAMICS G150 V4.7 (Control Unit), SINAMICS G150 V4.7 SP1 (Control Unit), SINAMICS G150 V4.8 (Control Unit), SINAMICS G150 V5.1 (Control Unit), SINAMICS G150 V5.1 SP1 (Control Unit), SINAMICS GH150 V4.7 (Control Unit), SINAMICS GH150 V4.8 (Control Unit), SINAMICS GL150 V4.7 (Control Unit), SINAMICS GL150 V4.8 (Control Unit), SINAMICS GM150 V4.7 (Control Unit), SINAMICS GM150 V4.8 (Control Unit), SINAMICS S120 V4.6 (Control Unit), SINAMICS S120 V4.7 (Control Unit), SINAMICS S120 V4.7 SP1 (Control Unit), SINAMICS S120 V4.8 (Control Unit), SINAMICS S120 V5.1 (Control Unit), SINAMICS S120 V5.1 SP1 (Control Unit), SINAMICS S150 V4.6 (Control Unit), SINAMICS S150 V4.7 (Control Unit), SINAMICS S150 V4.7 SP1 (Control Unit), SINAMICS S150 V4.8 (Control Unit), SINAMICS S150 V5.1 (Control Unit), SINAMICS S150 V5.1 SP1 (Control Unit), SINAMICS S210 V5.1 (Control Unit), SINAMICS S210 V5.1 SP1 (Control Unit), SINAMICS SL150 V4.7 (Control Unit), SINAMICS SL150 V4.8 (Control Unit), SINAMICS SM120 V4.7 (Control Unit), SINAMICS SM120 V4.8 (Control Unit), SINAMICS SM150 V4.8 (Control Unit), SITOP Manager, SITOP PSU8600, SITOP UPS1600, TIM 1531 IRC. At the time of advisory publication no public exploitation of this security vulnerability was known. Siemens SIMATIC S7-1500 CPU, etc. are all products of German Siemens (Siemens). SIMATIC S7-1500 CPU is a CPU (central processing unit) module. CP1616 is a communications processor. SIMATIC S7-1500 is a programmable logic controller. The vulnerability stems from the failure of the network system or product to properly validate the input data
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201904-0174", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "sinamics s210", "scope": "eq", "trust": 1.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s150", "scope": "eq", "trust": 1.3, "vendor": "siemens", "version": "5.1" }, { "model": "simatic rf186c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.1.0" }, { "model": "sinamics sm120", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics s150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.1" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic s7-400 pn", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic s7-1500", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.6.1" }, { "model": "sinamics sl150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic winac rtx", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "2010" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "sitop manager", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic ipc diagmonitor", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.1.3" }, { "model": "simatic s7-plcsim advanced", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "sinamics gm150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics s120", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "cp1616", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic s7-1500t", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.6.1" }, { "model": "sinamics sm150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.1" }, { "model": "simatic cp443-1 advanced", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic s7-1500s", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.6.1" }, { "model": "tim 1531 irc", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.1" }, { "model": "sitop ups1600", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.3" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simocode pro v pn", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.1.3" }, { "model": "simatic s7-400 pn\\/dp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic cp343-1 advanced", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simocode pro v eip", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.1.3" }, { "model": "sinamics g150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "sinamics s210", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics sl150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic s7-1500f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.6.1" }, { "model": "simatic teleservice adapter ie basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "cp1604", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic wincc runtime advanced", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic winac rtx", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2010" }, { "model": "sinamics g130", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "5.2" }, { "model": "sinamics gh150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic rf181-eip", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic rf185c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.1.0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic s7-plcsim advanced", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.0" }, { "model": "simatic rf188c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.1.0" }, { "model": "simatic s7-1500 software controller", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.7" }, { "model": "simatic teleservice adapter ie advanced", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "sinamics gl150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics gm150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic cp443-1 opc ua", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic et 200 sp open controller cpu 1515sp pc2", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.7" }, { "model": "sinamics sm120", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic et 200 sp open controller cpu 1515sp pc", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.1.6" }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic cp443-1", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic s7-300", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.3.17" }, { "model": "sitop psu8600", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.5" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "sinamics gh150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics sm150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics gl150", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "4.8" }, { "model": "simatic rf182c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic teleservice adapter ie standard", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic rf600r", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.2.1" }, { "model": "simatic cp 1543sp-1", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic cp 1604", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic cp 1616", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic cp 343-1 advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic cp 443-1 adv", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic cp 443-1", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic et 200 sp open controller cpu 1515sp pc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic et 200 sp open controller cpu 1515sp pc2", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic rf185c", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": null, "scope": "eq", "trust": 0.6, "vendor": "sinamics s150", "version": "5.1" }, { "model": "simatic winac rtx sp2 all", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "2010" }, { "model": "simatic s7-300 cpu family all", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-400 pn/dp", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v7" }, { "model": "simatic s7-1500 software controller", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics s120", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics g130 and g150", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic rf182c", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic cp443-1 opc ua", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic ipc diagmonitor", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic rf188c", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic rf600r", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "cp1604", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "cp1616", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic et sp open controller cpu 1515sp pc", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "200\u003cv2.1.6" }, { "model": "simatic hmi comfort panels 4\" 22\"", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-1500 cpu family", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-400 pn", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v6" }, { "model": "sinamics s150", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sinamics s210", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v5.1" }, { "model": "sinamics s210 sp1", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v5.1" }, { "model": "tim irc", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "1531" }, { "model": "simatic hmi comfort outdoor panels 7\" \u0026 15\"", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic rf181-eip", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic rf186c", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic s7-plcsim advanced", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic teleservice adapter ie advanced", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic teleservice adapter ie basic", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic teleservice adapter ie standard", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simocode pro eip", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v" }, { "model": "simocode pro pn", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v" }, { "model": "sitop manager", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sitop psu8600", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "sitop ups1600", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "siamtic rf185c", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic cp343-1 advanced", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic cp443-1", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic cp443-1 advanced", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null }, { "model": "simatic et sp open controller cpu 1515sp pc2", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "200" }, { "model": null, "scope": "eq", "trust": 0.4, "vendor": "sinamics s210", "version": "5.1" }, { "model": "tim irc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15310" }, { "model": "sitop ups1600", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "sitop psu8600", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "sitop manager", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "sinamics s210 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s150 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics s150 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics s150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics s150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.6" }, { "model": "sinamics s120 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s120", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s120", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics s120 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics s120", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics s120", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.6" }, { "model": "sinamics g150 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics g150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics g150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics g150 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics g150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics g150", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.6" }, { "model": "sinamics g130 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics g130", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics g130", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics g130 sp1", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics g130", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.7" }, { "model": "sinamics g130", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "4.6" }, { "model": "simocode pro pn", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v0" }, { "model": "simocode pro eip", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v0" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic winac rtx", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "20100" }, { "model": "simatic teleservice adapter ie standard", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic teleservice adapter ie basic", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic teleservice adapter ie advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic s7-plcsim advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic s7-400 pn/dp", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "7" }, { "model": "simatic s7-400 pn", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v60" }, { "model": "simatic s7-300 cpu", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic s7-1500 software controller", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic s7-1500 cpu", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic rf600r", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic rf188c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic rf186c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic rf185c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic rf182c", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic ipc diagmonitor", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi ktp900f mobile", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi ktp900 mobile", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi ktp700f mobile", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi ktp700 mobile", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi ktp400f mobile", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic et200 open controller cpu 1515sp pc2", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic et200 open controller cpu 1515sp pc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic cp opc ua", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "443-10" }, { "model": "simatic cp advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "443-10" }, { "model": "simatic cp", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "443-10" }, { "model": "simatic cp advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "343-10" }, { "model": "rfid 181-eip", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "cp", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "16160" }, { "model": "cp", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "16040" }, { "model": "sinamics s150 sp1 hf4", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s150 hf6", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics s120 sp1 hf4", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics s120 hf6", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics g150 sp1 hf4", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics g150 hf6", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "sinamics g130 sp1 hf4", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "5.1" }, { "model": "sinamics g130 hf6", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "4.8" }, { "model": "simatic s7-300 cpu", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v3.x.16" }, { "model": "simatic et200 open controller cpu 1515sp pc", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "2.1.6" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "cp1604", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort panels", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp400f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp700", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp700f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp900", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi ktp mobile panels ktp900f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic cp443 1 opc ua", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic ipc diagmonitor", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500 controller", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 plcsim advanced", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic wincc runtime advanced", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sitop manager", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic rf600r", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic rf188c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic rf186c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "cp1616", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic rf182c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic rf181 eip", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 300", "version": null }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 400 pn", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 400 pn dp", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic teleservice adapter ie advanced", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic teleservice adapter ie basic", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic teleservice adapter ie standard", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic winac rtx 2010", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic rf185c", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simocode pro v eip", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simocode pro v pn", "version": null }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics g130", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics g150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics s120", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics s150", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sinamics s210", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sitop psu8600", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "sitop ups1600", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "tim 1531 irc", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic cp343 1 advanced", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500f", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500s", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic s7 1500t", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic cp443 1", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic cp443 1 advanced", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200 sp open controller cpu 1515sp pc", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic et 200 sp open controller cpu 1515sp pc2", "version": "*" }, { "model": null, "scope": "eq", "trust": 0.2, "vendor": "simatic hmi comfort outdoor panels", "version": "*" } ], "sources": [ { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "BID", "id": "107842" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "NVD", "id": "CVE-2019-6568" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_cp_1604_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_cp_1616_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_cp343-1_advanced_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_adv_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200_sp_open_controller_cpu_1515sp_pc_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_et_200_sp_open_controller_cpu_1515sp_pc2_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_rf185c_firmware", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-003541" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens reported this vulnerability to NCCIC.", "sources": [ { "db": "CNNVD", "id": "CNNVD-201904-458" } ], "trust": 0.6 }, "cve": "CVE-2019-6568", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CVE-2019-6568", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CNVD-2019-12904", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "IVD", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.2, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.9 [IVD]" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "VHN-158003", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:L/AU:N/C:N/I:N/A:P", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "HIGH", "baseScore": 7.5, "baseSeverity": "HIGH", "confidentialityImpact": "NONE", "exploitabilityScore": 3.9, "id": "CVE-2019-6568", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 2.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.1" }, { "attackComplexity": "Low", "attackVector": "Network", "author": "NVD", "availabilityImpact": "High", "baseScore": 7.5, "baseSeverity": "High", "confidentialityImpact": "None", "exploitabilityScore": null, "id": "CVE-2019-6568", "impactScore": null, "integrityImpact": "None", "privilegesRequired": "None", "scope": "Unchanged", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2019-6568", "trust": 1.0, "value": "HIGH" }, { "author": "productcert@siemens.com", "id": "CVE-2019-6568", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2019-6568", "trust": 0.8, "value": "High" }, { "author": "CNVD", "id": "CNVD-2019-12904", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-201904-458", "trust": 0.6, "value": "HIGH" }, { "author": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12", "trust": 0.2, "value": "HIGH" }, { "author": "VULHUB", "id": "VHN-158003", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "VULHUB", "id": "VHN-158003" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "CNNVD", "id": "CNNVD-201904-458" }, { "db": "NVD", "id": "CVE-2019-6568" }, { "db": "NVD", "id": "CVE-2019-6568" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "The webserver of the affected devices contains a vulnerability that may lead to\r\na denial of service condition. An attacker may cause a denial of service\r\nsituation which leads to a restart of the webserver of the affected device. \r\n\r\nThe security vulnerability could be exploited by an attacker with network\r\naccess to the affected systems. Successful exploitation requires no system\r\nprivileges and no user interaction. An attacker could use the vulnerability\r\nto compromise availability of the device. Multiple Siemens products contain input validation vulnerabilities.Service operation interruption (DoS) There is a possibility of being put into a state. SiemensCP, SIAMTIC, SIMOCODE, SINAMICS, SITOP and TIM are all devices manufactured by Siemens. Multiple Siemens products are prone to an unspecified denial-of-service vulnerability. \nAttackers can exploit this issue to cause a denial-of-service condition, denying service to legitimate users. A vulnerability has been identified in CP1604, CP1616, SIMATIC CP343-1 Advanced, SIMATIC CP443-1, SIMATIC CP443-1 Advanced, SIMATIC CP443-1 OPC UA, SIMATIC ET 200 SP Open Controller CPU 1515SP PC, SIMATIC ET 200 SP Open Controller CPU 1515SP PC2, SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\", SIMATIC HMI Comfort Panels 4\" - 22\", SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F, SIMATIC IPC DiagMonitor, SIMATIC RF181-EIP, SIMATIC RF182C, SIMATIC RF185C, SIMATIC RF186C, SIMATIC RF188C, SIMATIC RF600R, SIMATIC S7-1500 CPU family, SIMATIC S7-1500 Software Controller, SIMATIC S7-300 CPU family, SIMATIC S7-400 PN (incl. F) V6 and below, SIMATIC S7-400 PN/DP V7 (incl. F), SIMATIC S7-PLCSIM Advanced, SIMATIC Teleservice Adapter IE Advanced, SIMATIC Teleservice Adapter IE Basic, SIMATIC Teleservice Adapter IE Standard, SIMATIC WinAC RTX (F) 2010, SIMATIC WinCC Runtime Advanced, SIMOCODE pro V EIP, SIMOCODE pro V PN, SINAMICS G130 V4.6 (Control Unit), SINAMICS G130 V4.7 (Control Unit), SINAMICS G130 V4.7 SP1 (Control Unit), SINAMICS G130 V4.8 (Control Unit), SINAMICS G130 V5.1 (Control Unit), SINAMICS G130 V5.1 SP1 (Control Unit), SINAMICS G150 V4.6 (Control Unit), SINAMICS G150 V4.7 (Control Unit), SINAMICS G150 V4.7 SP1 (Control Unit), SINAMICS G150 V4.8 (Control Unit), SINAMICS G150 V5.1 (Control Unit), SINAMICS G150 V5.1 SP1 (Control Unit), SINAMICS GH150 V4.7 (Control Unit), SINAMICS GH150 V4.8 (Control Unit), SINAMICS GL150 V4.7 (Control Unit), SINAMICS GL150 V4.8 (Control Unit), SINAMICS GM150 V4.7 (Control Unit), SINAMICS GM150 V4.8 (Control Unit), SINAMICS S120 V4.6 (Control Unit), SINAMICS S120 V4.7 (Control Unit), SINAMICS S120 V4.7 SP1 (Control Unit), SINAMICS S120 V4.8 (Control Unit), SINAMICS S120 V5.1 (Control Unit), SINAMICS S120 V5.1 SP1 (Control Unit), SINAMICS S150 V4.6 (Control Unit), SINAMICS S150 V4.7 (Control Unit), SINAMICS S150 V4.7 SP1 (Control Unit), SINAMICS S150 V4.8 (Control Unit), SINAMICS S150 V5.1 (Control Unit), SINAMICS S150 V5.1 SP1 (Control Unit), SINAMICS S210 V5.1 (Control Unit), SINAMICS S210 V5.1 SP1 (Control Unit), SINAMICS SL150 V4.7 (Control Unit), SINAMICS SL150 V4.8 (Control Unit), SINAMICS SM120 V4.7 (Control Unit), SINAMICS SM120 V4.8 (Control Unit), SINAMICS SM150 V4.8 (Control Unit), SITOP Manager, SITOP PSU8600, SITOP UPS1600, TIM 1531 IRC. At the time of advisory publication no public exploitation of this security vulnerability was known. Siemens SIMATIC S7-1500 CPU, etc. are all products of German Siemens (Siemens). SIMATIC S7-1500 CPU is a CPU (central processing unit) module. CP1616 is a communications processor. SIMATIC S7-1500 is a programmable logic controller. The vulnerability stems from the failure of the network system or product to properly validate the input data", "sources": [ { "db": "NVD", "id": "CVE-2019-6568" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "BID", "id": "107842" }, { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "VULHUB", "id": "VHN-158003" } ], "trust": 2.7 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2019-6568", "trust": 3.6 }, { "db": "ICS CERT", "id": "ICSA-19-099-06", "trust": 2.3 }, { "db": "SIEMENS", "id": "SSA-480230", "trust": 2.0 }, { "db": "SIEMENS", "id": "SSA-530931", "trust": 1.7 }, { "db": "ICS CERT", "id": "ICSA-19-227-04", "trust": 1.4 }, { "db": "BID", "id": "107842", "trust": 1.0 }, { "db": "CNNVD", "id": "CNNVD-201904-458", "trust": 0.9 }, { "db": "CNVD", "id": "CNVD-2019-12904", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2019-003541", "trust": 0.8 }, { "db": "AUSCERT", "id": "ESB-2019.3150", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1204.2", "trust": 0.6 }, { "db": "IVD", "id": "A397CC8B-EE17-4FAF-8447-E9EE5F57DD12", "trust": 0.2 }, { "db": "VULHUB", "id": "VHN-158003", "trust": 0.1 } ], "sources": [ { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "VULHUB", "id": "VHN-158003" }, { "db": "BID", "id": "107842" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "CNNVD", "id": "CNNVD-201904-458" }, { "db": "NVD", "id": "CVE-2019-6568" } ] }, "id": "VAR-201904-0174", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "VULHUB", "id": "VHN-158003" } ], "trust": 1.594357721153846 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "ICS", "Network device" ], "sub_category": null, "trust": 0.6 }, { "category": [ "ICS" ], "sub_category": null, "trust": 0.2 } ], "sources": [ { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "CNVD", "id": "CNVD-2019-12904" } ] }, "last_update_date": "2024-08-14T15:43:49.516000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-480230", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-480230.pdf" }, { "title": "SSA-530931", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-530931.pdf" }, { "title": "Patches for multiple Siemens product denial of service vulnerabilities", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/160237" }, { "title": "Multiple Siemens Product security vulnerabilities", "trust": 0.6, "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=91286" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "CNNVD", "id": "CNNVD-201904-458" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-125", "trust": 1.1 }, { "problemtype": "CWE-20", "trust": 0.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158003" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "NVD", "id": "CVE-2019-6568" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.3, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-099-06" }, { "trust": 2.0, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-480230.pdf" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-530931.pdf" }, { "trust": 1.4, "url": "https://www.us-cert.gov/ics/advisories/icsa-19-227-04" }, { "trust": 1.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-6568" }, { "trust": 0.9, "url": "http://subscriber.communications.siemens.com/" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-6568" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.3150/" }, { "trust": 0.6, "url": "https://www.us-cert.gov/ics/advisories/icsa-19-099-06" }, { "trust": 0.6, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-19-099-06" }, { "trust": 0.6, "url": "https://www.securityfocus.com/bid/107842" }, { "trust": 0.6, "url": "https://vigilance.fr/vulnerability/siemens-simatic-denial-of-service-via-webserver-28976" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/78710" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "VULHUB", "id": "VHN-158003" }, { "db": "BID", "id": "107842" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "CNNVD", "id": "CNNVD-201904-458" }, { "db": "NVD", "id": "CVE-2019-6568" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "db": "CNVD", "id": "CNVD-2019-12904" }, { "db": "VULHUB", "id": "VHN-158003" }, { "db": "BID", "id": "107842" }, { "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "db": "CNNVD", "id": "CNNVD-201904-458" }, { "db": "NVD", "id": "CVE-2019-6568" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-05T00:00:00", "db": "IVD", "id": "a397cc8b-ee17-4faf-8447-e9ee5f57dd12" }, { "date": "2019-05-05T00:00:00", "db": "CNVD", "id": "CNVD-2019-12904" }, { "date": "2019-04-17T00:00:00", "db": "VULHUB", "id": "VHN-158003" }, { "date": "2019-04-09T00:00:00", "db": "BID", "id": "107842" }, { "date": "2019-05-20T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "date": "2019-04-09T00:00:00", "db": "CNNVD", "id": "CNNVD-201904-458" }, { "date": "2019-04-17T14:29:03.683000", "db": "NVD", "id": "CVE-2019-6568" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-07T00:00:00", "db": "CNVD", "id": "CNVD-2019-12904" }, { "date": "2023-01-10T00:00:00", "db": "VULHUB", "id": "VHN-158003" }, { "date": "2019-04-09T00:00:00", "db": "BID", "id": "107842" }, { "date": "2019-08-20T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-003541" }, { "date": "2023-04-12T00:00:00", "db": "CNNVD", "id": "CNNVD-201904-458" }, { "date": "2023-04-11T10:15:09.153000", "db": "NVD", "id": "CVE-2019-6568" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201904-458" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Vulnerability related to input validation in multiple Siemens products", "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-003541" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "buffer error", "sources": [ { "db": "CNNVD", "id": "CNNVD-201904-458" } ], "trust": 0.6 } }
var-201905-0112
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 4" - 22" (All versions < V15.1 Update 1), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions < V15.1 Update 1), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F (All versions < V15.1 Update 1), SIMATIC WinCC Runtime Advanced (All versions < V15.1 Update 1), SIMATIC WinCC Runtime Professional (All versions < V15.1 Update 1), SIMATIC WinCC (TIA Portal) (All versions < V15.1 Update 1), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The affected device offered SNMP read and write capacities with a publicly know hardcoded community string. The security vulnerability could be exploited by an attacker with network access to the affected device. Successful exploitation requires no system privileges and no user interaction. An attacker could use the vulnerability to compromise confidentiality and integrity of the affected system. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains vulnerabilities related to authorization, permissions, and access control.Information may be obtained and information may be altered. Multiple Siemens Products are prone to following security vulnerabilities: 1. An information-disclosure vulnerability 2. A cross-site-scripting vulnerability 3. A security vulnerability An attacker may leverage these issues to obtain potentially sensitive information and to execute arbitrary script code in the browser of an unsuspecting user in the context of the affected site. This may allow the attacker to steal cookie-based authentication credentials and to launch other attacks. Siemens SIMATIC WinCC, etc. are all products of Siemens (Siemens) in Germany. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. Siemens SIMATIC HMI Comfort Panels is a touch panel device. Siemens SIMATIC HMI Comfort Outdoor Panels is a touch panel device specially designed for outdoor use. The vulnerability stems from the lack of effective permissions and access control measures in network systems or products
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201905-0112", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic wincc \\", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi mp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic wincc runtime", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi op", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi tp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15.1" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi classic devices", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime professional update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v15.11" }, { "model": "simatic wincc runtime advanced update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic wincc update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v15.11" }, { "model": "simatic hmi ktp mobile update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic hmi comfort panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic hmi comfort outdoor panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" } ], "sources": [ { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "NVD", "id": "CVE-2019-6572" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp400f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:wincc_runtime_advanced", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_runtime_professional", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004632" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens ProductCERT reported these vulnerabilities to NCCIC.,Siemens ProductCERT", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-590" } ], "trust": 0.6 }, "cve": "CVE-2019-6572", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 6.4, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 10.0, "id": "CVE-2019-6572", "impactScore": 4.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:L/Au:N/C:P/I:P/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 6.4, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 10.0, "id": "VHN-158007", "impactScore": 4.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:L/AU:N/C:P/I:P/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 9.1, "baseSeverity": "CRITICAL", "confidentialityImpact": "HIGH", "exploitabilityScore": 3.9, "id": "CVE-2019-6572", "impactScore": 5.2, "integrityImpact": "HIGH", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:N", "version": "3.1" }, { "attackComplexity": "Low", "attackVector": "Network", "author": "NVD", "availabilityImpact": "None", "baseScore": 9.1, "baseSeverity": "Critical", "confidentialityImpact": "High", "exploitabilityScore": null, "id": "CVE-2019-6572", "impactScore": null, "integrityImpact": "High", "privilegesRequired": "None", "scope": "Unchanged", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2019-6572", "trust": 1.0, "value": "CRITICAL" }, { "author": "NVD", "id": "CVE-2019-6572", "trust": 0.8, "value": "Critical" }, { "author": "CNNVD", "id": "CNNVD-201905-590", "trust": 0.6, "value": "CRITICAL" }, { "author": "VULHUB", "id": "VHN-158007", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-158007" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "CNNVD", "id": "CNNVD-201905-590" }, { "db": "NVD", "id": "CVE-2019-6572" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 4\" - 22\" (All versions \u003c V15.1 Update 1), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions \u003c V15.1 Update 1), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F (All versions \u003c V15.1 Update 1), SIMATIC WinCC Runtime Advanced (All versions \u003c V15.1 Update 1), SIMATIC WinCC Runtime Professional (All versions \u003c V15.1 Update 1), SIMATIC WinCC (TIA Portal) (All versions \u003c V15.1 Update 1), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). The affected device offered SNMP read and write capacities with a publicly know hardcoded community string. The security vulnerability could be exploited by an attacker with network access to the affected device. Successful exploitation requires no system privileges and no user interaction. An attacker could use the vulnerability to compromise confidentiality and integrity of the affected system. At the time of advisory publication no public exploitation of this security vulnerability was known. plural SIMATIC The product contains vulnerabilities related to authorization, permissions, and access control.Information may be obtained and information may be altered. Multiple Siemens Products are prone to following security vulnerabilities:\n1. An information-disclosure vulnerability\n2. A cross-site-scripting vulnerability\n3. A security vulnerability\nAn attacker may leverage these issues to obtain potentially sensitive information and to execute arbitrary script code in the browser of an unsuspecting user in the context of the affected site. This may allow the attacker to steal cookie-based authentication credentials and to launch other attacks. Siemens SIMATIC WinCC, etc. are all products of Siemens (Siemens) in Germany. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. Siemens SIMATIC HMI Comfort Panels is a touch panel device. Siemens SIMATIC HMI Comfort Outdoor Panels is a touch panel device specially designed for outdoor use. The vulnerability stems from the lack of effective permissions and access control measures in network systems or products", "sources": [ { "db": "NVD", "id": "CVE-2019-6572" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "BID", "id": "108412" }, { "db": "VULHUB", "id": "VHN-158007" } ], "trust": 1.98 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "ICS CERT", "id": "ICSA-19-134-09", "trust": 2.8 }, { "db": "NVD", "id": "CVE-2019-6572", "trust": 2.8 }, { "db": "BID", "id": "108412", "trust": 2.0 }, { "db": "SIEMENS", "id": "SSA-804486", "trust": 1.7 }, { "db": "JVNDB", "id": "JVNDB-2019-004632", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201905-590", "trust": 0.7 }, { "db": "ICS CERT", "id": "ICSA-19-134-02", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1716.2", "trust": 0.6 }, { "db": "CNVD", "id": "CNVD-2021-54367", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-158007", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158007" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "CNNVD", "id": "CNNVD-201905-590" }, { "db": "NVD", "id": "CVE-2019-6572" } ] }, "id": "VAR-201905-0112", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-158007" } ], "trust": 0.753329633 }, "last_update_date": "2024-08-14T13:26:20.995000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-804486", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-804486.pdf" }, { "title": "Siemens SIMATIC Panels and WinCC Repair measures for trust management problem vulnerabilities", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=92740" } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "CNNVD", "id": "CNNVD-201905-590" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-798", "trust": 1.1 }, { "problemtype": "CWE-200", "trust": 1.0 }, { "problemtype": "CWE-264", "trust": 0.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158007" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "NVD", "id": "CVE-2019-6572" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.9, "url": "http://www.securityfocus.com/bid/108412" }, { "trust": 2.5, "url": "https://www.us-cert.gov/ics/advisories/icsa-19-134-09" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-804486.pdf" }, { "trust": 1.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-6572" }, { "trust": 0.9, "url": "http://subscriber.communications.siemens.com/" }, { "trust": 0.9, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-134-09" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-6572" }, { "trust": 0.6, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-134-02-0" }, { "trust": 0.6, "url": "https://vigilance.fr/vulnerability/simatic-wincc-multiple-vulnerabilities-29288" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/80946" } ], "sources": [ { "db": "VULHUB", "id": "VHN-158007" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "CNNVD", "id": "CNNVD-201905-590" }, { "db": "NVD", "id": "CVE-2019-6572" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-158007" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "db": "CNNVD", "id": "CNNVD-201905-590" }, { "db": "NVD", "id": "CVE-2019-6572" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-14T00:00:00", "db": "VULHUB", "id": "VHN-158007" }, { "date": "2019-05-14T00:00:00", "db": "BID", "id": "108412" }, { "date": "2019-06-05T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "date": "2019-05-14T00:00:00", "db": "CNNVD", "id": "CNNVD-201905-590" }, { "date": "2019-05-14T20:29:04.200000", "db": "NVD", "id": "CVE-2019-6572" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2020-10-06T00:00:00", "db": "VULHUB", "id": "VHN-158007" }, { "date": "2019-05-14T00:00:00", "db": "BID", "id": "108412" }, { "date": "2019-07-09T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-004632" }, { "date": "2020-10-28T00:00:00", "db": "CNNVD", "id": "CNNVD-201905-590" }, { "date": "2020-10-06T16:18:02.707000", "db": "NVD", "id": "CVE-2019-6572" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-590" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "plural SIMATIC Vulnerabilities related to authorization, authority, and access control in products", "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004632" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "trust management problem", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-590" } ], "trust": 0.6 } }
var-201905-0114
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 4" - 22" (All versions < V15.1 Update 1), SIMATIC HMI Comfort Outdoor Panels 7" & 15" (All versions < V15.1 Update 1), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F (All versions < V15.1 Update 1), SIMATIC WinCC Runtime Advanced (All versions < V15.1 Update 1), SIMATIC WinCC Runtime Professional (All versions < V15.1 Update 1), SIMATIC WinCC (TIA Portal) (All versions < V15.1 Update 1), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). An attacker with network access to affected devices could potentially obtain a TLS session key. If the attacker is able to observe TLS traffic between a legitimate user and the device, then the attacker could decrypt the TLS traffic. The security vulnerability could be exploited by an attacker who has network access to the web interface of the device and who is able to observe TLS traffic between legitimate users and the web interface of the affected device. The vulnerability could impact the confidentiality of the communication between the affected device and a legitimate user. At the time of advisory publication no public exploitation of the security vulnerability was known. plural SIMATIC The product contains cryptographic vulnerabilities.Information may be obtained. Multiple Siemens Products are prone to following security vulnerabilities: 1. An information-disclosure vulnerability 2. A cross-site-scripting vulnerability 3. A security vulnerability An attacker may leverage these issues to obtain potentially sensitive information and to execute arbitrary script code in the browser of an unsuspecting user in the context of the affected site. This may allow the attacker to steal cookie-based authentication credentials and to launch other attacks. Siemens SIMATIC WinCC, etc. are all products of Siemens (Siemens) in Germany. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. Siemens SIMATIC HMI Comfort Panels is a touch panel device. Siemens SIMATIC HMI Comfort Outdoor Panels is a touch panel device specially designed for outdoor use
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201905-0114", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic wincc \\", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi mp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic wincc runtime", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi op", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi tp", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "*" }, { "model": "simatic hmi comfort outdoor panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp400f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp700f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels ktp900f", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime advanced", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": null, "trust": 0.8, "vendor": "siemens", "version": null }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic wincc runtime professional", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic wincc runtime advanced", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15.1" }, { "model": "simatic wincc", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "v15" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15.1" }, { "model": "simatic hmi comfort outdoor panels", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "15" }, { "model": "simatic hmi classic devices", "scope": "eq", "trust": 0.3, "vendor": "siemens", "version": "0" }, { "model": "simatic wincc runtime professional update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v15.11" }, { "model": "simatic wincc runtime advanced update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic wincc update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "v15.11" }, { "model": "simatic hmi ktp mobile update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic hmi comfort panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" }, { "model": "simatic hmi comfort outdoor panels update", "scope": "ne", "trust": 0.3, "vendor": "siemens", "version": "15.11" } ], "sources": [ { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "NVD", "id": "CVE-2019-6576" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_outdoor_panels_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp400f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp700f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/o:siemens:simatic_hmi_ktp_mobile_panels_ktp900f_firmware", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:wincc_runtime_advanced", "vulnerable": true }, { "cpe22Uri": "cpe:/a:siemens:simatic_wincc_runtime_professional", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004633" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens ProductCERT reported these vulnerabilities to NCCIC.,Siemens ProductCERT", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-589" } ], "trust": 0.6 }, "cve": "CVE-2019-6576", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.0, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 10.0, "id": "CVE-2019-6576", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:L/Au:N/C:P/I:N/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 5.0, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 10.0, "id": "VHN-158011", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:N/AC:L/AU:N/C:P/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 7.5, "baseSeverity": "HIGH", "confidentialityImpact": "HIGH", "exploitabilityScore": 3.9, "id": "CVE-2019-6576", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.8, "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2019-6576", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2019-6576", "trust": 0.8, "value": "High" }, { "author": "CNNVD", "id": "CNNVD-201905-589", "trust": 0.6, "value": "HIGH" }, { "author": "VULHUB", "id": "VHN-158011", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-158011" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "CNNVD", "id": "CNNVD-201905-589" }, { "db": "NVD", "id": "CVE-2019-6576" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 4\" - 22\" (All versions \u003c V15.1 Update 1), SIMATIC HMI Comfort Outdoor Panels 7\" \u0026 15\" (All versions \u003c V15.1 Update 1), SIMATIC HMI KTP Mobile Panels KTP400F, KTP700, KTP700F, KTP900 und KTP900F (All versions \u003c V15.1 Update 1), SIMATIC WinCC Runtime Advanced (All versions \u003c V15.1 Update 1), SIMATIC WinCC Runtime Professional (All versions \u003c V15.1 Update 1), SIMATIC WinCC (TIA Portal) (All versions \u003c V15.1 Update 1), SIMATIC HMI Classic Devices (TP/MP/OP/MP Mobile Panel) (All versions). An attacker with network access to affected devices could potentially obtain a TLS session key. If the attacker is able to observe TLS traffic between a legitimate user and the device, then the attacker could decrypt the TLS traffic. The security vulnerability could be exploited by an attacker who has network access to the web interface of the device and who is able to observe TLS traffic between legitimate users and the web interface of the affected device. The vulnerability could impact the confidentiality of the communication between the affected device and a legitimate user. At the time of advisory publication no public exploitation of the security vulnerability was known. plural SIMATIC The product contains cryptographic vulnerabilities.Information may be obtained. Multiple Siemens Products are prone to following security vulnerabilities:\n1. An information-disclosure vulnerability\n2. A cross-site-scripting vulnerability\n3. A security vulnerability\nAn attacker may leverage these issues to obtain potentially sensitive information and to execute arbitrary script code in the browser of an unsuspecting user in the context of the affected site. This may allow the attacker to steal cookie-based authentication credentials and to launch other attacks. Siemens SIMATIC WinCC, etc. are all products of Siemens (Siemens) in Germany. SIMATIC WinCC is an automated data acquisition and monitoring (SCADA) system. Siemens SIMATIC HMI Comfort Panels is a touch panel device. Siemens SIMATIC HMI Comfort Outdoor Panels is a touch panel device specially designed for outdoor use", "sources": [ { "db": "NVD", "id": "CVE-2019-6576" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "BID", "id": "108412" }, { "db": "VULHUB", "id": "VHN-158011" } ], "trust": 1.98 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "ICS CERT", "id": "ICSA-19-134-09", "trust": 2.8 }, { "db": "NVD", "id": "CVE-2019-6576", "trust": 2.8 }, { "db": "BID", "id": "108412", "trust": 2.0 }, { "db": "SIEMENS", "id": "SSA-804486", "trust": 1.7 }, { "db": "JVNDB", "id": "JVNDB-2019-004633", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201905-589", "trust": 0.7 }, { "db": "ICS CERT", "id": "ICSA-19-134-02", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1716.2", "trust": 0.6 }, { "db": "CNVD", "id": "CNVD-2021-54366", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-158011", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158011" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "CNNVD", "id": "CNNVD-201905-589" }, { "db": "NVD", "id": "CVE-2019-6576" } ] }, "id": "VAR-201905-0114", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-158011" } ], "trust": 0.753329633 }, "last_update_date": "2024-08-14T13:26:21.814000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-804486", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-804486.pdf" }, { "title": "Siemens SIMATIC Panels and WinCC Security vulnerabilities", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=92739" } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "CNNVD", "id": "CNNVD-201905-589" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-310", "trust": 1.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-158011" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "NVD", "id": "CVE-2019-6576" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.3, "url": "http://www.securityfocus.com/bid/108412" }, { "trust": 1.9, "url": "https://www.us-cert.gov/ics/advisories/icsa-19-134-09" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-804486.pdf" }, { "trust": 1.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-6576" }, { "trust": 0.9, "url": "http://subscriber.communications.siemens.com/" }, { "trust": 0.9, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-134-09" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-6576" }, { "trust": 0.6, "url": "https://ics-cert.us-cert.gov/advisories/icsa-19-134-02-0" }, { "trust": 0.6, "url": "https://vigilance.fr/vulnerability/simatic-wincc-multiple-vulnerabilities-29288" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/80946" } ], "sources": [ { "db": "VULHUB", "id": "VHN-158011" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "CNNVD", "id": "CNNVD-201905-589" }, { "db": "NVD", "id": "CVE-2019-6576" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-158011" }, { "db": "BID", "id": "108412" }, { "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "db": "CNNVD", "id": "CNNVD-201905-589" }, { "db": "NVD", "id": "CVE-2019-6576" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-14T00:00:00", "db": "VULHUB", "id": "VHN-158011" }, { "date": "2019-05-14T00:00:00", "db": "BID", "id": "108412" }, { "date": "2019-06-05T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "date": "2019-05-14T00:00:00", "db": "CNNVD", "id": "CNNVD-201905-589" }, { "date": "2019-05-14T20:29:04.560000", "db": "NVD", "id": "CVE-2019-6576" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2019-05-22T00:00:00", "db": "VULHUB", "id": "VHN-158011" }, { "date": "2019-05-14T00:00:00", "db": "BID", "id": "108412" }, { "date": "2019-07-09T00:00:00", "db": "JVNDB", "id": "JVNDB-2019-004633" }, { "date": "2019-06-20T00:00:00", "db": "CNNVD", "id": "CNNVD-201905-589" }, { "date": "2019-05-22T16:29:01.680000", "db": "NVD", "id": "CVE-2019-6576" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-589" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "plural SIMATIC Cryptographic vulnerabilities in products", "sources": [ { "db": "JVNDB", "id": "JVNDB-2019-004633" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "encryption problem", "sources": [ { "db": "CNNVD", "id": "CNNVD-201905-589" } ], "trust": 0.6 } }
var-202102-0161
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions < V16 Update 3a), SIMATIC HMI KTP Mobile Panels (All versions < V16 Update 3a), SINAMICS GH150 (All versions), SINAMICS GL150 (with option X30) (All versions), SINAMICS GM150 (with option X30) (All versions), SINAMICS SH150 (All versions), SINAMICS SL150 (All versions), SINAMICS SM120 (All versions), SINAMICS SM150 (All versions), SINAMICS SM150i (All versions). Affected devices with enabled telnet service do not require authentication for this service. This could allow a remote attacker to gain full access to the device. (ZDI-CAN-12046). This vulnerability allows remote attackers to execute arbitrary code on affected installations of Siemens Comfort Panel. Authentication is not required to exploit this vulnerability.The specific flaw exists within the telnet service, which listens on TCP port 22 by default. The issue results from the lack of authentication prior to allowing remote connections. An attacker can leverage this vulnerability to execute code in the context of SYSTEM. Siemens Simatic Hmi is a device of Germany's Siemens (Siemens) that provides human-computer interaction functions for industrial automation equipment
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-202102-0161", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "16.0" }, { "model": "sinamics sm150i", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "sinamics sh150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "16.0" }, { "model": "sinamics gm150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "16.0" }, { "model": "simatic hmi ktp mobile panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "16.0" }, { "model": "sinamics sm120", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "sinamics gh150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "sinamics sl150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "sinamics sm150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "sinamics gl150", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi ktp mobile panels", "scope": "lt", "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": "v16 update 3a earlier versions" }, { "model": "comfort panel", "scope": null, "trust": 0.7, "vendor": "siemens", "version": null }, { "model": "simatic hmi", "scope": null, "trust": 0.6, "vendor": "siemens", "version": null } ], "sources": [ { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "NVD", "id": "CVE-2020-15798" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Ta-Lun Yen of TXOne IoT/ICS Security Research Labs (Trend Micro)", "sources": [ { "db": "ZDI", "id": "ZDI-21-129" } ], "trust": 0.7 }, "cve": "CVE-2020-15798", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "COMPLETE", "baseScore": 9.3, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 8.6, "id": "CVE-2020-15798", "impactScore": 10.0, "integrityImpact": "COMPLETE", "severity": "HIGH", "trust": 1.1, "vectorString": "AV:N/AC:M/Au:N/C:C/I:C/A:C", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "NETWORK", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 4.3, "confidentialityImpact": "NONE", "exploitabilityScore": 8.6, "id": "CNVD-2021-07537", "impactScore": 2.9, "integrityImpact": "PARTIAL", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:N/AC:M/Au:N/C:N/I:P/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "HIGH", "baseScore": 9.8, "baseSeverity": "CRITICAL", "confidentialityImpact": "HIGH", "exploitabilityScore": 3.9, "id": "CVE-2020-15798", "impactScore": 5.9, "integrityImpact": "HIGH", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H", "version": "3.1" }, { "attackComplexity": "High", "attackVector": "Network", "author": "IPA", "availabilityImpact": "High", "baseScore": 8.1, "baseSeverity": "High", "confidentialityImpact": "High", "exploitabilityScore": null, "id": "JVNDB-2021-001015", "impactScore": null, "integrityImpact": "High", "privilegesRequired": "None", "scope": "Unchanged", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:N/AC:H/PR:N/UI:N/S:U/C:H/I:H/A:H", "version": "3.0" }, { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "ZDI", "availabilityImpact": "HIGH", "baseScore": 9.8, "baseSeverity": "CRITICAL", "confidentialityImpact": "HIGH", "exploitabilityScore": 3.9, "id": "CVE-2020-15798", "impactScore": 5.9, "integrityImpact": "HIGH", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 0.7, "userInteraction": "NONE", "vectorString": "AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2020-15798", "trust": 1.0, "value": "CRITICAL" }, { "author": "IPA", "id": "JVNDB-2021-001015", "trust": 0.8, "value": "High" }, { "author": "ZDI", "id": "CVE-2020-15798", "trust": 0.7, "value": "CRITICAL" }, { "author": "CNVD", "id": "CNVD-2021-07537", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-202101-2499", "trust": 0.6, "value": "CRITICAL" }, { "author": "VULMON", "id": "CVE-2020-15798", "trust": 0.1, "value": "HIGH" } ] } ], "sources": [ { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "VULMON", "id": "CVE-2020-15798" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "CNNVD", "id": "CNNVD-202101-2499" }, { "db": "NVD", "id": "CVE-2020-15798" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions \u003c V16 Update 3a), SIMATIC HMI KTP Mobile Panels (All versions \u003c V16 Update 3a), SINAMICS GH150 (All versions), SINAMICS GL150 (with option X30) (All versions), SINAMICS GM150 (with option X30) (All versions), SINAMICS SH150 (All versions), SINAMICS SL150 (All versions), SINAMICS SM120 (All versions), SINAMICS SM150 (All versions), SINAMICS SM150i (All versions). Affected devices with enabled telnet service do not require authentication for this service. This could allow a remote attacker to gain full access to the device. (ZDI-CAN-12046). This vulnerability allows remote attackers to execute arbitrary code on affected installations of Siemens Comfort Panel. Authentication is not required to exploit this vulnerability.The specific flaw exists within the telnet service, which listens on TCP port 22 by default. The issue results from the lack of authentication prior to allowing remote connections. An attacker can leverage this vulnerability to execute code in the context of SYSTEM. Siemens Simatic Hmi is a device of Germany\u0027s Siemens (Siemens) that provides human-computer interaction functions for industrial automation equipment", "sources": [ { "db": "NVD", "id": "CVE-2020-15798" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "VULMON", "id": "CVE-2020-15798" } ], "trust": 2.88 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2020-15798", "trust": 3.8 }, { "db": "ICS CERT", "id": "ICSA-21-033-02", "trust": 2.5 }, { "db": "SIEMENS", "id": "SSA-520004", "trust": 1.7 }, { "db": "SIEMENS", "id": "SSA-752103", "trust": 1.7 }, { "db": "ZDI", "id": "ZDI-21-129", "trust": 0.8 }, { "db": "JVN", "id": "JVNVU92618342", "trust": 0.8 }, { "db": "JVN", "id": "JVNVU91051134", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2021-001015", "trust": 0.8 }, { "db": "ZDI_CAN", "id": "ZDI-CAN-12046", "trust": 0.7 }, { "db": "CNVD", "id": "CNVD-2021-07537", "trust": 0.6 }, { "db": "ICS CERT", "id": "ICSA-21-131-13", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2021.0384", "trust": 0.6 }, { "db": "CNNVD", "id": "CNNVD-202101-2499", "trust": 0.6 }, { "db": "VULMON", "id": "CVE-2020-15798", "trust": 0.1 } ], "sources": [ { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "VULMON", "id": "CVE-2020-15798" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "CNNVD", "id": "CNNVD-202101-2499" }, { "db": "NVD", "id": "CVE-2020-15798" } ] }, "id": "VAR-202102-0161", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2021-07537" } ], "trust": 1.17291723125 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "ICS" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2021-07537" } ] }, "last_update_date": "2024-08-14T12:51:16.830000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-520004", "trust": 0.8, "url": "https://support.industry.siemens.com/cs/document/109746530/image-downloads-for-hmi-operator-panels?dti=0\u0026lc=en-WW" }, { "title": "Siemens has issued an update to correct this vulnerability.", "trust": 0.7, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02" }, { "title": "Patch for Siemens Simatic Hmi authorization issue vulnerability", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/246031" }, { "title": "Siemens Simatic Hmi Remediation measures for authorization problem vulnerabilities", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=140096" }, { "title": "Siemens Security Advisories: Siemens Security Advisory", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=727a7bb82c467c1176e726c944e1c560" }, { "title": "Siemens Security Advisories: Siemens Security Advisory", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=a4e80f78fa87968e8881f762b328bbfa" }, { "title": "", "trust": 0.1, "url": "https://github.com/Live-Hack-CVE/CVE-2020-15798 " } ], "sources": [ { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "VULMON", "id": "CVE-2020-15798" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "CNNVD", "id": "CNNVD-202101-2499" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-306", "trust": 1.0 }, { "problemtype": "Lack of authentication for important features (CWE-306) [IPA Evaluation ]", "trust": 0.8 } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "NVD", "id": "CVE-2020-15798" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 3.8, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-033-02" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-520004.pdf" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-752103.pdf" }, { "trust": 1.2, "url": "https://vigilance.fr/vulnerability/simatic-hmi-code-execution-via-unauthenticated-telnet-34430" }, { "trust": 0.8, "url": "http://jvn.jp/cert/jvnvu92618342" }, { "trust": 0.8, "url": "https://jvn.jp/vu/jvnvu91051134/index.html" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2021.0384/" }, { "trust": 0.6, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-131-13" }, { "trust": 0.1, "url": "https://cwe.mitre.org/data/definitions/306.html" }, { "trust": 0.1, "url": "https://github.com/live-hack-cve/cve-2020-15798" }, { "trust": 0.1, "url": "https://nvd.nist.gov" }, { "trust": 0.1, "url": "https://www.zerodayinitiative.com/advisories/zdi-21-129/" } ], "sources": [ { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "VULMON", "id": "CVE-2020-15798" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "CNNVD", "id": "CNNVD-202101-2499" }, { "db": "NVD", "id": "CVE-2020-15798" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "ZDI", "id": "ZDI-21-129" }, { "db": "CNVD", "id": "CNVD-2021-07537" }, { "db": "VULMON", "id": "CVE-2020-15798" }, { "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "db": "CNNVD", "id": "CNNVD-202101-2499" }, { "db": "NVD", "id": "CVE-2020-15798" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2021-02-04T00:00:00", "db": "ZDI", "id": "ZDI-21-129" }, { "date": "2021-01-31T00:00:00", "db": "CNVD", "id": "CNVD-2021-07537" }, { "date": "2021-02-09T00:00:00", "db": "VULMON", "id": "CVE-2020-15798" }, { "date": "2021-02-01T00:00:00", "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "date": "2021-01-28T00:00:00", "db": "CNNVD", "id": "CNNVD-202101-2499" }, { "date": "2021-02-09T17:15:13.437000", "db": "NVD", "id": "CVE-2020-15798" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2021-02-04T00:00:00", "db": "ZDI", "id": "ZDI-21-129" }, { "date": "2021-02-03T00:00:00", "db": "CNVD", "id": "CNVD-2021-07537" }, { "date": "2022-10-19T00:00:00", "db": "VULMON", "id": "CVE-2020-15798" }, { "date": "2021-05-19T07:05:00", "db": "JVNDB", "id": "JVNDB-2021-001015" }, { "date": "2021-08-11T00:00:00", "db": "CNNVD", "id": "CNNVD-202101-2499" }, { "date": "2022-10-19T19:39:10.340000", "db": "NVD", "id": "CVE-2020-15798" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-202101-2499" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens\u00a0 Made \u00a0HMI\u00a0 Lack of authentication vulnerability for product critical features", "sources": [ { "db": "JVNDB", "id": "JVNDB-2021-001015" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "access control error", "sources": [ { "db": "CNNVD", "id": "CNNVD-202101-2499" } ], "trust": 0.6 } }
var-202210-0467
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions < V17 Update 4), SIMATIC HMI KTP Mobile Panels (All versions < V17 Update 4), SIMATIC HMI KTP1200 Basic (All versions < V17 Update 5), SIMATIC HMI KTP400 Basic (All versions < V17 Update 5), SIMATIC HMI KTP700 Basic (All versions < V17 Update 5), SIMATIC HMI KTP900 Basic (All versions < V17 Update 5), SIPLUS HMI KTP1200 BASIC (All versions < V17 Update 5), SIPLUS HMI KTP400 BASIC (All versions < V17 Update 5), SIPLUS HMI KTP700 BASIC (All versions < V17 Update 5), SIPLUS HMI KTP900 BASIC (All versions < V17 Update 5). Affected devices do not properly validate input sent to certain services over TCP. This could allow an unauthenticated remote attacker to cause a permanent denial of service condition (requiring a device reboot) by sending specially crafted TCP packets. simatic hmi comfort panels firmware, simatic hmi ktp400 basic firmware, simatic hmi ktp700 basic Multiple Siemens products, including firmware, contain vulnerabilities related to input validation.Service operation interruption (DoS) It may be in a state. Siemens SIMATIC HMI Comfort Panels is a touch panel device from Siemens, Germany.
Several Siemens products have an input validation error vulnerability
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-202210-0467", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp900 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp400 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp700 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp1200 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp700 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp400 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp700 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi comfort panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp700 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp1200 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp mobile panels", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp1200 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp400 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp900 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp1200 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp400 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "siplus hmi ktp900 basic", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp900 basic", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0" }, { "model": "simatic hmi ktp1200 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi ktp900 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "siplus hmi ktp400 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "siplus hmi ktp700 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi ktp mobile panels", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "siplus hmi ktp1200 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "siplus hmi ktp900 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi ktp700 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi ktp400 basic", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi comfort panels update", "scope": "eq", "trust": 0.6, "vendor": "siemens", "version": "v174" }, { "model": "simatic hmi ktp mobile panels update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v174" }, { "model": "simatic hmi ktp1200 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "simatic hmi ktp400 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "simatic hmi ktp700 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "simatic hmi ktp900 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "siplus hmi ktp1200 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "siplus hmi ktp400 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "siplus hmi ktp700 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" }, { "model": "siplus hmi ktp900 basic update", "scope": "lt", "trust": 0.6, "vendor": "siemens", "version": "v175" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" }, { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "NVD", "id": "CVE-2022-40227" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Siemens reported this vulnerability to CISA.", "sources": [ { "db": "CNNVD", "id": "CNNVD-202210-446" } ], "trust": 0.6 }, "cve": "CVE-2022-40227", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "COMPLETE", "baseScore": 7.8, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CNVD-2022-91619", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "HIGH", "trust": 0.6, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "HIGH", "baseScore": 7.5, "baseSeverity": "HIGH", "confidentialityImpact": "NONE", "exploitabilityScore": 3.9, "id": "CVE-2022-40227", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.1" }, { "attackComplexity": "Low", "attackVector": "Network", "author": "NVD", "availabilityImpact": "High", "baseScore": 7.5, "baseSeverity": "High", "confidentialityImpact": "None", "exploitabilityScore": null, "id": "CVE-2022-40227", "impactScore": null, "integrityImpact": "None", "privilegesRequired": "None", "scope": "Unchanged", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2022-40227", "trust": 1.0, "value": "HIGH" }, { "author": "NVD", "id": "CVE-2022-40227", "trust": 0.8, "value": "High" }, { "author": "CNVD", "id": "CNVD-2022-91619", "trust": 0.6, "value": "HIGH" }, { "author": "CNNVD", "id": "CNNVD-202210-446", "trust": 0.6, "value": "HIGH" } ] } ], "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" }, { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "CNNVD", "id": "CNNVD-202210-446" }, { "db": "NVD", "id": "CVE-2022-40227" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels (incl. SIPLUS variants) (All versions \u003c V17 Update 4), SIMATIC HMI KTP Mobile Panels (All versions \u003c V17 Update 4), SIMATIC HMI KTP1200 Basic (All versions \u003c V17 Update 5), SIMATIC HMI KTP400 Basic (All versions \u003c V17 Update 5), SIMATIC HMI KTP700 Basic (All versions \u003c V17 Update 5), SIMATIC HMI KTP900 Basic (All versions \u003c V17 Update 5), SIPLUS HMI KTP1200 BASIC (All versions \u003c V17 Update 5), SIPLUS HMI KTP400 BASIC (All versions \u003c V17 Update 5), SIPLUS HMI KTP700 BASIC (All versions \u003c V17 Update 5), SIPLUS HMI KTP900 BASIC (All versions \u003c V17 Update 5). Affected devices do not properly validate input sent to certain services over TCP. This could allow an unauthenticated remote attacker to cause a permanent denial of service condition (requiring a device reboot) by sending specially crafted TCP packets. simatic hmi comfort panels firmware, simatic hmi ktp400 basic firmware, simatic hmi ktp700 basic Multiple Siemens products, including firmware, contain vulnerabilities related to input validation.Service operation interruption (DoS) It may be in a state. Siemens SIMATIC HMI Comfort Panels is a touch panel device from Siemens, Germany. \n\r\n\r\nSeveral Siemens products have an input validation error vulnerability", "sources": [ { "db": "NVD", "id": "CVE-2022-40227" }, { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "CNVD", "id": "CNVD-2022-91619" } ], "trust": 2.16 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2022-40227", "trust": 3.8 }, { "db": "SIEMENS", "id": "SSA-384224", "trust": 3.0 }, { "db": "ICS CERT", "id": "ICSA-22-286-14", "trust": 1.4 }, { "db": "JVN", "id": "JVNVU92214181", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2022-018713", "trust": 0.8 }, { "db": "CNVD", "id": "CNVD-2022-91619", "trust": 0.6 }, { "db": "CNNVD", "id": "CNNVD-202210-446", "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" }, { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "CNNVD", "id": "CNNVD-202210-446" }, { "db": "NVD", "id": "CVE-2022-40227" } ] }, "id": "VAR-202210-0467", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" } ], "trust": 1.2763986227272728 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "Network device" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" } ] }, "last_update_date": "2024-08-14T12:18:52.673000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "Patch for Various Siemens products input validation error vulnerability", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/384516" }, { "title": "Siemens SIMATIC HMI Comfort Panels Enter the fix for the verification error vulnerability", "trust": 0.6, "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=210554" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" }, { "db": "CNNVD", "id": "CNNVD-202210-446" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-20", "trust": 1.0 }, { "problemtype": "Inappropriate input confirmation (CWE-20) [ others ]", "trust": 0.8 } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "NVD", "id": "CVE-2022-40227" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 3.0, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-384224.pdf" }, { "trust": 0.8, "url": "https://jvn.jp/vu/jvnvu92214181/" }, { "trust": 0.8, "url": "https://nvd.nist.gov/vuln/detail/cve-2022-40227" }, { "trust": 0.8, "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-286-14" }, { "trust": 0.6, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-286-14" }, { "trust": 0.6, "url": "https://vigilance.fr/vulnerability/simatic-hmi-denial-of-service-via-tcp-packets-39514" }, { "trust": 0.6, "url": "https://cxsecurity.com/cveshow/cve-2022-40227/" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2022-91619" }, { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "CNNVD", "id": "CNNVD-202210-446" }, { "db": "NVD", "id": "CVE-2022-40227" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "CNVD", "id": "CNVD-2022-91619" }, { "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "db": "CNNVD", "id": "CNNVD-202210-446" }, { "db": "NVD", "id": "CVE-2022-40227" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2022-12-18T00:00:00", "db": "CNVD", "id": "CNVD-2022-91619" }, { "date": "2023-10-23T00:00:00", "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "date": "2022-10-11T00:00:00", "db": "CNNVD", "id": "CNNVD-202210-446" }, { "date": "2022-10-11T11:15:10.940000", "db": "NVD", "id": "CVE-2022-40227" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2022-12-29T00:00:00", "db": "CNVD", "id": "CNVD-2022-91619" }, { "date": "2023-10-23T02:35:00", "db": "JVNDB", "id": "JVNDB-2022-018713" }, { "date": "2022-10-17T00:00:00", "db": "CNNVD", "id": "CNNVD-202210-446" }, { "date": "2022-10-14T17:07:23.703000", "db": "NVD", "id": "CVE-2022-40227" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-202210-446" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Input validation vulnerability in multiple Siemens products", "sources": [ { "db": "JVNDB", "id": "JVNDB-2022-018713" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "input validation error", "sources": [ { "db": "CNNVD", "id": "CNNVD-202210-446" } ], "trust": 0.6 } }
var-202105-0068
Vulnerability from variot
A vulnerability has been identified in SIMATIC HMI Comfort Panels 1st Generation (incl. SIPLUS variants) (All versions < V16 Update 4), SIMATIC HMI KTP Mobile Panels (All versions < V16 Update 4). Specially crafted packets sent to port 161/udp can cause the SNMP service of affected devices to crash. A manual restart of the device is required to resume operation of the service. Pillow is a Python-based image processing library. There is currently no information about this vulnerability, please feel free to follow CNNVD or manufacturer announcements
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-202105-0068", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "simatic hmi comfort panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "16" }, { "model": "simatic hmi ktp mobile panels", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "16" }, { "model": "simatic hmi ktp mobile panels", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null }, { "model": "simatic hmi comfort panels", "scope": null, "trust": 0.8, "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9", "version": null } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "NVD", "id": "CVE-2019-19276" } ] }, "cve": "CVE-2019-19276", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "NETWORK", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "PARTIAL", "baseScore": 5.0, "confidentialityImpact": "NONE", "exploitabilityScore": 10.0, "id": "CVE-2019-19276", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.8, "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "NETWORK", "author": "nvd@nist.gov", "availabilityImpact": "LOW", "baseScore": 5.3, "baseSeverity": "MEDIUM", "confidentialityImpact": "NONE", "exploitabilityScore": 3.9, "id": "CVE-2019-19276", "impactScore": 1.4, "integrityImpact": "NONE", "privilegesRequired": "NONE", "scope": "UNCHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:L", "version": "3.1" }, { "attackComplexity": "Low", "attackVector": "Network", "author": "NVD", "availabilityImpact": "Low", "baseScore": 5.3, "baseSeverity": "Medium", "confidentialityImpact": "None", "exploitabilityScore": null, "id": "CVE-2019-19276", "impactScore": null, "integrityImpact": "None", "privilegesRequired": "None", "scope": "Unchanged", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:L", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2019-19276", "trust": 1.0, "value": "MEDIUM" }, { "author": "NVD", "id": "CVE-2019-19276", "trust": 0.8, "value": "Medium" }, { "author": "CNNVD", "id": "CNNVD-202104-975", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-202105-541", "trust": 0.6, "value": "MEDIUM" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "CNNVD", "id": "CNNVD-202104-975" }, { "db": "CNNVD", "id": "CNNVD-202105-541" }, { "db": "NVD", "id": "CVE-2019-19276" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "A vulnerability has been identified in SIMATIC HMI Comfort Panels 1st Generation (incl. SIPLUS variants) (All versions \u003c V16 Update 4), SIMATIC HMI KTP Mobile Panels (All versions \u003c V16 Update 4). Specially crafted packets sent to port 161/udp can cause the SNMP service of affected devices to crash. A manual restart of the device is required to resume operation of the service. Pillow is a Python-based image processing library. \nThere is currently no information about this vulnerability, please feel free to follow CNNVD or manufacturer announcements", "sources": [ { "db": "NVD", "id": "CVE-2019-19276" }, { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "CNNVD", "id": "CNNVD-202104-975" }, { "db": "VULMON", "id": "CVE-2019-19276" } ], "trust": 2.25 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2019-19276", "trust": 3.3 }, { "db": "SIEMENS", "id": "SSA-594364", "trust": 1.7 }, { "db": "JVN", "id": "JVNVU91051134", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2021-007395", "trust": 0.8 }, { "db": "CS-HELP", "id": "SB2021041363", "trust": 0.6 }, { "db": "CNNVD", "id": "CNNVD-202104-975", "trust": 0.6 }, { "db": "CS-HELP", "id": "SB2021051309", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2021.1602", "trust": 0.6 }, { "db": "ICS CERT", "id": "ICSA-21-131-06", "trust": 0.6 }, { "db": "CNNVD", "id": "CNNVD-202105-541", "trust": 0.6 }, { "db": "VULMON", "id": "CVE-2019-19276", "trust": 0.1 } ], "sources": [ { "db": "VULMON", "id": "CVE-2019-19276" }, { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "CNNVD", "id": "CNNVD-202104-975" }, { "db": "CNNVD", "id": "CNNVD-202105-541" }, { "db": "NVD", "id": "CVE-2019-19276" } ] }, "id": "VAR-202105-0068", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VARIoT devices database", "id": null } ], "trust": 0.57371795 }, "last_update_date": "2024-08-14T12:56:54.515000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "SSA-594364", "trust": 0.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf" }, { "title": "Multiple Siemens Fix for device buffer error vulnerability", "trust": 0.6, "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=149969" }, { "title": "Siemens Security Advisories: Siemens Security Advisory", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=3a6418c2c9d9d914ae85f34d330d364e" } ], "sources": [ { "db": "VULMON", "id": "CVE-2019-19276" }, { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "CNNVD", "id": "CNNVD-202105-541" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-787", "trust": 1.0 }, { "problemtype": "Out-of-bounds writing (CWE-787) [ Other ]", "trust": 0.8 } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "NVD", "id": "CVE-2019-19276" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-594364.pdf" }, { "trust": 1.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-19276" }, { "trust": 0.8, "url": "https://jvn.jp/vu/jvnvu91051134/" }, { "trust": 0.6, "url": "https://www.cybersecurity-help.cz/vdb/sb2021041363" }, { "trust": 0.6, "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-131-06" }, { "trust": 0.6, "url": "https://vigilance.fr/vulnerability/siemens-simatic-wincc-denial-of-service-via-snmp-35359" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2021.1602" }, { "trust": 0.6, "url": "https://www.cybersecurity-help.cz/vdb/sb2021051309" }, { "trust": 0.1, "url": "https://cwe.mitre.org/data/definitions/787.html" }, { "trust": 0.1, "url": "https://nvd.nist.gov" }, { "trust": 0.1, "url": "https://cert-portal.siemens.com/productcert/txt/ssa-594364.txt" } ], "sources": [ { "db": "VULMON", "id": "CVE-2019-19276" }, { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "CNNVD", "id": "CNNVD-202104-975" }, { "db": "CNNVD", "id": "CNNVD-202105-541" }, { "db": "NVD", "id": "CVE-2019-19276" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULMON", "id": "CVE-2019-19276" }, { "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "db": "CNNVD", "id": "CNNVD-202104-975" }, { "db": "CNNVD", "id": "CNNVD-202105-541" }, { "db": "NVD", "id": "CVE-2019-19276" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2021-05-12T00:00:00", "db": "VULMON", "id": "CVE-2019-19276" }, { "date": "2022-02-09T00:00:00", "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "date": "2021-04-13T00:00:00", "db": "CNNVD", "id": "CNNVD-202104-975" }, { "date": "2021-05-11T00:00:00", "db": "CNNVD", "id": "CNNVD-202105-541" }, { "date": "2021-05-12T14:15:10.543000", "db": "NVD", "id": "CVE-2019-19276" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2021-05-12T00:00:00", "db": "VULMON", "id": "CVE-2019-19276" }, { "date": "2022-02-09T09:11:00", "db": "JVNDB", "id": "JVNDB-2021-007395" }, { "date": "2021-04-14T00:00:00", "db": "CNNVD", "id": "CNNVD-202104-975" }, { "date": "2021-06-03T00:00:00", "db": "CNNVD", "id": "CNNVD-202105-541" }, { "date": "2021-06-02T18:18:33.440000", "db": "NVD", "id": "CVE-2019-19276" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "remote", "sources": [ { "db": "CNNVD", "id": "CNNVD-202105-541" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "SIMATIC\u00a0HMI\u00a0Comfort\u00a0Panels\u00a01st\u00a0Generation\u00a0 and \u00a0SIMATIC\u00a0HMI\u00a0KTP\u00a0Mobile\u00a0Panels\u00a0 Out-of-bounds Vulnerability in Microsoft", "sources": [ { "db": "JVNDB", "id": "JVNDB-2021-007395" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "other", "sources": [ { "db": "CNNVD", "id": "CNNVD-202104-975" } ], "trust": 0.6 } }