All the vulnerabilites related to Siemens - SCALANCE S615
cve-2022-46142
Vulnerability from cvelistv5
Published
2022-12-13 00:00
Modified
2025-04-21 13:43
Summary
Affected devices store the CLI user passwords encrypted in flash memory. Attackers with physical access to the device could retrieve the file and decrypt the CLI user passwords.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615 EEC LAN-Router
SiemensSCALANCE S615 LAN-Router
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM766-1
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM766-1
SiemensSCALANCE WUM766-1 (USA)
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T14:24:03.321Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-46142",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "no"
                  },
                  {
                    "Technical Impact": "partial"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:14:43.501518Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:43:06.184Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 EEC LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices store the CLI user passwords encrypted in flash memory. Attackers with physical access to the device could retrieve the file and decrypt the CLI user passwords."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 5.7,
            "baseSeverity": "MEDIUM",
            "vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:L/A:L",
            "version": "3.1"
          }
        },
        {
          "cvssV4_0": {
            "baseScore": 5.2,
            "baseSeverity": "MEDIUM",
            "vectorString": "CVSS:4.0/AV:P/AC:L/AT:N/PR:N/UI:N/VC:H/VI:L/VA:L/SC:N/SI:N/SA:N",
            "version": "4.0"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-257",
              "description": "CWE-257: Storing Passwords in a Recoverable Format",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2025-01-14T10:27:07.533Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/html/ssa-413565.html"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-46142",
    "datePublished": "2022-12-13T00:00:00.000Z",
    "dateReserved": "2022-11-28T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:43:06.184Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-36325
Vulnerability from cvelistv5
Published
2022-08-10 11:18
Modified
2025-04-21 13:50
Summary
Affected devices do not properly sanitize data introduced by an user when rendering the web interface. This could allow an authenticated remote attacker with administrative privileges to inject code and lead to a DOM-based XSS.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router (Annex A)
SiemensSCALANCE M812-1 ADSL-Router (Annex B)
SiemensSCALANCE M816-1 ADSL-Router (Annex A)
SiemensSCALANCE M816-1 ADSL-Router (Annex B)
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3 (EVDO)
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM766-1 (EU)
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC (EU)
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM766-1 (EU)
SiemensSCALANCE WUM766-1 (US)
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T10:00:04.293Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-36325",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "no"
                  },
                  {
                    "Technical Impact": "total"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:22:55.607913Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:50:56.289Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (EVDO)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices do not properly sanitize data introduced by an user when rendering the web interface. This could allow an authenticated remote attacker with administrative privileges to inject code and lead to a DOM-based XSS."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 6.8,
            "baseSeverity": "MEDIUM",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:U/C:H/I:H/A:H/E:P/RL:O/RC:C",
            "version": "3.1"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-80",
              "description": "CWE-80: Improper Neutralization of Script-Related HTML Tags in a Web Page (Basic XSS)",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2023-10-10T10:21:04.880Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-36325",
    "datePublished": "2022-08-10T11:18:45.000Z",
    "dateReserved": "2022-07-20T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:50:56.289Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2021-25667
Vulnerability from cvelistv5
Published
2021-03-15 17:03
Modified
2024-08-03 20:11
Severity ?
Summary
A vulnerability has been identified in RUGGEDCOM RM1224 (All versions >= V4.3 and < V6.4), SCALANCE M-800 (All versions >= V4.3 and < V6.4), SCALANCE S615 (All versions >= V4.3 and < V6.4), SCALANCE SC-600 Family (All versions >= V2.0 and < V2.1.3), SCALANCE XB-200 (All versions < V4.1), SCALANCE XC-200 (All versions < V4.1), SCALANCE XF-200BA (All versions < V4.1), SCALANCE XM400 (All versions < V6.2), SCALANCE XP-200 (All versions < V4.1), SCALANCE XR-300WG (All versions < V4.1), SCALANCE XR500 (All versions < V6.2). Affected devices contain a stack-based buffer overflow vulnerability in the handling of STP BPDU frames that could allow a remote attacker to trigger a denial-of-service condition or potentially remote code execution. Successful exploitation requires the passive listening feature of the device to be active.
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T20:11:27.468Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_refsource_MISC",
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-979775.pdf"
          },
          {
            "tags": [
              "x_refsource_MISC",
              "x_transferred"
            ],
            "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-03"
          }
        ],
        "title": "CVE Program Container"
      }
    ],
    "cna": {
      "affected": [
        {
          "product": "RUGGEDCOM RM1224",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003e= V4.3 and \u003c V6.4"
            }
          ]
        },
        {
          "product": "SCALANCE M-800",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003e= V4.3 and \u003c V6.4"
            }
          ]
        },
        {
          "product": "SCALANCE S615",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003e= V4.3 and \u003c V6.4"
            }
          ]
        },
        {
          "product": "SCALANCE SC-600 Family",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003e= V2.0 and \u003c V2.1.3"
            }
          ]
        },
        {
          "product": "SCALANCE XB-200",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.1"
            }
          ]
        },
        {
          "product": "SCALANCE XC-200",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.1"
            }
          ]
        },
        {
          "product": "SCALANCE XF-200BA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.1"
            }
          ]
        },
        {
          "product": "SCALANCE XM400",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.2"
            }
          ]
        },
        {
          "product": "SCALANCE XP-200",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.1"
            }
          ]
        },
        {
          "product": "SCALANCE XR-300WG",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.1"
            }
          ]
        },
        {
          "product": "SCALANCE XR500",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.2"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "A vulnerability has been identified in RUGGEDCOM RM1224 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE M-800 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE S615 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE SC-600 Family (All versions \u003e= V2.0 and \u003c V2.1.3), SCALANCE XB-200 (All versions \u003c V4.1), SCALANCE XC-200 (All versions \u003c V4.1), SCALANCE XF-200BA (All versions \u003c V4.1), SCALANCE XM400 (All versions \u003c V6.2), SCALANCE XP-200 (All versions \u003c V4.1), SCALANCE XR-300WG (All versions \u003c V4.1), SCALANCE XR500 (All versions \u003c V6.2). Affected devices contain a stack-based buffer overflow vulnerability in the handling of STP BPDU frames that could allow a remote attacker to trigger a denial-of-service condition or potentially remote code execution. Successful exploitation requires the passive listening feature of the device to be active."
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-121",
              "description": "CWE-121: Stack-based Buffer Overflow",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2021-04-22T20:42:20",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "tags": [
            "x_refsource_MISC"
          ],
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-979775.pdf"
        },
        {
          "tags": [
            "x_refsource_MISC"
          ],
          "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-03"
        }
      ],
      "x_legacyV4Record": {
        "CVE_data_meta": {
          "ASSIGNER": "productcert@siemens.com",
          "ID": "CVE-2021-25667",
          "STATE": "PUBLIC"
        },
        "affects": {
          "vendor": {
            "vendor_data": [
              {
                "product": {
                  "product_data": [
                    {
                      "product_name": "RUGGEDCOM RM1224",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003e= V4.3 and \u003c V6.4"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE M-800",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003e= V4.3 and \u003c V6.4"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE S615",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003e= V4.3 and \u003c V6.4"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE SC-600 Family",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003e= V2.0 and \u003c V2.1.3"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XB-200",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V4.1"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XC-200",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V4.1"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XF-200BA",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V4.1"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XM400",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V6.2"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XP-200",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V4.1"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XR-300WG",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V4.1"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE XR500",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All versions \u003c V6.2"
                          }
                        ]
                      }
                    }
                  ]
                },
                "vendor_name": "Siemens"
              }
            ]
          }
        },
        "data_format": "MITRE",
        "data_type": "CVE",
        "data_version": "4.0",
        "description": {
          "description_data": [
            {
              "lang": "eng",
              "value": "A vulnerability has been identified in RUGGEDCOM RM1224 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE M-800 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE S615 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE SC-600 Family (All versions \u003e= V2.0 and \u003c V2.1.3), SCALANCE XB-200 (All versions \u003c V4.1), SCALANCE XC-200 (All versions \u003c V4.1), SCALANCE XF-200BA (All versions \u003c V4.1), SCALANCE XM400 (All versions \u003c V6.2), SCALANCE XP-200 (All versions \u003c V4.1), SCALANCE XR-300WG (All versions \u003c V4.1), SCALANCE XR500 (All versions \u003c V6.2). Affected devices contain a stack-based buffer overflow vulnerability in the handling of STP BPDU frames that could allow a remote attacker to trigger a denial-of-service condition or potentially remote code execution. Successful exploitation requires the passive listening feature of the device to be active."
            }
          ]
        },
        "problemtype": {
          "problemtype_data": [
            {
              "description": [
                {
                  "lang": "eng",
                  "value": "CWE-121: Stack-based Buffer Overflow"
                }
              ]
            }
          ]
        },
        "references": {
          "reference_data": [
            {
              "name": "https://cert-portal.siemens.com/productcert/pdf/ssa-979775.pdf",
              "refsource": "MISC",
              "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-979775.pdf"
            },
            {
              "name": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-03",
              "refsource": "MISC",
              "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-03"
            }
          ]
        }
      }
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2021-25667",
    "datePublished": "2021-03-15T17:03:31",
    "dateReserved": "2021-01-21T00:00:00",
    "dateUpdated": "2024-08-03T20:11:27.468Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-34821
Vulnerability from cvelistv5
Published
2022-07-12 00:00
Modified
2025-04-21 13:52
Summary
A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2), SCALANCE M804PB (6GK5804-0AP00-2AA2), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2), SCALANCE M874-2 (6GK5874-2AA00-2AA2), SCALANCE M874-3 (6GK5874-3AA00-2AA2), SCALANCE M876-3 (6GK5876-3AA02-2BA2), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2), SCALANCE M876-4 (6GK5876-4AA10-2BA2), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2), SCALANCE SC622-2C (6GK5622-2GS00-2AC2), SCALANCE SC622-2C (6GK5622-2GS00-2AC2), SCALANCE SC626-2C (6GK5626-2GS00-2AC2), SCALANCE SC626-2C (6GK5626-2GS00-2AC2), SCALANCE SC632-2C (6GK5632-2GS00-2AC2), SCALANCE SC632-2C (6GK5632-2GS00-2AC2), SCALANCE SC636-2C (6GK5636-2GS00-2AC2), SCALANCE SC636-2C (6GK5636-2GS00-2AC2), SCALANCE SC642-2C (6GK5642-2GS00-2AC2), SCALANCE SC642-2C (6GK5642-2GS00-2AC2), SCALANCE SC646-2C (6GK5646-2GS00-2AC2), SCALANCE SC646-2C (6GK5646-2GS00-2AC2), SCALANCE WAB762-1 (6GK5762-1AJ00-6AA0), SCALANCE WAM763-1 (6GK5763-1AL00-7DA0), SCALANCE WAM763-1 (ME) (6GK5763-1AL00-7DC0), SCALANCE WAM763-1 (US) (6GK5763-1AL00-7DB0), SCALANCE WAM766-1 (6GK5766-1GE00-7DA0), SCALANCE WAM766-1 (ME) (6GK5766-1GE00-7DC0), SCALANCE WAM766-1 (US) (6GK5766-1GE00-7DB0), SCALANCE WAM766-1 EEC (6GK5766-1GE00-7TA0), SCALANCE WAM766-1 EEC (ME) (6GK5766-1GE00-7TC0), SCALANCE WAM766-1 EEC (US) (6GK5766-1GE00-7TB0), SCALANCE WUB762-1 (6GK5762-1AJ00-1AA0), SCALANCE WUB762-1 iFeatures (6GK5762-1AJ00-2AA0), SCALANCE WUM763-1 (6GK5763-1AL00-3AA0), SCALANCE WUM763-1 (6GK5763-1AL00-3DA0), SCALANCE WUM763-1 (US) (6GK5763-1AL00-3AB0), SCALANCE WUM763-1 (US) (6GK5763-1AL00-3DB0), SCALANCE WUM766-1 (6GK5766-1GE00-3DA0), SCALANCE WUM766-1 (ME) (6GK5766-1GE00-3DC0), SCALANCE WUM766-1 (USA) (6GK5766-1GE00-3DB0), SIMATIC CP 1242-7 V2 (6GK7242-7KX31-0XE0), SIMATIC CP 1243-1 (6GK7243-1BX30-0XE0), SIMATIC CP 1243-7 LTE EU (6GK7243-7KX30-0XE0), SIMATIC CP 1243-7 LTE US (6GK7243-7SX30-0XE0), SIMATIC CP 1243-8 IRC (6GK7243-8RX30-0XE0), SIMATIC CP 1542SP-1 IRC (6GK7542-6VX00-0XE0), SIMATIC CP 1543-1 (6GK7543-1AX00-0XE0), SIMATIC CP 1543SP-1 (6GK7543-6WX00-0XE0), SIPLUS ET 200SP CP 1542SP-1 IRC TX RAIL (6AG2542-6VX00-4XE0), SIPLUS ET 200SP CP 1543SP-1 ISEC (6AG1543-6WX00-7XE0), SIPLUS ET 200SP CP 1543SP-1 ISEC TX RAIL (6AG2543-6WX00-4XE0), SIPLUS NET CP 1242-7 V2 (6AG1242-7KX31-7XE0), SIPLUS NET CP 1543-1 (6AG1543-1AX00-2XE0), SIPLUS S7-1200 CP 1243-1 (6AG1243-1BX30-2AX0), SIPLUS S7-1200 CP 1243-1 RAIL (6AG2243-1BX30-1XE0). By injecting code to specific configuration options for OpenVPN, an attacker could execute arbitrary code with elevated privileges.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615 EEC LAN-Router
SiemensSCALANCE S615 LAN-Router
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE WAB762-1
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM763-1 (ME)
SiemensSCALANCE WAM763-1 (US)
SiemensSCALANCE WAM766-1
SiemensSCALANCE WAM766-1 (ME)
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC
SiemensSCALANCE WAM766-1 EEC (ME)
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUB762-1
SiemensSCALANCE WUB762-1 iFeatures
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1 (US)
SiemensSCALANCE WUM763-1 (US)
SiemensSCALANCE WUM766-1
SiemensSCALANCE WUM766-1 (ME)
SiemensSCALANCE WUM766-1 (USA)
SiemensSIMATIC CP 1242-7 V2
SiemensSIMATIC CP 1243-1
SiemensSIMATIC CP 1243-7 LTE EU
SiemensSIMATIC CP 1243-7 LTE US
SiemensSIMATIC CP 1243-8 IRC
SiemensSIMATIC CP 1542SP-1 IRC
SiemensSIMATIC CP 1543-1
SiemensSIMATIC CP 1543SP-1
SiemensSIPLUS ET 200SP CP 1542SP-1 IRC TX RAIL
SiemensSIPLUS ET 200SP CP 1543SP-1 ISEC
SiemensSIPLUS ET 200SP CP 1543SP-1 ISEC TX RAIL
SiemensSIPLUS NET CP 1242-7 V2
SiemensSIPLUS NET CP 1543-1
SiemensSIPLUS S7-1200 CP 1243-1
SiemensSIPLUS S7-1200 CP 1243-1 RAIL
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T09:22:10.733Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-517377.pdf"
          },
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-34821",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "no"
                  },
                  {
                    "Technical Impact": "total"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:23:16.425380Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:52:26.030Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 EEC LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0",
              "status": "affected",
              "version": "V2.3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAB762-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1 (ME)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (ME)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (ME)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUB762-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUB762-1 iFeatures",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (ME)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1242-7 V2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1243-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1243-7 LTE EU",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1243-7 LTE US",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1243-8 IRC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1542SP-1 IRC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.2.28",
              "status": "affected",
              "version": "V2.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1543-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.22"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1543SP-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.2.28",
              "status": "affected",
              "version": "V2.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS ET 200SP CP 1542SP-1 IRC TX RAIL",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.2.28",
              "status": "affected",
              "version": "V2.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS ET 200SP CP 1543SP-1 ISEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.2.28",
              "status": "affected",
              "version": "V2.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS ET 200SP CP 1543SP-1 ISEC TX RAIL",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.2.28",
              "status": "affected",
              "version": "V2.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET CP 1242-7 V2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET CP 1543-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.22"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS S7-1200 CP 1243-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS S7-1200 CP 1243-1 RAIL",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.3.46"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2), SCALANCE M804PB (6GK5804-0AP00-2AA2), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2), SCALANCE M874-2 (6GK5874-2AA00-2AA2), SCALANCE M874-3 (6GK5874-3AA00-2AA2), SCALANCE M876-3 (6GK5876-3AA02-2BA2), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2), SCALANCE M876-4 (6GK5876-4AA10-2BA2), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2), SCALANCE SC622-2C (6GK5622-2GS00-2AC2), SCALANCE SC622-2C (6GK5622-2GS00-2AC2), SCALANCE SC626-2C (6GK5626-2GS00-2AC2), SCALANCE SC626-2C (6GK5626-2GS00-2AC2), SCALANCE SC632-2C (6GK5632-2GS00-2AC2), SCALANCE SC632-2C (6GK5632-2GS00-2AC2), SCALANCE SC636-2C (6GK5636-2GS00-2AC2), SCALANCE SC636-2C (6GK5636-2GS00-2AC2), SCALANCE SC642-2C (6GK5642-2GS00-2AC2), SCALANCE SC642-2C (6GK5642-2GS00-2AC2), SCALANCE SC646-2C (6GK5646-2GS00-2AC2), SCALANCE SC646-2C (6GK5646-2GS00-2AC2), SCALANCE WAB762-1 (6GK5762-1AJ00-6AA0), SCALANCE WAM763-1 (6GK5763-1AL00-7DA0), SCALANCE WAM763-1 (ME) (6GK5763-1AL00-7DC0), SCALANCE WAM763-1 (US) (6GK5763-1AL00-7DB0), SCALANCE WAM766-1 (6GK5766-1GE00-7DA0), SCALANCE WAM766-1 (ME) (6GK5766-1GE00-7DC0), SCALANCE WAM766-1 (US) (6GK5766-1GE00-7DB0), SCALANCE WAM766-1 EEC (6GK5766-1GE00-7TA0), SCALANCE WAM766-1 EEC (ME) (6GK5766-1GE00-7TC0), SCALANCE WAM766-1 EEC (US) (6GK5766-1GE00-7TB0), SCALANCE WUB762-1 (6GK5762-1AJ00-1AA0), SCALANCE WUB762-1 iFeatures (6GK5762-1AJ00-2AA0), SCALANCE WUM763-1 (6GK5763-1AL00-3AA0), SCALANCE WUM763-1 (6GK5763-1AL00-3DA0), SCALANCE WUM763-1 (US) (6GK5763-1AL00-3AB0), SCALANCE WUM763-1 (US) (6GK5763-1AL00-3DB0), SCALANCE WUM766-1 (6GK5766-1GE00-3DA0), SCALANCE WUM766-1 (ME) (6GK5766-1GE00-3DC0), SCALANCE WUM766-1 (USA) (6GK5766-1GE00-3DB0), SIMATIC CP 1242-7 V2 (6GK7242-7KX31-0XE0), SIMATIC CP 1243-1 (6GK7243-1BX30-0XE0), SIMATIC CP 1243-7 LTE EU (6GK7243-7KX30-0XE0), SIMATIC CP 1243-7 LTE US (6GK7243-7SX30-0XE0), SIMATIC CP 1243-8 IRC (6GK7243-8RX30-0XE0), SIMATIC CP 1542SP-1 IRC (6GK7542-6VX00-0XE0), SIMATIC CP 1543-1 (6GK7543-1AX00-0XE0), SIMATIC CP 1543SP-1 (6GK7543-6WX00-0XE0), SIPLUS ET 200SP CP 1542SP-1 IRC TX RAIL (6AG2542-6VX00-4XE0), SIPLUS ET 200SP CP 1543SP-1 ISEC (6AG1543-6WX00-7XE0), SIPLUS ET 200SP CP 1543SP-1 ISEC TX RAIL (6AG2543-6WX00-4XE0), SIPLUS NET CP 1242-7 V2 (6AG1242-7KX31-7XE0), SIPLUS NET CP 1543-1 (6AG1543-1AX00-2XE0), SIPLUS S7-1200 CP 1243-1 (6AG1243-1BX30-2AX0), SIPLUS S7-1200 CP 1243-1 RAIL (6AG2243-1BX30-1XE0). By injecting code to specific configuration options for OpenVPN, an attacker could execute arbitrary code with elevated privileges."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 7.6,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:3.1/AV:A/AC:H/PR:H/UI:N/S:C/C:H/I:H/A:H",
            "version": "3.1"
          }
        },
        {
          "cvssV4_0": {
            "baseScore": 8.8,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:4.0/AV:A/AC:L/AT:P/PR:H/UI:N/VC:H/VI:H/VA:H/SC:H/SI:H/SA:H",
            "version": "4.0"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-94",
              "description": "CWE-94: Improper Control of Generation of Code (\u0027Code Injection\u0027)",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2025-01-14T10:26:58.220Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-517377.pdf"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/html/ssa-517377.html"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/html/ssa-413565.html"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-34821",
    "datePublished": "2022-07-12T00:00:00.000Z",
    "dateReserved": "2022-06-29T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:52:26.030Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-36323
Vulnerability from cvelistv5
Published
2022-08-10 11:18
Modified
2025-05-20 19:08
Summary
Affected devices do not properly sanitize an input field. This could allow an authenticated remote attacker with administrative privileges to inject code or spawn a system root shell.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router (Annex A)
SiemensSCALANCE M812-1 ADSL-Router (Annex B)
SiemensSCALANCE M816-1 ADSL-Router (Annex A)
SiemensSCALANCE M816-1 ADSL-Router (Annex B)
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3 (EVDO)
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM766-1 (EU)
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC (EU)
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM766-1 (EU)
SiemensSCALANCE WUM766-1 (US)
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T10:00:04.366Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-36323",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "no"
                  },
                  {
                    "Technical Impact": "total"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-05-20T19:08:22.133863Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-05-20T19:08:26.770Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (EVDO)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices do not properly sanitize an input field.  This could allow an authenticated remote attacker with administrative privileges to inject code or spawn a system root shell."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 9.1,
            "baseSeverity": "CRITICAL",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H/E:P/RL:O/RC:C",
            "version": "3.1"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-74",
              "description": "CWE-74: Improper Neutralization of Special Elements in Output Used by a Downstream Component (\u0027Injection\u0027)",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2023-10-10T10:20:59.701Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-36323",
    "datePublished": "2022-08-10T11:18:33.000Z",
    "dateReserved": "2022-07-20T00:00:00.000Z",
    "dateUpdated": "2025-05-20T19:08:26.770Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-36324
Vulnerability from cvelistv5
Published
2022-08-10 11:18
Modified
2025-04-21 13:51
Summary
Affected devices do not properly handle the renegotiation of SSL/TLS parameters. This could allow an unauthenticated remote attacker to bypass the TCP brute force prevention and lead to a denial of service condition for the duration of the attack.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router (Annex A)
SiemensSCALANCE M812-1 ADSL-Router (Annex B)
SiemensSCALANCE M816-1 ADSL-Router (Annex A)
SiemensSCALANCE M816-1 ADSL-Router (Annex B)
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3 (EVDO)
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM766-1 (EU)
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC (EU)
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM766-1 (EU)
SiemensSCALANCE WUM766-1 (US)
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T10:00:04.354Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-36324",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "yes"
                  },
                  {
                    "Technical Impact": "partial"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:12:22.854913Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:51:04.290Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (EVDO)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3.1"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices do not properly handle the renegotiation of SSL/TLS parameters. This could allow an unauthenticated remote attacker to bypass the TCP brute force prevention and lead to a denial of service condition for the duration of the attack."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H/E:P/RL:O/RC:C",
            "version": "3.1"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-770",
              "description": "CWE-770: Allocation of Resources Without Limits or Throttling",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2023-10-10T10:21:02.321Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-36324",
    "datePublished": "2022-08-10T11:18:39.000Z",
    "dateReserved": "2022-07-20T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:51:04.290Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-31766
Vulnerability from cvelistv5
Published
2022-10-11 00:00
Modified
2025-04-21 13:48
Summary
A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2) (All versions < V7.1.2), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2) (All versions < V7.1.2), SCALANCE M804PB (6GK5804-0AP00-2AA2) (All versions < V7.1.2), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) (All versions < V7.1.2), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) (All versions < V7.1.2), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) (All versions < V7.1.2), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) (All versions < V7.1.2), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) (All versions < V7.1.2), SCALANCE M874-2 (6GK5874-2AA00-2AA2) (All versions < V7.1.2), SCALANCE M874-3 (6GK5874-3AA00-2AA2) (All versions < V7.1.2), SCALANCE M876-3 (6GK5876-3AA02-2BA2) (All versions < V7.1.2), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) (All versions < V7.1.2), SCALANCE M876-4 (6GK5876-4AA10-2BA2) (All versions < V7.1.2), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) (All versions < V7.1.2), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) (All versions < V7.1.2), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) (All versions < V7.1.2), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) (All versions < V7.1.2), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) (All versions < V7.1.2), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) (All versions < V7.1.2), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) (All versions < V7.1.2), SCALANCE WAM763-1 (6GK5763-1AL00-7DA0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WAM766-1 (6GK5766-1GE00-7DA0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WAM766-1 (US) (6GK5766-1GE00-7DB0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WAM766-1 EEC (6GK5766-1GE00-7TA0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WAM766-1 EEC (US) (6GK5766-1GE00-7TB0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WUM763-1 (6GK5763-1AL00-3AA0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WUM763-1 (6GK5763-1AL00-3DA0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WUM766-1 (6GK5766-1GE00-3DA0) (All versions >= V1.1.0 < V3.0.0), SCALANCE WUM766-1 (USA) (6GK5766-1GE00-3DB0) (All versions >= V1.1.0 < V3.0.0). Affected devices with TCP Event service enabled do not properly handle malformed packets. This could allow an unauthenticated remote attacker to cause a denial of service condition and reboot the device thus possibly affecting other network resources.
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T07:26:01.135Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-697140.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-31766",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "yes"
                  },
                  {
                    "Technical Impact": "partial"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:12:15.373311Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:48:28.967Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 EEC LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.1.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V3.0.0",
              "status": "affected",
              "version": "V1.1.0",
              "versionType": "custom"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2) (All versions \u003c V7.1.2), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2) (All versions \u003c V7.1.2), SCALANCE M804PB (6GK5804-0AP00-2AA2) (All versions \u003c V7.1.2), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) (All versions \u003c V7.1.2), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) (All versions \u003c V7.1.2), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) (All versions \u003c V7.1.2), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) (All versions \u003c V7.1.2), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) (All versions \u003c V7.1.2), SCALANCE M874-2 (6GK5874-2AA00-2AA2) (All versions \u003c V7.1.2), SCALANCE M874-3 (6GK5874-3AA00-2AA2) (All versions \u003c V7.1.2), SCALANCE M876-3 (6GK5876-3AA02-2BA2) (All versions \u003c V7.1.2), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) (All versions \u003c V7.1.2), SCALANCE M876-4 (6GK5876-4AA10-2BA2) (All versions \u003c V7.1.2), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) (All versions \u003c V7.1.2), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) (All versions \u003c V7.1.2), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) (All versions \u003c V7.1.2), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) (All versions \u003c V7.1.2), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) (All versions \u003c V7.1.2), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) (All versions \u003c V7.1.2), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) (All versions \u003c V7.1.2), SCALANCE WAM763-1 (6GK5763-1AL00-7DA0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WAM766-1 (6GK5766-1GE00-7DA0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WAM766-1 (US) (6GK5766-1GE00-7DB0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WAM766-1 EEC (6GK5766-1GE00-7TA0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WAM766-1 EEC (US) (6GK5766-1GE00-7TB0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WUM763-1 (6GK5763-1AL00-3AA0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WUM763-1 (6GK5763-1AL00-3DA0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WUM766-1 (6GK5766-1GE00-3DA0) (All versions \u003e= V1.1.0 \u003c V3.0.0), SCALANCE WUM766-1 (USA) (6GK5766-1GE00-3DB0) (All versions \u003e= V1.1.0 \u003c V3.0.0). Affected devices with TCP Event service enabled do not properly handle malformed packets.\r\nThis could allow an unauthenticated remote attacker to cause a denial of service condition and reboot the device thus possibly affecting other network resources."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 8.6,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:C/C:N/I:N/A:H/E:P/RL:O/RC:C",
            "version": "3.1"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-20",
              "description": "CWE-20: Improper Input Validation",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2025-02-11T10:26:25.003Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-697140.pdf"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/html/ssa-697140.html"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-31766",
    "datePublished": "2022-10-11T00:00:00.000Z",
    "dateReserved": "2022-05-27T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:48:28.967Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2020-28400
Vulnerability from cvelistv5
Published
2021-07-13 11:02
Modified
2024-12-10 13:53
Summary
Affected devices contain a vulnerability that allows an unauthenticated attacker to trigger a denial of service condition. The vulnerability can be triggered if a large amount of DCP reset packets are sent to the device.
Impacted products
SiemensDevelopment/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller
SiemensDevelopment/Evaluation Kits for PROFINET IO: EK-ERTEC 200
SiemensDevelopment/Evaluation Kits for PROFINET IO: EK-ERTEC 200P
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M874-3 3G-Router (CN)
SiemensSCALANCE M876-3
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (A1)
SiemensSCALANCE MUM853-1 (B1)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (A1)
SiemensSCALANCE MUM856-1 (B1)
SiemensSCALANCE MUM856-1 (CN)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615 EEC LAN-Router
SiemensSCALANCE S615 LAN-Router
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE X200-4P IRT
SiemensSCALANCE X201-3P IRT
SiemensSCALANCE X201-3P IRT PRO
SiemensSCALANCE X202-2IRT
SiemensSCALANCE X202-2P IRT
SiemensSCALANCE X202-2P IRT PRO
SiemensSCALANCE X204-2
SiemensSCALANCE X204-2FM
SiemensSCALANCE X204-2LD
SiemensSCALANCE X204-2LD TS
SiemensSCALANCE X204-2TS
SiemensSCALANCE X204IRT
SiemensSCALANCE X204IRT PRO
SiemensSCALANCE X206-1
SiemensSCALANCE X206-1LD
SiemensSCALANCE X208
SiemensSCALANCE X208PRO
SiemensSCALANCE X212-2
SiemensSCALANCE X212-2LD
SiemensSCALANCE X216
SiemensSCALANCE X224
SiemensSCALANCE X302-7 EEC (230V, coated)
SiemensSCALANCE X302-7 EEC (230V)
SiemensSCALANCE X302-7 EEC (24V, coated)
SiemensSCALANCE X302-7 EEC (24V)
SiemensSCALANCE X302-7 EEC (2x 230V, coated)
SiemensSCALANCE X302-7 EEC (2x 230V)
SiemensSCALANCE X302-7 EEC (2x 24V, coated)
SiemensSCALANCE X302-7 EEC (2x 24V)
SiemensSCALANCE X304-2FE
SiemensSCALANCE X306-1LD FE
SiemensSCALANCE X307-2 EEC (230V, coated)
SiemensSCALANCE X307-2 EEC (230V)
SiemensSCALANCE X307-2 EEC (24V, coated)
SiemensSCALANCE X307-2 EEC (24V)
SiemensSCALANCE X307-2 EEC (2x 230V, coated)
SiemensSCALANCE X307-2 EEC (2x 230V)
SiemensSCALANCE X307-2 EEC (2x 24V, coated)
SiemensSCALANCE X307-2 EEC (2x 24V)
SiemensSCALANCE X307-3
SiemensSCALANCE X307-3
SiemensSCALANCE X307-3LD
SiemensSCALANCE X307-3LD
SiemensSCALANCE X308-2
SiemensSCALANCE X308-2
SiemensSCALANCE X308-2LD
SiemensSCALANCE X308-2LD
SiemensSCALANCE X308-2LH
SiemensSCALANCE X308-2LH
SiemensSCALANCE X308-2LH+
SiemensSCALANCE X308-2LH+
SiemensSCALANCE X308-2M
SiemensSCALANCE X308-2M
SiemensSCALANCE X308-2M PoE
SiemensSCALANCE X308-2M PoE
SiemensSCALANCE X308-2M TS
SiemensSCALANCE X308-2M TS
SiemensSCALANCE X310
SiemensSCALANCE X310
SiemensSCALANCE X310FE
SiemensSCALANCE X310FE
SiemensSCALANCE X320-1 FE
SiemensSCALANCE X320-1-2LD FE
SiemensSCALANCE X408-2
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF201-3P IRT
SiemensSCALANCE XF202-2P IRT
SiemensSCALANCE XF204
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XF204-2BA IRT
SiemensSCALANCE XF204IRT
SiemensSCALANCE XF206-1
SiemensSCALANCE XF208
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324-12M (230V, ports on front)
SiemensSCALANCE XR324-12M (230V, ports on front)
SiemensSCALANCE XR324-12M (230V, ports on rear)
SiemensSCALANCE XR324-12M (230V, ports on rear)
SiemensSCALANCE XR324-12M (24V, ports on front)
SiemensSCALANCE XR324-12M (24V, ports on front)
SiemensSCALANCE XR324-12M (24V, ports on rear)
SiemensSCALANCE XR324-12M (24V, ports on rear)
SiemensSCALANCE XR324-12M TS (24V)
SiemensSCALANCE XR324-12M TS (24V)
SiemensSCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front)
SiemensSCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front)
SiemensSCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear)
SiemensSCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear)
SiemensSCALANCE XR324-4M EEC (24V, ports on front)
SiemensSCALANCE XR324-4M EEC (24V, ports on front)
SiemensSCALANCE XR324-4M EEC (24V, ports on rear)
SiemensSCALANCE XR324-4M EEC (24V, ports on rear)
SiemensSCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front)
SiemensSCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front)
SiemensSCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear)
SiemensSCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear)
SiemensSCALANCE XR324-4M EEC (2x 24V, ports on front)
SiemensSCALANCE XR324-4M EEC (2x 24V, ports on front)
SiemensSCALANCE XR324-4M EEC (2x 24V, ports on rear)
SiemensSCALANCE XR324-4M EEC (2x 24V, ports on rear)
SiemensSCALANCE XR324-4M PoE (230V, ports on front)
SiemensSCALANCE XR324-4M PoE (230V, ports on rear)
SiemensSCALANCE XR324-4M PoE (24V, ports on front)
SiemensSCALANCE XR324-4M PoE (24V, ports on rear)
SiemensSCALANCE XR324-4M PoE TS (24V, ports on front)
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIMATIC CFU DIQ
SiemensSIMATIC CFU PA
SiemensSIMATIC CM 1542-1
SiemensSIMATIC CP 1604
SiemensSIMATIC CP 1616
SiemensSIMATIC CP 1626
SiemensSIMATIC IE/PB-LINK
SiemensSIMATIC MV540 H
SiemensSIMATIC MV540 S
SiemensSIMATIC MV550 H
SiemensSIMATIC MV550 S
SiemensSIMATIC MV560 U
SiemensSIMATIC MV560 X
SiemensSIMATIC NET DK-16xx PN IO
SiemensSIMATIC Power Line Booster PLB, Base Module
SiemensSIMATIC PROFINET Driver
SiemensSIMATIC S7-1200 CPU family (incl. SIPLUS variants)
SiemensSIMOCODE pro V Ethernet/IP (incl. SIPLUS variants)
SiemensSIMOCODE pro V PROFINET (incl. SIPLUS variants)
SiemensSIPLUS NET SCALANCE X308-2
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
SiemensSOFTNET-IE PNIO
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "affected": [
          {
            "cpes": [
              "cpe:2.3:a:seimens:scalance_m812-1_adsl-router_annex_b:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m812-1_adsl-router_annex_b",
            "vendor": "seimens",
            "versions": [
              {
                "status": "affected",
                "version": "0"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:development_evaluation_kits_for_profinet_io_dk_standard_ethernet_controller:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "development_evaluation_kits_for_profinet_io_dk_standard_ethernet_controller",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "*",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:development_evaluation_kits_for_profinet_io_ek_ertec_200:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "development_evaluation_kits_for_profinet_io_ek_ertec_200",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "*",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:development_evaluation_kits_for_profinet_io_ek_ertec_200p:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "development_evaluation_kits_for_profinet_io_ek_ertec_200p",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v4.7",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:ruggedcom_rm1224:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "ruggedcom_rm1224",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:h:siemens:scalance_m804pb:-:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m804pb",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:seimens:scalance_m812-1_adsl-router_annex_a:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m812-1_adsl-router_annex_a",
            "vendor": "seimens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:seimens:scalance_m812-1_adsl-router_annex_b:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m812-1_adsl-router_annex_b",
            "vendor": "seimens",
            "versions": [
              {
                "lessThan": "6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m816_1_adsl_router_annex_a:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m816_1_adsl_router_annex_a",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m816-1_adsl-router_annex_b:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m816-1_adsl-router_annex_b",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m826-2_shdsl-router:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m826-2_shdsl-router",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_m874_2:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_m874_2",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_m874_3:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_m874_3",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m876_3_evdo:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m876_3_evdo",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m876_3_rok:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m876_3_rok",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m876_4_eu:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m876_4_eu",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_m876_4_nam:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_m876_4_nam",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:h:siemens:scalance_s615:-:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_s615",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v6.4",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_w700_ieee_802.11n_family:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_w700_ieee_802.11n_family",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "*",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_w1748_1_m12:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_w1748_1_m12",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v3.0.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_w1788_1_m12:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_w1788_1_m12",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v3.0.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_w1788_2_eec_m12:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_w1788_2_eec_m12",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v3.0.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_w1788_2_m12:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_w1788_2_m12",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v3.0.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_w1788_2ia_m12:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_w1788_2ia_m12",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v3.0.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_x200_4p_irt:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_x200_4p_irt",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.5.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_x201_3p_irt:0.0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_x201_3p_irt",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.5.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalance_x201_3p_irt_pro:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalance_x201_3p_irt_pro",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.5.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalancce_x202_2p_irt:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalancce_x202_2p_irt",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.5.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_202_2p_irt_pro:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_202_2p_irt_pro",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.5.0",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalancce_x204_2:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalancce_x204_2",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.25",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_x204_2fm:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_x204_2fm",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.25",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_x204_2ld:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_x204_2ld",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.25",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_x204_2ld_ts:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_x204_2ld_ts",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.25",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          },
          {
            "cpes": [
              "cpe:2.3:a:siemens:scalence_x204_2ts:0:*:*:*:*:*:*:*"
            ],
            "defaultStatus": "unknown",
            "product": "scalence_x204_2ts",
            "vendor": "siemens",
            "versions": [
              {
                "lessThan": "v5.25",
                "status": "affected",
                "version": "0",
                "versionType": "custom"
              }
            ]
          }
        ],
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2020-28400",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "yes"
                  },
                  {
                    "Technical Impact": "partial"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2024-06-13T18:59:11.953107Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2024-07-24T18:07:44.485Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      },
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-04T16:33:59.218Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_refsource_MISC",
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-599968.pdf"
          },
          {
            "tags": [
              "x_refsource_MISC",
              "x_transferred"
            ],
            "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-194-03"
          },
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/html/ssa-599968.html"
          }
        ],
        "title": "CVE Program Container"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.7"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3 3G-Router (CN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (A1)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (B1)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (A1)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (B1)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (CN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 EEC LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X200-4P IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X201-3P IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X201-3P IRT PRO",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X202-2IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X202-2P IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X202-2P IRT PRO",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204-2FM",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204-2LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204-2LD TS",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204-2TS",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X204IRT PRO",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X206-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X206-1LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X208PRO",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X212-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X212-2LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X224",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (230V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (24V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (2x 230V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (2x 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (2x 24V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X302-7 EEC (2x 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X304-2FE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X306-1LD FE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (230V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (24V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (2x 230V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (2x 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (2x 24V, coated)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-2 EEC (2x 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-3LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X307-3LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2LD",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2LH",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2LH",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2LH+",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2LH+",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2M PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2M PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2M TS",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X308-2M TS",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X310",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X310",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X310FE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X310FE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X320-1 FE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X320-1-2LD FE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE X408-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF201-3P IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF202-2P IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204IRT",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V5.5.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF206-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V5.2.5",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (230V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (230V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (230V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (230V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M (24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M TS (24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-12M TS (24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M EEC (2x 24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M PoE (230V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M PoE (230V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M PoE (24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M PoE (24V, ports on rear)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324-4M PoE TS (24V, ports on front)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.3.1",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CFU DIQ",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CFU PA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CM 1542-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1604",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003e= V2.7"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1616",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003e= V2.7"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC CP 1626",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC IE/PB-LINK",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "V3",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC MV540 H",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC MV540 S",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC MV550 H",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC MV550 S",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC MV560 U",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC MV560 X",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC NET DK-16xx PN IO",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003e= V2.7"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC Power Line Booster PLB, Base Module",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC PROFINET Driver",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.3"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMATIC S7-1200 CPU family (incl. SIPLUS variants)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003c V4.5"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMOCODE pro V Ethernet/IP (incl. SIPLUS variants)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V1.1.3"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIMOCODE pro V PROFINET (incl. SIPLUS variants)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.1.3"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE X308-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.1.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SOFTNET-IE PNIO",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices contain a vulnerability that allows an unauthenticated attacker to trigger a denial of service condition. The vulnerability can be triggered if a large amount of DCP reset packets are sent to the device."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          }
        },
        {
          "cvssV4_0": {
            "baseScore": 8.7,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:4.0/AV:N/AC:L/AT:N/PR:N/UI:N/VC:N/VI:N/VA:H/SC:N/SI:N/SA:N",
            "version": "4.0"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-770",
              "description": "CWE-770: Allocation of Resources Without Limits or Throttling",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2024-12-10T13:53:22.763Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "tags": [
            "x_refsource_MISC"
          ],
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-599968.pdf"
        },
        {
          "tags": [
            "x_refsource_MISC"
          ],
          "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-194-03"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/html/ssa-599968.html"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2020-28400",
    "datePublished": "2021-07-13T11:02:49",
    "dateReserved": "2020-11-10T00:00:00",
    "dateUpdated": "2024-12-10T13:53:22.763Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-46140
Vulnerability from cvelistv5
Published
2022-12-13 00:00
Modified
2025-04-21 13:43
Summary
Affected devices use a weak encryption scheme to encrypt the debug zip file. This could allow an authenticated attacker to decrypt the contents of the file and retrieve debug information about the system.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M812-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M816-1 ADSL-Router
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615 EEC LAN-Router
SiemensSCALANCE S615 LAN-Router
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC626-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM766-1
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM766-1
SiemensSCALANCE WUM766-1 (USA)
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T14:24:03.297Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-46140",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "no"
                  },
                  {
                    "Technical Impact": "partial"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:14:47.809679Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:43:14.878Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 EEC LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 LAN-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V7.2",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC626-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.3",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "*",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V2.0.0",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V6.6",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "lessThan": "V4.4",
              "status": "affected",
              "version": "0",
              "versionType": "custom"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices use a weak encryption scheme to encrypt the debug zip file. This could allow an authenticated attacker to decrypt the contents of the file and retrieve debug information about the system."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 6.5,
            "baseSeverity": "MEDIUM",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
            "version": "3.1"
          }
        },
        {
          "cvssV4_0": {
            "baseScore": 7.1,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:4.0/AV:N/AC:L/AT:N/PR:L/UI:N/VC:H/VI:N/VA:N/SC:N/SI:N/SA:N",
            "version": "4.0"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-327",
              "description": "CWE-327: Use of a Broken or Risky Cryptographic Algorithm",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2025-01-14T10:27:03.863Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
        },
        {
          "url": "https://cert-portal.siemens.com/productcert/html/ssa-413565.html"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-46140",
    "datePublished": "2022-12-13T00:00:00.000Z",
    "dateReserved": "2022-11-28T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:43:14.878Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2022-31765
Vulnerability from cvelistv5
Published
2022-10-11 00:00
Modified
2025-04-21 13:48
Summary
Affected devices do not properly authorize the change password function of the web interface. This could allow low privileged users to escalate their privileges.
Impacted products
SiemensRUGGEDCOM RM1224 LTE(4G) EU
SiemensRUGGEDCOM RM1224 LTE(4G) NAM
SiemensSCALANCE M804PB
SiemensSCALANCE M812-1 ADSL-Router (Annex A)
SiemensSCALANCE M812-1 ADSL-Router (Annex B)
SiemensSCALANCE M816-1 ADSL-Router (Annex A)
SiemensSCALANCE M816-1 ADSL-Router (Annex B)
SiemensSCALANCE M826-2 SHDSL-Router
SiemensSCALANCE M874-2
SiemensSCALANCE M874-3
SiemensSCALANCE M876-3 (EVDO)
SiemensSCALANCE M876-3 (ROK)
SiemensSCALANCE M876-4
SiemensSCALANCE M876-4 (EU)
SiemensSCALANCE M876-4 (NAM)
SiemensSCALANCE MUM853-1 (EU)
SiemensSCALANCE MUM856-1 (EU)
SiemensSCALANCE MUM856-1 (RoW)
SiemensSCALANCE S615
SiemensSCALANCE S615 EEC
SiemensSCALANCE SC622-2C
SiemensSCALANCE SC632-2C
SiemensSCALANCE SC636-2C
SiemensSCALANCE SC642-2C
SiemensSCALANCE SC646-2C
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1748-1 M12
SiemensSCALANCE W1788-1 M12
SiemensSCALANCE W1788-2 EEC M12
SiemensSCALANCE W1788-2 M12
SiemensSCALANCE W1788-2IA M12
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W721-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W722-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45
SiemensSCALANCE W734-1 RJ45 (USA)
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W738-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 M12
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W748-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W761-1 RJ45
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 M12 EEC
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45
SiemensSCALANCE W774-1 RJ45 (USA)
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12
SiemensSCALANCE W778-1 M12 EEC
SiemensSCALANCE W778-1 M12 EEC (USA)
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-1 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 RJ45
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2 SFP
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W786-2IA RJ45
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 M12
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-1 RJ45
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 M12 EEC
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE W788-2 RJ45
SiemensSCALANCE WAM763-1
SiemensSCALANCE WAM766-1 (EU)
SiemensSCALANCE WAM766-1 (US)
SiemensSCALANCE WAM766-1 EEC (EU)
SiemensSCALANCE WAM766-1 EEC (US)
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM763-1
SiemensSCALANCE WUM766-1 (EU)
SiemensSCALANCE WUM766-1 (US)
SiemensSCALANCE XB205-3 (SC, PN)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, E/IP)
SiemensSCALANCE XB205-3 (ST, PN)
SiemensSCALANCE XB205-3LD (SC, E/IP)
SiemensSCALANCE XB205-3LD (SC, PN)
SiemensSCALANCE XB208 (E/IP)
SiemensSCALANCE XB208 (PN)
SiemensSCALANCE XB213-3 (SC, E/IP)
SiemensSCALANCE XB213-3 (SC, PN)
SiemensSCALANCE XB213-3 (ST, E/IP)
SiemensSCALANCE XB213-3 (ST, PN)
SiemensSCALANCE XB213-3LD (SC, E/IP)
SiemensSCALANCE XB213-3LD (SC, PN)
SiemensSCALANCE XB216 (E/IP)
SiemensSCALANCE XB216 (PN)
SiemensSCALANCE XC206-2 (SC)
SiemensSCALANCE XC206-2 (ST/BFOC)
SiemensSCALANCE XC206-2G PoE
SiemensSCALANCE XC206-2G PoE (54 V DC)
SiemensSCALANCE XC206-2G PoE EEC (54 V DC)
SiemensSCALANCE XC206-2SFP
SiemensSCALANCE XC206-2SFP EEC
SiemensSCALANCE XC206-2SFP G
SiemensSCALANCE XC206-2SFP G (EIP DEF.)
SiemensSCALANCE XC206-2SFP G EEC
SiemensSCALANCE XC208
SiemensSCALANCE XC208EEC
SiemensSCALANCE XC208G
SiemensSCALANCE XC208G (EIP def.)
SiemensSCALANCE XC208G EEC
SiemensSCALANCE XC208G PoE
SiemensSCALANCE XC208G PoE (54 V DC)
SiemensSCALANCE XC216
SiemensSCALANCE XC216-3G PoE
SiemensSCALANCE XC216-3G PoE (54 V DC)
SiemensSCALANCE XC216-4C
SiemensSCALANCE XC216-4C G
SiemensSCALANCE XC216-4C G (EIP Def.)
SiemensSCALANCE XC216-4C G EEC
SiemensSCALANCE XC216EEC
SiemensSCALANCE XC224
SiemensSCALANCE XC224-4C G
SiemensSCALANCE XC224-4C G (EIP Def.)
SiemensSCALANCE XC224-4C G EEC
SiemensSCALANCE XF204
SiemensSCALANCE XF204 DNA
SiemensSCALANCE XF204-2BA
SiemensSCALANCE XF204-2BA DNA
SiemensSCALANCE XM408-4C
SiemensSCALANCE XM408-4C (L3 int.)
SiemensSCALANCE XM408-8C
SiemensSCALANCE XM408-8C (L3 int.)
SiemensSCALANCE XM416-4C
SiemensSCALANCE XM416-4C (L3 int.)
SiemensSCALANCE XP208
SiemensSCALANCE XP208 (Ethernet/IP)
SiemensSCALANCE XP208EEC
SiemensSCALANCE XP208PoE EEC
SiemensSCALANCE XP216
SiemensSCALANCE XP216 (Ethernet/IP)
SiemensSCALANCE XP216EEC
SiemensSCALANCE XP216POE EEC
SiemensSCALANCE XR324WG (24 x FE, AC 230V)
SiemensSCALANCE XR324WG (24 X FE, DC 24V)
SiemensSCALANCE XR326-2C PoE WG
SiemensSCALANCE XR326-2C PoE WG (without UL)
SiemensSCALANCE XR328-4C WG (24XFE, 4XGE, 24V)
SiemensSCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (24xFE,4xGE,AC230V)
SiemensSCALANCE XR328-4C WG (28xGE, AC 230V)
SiemensSCALANCE XR328-4C WG (28xGE, DC 24V)
SiemensSCALANCE XR524-8C, 1x230V
SiemensSCALANCE XR524-8C, 1x230V (L3 int.)
SiemensSCALANCE XR524-8C, 24V
SiemensSCALANCE XR524-8C, 24V (L3 int.)
SiemensSCALANCE XR524-8C, 2x230V
SiemensSCALANCE XR524-8C, 2x230V (L3 int.)
SiemensSCALANCE XR526-8C, 1x230V
SiemensSCALANCE XR526-8C, 1x230V (L3 int.)
SiemensSCALANCE XR526-8C, 24V
SiemensSCALANCE XR526-8C, 24V (L3 int.)
SiemensSCALANCE XR526-8C, 2x230V
SiemensSCALANCE XR526-8C, 2x230V (L3 int.)
SiemensSCALANCE XR528-6M
SiemensSCALANCE XR528-6M (2HR2, L3 int.)
SiemensSCALANCE XR528-6M (2HR2)
SiemensSCALANCE XR528-6M (L3 int.)
SiemensSCALANCE XR552-12M
SiemensSCALANCE XR552-12M (2HR2, L3 int.)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSCALANCE XR552-12M (2HR2)
SiemensSIPLUS NET SCALANCE XC206-2
SiemensSIPLUS NET SCALANCE XC206-2SFP
SiemensSIPLUS NET SCALANCE XC208
SiemensSIPLUS NET SCALANCE XC216-4C
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T07:26:01.033Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-552702.pdf"
          }
        ],
        "title": "CVE Program Container"
      },
      {
        "metrics": [
          {
            "other": {
              "content": {
                "id": "CVE-2022-31765",
                "options": [
                  {
                    "Exploitation": "none"
                  },
                  {
                    "Automatable": "no"
                  },
                  {
                    "Technical Impact": "total"
                  }
                ],
                "role": "CISA Coordinator",
                "timestamp": "2025-04-18T15:22:51.272836Z",
                "version": "2.0.3"
              },
              "type": "ssvc"
            }
          }
        ],
        "providerMetadata": {
          "dateUpdated": "2025-04-21T13:48:35.929Z",
          "orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
          "shortName": "CISA-ADP"
        },
        "title": "CISA ADP Vulnrichment"
      }
    ],
    "cna": {
      "affected": [
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) EU",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "RUGGEDCOM RM1224 LTE(4G) NAM",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M804PB",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M812-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex A)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M816-1 ADSL-Router (Annex B)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M826-2 SHDSL-Router",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M874-3",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (EVDO)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-3 (ROK)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE M876-4 (NAM)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM853-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE MUM856-1 (RoW)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE S615 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V7.1.2"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC622-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC632-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC636-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC642-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE SC646-2C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V3.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 EEC M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W1788-2IA M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W721-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W722-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W734-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W738-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W748-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W761-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W774-1 RJ45 (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W778-1 M12 EEC (USA)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2 SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W786-2IA RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-1 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 M12 EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE W788-2 RJ45",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WAM766-1 EEC (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM763-1",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (EU)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE WUM766-1 (US)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V2.0"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB205-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB208 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3 (ST, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB213-3LD (SC, PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (E/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XB216 (PN)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (SC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2 (ST/BFOC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2G PoE EEC (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G (EIP DEF.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC206-2SFP G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G (EIP def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC208G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-3G PoE (54 V DC)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G (EIP Def.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XC224-4C G EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204 DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XF204-2BA DNA",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM408-8C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XM416-4C (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP208PoE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216 (Ethernet/IP)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XP216POE EEC",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 x FE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR324WG (24 X FE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR326-2C PoE WG (without UL)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24XFE, 4XGE, 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE, 4xGE,DC24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (24xFE,4xGE,AC230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, AC 230V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR328-4C WG (28xGE, DC 24V)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR524-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 1x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 24V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR526-8C, 2x230V (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR528-6M (L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2, L3 int.)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SCALANCE XR552-12M (2HR2)",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V6.6"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC206-2SFP",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC208",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        },
        {
          "defaultStatus": "unknown",
          "product": "SIPLUS NET SCALANCE XC216-4C",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All versions \u003c V4.4"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "Affected devices do not properly authorize the change password function of the web interface.\r\nThis could allow low privileged users to escalate their privileges."
        }
      ],
      "metrics": [
        {
          "cvssV3_1": {
            "baseScore": 8.8,
            "baseSeverity": "HIGH",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H/E:P/RL:O/RC:C",
            "version": "3.1"
          }
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-862",
              "description": "CWE-862: Missing Authorization",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2023-04-11T09:02:25.347Z",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-552702.pdf"
        }
      ]
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2022-31765",
    "datePublished": "2022-10-11T00:00:00.000Z",
    "dateReserved": "2022-05-27T00:00:00.000Z",
    "dateUpdated": "2025-04-21T13:48:35.929Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

cve-2021-25676
Vulnerability from cvelistv5
Published
2021-03-15 17:03
Modified
2024-08-03 20:11
Severity ?
Summary
A vulnerability has been identified in RUGGEDCOM RM1224 (V6.3), SCALANCE M-800 (V6.3), SCALANCE S615 (V6.3), SCALANCE SC-600 (All Versions >= V2.1 and < V2.1.3). Multiple failed SSH authentication attempts could trigger a temporary Denial-of-Service under certain conditions. When triggered, the device will reboot automatically.
Show details on NVD website


{
  "containers": {
    "adp": [
      {
        "providerMetadata": {
          "dateUpdated": "2024-08-03T20:11:27.563Z",
          "orgId": "af854a3a-2127-422b-91ae-364da2661108",
          "shortName": "CVE"
        },
        "references": [
          {
            "tags": [
              "x_refsource_MISC",
              "x_transferred"
            ],
            "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-296266.pdf"
          },
          {
            "tags": [
              "x_refsource_CONFIRM",
              "x_transferred"
            ],
            "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-02"
          }
        ],
        "title": "CVE Program Container"
      }
    ],
    "cna": {
      "affected": [
        {
          "product": "RUGGEDCOM RM1224",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "V6.3"
            }
          ]
        },
        {
          "product": "SCALANCE M-800",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "V6.3"
            }
          ]
        },
        {
          "product": "SCALANCE S615",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "V6.3"
            }
          ]
        },
        {
          "product": "SCALANCE SC-600",
          "vendor": "Siemens",
          "versions": [
            {
              "status": "affected",
              "version": "All Versions \u003e= V2.1 and \u003c V2.1.3"
            }
          ]
        }
      ],
      "descriptions": [
        {
          "lang": "en",
          "value": "A vulnerability has been identified in RUGGEDCOM RM1224 (V6.3), SCALANCE M-800 (V6.3), SCALANCE S615 (V6.3), SCALANCE SC-600 (All Versions \u003e= V2.1 and \u003c V2.1.3). Multiple failed SSH authentication attempts could trigger a temporary Denial-of-Service under certain conditions. When triggered, the device will reboot automatically."
        }
      ],
      "problemTypes": [
        {
          "descriptions": [
            {
              "cweId": "CWE-307",
              "description": "CWE-307: Improper Restriction of Excessive Authentication Attempts",
              "lang": "en",
              "type": "CWE"
            }
          ]
        }
      ],
      "providerMetadata": {
        "dateUpdated": "2021-04-22T20:42:21",
        "orgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
        "shortName": "siemens"
      },
      "references": [
        {
          "tags": [
            "x_refsource_MISC"
          ],
          "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-296266.pdf"
        },
        {
          "tags": [
            "x_refsource_CONFIRM"
          ],
          "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-02"
        }
      ],
      "x_legacyV4Record": {
        "CVE_data_meta": {
          "ASSIGNER": "productcert@siemens.com",
          "ID": "CVE-2021-25676",
          "STATE": "PUBLIC"
        },
        "affects": {
          "vendor": {
            "vendor_data": [
              {
                "product": {
                  "product_data": [
                    {
                      "product_name": "RUGGEDCOM RM1224",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "V6.3"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE M-800",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "V6.3"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE S615",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "V6.3"
                          }
                        ]
                      }
                    },
                    {
                      "product_name": "SCALANCE SC-600",
                      "version": {
                        "version_data": [
                          {
                            "version_value": "All Versions \u003e= V2.1 and \u003c V2.1.3"
                          }
                        ]
                      }
                    }
                  ]
                },
                "vendor_name": "Siemens"
              }
            ]
          }
        },
        "data_format": "MITRE",
        "data_type": "CVE",
        "data_version": "4.0",
        "description": {
          "description_data": [
            {
              "lang": "eng",
              "value": "A vulnerability has been identified in RUGGEDCOM RM1224 (V6.3), SCALANCE M-800 (V6.3), SCALANCE S615 (V6.3), SCALANCE SC-600 (All Versions \u003e= V2.1 and \u003c V2.1.3). Multiple failed SSH authentication attempts could trigger a temporary Denial-of-Service under certain conditions. When triggered, the device will reboot automatically."
            }
          ]
        },
        "problemtype": {
          "problemtype_data": [
            {
              "description": [
                {
                  "lang": "eng",
                  "value": "CWE-307: Improper Restriction of Excessive Authentication Attempts"
                }
              ]
            }
          ]
        },
        "references": {
          "reference_data": [
            {
              "name": "https://cert-portal.siemens.com/productcert/pdf/ssa-296266.pdf",
              "refsource": "MISC",
              "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-296266.pdf"
            },
            {
              "name": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-02",
              "refsource": "CONFIRM",
              "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-02"
            }
          ]
        }
      }
    }
  },
  "cveMetadata": {
    "assignerOrgId": "cec7a2ec-15b4-4faf-bd53-b40f371f3a77",
    "assignerShortName": "siemens",
    "cveId": "CVE-2021-25676",
    "datePublished": "2021-03-15T17:03:31",
    "dateReserved": "2021-01-21T00:00:00",
    "dateUpdated": "2024-08-03T20:11:27.563Z",
    "state": "PUBLISHED"
  },
  "dataType": "CVE_RECORD",
  "dataVersion": "5.1"
}

var-202107-1608
Vulnerability from variot

Affected devices contain a vulnerability that allows an unauthenticated attacker to trigger a denial-of-service condition. The vulnerability can be triggered if a large amount of DCP reset packets are sent to the device. Multiple Siemens products contain vulnerabilities in resource allocation without restrictions or throttling.Service operation interruption (DoS) It may be in a state. Pillow is a Python-based image processing library. There is currently no information about this vulnerability, please feel free to follow CNNVD or manufacturer announcements. Siemens SCALANCE S602是德国西门子(Siemens)公司的一款工业安全设备. Siemens多款产品 存在安全漏洞,该漏洞允许攻击者执行拒绝服务攻击。以下产品和版本受到影响:Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200 (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P (All versions), RUGGEDCOM RM1224 (All Versions < 6.4), SCALANCE M-800 (All Versions < 6.4), SCALANCE S615 (All Versions < 6.4), SCALANCE W1700 IEEE 802.11ac (All versions), SCALANCE W700 IEEE 802.11n (All versions), SCALANCE X200-4 P IRT (All Versions < V5.5.0), SCALANCE X201-3P IRT (All Versions < V5.5.0), SCALANCE X201-3P IRT PRO (All Versions < V5.5.0), SCALANCE X202-2 IRT (All Versions < V5.5.0), SCALANCE X202-2P IRT (incl. SIPLUS NET variant) (All Versions < V5.5.0), SCALANCE X202-2P IRT PRO (All Versions < V5.5.0), SCALANCE X204 IRT (All Versions < V5.5.0), SCALANCE X204 IRT PRO (All Versions < V5.5.0), SCALANCE X204-2 (incl. SIPLUS NET variant) (All versions), SCALANCE X204-2FM (All versions), SCALANCE X204-2LD (incl. SIPLUS NET variant) (All versions), SCALANCE X204-2LD TS (All versions), SCALANCE X204-2TS (All versions), SCALANCE X206-1 (All versions), SCALANCE X206-1LD (incl. SIPLUS NET variant) (All versions), SCALANCE X208 (incl. SIPLUS NET variant) (All versions), SCALANCE X208PRO (All versions), SCALANCE X212-2 (All versions), SCALANCE X212-2LD (All versions), SCALANCE X216 (All versions), SCALANCE X224 (All versions), SCALANCE X302-7EEC (All versions), SCALANCE X304-2FE (All versions), SCALANCE X306-1LDFE (All versions), SCALANCE X307-2EEC (All versions), SCALANCE X307-3 (All versions), SCALANCE X307-3LD (All versions), SCALANCE X308-2 (incl. SIPLUS NET variant) (All versions), SCALANCE X308-2LD (All versions), SCALANCE X308-2LH (All versions), SCALANCE X308-2LH+ (All versions), SCALANCE X308-2M (All versions), SCALANCE X308-2M POE (All versions), SCALANCE X308-2M TS (All versions), SCALANCE X310 (All versions), SCALANCE X310FE (All versions), SCALANCE X320-1FE (All versions), SCALANCE X320-3LDFE (All versions), SCALANCE XB-200 (All versions), SCALANCE XC-200 (All versions), SCALANCE XF-200BA (All versions), SCALANCE XF201-3P IRT (All Versions < V5.5.0), SCALANCE XF202-2P IRT (All Versions < V5.5.0), SCALANCE XF204 (All versions), SCALANCE XF204 IRT (All Versions < V5.5.0), SCALANCE XF204-2 (incl. SIPLUS NET variant) (All versions), SCALANCE XF204-2BA IRT (All Versions < V5.5.0), SCALANCE XF206-1 (All versions), SCALANCE XF208 (All versions), SCALANCE XM400 (All versions < V6.3.1), SCALANCE XP-200 (All versions), SCALANCE XR-300WG (All versions), SCALANCE XR324-12M (All versions), SCALANCE XR324-12M TS (All versions), SCALANCE XR324-4M EEC (All versions), SCALANCE XR324-4M POE (All versions), SCALANCE XR324-4M POE TS (All versions), SCALANCE XR500 (All versions < V6.3.1), SIMATIC CFU PA (All versions), SIMATIC IE/PB-LINK V3 (All versions), SIMATIC MV500 family (All versions < V3.0), SIMATIC NET CM 1542-1 (All versions), SIMATIC NET CP1616/CP1604 (All Versions >= V2.7), SIMATIC NET CP1626 (All versions), SIMATIC NET DK-16xx PN IO (All Versions >= V2.7), SIMATIC PROFINET Driver (All versions), SIMATIC Power Line Booster PLB, Base Module (MLFB: 6ES7972-5AA10-0AB0) (All versions), SIMATIC S7-1200 CPU family (incl. SIPLUS variants) (All Versions < V4.5), SIMOCODE proV Ethernet/IP (All versions < V1.1.3), SIMOCODE proV PROFINET (All versions < V2.1.3), SOFTNET-IE PNIO (All versions)

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202107-1608",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance x206-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x201-3p irt pro",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "softnet-ie pnio",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x310fe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic net cp1604",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "scalance xr324-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x306-1ldfe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x304-2fe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simocode prov profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "simatic net cm 1542-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w1700",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x206-1ld",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x308-2m poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x202-2p irt pro",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance x310",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simocode prov ethernet\\/ip",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.3"
      },
      {
        "model": "scalance x204 irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "dk standard ethernet controller evaluation kit",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x308-2lh\\+",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance x308-2m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x204-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance xf204",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x307-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf206-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x204 irt pro",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "simatic ie\\/pb-link v3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x308-2lh",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x308-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x307-2eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ek-ertec 200 evaulation kit",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x320-1fe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-12m ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic power line booster plb",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic profinet driver",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance x201-3p irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance x208",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "scalance x308-2ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic mv500",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "scalance x212-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance xb-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance x208pro",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x204-2ts",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x308-2m ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204 irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance w700",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic net dk-16xx pn io",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "scalance xf202-2p irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance x307-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic s7-1200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic cfu pa",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr500",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.3.1"
      },
      {
        "model": "scalance x302-7eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ek-ertec 200p evaluation kit",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance xf201-3p irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance xc-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance x200-4 p irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance x204-2ld ts",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x204-2ld",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance xr-300wg",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance xp-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance x320-3ldfe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "scalance x224",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "simatic net cp1626",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf208",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x216",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x212-2ld",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "simatic net cp1616",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "scalance xm400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.3.1"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "scalance x202-2 irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.5.0"
      },
      {
        "model": "scalance x204-2fm",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.5"
      },
      {
        "model": "scalance x200-4p irt",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "dk standard ethernet controller evaluation kit",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w1700",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ek-ertec 200p evaluation kit",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance x201-3p irt",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ek-ertec 200 evaluation kit",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens reported this vulnerability to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2020-28400",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 5.0,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2020-28400",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.8,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2020-28400",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 7.5,
            "baseSeverity": "High",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "CVE-2020-28400",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2020-28400",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2020-28400",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2020-28400",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202104-975",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202107-901",
            "trust": 0.6,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices contain a vulnerability that allows an unauthenticated attacker to trigger a denial-of-service condition. The vulnerability can be triggered if a large amount of DCP reset packets are sent to the device. Multiple Siemens products contain vulnerabilities in resource allocation without restrictions or throttling.Service operation interruption (DoS) It may be in a state. Pillow is a Python-based image processing library. \nThere is currently no information about this vulnerability, please feel free to follow CNNVD or manufacturer announcements. Siemens SCALANCE S602\u662f\u5fb7\u56fd\u897f\u95e8\u5b50\uff08Siemens\uff09\u516c\u53f8\u7684\u4e00\u6b3e\u5de5\u4e1a\u5b89\u5168\u8bbe\u5907. \nSiemens\u591a\u6b3e\u4ea7\u54c1 \u5b58\u5728\u5b89\u5168\u6f0f\u6d1e\uff0c\u8be5\u6f0f\u6d1e\u5141\u8bb8\u653b\u51fb\u8005\u6267\u884c\u62d2\u7edd\u670d\u52a1\u653b\u51fb\u3002\u4ee5\u4e0b\u4ea7\u54c1\u548c\u7248\u672c\u53d7\u5230\u5f71\u54cd\uff1aDevelopment/Evaluation Kits for PROFINET IO\uff1a DK Standard Ethernet Controller (All versions), Development/Evaluation Kits for PROFINET IO\uff1a EK-ERTEC 200 (All versions), Development/Evaluation Kits for PROFINET IO\uff1a EK-ERTEC 200P (All versions), RUGGEDCOM RM1224 (All Versions \uff1c 6.4), SCALANCE M-800 (All Versions \uff1c 6.4), SCALANCE S615 (All Versions \uff1c 6.4), SCALANCE W1700 IEEE 802.11ac (All versions), SCALANCE W700 IEEE 802.11n (All versions), SCALANCE X200-4 P IRT (All Versions \uff1c V5.5.0), SCALANCE X201-3P IRT (All Versions \uff1c V5.5.0), SCALANCE X201-3P IRT PRO (All Versions \uff1c V5.5.0), SCALANCE X202-2 IRT (All Versions \uff1c V5.5.0), SCALANCE X202-2P IRT (incl. SIPLUS NET variant) (All Versions \uff1c V5.5.0), SCALANCE X202-2P IRT PRO (All Versions \uff1c V5.5.0), SCALANCE X204 IRT (All Versions \uff1c V5.5.0), SCALANCE X204 IRT PRO (All Versions \uff1c V5.5.0), SCALANCE X204-2 (incl. SIPLUS NET variant) (All versions), SCALANCE X204-2FM (All versions), SCALANCE X204-2LD (incl. SIPLUS NET variant) (All versions), SCALANCE X204-2LD TS (All versions), SCALANCE X204-2TS (All versions), SCALANCE X206-1 (All versions), SCALANCE X206-1LD (incl. SIPLUS NET variant) (All versions), SCALANCE X208 (incl. SIPLUS NET variant) (All versions), SCALANCE X208PRO (All versions), SCALANCE X212-2 (All versions), SCALANCE X212-2LD (All versions), SCALANCE X216 (All versions), SCALANCE X224 (All versions), SCALANCE X302-7EEC (All versions), SCALANCE X304-2FE (All versions), SCALANCE X306-1LDFE (All versions), SCALANCE X307-2EEC (All versions), SCALANCE X307-3 (All versions), SCALANCE X307-3LD (All versions), SCALANCE X308-2 (incl. SIPLUS NET variant) (All versions), SCALANCE X308-2LD (All versions), SCALANCE X308-2LH (All versions), SCALANCE X308-2LH+ (All versions), SCALANCE X308-2M (All versions), SCALANCE X308-2M POE (All versions), SCALANCE X308-2M TS (All versions), SCALANCE X310 (All versions), SCALANCE X310FE (All versions), SCALANCE X320-1FE (All versions), SCALANCE X320-3LDFE (All versions), SCALANCE XB-200 (All versions), SCALANCE XC-200 (All versions), SCALANCE XF-200BA (All versions), SCALANCE XF201-3P IRT (All Versions \uff1c V5.5.0), SCALANCE XF202-2P IRT (All Versions \uff1c V5.5.0), SCALANCE XF204 (All versions), SCALANCE XF204 IRT (All Versions \uff1c V5.5.0), SCALANCE XF204-2 (incl. SIPLUS NET variant) (All versions), SCALANCE XF204-2BA IRT (All Versions \uff1c V5.5.0), SCALANCE XF206-1 (All versions), SCALANCE XF208 (All versions), SCALANCE XM400 (All versions \uff1c V6.3.1), SCALANCE XP-200 (All versions), SCALANCE XR-300WG (All versions), SCALANCE XR324-12M (All versions), SCALANCE XR324-12M TS (All versions), SCALANCE XR324-4M EEC (All versions), SCALANCE XR324-4M POE (All versions), SCALANCE XR324-4M POE TS (All versions), SCALANCE XR500 (All versions \uff1c V6.3.1), SIMATIC CFU PA (All versions), SIMATIC IE/PB-LINK V3 (All versions), SIMATIC MV500 family (All versions \uff1c V3.0), SIMATIC NET CM 1542-1 (All versions), SIMATIC NET CP1616/CP1604 (All Versions \uff1e= V2.7), SIMATIC NET CP1626 (All versions), SIMATIC NET DK-16xx PN IO (All Versions \uff1e= V2.7), SIMATIC PROFINET Driver (All versions), SIMATIC Power Line Booster PLB, Base Module (MLFB\uff1a 6ES7972-5AA10-0AB0) (All versions), SIMATIC S7-1200 CPU family (incl. SIPLUS variants) (All Versions \uff1c V4.5), SIMOCODE proV Ethernet/IP (All versions \uff1c V1.1.3), SIMOCODE proV PROFINET (All versions \uff1c V2.1.3), SOFTNET-IE PNIO (All versions)",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "db": "VULMON",
        "id": "CVE-2020-28400"
      }
    ],
    "trust": 2.79
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2020-28400",
        "trust": 3.3
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-21-194-03",
        "trust": 2.4
      },
      {
        "db": "SIEMENS",
        "id": "SSA-599968",
        "trust": 1.7
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133",
        "trust": 0.8
      },
      {
        "db": "CS-HELP",
        "id": "SB2021041363",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.2401",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021071416",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2020-28400",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2020-28400"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "id": "VAR-202107-1608",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.5447269509677419
  },
  "last_update_date": "2024-08-14T12:06:49.974000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-599968",
        "trust": 0.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-599968.pdf"
      },
      {
        "title": "Siemens Various product security vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=156594"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=77fc0ba2dcd8966c9a1f7eb47b8603ca"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2020-28400"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-770",
        "trust": 1.0
      },
      {
        "problemtype": "Allocation of resources without limits or throttling (CWE-770) [NVD evaluation ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.2,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-194-03"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-599968.pdf"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-599968.html"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28400"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/uscert/ics/advisories/icsa-21-194-03"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021041363"
      },
      {
        "trust": 0.6,
        "url": "https://vigilance.fr/vulnerability/siemens-ruggedcom-simatic-denial-of-service-via-profinet-dcp-reset-35890"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021071416"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.2401"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/770.html"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://cert-portal.siemens.com/productcert/txt/ssa-599968.txt"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2020-28400"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "VULMON",
        "id": "CVE-2020-28400"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-07-13T00:00:00",
        "db": "VULMON",
        "id": "CVE-2020-28400"
      },
      {
        "date": "2022-06-22T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "date": "2021-04-13T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "date": "2021-07-13T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "date": "2021-07-13T11:15:08.960000",
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-07-13T00:00:00",
        "db": "VULMON",
        "id": "CVE-2020-28400"
      },
      {
        "date": "2022-06-22T02:38:00",
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      },
      {
        "date": "2021-04-14T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "date": "2022-04-13T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      },
      {
        "date": "2024-06-11T09:15:09.487000",
        "db": "NVD",
        "id": "CVE-2020-28400"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Vulnerability in limiting or non-slotting resource allocation in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-010133"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202104-975"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-901"
      }
    ],
    "trust": 1.2
  }
}

var-202212-1133
Vulnerability from variot

Affected devices use a weak encryption scheme to encrypt the debug zip file. This could allow an authenticated attacker to decrypt the contents of the file and retrieve debug information about the system. ruggedcom rm1224 lte(4g) eu firmware, ruggedcom rm1224 lte(4g) nam firmware, scalance m804pb Multiple Siemens products, including firmware, contain vulnerabilities related to the use of cryptographic algorithms.Information may be obtained

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202212-1133",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance xr552-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1 ecc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm416-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr326-2c poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xc224-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr328-4c wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w734-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "siplus net scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w788-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w738-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m874-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "ruggedcom rm1224 lte\\ eu",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2bca dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc224",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc224-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w748-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w786-2 sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc206-2sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum766-1 6ghz",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w778-1 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr528-6m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m876-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr326-2c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w778-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w788-2 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb213-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum766-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w788-2 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance mum853-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "siplus net scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m804pb",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w774-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2ia m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr526-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w721-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance mum856-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ruggedcom rm1224 lte\\ nam",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m874-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2 eec m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb205-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-2 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w761-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-3g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204 dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance wum763-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr324wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam763-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm408-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1 6ghz",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-2ia rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance wam766-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 m12 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb213-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm408-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w788-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w722-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w1748-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208 poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m876-4",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc626-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xc216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615 eec",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m876-4",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte eu",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-622-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-636-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte nam",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance mum856-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m876-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc626-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m874-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-642-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance mum853-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m804pb",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-646-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-632-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m874-2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens reported these vulnerabilities to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-46140",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "NONE",
            "baseScore": 6.5,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 2.8,
            "id": "CVE-2022-46140",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "LOW",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "OTHER",
            "availabilityImpact": "None",
            "baseScore": 6.5,
            "baseSeverity": "Medium",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "JVNDB-2022-023551",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "Low",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-46140",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-46140",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "OTHER",
            "id": "JVNDB-2022-023551",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202212-3091",
            "trust": 0.6,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices use a weak encryption scheme to encrypt the debug zip file. This could allow an authenticated attacker to decrypt the contents of the file and retrieve debug information about the system. ruggedcom rm1224 lte(4g) eu firmware, ruggedcom rm1224 lte(4g) nam firmware, scalance m804pb Multiple Siemens products, including firmware, contain vulnerabilities related to the use of cryptographic algorithms.Information may be obtained",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      }
    ],
    "trust": 1.62
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-46140",
        "trust": 3.2
      },
      {
        "db": "SIEMENS",
        "id": "SSA-413565",
        "trust": 2.4
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-349-04",
        "trust": 1.4
      },
      {
        "db": "JVN",
        "id": "JVNVU91561630",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "id": "VAR-202212-1133",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.6398166875
  },
  "last_update_date": "2024-08-14T12:05:03.547000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Siemens part of the product Fixes for encryption problem vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=218340"
      }
    ],
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-327",
        "trust": 1.0
      },
      {
        "problemtype": "Use of incomplete or dangerous cryptographic algorithms (CWE-327) [ others ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.4,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu91561630/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-46140"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-349-04"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-46140/"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-349-04"
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-11-29T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "date": "2022-12-13T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      },
      {
        "date": "2022-12-13T16:15:25.007000",
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-11-29T03:03:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      },
      {
        "date": "2022-12-20T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      },
      {
        "date": "2023-03-14T10:15:23.297000",
        "db": "NVD",
        "id": "CVE-2022-46140"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Vulnerabilities related to the use of cryptographic algorithms in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023551"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "encryption problem",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3091"
      }
    ],
    "trust": 0.6
  }
}

var-202103-1464
Vulnerability from variot

An OpenSSL TLS server may crash if sent a maliciously crafted renegotiation ClientHello message from a client. If a TLSv1.2 renegotiation ClientHello omits the signature_algorithms extension (where it was present in the initial ClientHello), but includes a signature_algorithms_cert extension then a NULL pointer dereference will result, leading to a crash and a denial of service attack. A server is only vulnerable if it has TLSv1.2 and renegotiation enabled (which is the default configuration). OpenSSL TLS clients are not impacted by this issue. All OpenSSL 1.1.1 versions are affected by this issue. Users of these versions should upgrade to OpenSSL 1.1.1k. OpenSSL 1.0.2 is not impacted by this issue. Fixed in OpenSSL 1.1.1k (Affected 1.1.1-1.1.1j). OpenSSL is an open source general encryption library of the Openssl team that can implement the Secure Sockets Layer (SSLv2/v3) and Transport Layer Security (TLSv1) protocols. The product supports a variety of encryption algorithms, including symmetric ciphers, hash algorithms, secure hash algorithms, etc. Description:

Windows Container Support for Red Hat OpenShift allows you to deploy Windows container workloads running on Windows Server containers.

Bug Fix(es):

  • WMCO patch pub-key-hash annotation to Linux node (BZ#1945248)

  • LoadBalancer Service type with invalid external loadbalancer IP breaks the datapath (BZ#1952917)

  • Telemetry info not completely available to identify windows nodes (BZ#1955319)

  • WMCO incorrectly shows node as ready after a failed configuration (BZ#1956412)

  • kube-proxy service terminated unexpectedly after recreated LB service (BZ#1963263)

  • Solution:

For Windows Machine Config Operator upgrades, see the following documentation:

https://docs.openshift.com/container-platform/4.7/windows_containers/window s-node-upgrades.html

  1. Bugs fixed (https://bugzilla.redhat.com/):

1945248 - WMCO patch pub-key-hash annotation to Linux node 1946538 - CVE-2021-25736 kubernetes: LoadBalancer Service type don't create a HNS policy for empty or invalid external loadbalancer IP, what could lead to MITM 1952917 - LoadBalancer Service type with invalid external loadbalancer IP breaks the datapath 1955319 - Telemetry info not completely available to identify windows nodes 1956412 - WMCO incorrectly shows node as ready after a failed configuration 1963263 - kube-proxy service terminated unexpectedly after recreated LB service

  1. Bugs fixed (https://bugzilla.redhat.com/):

1897635 - CVE-2020-28362 golang: math/big: panic during recursive division of very large numbers 1918750 - CVE-2021-3114 golang: crypto/elliptic: incorrect operations on the P-224 curve

  1. JIRA issues fixed (https://issues.jboss.org/):

TRACING-1725 - Elasticsearch operator reports x509 errors communicating with ElasticSearch in OpenShift Service Mesh project

  1. Description:

Red Hat OpenShift Container Platform is Red Hat's cloud computing Kubernetes application platform solution designed for on-premise or private cloud deployments.

Security Fix(es):

  • jackson-databind: arbitrary code execution in slf4j-ext class (CVE-2018-14718)

  • jackson-databind: arbitrary code execution in blaze-ds-opt and blaze-ds-core classes (CVE-2018-14719)

  • jackson-databind: improper polymorphic deserialization in axis2-transport-jms class (CVE-2018-19360)

  • jackson-databind: improper polymorphic deserialization in openjpa class (CVE-2018-19361)

  • jackson-databind: improper polymorphic deserialization in jboss-common-core class (CVE-2018-19362)

  • jackson-databind: default typing mishandling leading to remote code execution (CVE-2019-14379)

  • jackson-databind: Serialization gadgets in com.pastdev.httpcomponents.configuration.JndiConfiguration (CVE-2020-24750)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.PerUserPoolDataSource (CVE-2020-35490)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.SharedPoolDataSource (CVE-2020-35491)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool (CVE-2020-35728)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to oadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36179)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36180)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36181)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36182)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool (CVE-2020-36183)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource (CVE-2020-36184)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource (CVE-2020-36185)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource (CVE-2020-36186)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource (CVE-2020-36187)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource (CVE-2020-36188)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSourc e (CVE-2020-36189)

  • jackson-databind: mishandles the interaction between serialization gadgets and typing, related to javax.swing (CVE-2021-20190)

  • jackson-databind: exfiltration/XXE in some JDK classes (CVE-2018-14720)

  • jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class (CVE-2018-14721)

For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section. See the following advisory for the container images for this release:

https://access.redhat.com/errata/RHBA-2021:1232

All OpenShift Container Platform 4.6 users are advised to upgrade to these updated packages and images when they are available in the appropriate release channel. To check for available updates, use the OpenShift Console or the CLI oc command. Instructions for upgrading a cluster are available at https://docs.openshift.com/container-platform/4.6/updating/updating-cluster - -between-minor.html#understanding-upgrade-channels_updating-cluster-between - -minor

For OpenShift Container Platform 4.6 see the following documentation, which will be updated shortly for this release, for important instructions on how to upgrade your cluster and fully apply this asynchronous errata update:

https://docs.openshift.com/container-platform/4.6/release_notes/ocp-4-6-rel ease-notes.html

Details on how to access this content are available at https://docs.openshift.com/container-platform/4.6/updating/updating-cluster - -cli.html

  1. Bugs fixed (https://bugzilla.redhat.com/):

1666415 - CVE-2018-14718 jackson-databind: arbitrary code execution in slf4j-ext class 1666418 - CVE-2018-14719 jackson-databind: arbitrary code execution in blaze-ds-opt and blaze-ds-core classes 1666423 - CVE-2018-14720 jackson-databind: exfiltration/XXE in some JDK classes 1666428 - CVE-2018-14721 jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class 1666482 - CVE-2018-19360 jackson-databind: improper polymorphic deserialization in axis2-transport-jms class 1666484 - CVE-2018-19361 jackson-databind: improper polymorphic deserialization in openjpa class 1666489 - CVE-2018-19362 jackson-databind: improper polymorphic deserialization in jboss-common-core class 1737517 - CVE-2019-14379 jackson-databind: default typing mishandling leading to remote code execution 1859004 - Sometimes the eventrouter couldn't gather event logs. 1882310 - CVE-2020-24750 jackson-databind: Serialization gadgets in com.pastdev.httpcomponents.configuration.JndiConfiguration 1909266 - CVE-2020-35490 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.PerUserPoolDataSource 1909269 - CVE-2020-35491 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.SharedPoolDataSource 1911502 - CVE-2020-35728 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool 1913871 - CVE-2020-36179 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to oadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS 1913872 - CVE-2020-36180 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS 1913874 - CVE-2020-36181 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS 1913926 - CVE-2020-36182 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS 1913927 - CVE-2020-36183 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool 1913928 - CVE-2020-36184 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource 1913929 - CVE-2020-36185 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource 1913931 - CVE-2020-36186 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource 1913933 - CVE-2020-36187 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource 1913934 - CVE-2020-36188 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource 1913937 - CVE-2020-36189 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSource 1916633 - CVE-2021-20190 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to javax.swing 1925361 - [4.6] ClusterLogForwarder namespace-specific log forwarding does not work as expected 1950894 - Placeholder bug for OCP 4.6.0 extras release

Bug fix:

  • RHACM 2.0.10 images (BZ #1940452)

  • Bugs fixed (https://bugzilla.redhat.com/):

1940452 - RHACM 2.0.10 images 1944286 - CVE-2021-23358 nodejs-underscore: Arbitrary code execution via the template function

  1. Description:

Red Hat Advanced Cluster Management for Kubernetes 2.1.6 images

Red Hat Advanced Cluster Management for Kubernetes provides the capabilities to address common challenges that administrators and site reliability engineers face as they work across a range of public and private cloud environments. Clusters and applications are all visible and managed from a single console—with security policy built in.

Bug fixes:

  • RHACM 2.1.6 images (BZ#1940581)

  • When generating the import cluster string, it can include unescaped characters (BZ#1934184)

  • Bugs fixed (https://bugzilla.redhat.com/):

1853652 - CVE-2020-14040 golang.org/x/text: possibility to trigger an infinite loop in encoding/unicode could lead to crash 1929338 - CVE-2020-35149 mquery: Code injection via merge or clone operation 1934184 - When generating the import cluster string, it can include unescaped characters 1940581 - RHACM 2.1.6 images

  1. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256

====================================================================
Red Hat Security Advisory

Synopsis: Important: Red Hat JBoss Core Services Apache HTTP Server 2.4.37 SP7 security update Advisory ID: RHSA-2021:1199-01 Product: Red Hat JBoss Core Services Advisory URL: https://access.redhat.com/errata/RHSA-2021:1199 Issue date: 2021-04-14 CVE Names: CVE-2021-3449 CVE-2021-3450 ==================================================================== 1. Summary:

Updated packages that provide Red Hat JBoss Core Services Pack Apache Server 2.4.37 and fix several bugs, and add various enhancements are now available for Red Hat Enterprise Linux 7.

Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.

  1. Relevant releases/architectures:

Red Hat JBoss Core Services on RHEL 7 Server - noarch, ppc64, x86_64

  1. Description:

This release adds the new Apache HTTP Server 2.4.37 Service Pack 7 packages that are part of the JBoss Core Services offering.

This release serves as a replacement for Red Hat JBoss Core Services Pack Apache Server 2.4.37 Service Pack 6 and includes bug fixes and enhancements. Refer to the Release Notes for information on the most significant bug fixes and enhancements included in this release.

Security fix(es):

  • openssl: NULL pointer dereference in signature_algorithms processing (CVE-2021-3449)
  • openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT (CVE-2021-3450)

For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section.

  1. Solution:

Before applying this update, make sure all previously released errata relevant to your system have been applied.

For details on how to apply this update, refer to:

https://access.redhat.com/articles/11258

  1. Bugs fixed (https://bugzilla.redhat.com/):

1941547 - CVE-2021-3450 openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT 1941554 - CVE-2021-3449 openssl: NULL pointer dereference in signature_algorithms processing

  1. Package List:

Red Hat JBoss Core Services on RHEL 7 Server:

Source: jbcs-httpd24-httpd-2.4.37-70.jbcs.el7.src.rpm jbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.src.rpm jbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.src.rpm jbcs-httpd24-mod_jk-1.2.48-13.redhat_1.jbcs.el7.src.rpm jbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.src.rpm jbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.src.rpm jbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.src.rpm jbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.src.rpm jbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.src.rpm jbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.src.rpm

noarch: jbcs-httpd24-httpd-manual-2.4.37-70.jbcs.el7.noarch.rpm

ppc64: jbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.ppc64.rpm jbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.ppc64.rpm jbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.ppc64.rpm jbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.ppc64.rpm jbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.ppc64.rpm

x86_64: jbcs-httpd24-httpd-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-debuginfo-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-devel-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-selinux-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-httpd-tools-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_cluster-native-debuginfo-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_jk-ap24-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_jk-debuginfo-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_jk-manual-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_ldap-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_proxy_html-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_security-debuginfo-2.9.2-60.GA.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_session-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-mod_ssl-2.4.37-70.jbcs.el7.x86_64.rpm jbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.x86_64.rpm jbcs-httpd24-nghttp2-debuginfo-1.39.2-37.jbcs.el7.x86_64.rpm jbcs-httpd24-nghttp2-devel-1.39.2-37.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-debuginfo-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-devel-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-libs-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-perl-1.1.1g-6.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.x86_64.rpm jbcs-httpd24-openssl-static-1.1.1g-6.jbcs.el7.x86_64.rpm

These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/

  1. References:

https://access.redhat.com/security/cve/CVE-2021-3449 https://access.redhat.com/security/cve/CVE-2021-3450 https://access.redhat.com/security/updates/classification/#important

  1. Contact:

The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/

Copyright 2021 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1

iQIVAwUBYHcQ4tzjgjWX9erEAQg5Zg/9FciPflU5YnbBIktqUgZAzkgIaZf3cp/A vYQu1D/5oRwfvcdbhtzgYBVB5Ha+Ut1QQRHix/3QkD2v4+pF2eAnfe6TN2ftgKyJ Qw1oOs0HGdUzSkxboZESkTGiSmaCLT7fn7dHvJ1cH0rfQx7ngYRPGLPAbSHqOaQZ gkRYTZGl+jBG/a91XBMoa+QRFT0+yQX4ps2oEGiMWZMIfWOrC4iU9NnudR1CDGE7 SWzDmjAIKP2xjfi6UVwTuuq64ROju9ginT5KPwj42Btfatnj6nTF4CIoWyfBm9LK CLBXeJOfjQUB/vjiTeLh47d1rMt7H5Jjck8imL6nfdAkzG+SKQA3yxjHztdmEFyX aDQR6T5X2lPBPdtHE0qaunS5lb/XRWh7xTQ3k34iTYvIN2wd2KqP78TwXSMEKWlV ddGQul2vakBXn4C2waTvuJE6JvvwS4Q8zQ1plpW1uOuGIRn1XAxJWV+Wkmt5eBg6 AbyXUMM7pLKiUNP1L0k7nKKx5Ta3HlnpvOpXMDlvccxwEAWoVqZ+nrmUe9bG67DK 1yEp/DR/XpKLPjCwBEW+i+nZUSpTyKe3+J962KoSJ/HISVRZaicBmGiQDCKCEbPr hnhoDO+7Y0A1GlmAd3ZkHu+k97louMpIkRsghdZ7el3D1Hx2EhP/HSQqHI5QCyMl qQeHglPylHU=m11c -----END PGP SIGNATURE-----

-- RHSA-announce mailing list RHSA-announce@redhat.com https://listman.redhat.com/mailman/listinfo/rhsa-announce . Description:

Red Hat JBoss Web Server is a fully integrated and certified set of components for hosting Java web applications. It is comprised of the Apache HTTP Server, the Apache Tomcat Servlet container, Apache Tomcat Connector (mod_jk), JBoss HTTP Connector (mod_cluster), Hibernate, and the Tomcat Native library

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202103-1464",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "simatic pdm",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "9.1.0.7"
      },
      {
        "model": "node.js",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "14.14.0"
      },
      {
        "model": "scalance w700",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.5"
      },
      {
        "model": "multi-domain management",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "checkpoint",
        "version": "r81"
      },
      {
        "model": "web gateway cloud service",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "mcafee",
        "version": "10.1.1"
      },
      {
        "model": "simatic logon",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.5"
      },
      {
        "model": "web gateway cloud service",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "mcafee",
        "version": "9.2.10"
      },
      {
        "model": "log correlation engine",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "6.0.9"
      },
      {
        "model": "simatic mv500",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic net cp1243-7 lte eu",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "graalvm",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "20.3.1.2"
      },
      {
        "model": "primavera unifier",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "17.12"
      },
      {
        "model": "graalvm",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "19.3.5"
      },
      {
        "model": "freebsd",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "freebsd",
        "version": "12.2"
      },
      {
        "model": "tenable.sc",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.13.0"
      },
      {
        "model": "simatic pcs neo",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s602",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "simatic wincc runtime advanced",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "node.js",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "12.12.0"
      },
      {
        "model": "node.js",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "10.24.0"
      },
      {
        "model": "simatic rf185c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinec infrastructure network services",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.1.1"
      },
      {
        "model": "nessus",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "8.13.1"
      },
      {
        "model": "nessus network monitor",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.11.0"
      },
      {
        "model": "mysql server",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.0.15"
      },
      {
        "model": "openssl",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "openssl",
        "version": "1.1.1k"
      },
      {
        "model": "primavera unifier",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "17.7"
      },
      {
        "model": "simatic net cp 1543sp-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "zfs storage appliance kit",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.8"
      },
      {
        "model": "sinamics connect 300",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "nessus network monitor",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.12.1"
      },
      {
        "model": "tim 1531 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.2"
      },
      {
        "model": "scalance s623",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "simatic net cp 1243-8 irc",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "oncommand workflow automation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "essbase",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "21.2"
      },
      {
        "model": "simatic net cp1243-7 lte us",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "sinec nms",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0"
      },
      {
        "model": "sinema server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "14.0"
      },
      {
        "model": "scalance m-800",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.2"
      },
      {
        "model": "fedora",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "fedoraproject",
        "version": "34"
      },
      {
        "model": "simatic rf166c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "oncommand insight",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "simatic s7-1200 cpu 1215 fc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 1242-7 gprs v2",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "simatic hmi basic panels 2nd generation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic rf186c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "14.0.0"
      },
      {
        "model": "simatic s7-1200 cpu 1211c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "jd edwards enterpriseone tools",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "9.2.6.0"
      },
      {
        "model": "ruggedcom rcm1224",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.2"
      },
      {
        "model": "peoplesoft enterprise peopletools",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.58"
      },
      {
        "model": "sma100",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "sonicwall",
        "version": "10.2.1.0-17sv"
      },
      {
        "model": "scalance sc-600",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "peoplesoft enterprise peopletools",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.57"
      },
      {
        "model": "web gateway",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "mcafee",
        "version": "10.1.1"
      },
      {
        "model": "simatic rf186ci",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "web gateway",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "mcafee",
        "version": "9.2.10"
      },
      {
        "model": "openssl",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "openssl",
        "version": "1.1.1"
      },
      {
        "model": "communications communications policy management",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "12.6.0.0.0"
      },
      {
        "model": "simatic process historian opc ua server",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2019"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "12.0.0"
      },
      {
        "model": "primavera unifier",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "21.12"
      },
      {
        "model": "simatic rf188ci",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic net cp 1545-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0"
      },
      {
        "model": "graalvm",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "21.0.0.2"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "10.13.0"
      },
      {
        "model": "mysql server",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.0.23"
      },
      {
        "model": "simatic net cp 1543-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.2"
      },
      {
        "model": "scalance lpe9403",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic net cp 1243-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "scalance s615",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.2"
      },
      {
        "model": "simatic net cp 1543-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "12.13.0"
      },
      {
        "model": "scalance xb-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "simatic cloud connect 7",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1"
      },
      {
        "model": "secure backup",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "18.1.0.1.0"
      },
      {
        "model": "simatic hmi comfort outdoor panels",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic s7-1200 cpu 1215c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s627-2m",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "tenable.sc",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.17.0"
      },
      {
        "model": "simatic s7-1200 cpu 1214c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "mysql server",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "5.7.33"
      },
      {
        "model": "node.js",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "10.12.0"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "14.15.0"
      },
      {
        "model": "cloud volumes ontap mediator",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "simatic cloud connect 7",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "nessus network monitor",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.13.0"
      },
      {
        "model": "simatic rf360r",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "tim 1531 irc",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "simatic logon",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.6.0.2"
      },
      {
        "model": "sinec pni",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr524-8c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "nessus network monitor",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.12.0"
      },
      {
        "model": "jd edwards world security",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "a9.4"
      },
      {
        "model": "simatic s7-1200 cpu 1212c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinumerik opc ua server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm-400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "primavera unifier",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "19.12"
      },
      {
        "model": "simatic s7-1500 cpu 1518-4 pn\\/dp mfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "10.0"
      },
      {
        "model": "tia administrator",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "node.js",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "15.14.0"
      },
      {
        "model": "e-series performance analyzer",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "simatic s7-1200 cpu 1214 fc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "mysql connectors",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.0.23"
      },
      {
        "model": "scalance xc-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "quantum security gateway",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "checkpoint",
        "version": "r80.40"
      },
      {
        "model": "nessus network monitor",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "tenable",
        "version": "5.11.1"
      },
      {
        "model": "quantum security management",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "checkpoint",
        "version": "r80.40"
      },
      {
        "model": "web gateway",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "mcafee",
        "version": "8.2.19"
      },
      {
        "model": "active iq unified manager",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "sonicos",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "sonicwall",
        "version": "7.0.1.0"
      },
      {
        "model": "scalance xp-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance xr-300wg",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "simatic hmi ktp mobile panels",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ontap select deploy administration utility",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "quantum security gateway",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "checkpoint",
        "version": "r81"
      },
      {
        "model": "quantum security management",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "checkpoint",
        "version": "r81"
      },
      {
        "model": "simatic wincc telecontrol",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "primavera unifier",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "20.12"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "15.0.0"
      },
      {
        "model": "scalance s612",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "simatic net cp 1542sp-1 irc",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "santricity smi-s provider",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "scalance xr528-6m",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "node.js",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "12.22.1"
      },
      {
        "model": "sma100",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "sonicwall",
        "version": "10.2.0.0"
      },
      {
        "model": "snapcenter",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "web gateway cloud service",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "mcafee",
        "version": "8.2.19"
      },
      {
        "model": "mysql workbench",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.0.23"
      },
      {
        "model": "peoplesoft enterprise peopletools",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.59"
      },
      {
        "model": "capture client",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "sonicwall",
        "version": "3.5"
      },
      {
        "model": "scalance xr552-12",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "simatic pcs 7 telecontrol",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic rf188c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "enterprise manager for storage management",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "13.4.0.0"
      },
      {
        "model": "scalance xr526-8c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "scalance w1700",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "simatic s7-1200 cpu 1217c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "node.js",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "10.0.0"
      },
      {
        "model": "secure global desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "5.6"
      },
      {
        "model": "node.js",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "nodejs",
        "version": "14.16.1"
      },
      {
        "model": "storagegrid",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "simatic s7-1200 cpu 1212fc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 1242-7 gprs v2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "multi-domain management",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "checkpoint",
        "version": "r80.40"
      }
    ],
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Red Hat",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "163257"
      },
      {
        "db": "PACKETSTORM",
        "id": "163267"
      },
      {
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "db": "PACKETSTORM",
        "id": "162383"
      },
      {
        "db": "PACKETSTORM",
        "id": "162337"
      },
      {
        "db": "PACKETSTORM",
        "id": "162196"
      },
      {
        "db": "PACKETSTORM",
        "id": "162201"
      }
    ],
    "trust": 0.8
  },
  "cve": "CVE-2021-3449",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "MEDIUM",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 4.3,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 8.6,
            "id": "CVE-2021-3449",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.0,
            "vectorString": "AV:N/AC:M/Au:N/C:N/I:N/A:P",
            "version": "2.0"
          },
          {
            "accessComplexity": "MEDIUM",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "VULHUB",
            "availabilityImpact": "PARTIAL",
            "baseScore": 4.3,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 8.6,
            "id": "VHN-388130",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.1,
            "vectorString": "AV:N/AC:M/AU:N/C:N/I:N/A:P",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "HIGH",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 5.9,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 2.2,
            "id": "CVE-2021-3449",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2021-3449",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "VULHUB",
            "id": "VHN-388130",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "An OpenSSL TLS server may crash if sent a maliciously crafted renegotiation ClientHello message from a client. If a TLSv1.2 renegotiation ClientHello omits the signature_algorithms extension (where it was present in the initial ClientHello), but includes a signature_algorithms_cert extension then a NULL pointer dereference will result, leading to a crash and a denial of service attack. A server is only vulnerable if it has TLSv1.2 and renegotiation enabled (which is the default configuration). OpenSSL TLS clients are not impacted by this issue. All OpenSSL 1.1.1 versions are affected by this issue. Users of these versions should upgrade to OpenSSL 1.1.1k. OpenSSL 1.0.2 is not impacted by this issue. Fixed in OpenSSL 1.1.1k (Affected 1.1.1-1.1.1j). OpenSSL is an open source general encryption library of the Openssl team that can implement the Secure Sockets Layer (SSLv2/v3) and Transport Layer Security (TLSv1) protocols. The product supports a variety of encryption algorithms, including symmetric ciphers, hash algorithms, secure hash algorithms, etc. Description:\n\nWindows Container Support for Red Hat OpenShift allows you to deploy\nWindows container workloads running on Windows Server containers. \n\nBug Fix(es):\n\n* WMCO patch pub-key-hash annotation to Linux node (BZ#1945248)\n\n* LoadBalancer Service type with invalid external loadbalancer IP breaks\nthe datapath (BZ#1952917)\n\n* Telemetry info not completely available to identify windows nodes\n(BZ#1955319)\n\n* WMCO incorrectly shows node as ready after a failed configuration\n(BZ#1956412)\n\n* kube-proxy service terminated unexpectedly after recreated LB service\n(BZ#1963263)\n\n3. Solution:\n\nFor Windows Machine Config Operator upgrades, see the following\ndocumentation:\n\nhttps://docs.openshift.com/container-platform/4.7/windows_containers/window\ns-node-upgrades.html\n\n4. Bugs fixed (https://bugzilla.redhat.com/):\n\n1945248 - WMCO patch pub-key-hash annotation to Linux node\n1946538 - CVE-2021-25736 kubernetes: LoadBalancer Service type don\u0027t create a HNS policy for empty or invalid external loadbalancer IP, what could lead to MITM\n1952917 - LoadBalancer Service type with invalid external loadbalancer IP breaks the datapath\n1955319 - Telemetry info not completely available to identify windows nodes\n1956412 - WMCO incorrectly shows node as ready after a failed configuration\n1963263 - kube-proxy service terminated unexpectedly after recreated LB service\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1897635 - CVE-2020-28362 golang: math/big: panic during recursive division of very large numbers\n1918750 - CVE-2021-3114 golang: crypto/elliptic: incorrect operations on the P-224 curve\n\n5. JIRA issues fixed (https://issues.jboss.org/):\n\nTRACING-1725 -  Elasticsearch operator reports x509 errors communicating with ElasticSearch in OpenShift Service Mesh project\n\n6. Description:\n\nRed Hat OpenShift Container Platform is Red Hat\u0027s cloud computing\nKubernetes application platform solution designed for on-premise or private\ncloud deployments. \n\nSecurity Fix(es):\n\n* jackson-databind: arbitrary code execution in slf4j-ext class\n(CVE-2018-14718)\n\n* jackson-databind: arbitrary code execution in blaze-ds-opt and\nblaze-ds-core classes (CVE-2018-14719)\n\n* jackson-databind: improper polymorphic deserialization in\naxis2-transport-jms class (CVE-2018-19360)\n\n* jackson-databind: improper polymorphic deserialization in openjpa class\n(CVE-2018-19361)\n\n* jackson-databind: improper polymorphic deserialization in\njboss-common-core class (CVE-2018-19362)\n\n* jackson-databind: default typing mishandling leading to remote code\nexecution (CVE-2019-14379)\n\n* jackson-databind: Serialization gadgets in\ncom.pastdev.httpcomponents.configuration.JndiConfiguration (CVE-2020-24750)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.commons.dbcp2.datasources.PerUserPoolDataSource (CVE-2020-35490)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.commons.dbcp2.datasources.SharedPoolDataSource (CVE-2020-35491)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\ncom.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool\n(CVE-2020-35728)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\noadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36179)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36180)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS (CVE-2020-36181)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS (CVE-2020-36182)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool (CVE-2020-36183)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource\n(CVE-2020-36184)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource\n(CVE-2020-36185)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource\n(CVE-2020-36186)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\norg.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource\n(CVE-2020-36187)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\ncom.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource\n(CVE-2020-36188)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to\ncom.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSourc\ne (CVE-2020-36189)\n\n* jackson-databind: mishandles the interaction between serialization\ngadgets and typing, related to javax.swing (CVE-2021-20190)\n\n* jackson-databind: exfiltration/XXE in some JDK classes (CVE-2018-14720)\n\n* jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class\n(CVE-2018-14721)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. See the following advisory for the container images for\nthis release:\n\nhttps://access.redhat.com/errata/RHBA-2021:1232\n\nAll OpenShift Container Platform 4.6 users are advised to upgrade to these\nupdated packages and images when they are available in the appropriate\nrelease channel. To check for available updates, use the OpenShift Console\nor the CLI oc command. Instructions for upgrading a cluster are available\nat\nhttps://docs.openshift.com/container-platform/4.6/updating/updating-cluster\n- -between-minor.html#understanding-upgrade-channels_updating-cluster-between\n- -minor\n\nFor OpenShift Container Platform 4.6 see the following documentation, which\nwill be updated shortly for this release, for important instructions on how\nto upgrade your cluster and fully apply this asynchronous errata update:\n\nhttps://docs.openshift.com/container-platform/4.6/release_notes/ocp-4-6-rel\nease-notes.html\n\nDetails on how to access this content are available at\nhttps://docs.openshift.com/container-platform/4.6/updating/updating-cluster\n- -cli.html\n\n4. Bugs fixed (https://bugzilla.redhat.com/):\n\n1666415 - CVE-2018-14718 jackson-databind: arbitrary code execution in slf4j-ext class\n1666418 - CVE-2018-14719 jackson-databind: arbitrary code execution in blaze-ds-opt and blaze-ds-core classes\n1666423 - CVE-2018-14720 jackson-databind: exfiltration/XXE in some JDK classes\n1666428 - CVE-2018-14721 jackson-databind: server-side request forgery (SSRF) in axis2-jaxws class\n1666482 - CVE-2018-19360 jackson-databind: improper polymorphic deserialization in axis2-transport-jms class\n1666484 - CVE-2018-19361 jackson-databind: improper polymorphic deserialization in openjpa class\n1666489 - CVE-2018-19362 jackson-databind: improper polymorphic deserialization in jboss-common-core class\n1737517 - CVE-2019-14379 jackson-databind: default typing mishandling leading to remote code execution\n1859004 - Sometimes the eventrouter couldn\u0027t gather event logs. \n1882310 - CVE-2020-24750 jackson-databind: Serialization gadgets in com.pastdev.httpcomponents.configuration.JndiConfiguration\n1909266 - CVE-2020-35490 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.PerUserPoolDataSource\n1909269 - CVE-2020-35491 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.datasources.SharedPoolDataSource\n1911502 - CVE-2020-35728 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.oracle.wls.shaded.org.apache.xalan.lib.sql.JNDIConnectionPool\n1913871 - CVE-2020-36179 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to oadd.org.apache.commons.dbcp.cpdsadapter.DriverAdapterCPDS\n1913872 - CVE-2020-36180 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.commons.dbcp2.cpdsadapter.DriverAdapterCPDS\n1913874 - CVE-2020-36181 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.cpdsadapter.DriverAdapterCPDS\n1913926 - CVE-2020-36182 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.cpdsadapter.DriverAdapterCPDS\n1913927 - CVE-2020-36183 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.docx4j.org.apache.xalan.lib.sql.JNDIConnectionPool\n1913928 - CVE-2020-36184 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.PerUserPoolDataSource\n1913929 - CVE-2020-36185 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp2.datasources.SharedPoolDataSource\n1913931 - CVE-2020-36186 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.PerUserPoolDataSource\n1913933 - CVE-2020-36187 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to org.apache.tomcat.dbcp.dbcp.datasources.SharedPoolDataSource\n1913934 - CVE-2020-36188 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.JNDIConnectionSource\n1913937 - CVE-2020-36189 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to com.newrelic.agent.deps.ch.qos.logback.core.db.DriverManagerConnectionSource\n1916633 - CVE-2021-20190 jackson-databind: mishandles the interaction between serialization gadgets and typing, related to javax.swing\n1925361 - [4.6] ClusterLogForwarder namespace-specific log forwarding does not work as expected\n1950894 - Placeholder bug for OCP 4.6.0 extras release\n\n5. \n\nBug fix:\n\n* RHACM 2.0.10 images (BZ #1940452)\n\n3. Bugs fixed (https://bugzilla.redhat.com/):\n\n1940452 - RHACM 2.0.10 images\n1944286 - CVE-2021-23358 nodejs-underscore: Arbitrary code execution via the template function\n\n5. Description:\n\nRed Hat Advanced Cluster Management for Kubernetes 2.1.6 images\n\nRed Hat Advanced Cluster Management for Kubernetes provides the\ncapabilities to address common challenges that administrators and site\nreliability engineers face as they work across a range of public and\nprivate cloud environments. Clusters and applications are all visible and\nmanaged from a single console\u2014with security policy built in. \n\nBug fixes:\n\n* RHACM 2.1.6 images (BZ#1940581)\n\n* When generating the import cluster string, it can include unescaped\ncharacters (BZ#1934184)\n\n3. Bugs fixed (https://bugzilla.redhat.com/):\n\n1853652 - CVE-2020-14040 golang.org/x/text: possibility to trigger an infinite loop in encoding/unicode could lead to crash\n1929338 - CVE-2020-35149 mquery: Code injection via merge or clone operation\n1934184 - When generating the import cluster string, it can include unescaped characters\n1940581 - RHACM 2.1.6 images\n\n5. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n====================================================================                   \nRed Hat Security Advisory\n\nSynopsis:          Important: Red Hat JBoss Core Services Apache HTTP Server 2.4.37 SP7 security update\nAdvisory ID:       RHSA-2021:1199-01\nProduct:           Red Hat JBoss Core Services\nAdvisory URL:      https://access.redhat.com/errata/RHSA-2021:1199\nIssue date:        2021-04-14\nCVE Names:         CVE-2021-3449 CVE-2021-3450\n====================================================================\n1. Summary:\n\nUpdated packages that provide Red Hat JBoss Core Services Pack Apache\nServer 2.4.37 and fix several bugs, and add various enhancements are now\navailable for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat JBoss Core Services on RHEL 7 Server - noarch, ppc64, x86_64\n\n3. Description:\n\nThis release adds the new Apache HTTP Server 2.4.37 Service Pack 7 packages\nthat are part of the JBoss Core Services offering. \n\nThis release serves as a replacement for Red Hat JBoss Core Services Pack\nApache Server 2.4.37 Service Pack 6 and includes bug fixes and\nenhancements. Refer to the Release Notes for information on the most\nsignificant bug fixes and enhancements included in this release. \n\nSecurity fix(es):\n\n* openssl: NULL pointer dereference in signature_algorithms processing\n(CVE-2021-3449)\n* openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT\n(CVE-2021-3450)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. \n\n4. Solution:\n\nBefore applying this update, make sure all previously released errata\nrelevant to your system have been applied. \n\nFor details on how to apply this update, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1941547 - CVE-2021-3450 openssl: CA certificate check bypass with X509_V_FLAG_X509_STRICT\n1941554 - CVE-2021-3449 openssl: NULL pointer dereference in signature_algorithms processing\n\n6. Package List:\n\nRed Hat JBoss Core Services on RHEL 7 Server:\n\nSource:\njbcs-httpd24-httpd-2.4.37-70.jbcs.el7.src.rpm\njbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.src.rpm\njbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.src.rpm\njbcs-httpd24-mod_jk-1.2.48-13.redhat_1.jbcs.el7.src.rpm\njbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.src.rpm\njbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.src.rpm\njbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.src.rpm\njbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.src.rpm\njbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.src.rpm\njbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.src.rpm\n\nnoarch:\njbcs-httpd24-httpd-manual-2.4.37-70.jbcs.el7.noarch.rpm\n\nppc64:\njbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.ppc64.rpm\njbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.ppc64.rpm\njbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.ppc64.rpm\njbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.ppc64.rpm\njbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.ppc64.rpm\n\nx86_64:\njbcs-httpd24-httpd-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-debuginfo-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-devel-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-selinux-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-httpd-tools-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_cluster-native-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_cluster-native-debuginfo-1.3.14-20.Final_redhat_2.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_http2-1.15.7-14.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_http2-debuginfo-1.15.7-14.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_jk-ap24-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_jk-debuginfo-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_jk-manual-1.2.48-13.redhat_1.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_ldap-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_md-2.0.8-33.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_md-debuginfo-2.0.8-33.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_proxy_html-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_security-2.9.2-60.GA.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_security-debuginfo-2.9.2-60.GA.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_session-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-mod_ssl-2.4.37-70.jbcs.el7.x86_64.rpm\njbcs-httpd24-nghttp2-1.39.2-37.jbcs.el7.x86_64.rpm\njbcs-httpd24-nghttp2-debuginfo-1.39.2-37.jbcs.el7.x86_64.rpm\njbcs-httpd24-nghttp2-devel-1.39.2-37.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-chil-1.0.0-5.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-chil-debuginfo-1.0.0-5.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-debuginfo-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-devel-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-libs-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-perl-1.1.1g-6.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-pkcs11-0.4.10-20.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-pkcs11-debuginfo-0.4.10-20.jbcs.el7.x86_64.rpm\njbcs-httpd24-openssl-static-1.1.1g-6.jbcs.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security.  Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2021-3449\nhttps://access.redhat.com/security/cve/CVE-2021-3450\nhttps://access.redhat.com/security/updates/classification/#important\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2021 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBYHcQ4tzjgjWX9erEAQg5Zg/9FciPflU5YnbBIktqUgZAzkgIaZf3cp/A\nvYQu1D/5oRwfvcdbhtzgYBVB5Ha+Ut1QQRHix/3QkD2v4+pF2eAnfe6TN2ftgKyJ\nQw1oOs0HGdUzSkxboZESkTGiSmaCLT7fn7dHvJ1cH0rfQx7ngYRPGLPAbSHqOaQZ\ngkRYTZGl+jBG/a91XBMoa+QRFT0+yQX4ps2oEGiMWZMIfWOrC4iU9NnudR1CDGE7\nSWzDmjAIKP2xjfi6UVwTuuq64ROju9ginT5KPwj42Btfatnj6nTF4CIoWyfBm9LK\nCLBXeJOfjQUB/vjiTeLh47d1rMt7H5Jjck8imL6nfdAkzG+SKQA3yxjHztdmEFyX\naDQR6T5X2lPBPdtHE0qaunS5lb/XRWh7xTQ3k34iTYvIN2wd2KqP78TwXSMEKWlV\nddGQul2vakBXn4C2waTvuJE6JvvwS4Q8zQ1plpW1uOuGIRn1XAxJWV+Wkmt5eBg6\nAbyXUMM7pLKiUNP1L0k7nKKx5Ta3HlnpvOpXMDlvccxwEAWoVqZ+nrmUe9bG67DK\n1yEp/DR/XpKLPjCwBEW+i+nZUSpTyKe3+J962KoSJ/HISVRZaicBmGiQDCKCEbPr\nhnhoDO+7Y0A1GlmAd3ZkHu+k97louMpIkRsghdZ7el3D1Hx2EhP/HSQqHI5QCyMl\nqQeHglPylHU=m11c\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://listman.redhat.com/mailman/listinfo/rhsa-announce\n. Description:\n\nRed Hat JBoss Web Server is a fully integrated and certified set of\ncomponents for hosting Java web applications. It is comprised of the Apache\nHTTP Server, the Apache Tomcat Servlet container, Apache Tomcat Connector\n(mod_jk), JBoss HTTP Connector (mod_cluster), Hibernate, and the Tomcat\nNative library",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      },
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "db": "PACKETSTORM",
        "id": "163257"
      },
      {
        "db": "PACKETSTORM",
        "id": "163267"
      },
      {
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "db": "PACKETSTORM",
        "id": "162383"
      },
      {
        "db": "PACKETSTORM",
        "id": "162337"
      },
      {
        "db": "PACKETSTORM",
        "id": "162196"
      },
      {
        "db": "PACKETSTORM",
        "id": "162201"
      }
    ],
    "trust": 1.71
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2021-3449",
        "trust": 1.9
      },
      {
        "db": "TENABLE",
        "id": "TNS-2021-06",
        "trust": 1.1
      },
      {
        "db": "TENABLE",
        "id": "TNS-2021-09",
        "trust": 1.1
      },
      {
        "db": "TENABLE",
        "id": "TNS-2021-05",
        "trust": 1.1
      },
      {
        "db": "TENABLE",
        "id": "TNS-2021-10",
        "trust": 1.1
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2021/03/28/3",
        "trust": 1.1
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2021/03/27/2",
        "trust": 1.1
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2021/03/28/4",
        "trust": 1.1
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2021/03/27/1",
        "trust": 1.1
      },
      {
        "db": "SIEMENS",
        "id": "SSA-772220",
        "trust": 1.1
      },
      {
        "db": "SIEMENS",
        "id": "SSA-389290",
        "trust": 1.1
      },
      {
        "db": "PULSESECURE",
        "id": "SA44845",
        "trust": 1.1
      },
      {
        "db": "MCAFEE",
        "id": "SB10356",
        "trust": 1.1
      },
      {
        "db": "PACKETSTORM",
        "id": "163257",
        "trust": 0.2
      },
      {
        "db": "PACKETSTORM",
        "id": "162350",
        "trust": 0.2
      },
      {
        "db": "PACKETSTORM",
        "id": "162383",
        "trust": 0.2
      },
      {
        "db": "PACKETSTORM",
        "id": "162337",
        "trust": 0.2
      },
      {
        "db": "PACKETSTORM",
        "id": "162196",
        "trust": 0.2
      },
      {
        "db": "PACKETSTORM",
        "id": "162201",
        "trust": 0.2
      },
      {
        "db": "PACKETSTORM",
        "id": "162197",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162114",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162076",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162041",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162013",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162183",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162699",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162151",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162189",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162172",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "161984",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162307",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "162200",
        "trust": 0.1
      },
      {
        "db": "SEEBUG",
        "id": "SSVID-99170",
        "trust": 0.1
      },
      {
        "db": "VULHUB",
        "id": "VHN-388130",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "163267",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "163276",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "db": "PACKETSTORM",
        "id": "163257"
      },
      {
        "db": "PACKETSTORM",
        "id": "163267"
      },
      {
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "db": "PACKETSTORM",
        "id": "162383"
      },
      {
        "db": "PACKETSTORM",
        "id": "162337"
      },
      {
        "db": "PACKETSTORM",
        "id": "162196"
      },
      {
        "db": "PACKETSTORM",
        "id": "162201"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "id": "VAR-202103-1464",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      }
    ],
    "trust": 0.69085685
  },
  "last_update_date": "2024-09-19T22:06:59.925000Z",
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-476",
        "trust": 1.1
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 1.1,
        "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-openssl-2021-ghy28djd"
      },
      {
        "trust": 1.1,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-389290.pdf"
      },
      {
        "trust": 1.1,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-772220.pdf"
      },
      {
        "trust": 1.1,
        "url": "https://kb.pulsesecure.net/articles/pulse_security_advisories/sa44845"
      },
      {
        "trust": 1.1,
        "url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2021-0013"
      },
      {
        "trust": 1.1,
        "url": "https://security.netapp.com/advisory/ntap-20210326-0006/"
      },
      {
        "trust": 1.1,
        "url": "https://security.netapp.com/advisory/ntap-20210513-0002/"
      },
      {
        "trust": 1.1,
        "url": "https://www.openssl.org/news/secadv/20210325.txt"
      },
      {
        "trust": 1.1,
        "url": "https://www.tenable.com/security/tns-2021-05"
      },
      {
        "trust": 1.1,
        "url": "https://www.tenable.com/security/tns-2021-06"
      },
      {
        "trust": 1.1,
        "url": "https://www.tenable.com/security/tns-2021-09"
      },
      {
        "trust": 1.1,
        "url": "https://www.tenable.com/security/tns-2021-10"
      },
      {
        "trust": 1.1,
        "url": "https://www.debian.org/security/2021/dsa-4875"
      },
      {
        "trust": 1.1,
        "url": "https://security.gentoo.org/glsa/202103-03"
      },
      {
        "trust": 1.1,
        "url": "https://security.freebsd.org/advisories/freebsd-sa-21:07.openssl.asc"
      },
      {
        "trust": 1.1,
        "url": "https://www.oracle.com//security-alerts/cpujul2021.html"
      },
      {
        "trust": 1.1,
        "url": "https://www.oracle.com/security-alerts/cpuapr2021.html"
      },
      {
        "trust": 1.1,
        "url": "https://www.oracle.com/security-alerts/cpuapr2022.html"
      },
      {
        "trust": 1.1,
        "url": "https://www.oracle.com/security-alerts/cpujul2022.html"
      },
      {
        "trust": 1.1,
        "url": "https://www.oracle.com/security-alerts/cpuoct2021.html"
      },
      {
        "trust": 1.1,
        "url": "https://lists.debian.org/debian-lts-announce/2021/08/msg00029.html"
      },
      {
        "trust": 1.1,
        "url": "http://www.openwall.com/lists/oss-security/2021/03/27/1"
      },
      {
        "trust": 1.1,
        "url": "http://www.openwall.com/lists/oss-security/2021/03/27/2"
      },
      {
        "trust": 1.1,
        "url": "http://www.openwall.com/lists/oss-security/2021/03/28/3"
      },
      {
        "trust": 1.1,
        "url": "http://www.openwall.com/lists/oss-security/2021/03/28/4"
      },
      {
        "trust": 1.0,
        "url": "https://git.openssl.org/gitweb/?p=openssl.git%3ba=commitdiff%3bh=fb9fa6b51defd48157eeb207f52181f735d96148"
      },
      {
        "trust": 1.0,
        "url": "https://kc.mcafee.com/corporate/index?page=content\u0026id=sb10356"
      },
      {
        "trust": 1.0,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/ccbfllvqvilivgzmbjl3ixzgkwqisynp/"
      },
      {
        "trust": 1.0,
        "url": "https://security.netapp.com/advisory/ntap-20240621-0006/"
      },
      {
        "trust": 0.8,
        "url": "https://listman.redhat.com/mailman/listinfo/rhsa-announce"
      },
      {
        "trust": 0.8,
        "url": "https://access.redhat.com/security/team/contact/"
      },
      {
        "trust": 0.8,
        "url": "https://access.redhat.com/security/cve/cve-2021-3449"
      },
      {
        "trust": 0.8,
        "url": "https://bugzilla.redhat.com/):"
      },
      {
        "trust": 0.7,
        "url": "https://access.redhat.com/security/cve/cve-2021-3450"
      },
      {
        "trust": 0.6,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3449"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3450"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/cve/cve-2021-20305"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-20305"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/updates/classification/#moderate"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2019-25013"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-29362"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-29361"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2019-2708"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-8286"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8284"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-28196"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-15358"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-15358"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-8927"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-13434"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2017-14502"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-29362"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8285"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-8285"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14502"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8286"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-29363"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2019-9169"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2016-10228"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27618"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8927"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2019-3842"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-13434"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2019-2708"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-13776"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2016-10228"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-29363"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-24977"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2019-3842"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-13776"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2019-25013"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-8231"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2019-9169"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2021-3326"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8231"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2021-27219"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-8284"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-24977"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-29361"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-27618"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28196"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28362"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2020-28362"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/updates/classification/#important"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27219"
      },
      {
        "trust": 0.2,
        "url": "https://issues.jboss.org/):"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-26116"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-23336"
      },
      {
        "trust": 0.2,
        "url": "https://docs.openshift.com/container-platform/4.7/jaeger/jaeger_install/rhb"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-3114"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2020-26116"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2020-27619"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23336"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-3177"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27619"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27363"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/documentation/en-us/red_hat_advanced_cluster_mana"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-3347"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2020-28374"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-27364"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-26708"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27365"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-0466"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2020-27152"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-27363"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27152"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3347"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-27365"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2020-0466"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27364"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28374"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-26708"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/team/key/"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/articles/11258"
      },
      {
        "trust": 0.1,
        "url": "https://git.openssl.org/gitweb/?p=openssl.git;a=commitdiff;h=fb9fa6b51defd48157eeb207f52181f735d96148"
      },
      {
        "trust": 0.1,
        "url": "https://kc.mcafee.com/corporate/index?page=content\u0026amp;id=sb10356"
      },
      {
        "trust": 0.1,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/ccbfllvqvilivgzmbjl3ixzgkwqisynp/"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-25736"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:2130"
      },
      {
        "trust": 0.1,
        "url": "https://docs.openshift.com/container-platform/4.7/windows_containers/window"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3326"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-25736"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:2532"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3114"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-28500"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-28500"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-13949"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:2543"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-13949"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-23337"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36189"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-19360"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36188"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2019-14379"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14720"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-14718"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-20190"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14718"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36179"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-19361"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36185"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35490"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-14719"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14719"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36180"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-14720"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-35491"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-35490"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-35728"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36180"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36181"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35491"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36182"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36183"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36186"
      },
      {
        "trust": 0.1,
        "url": "https://docs.openshift.com/container-platform/4.6/updating/updating-cluster"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-19360"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-24750"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36187"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-19362"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36183"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-19362"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36188"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-14721"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36179"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36182"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36185"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14721"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-24750"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36186"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36187"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36189"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:1230"
      },
      {
        "trust": 0.1,
        "url": "https://docs.openshift.com/container-platform/4.6/release_notes/ocp-4-6-rel"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36184"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36181"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36184"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-20190"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhba-2021:1232"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2018-19361"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35728"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2019-14379"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-23358"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-15586"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23358"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-16845"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-16845"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-15586"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:1448"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-20218"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-20218"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3121"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:1369"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-3121"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-35149"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-35149"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-14040"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-14040"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:1199"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:1202"
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "db": "PACKETSTORM",
        "id": "163257"
      },
      {
        "db": "PACKETSTORM",
        "id": "163267"
      },
      {
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "db": "PACKETSTORM",
        "id": "162383"
      },
      {
        "db": "PACKETSTORM",
        "id": "162337"
      },
      {
        "db": "PACKETSTORM",
        "id": "162196"
      },
      {
        "db": "PACKETSTORM",
        "id": "162201"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "db": "PACKETSTORM",
        "id": "163257"
      },
      {
        "db": "PACKETSTORM",
        "id": "163267"
      },
      {
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "db": "PACKETSTORM",
        "id": "162383"
      },
      {
        "db": "PACKETSTORM",
        "id": "162337"
      },
      {
        "db": "PACKETSTORM",
        "id": "162196"
      },
      {
        "db": "PACKETSTORM",
        "id": "162201"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-03-25T00:00:00",
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "date": "2021-06-23T15:44:15",
        "db": "PACKETSTORM",
        "id": "163257"
      },
      {
        "date": "2021-06-23T16:08:25",
        "db": "PACKETSTORM",
        "id": "163267"
      },
      {
        "date": "2021-06-24T17:54:53",
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "date": "2021-04-27T15:37:46",
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "date": "2021-04-29T14:37:49",
        "db": "PACKETSTORM",
        "id": "162383"
      },
      {
        "date": "2021-04-26T19:21:56",
        "db": "PACKETSTORM",
        "id": "162337"
      },
      {
        "date": "2021-04-15T13:49:54",
        "db": "PACKETSTORM",
        "id": "162196"
      },
      {
        "date": "2021-04-15T13:50:39",
        "db": "PACKETSTORM",
        "id": "162201"
      },
      {
        "date": "2021-03-25T15:15:13.450000",
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-29T00:00:00",
        "db": "VULHUB",
        "id": "VHN-388130"
      },
      {
        "date": "2024-06-21T19:15:19.710000",
        "db": "NVD",
        "id": "CVE-2021-3449"
      }
    ]
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Red Hat Security Advisory 2021-2130-01",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "163257"
      }
    ],
    "trust": 0.1
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "code execution",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "163276"
      },
      {
        "db": "PACKETSTORM",
        "id": "162350"
      },
      {
        "db": "PACKETSTORM",
        "id": "162383"
      }
    ],
    "trust": 0.3
  }
}

var-201710-1267
Vulnerability from variot

In dnsmasq before 2.78, if the DNS packet size does not match the expected size, the size parameter in a memset call gets a negative value. As it is an unsigned value, memset ends up writing up to 0xffffffff zero's (0xffffffffffffffff in 64 bit platforms), making dnsmasq crash. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Contains an input validation vulnerability.Service operation interruption (DoS) There is a possibility of being put into a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities: 1. A buffer-overflow vulnerability 2. Multiple denial-of-service vulnerabilities Attackers can exploit these issues to execute arbitrary code within the context of affected device or cause a denial-of-service condition. This BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201710-1267",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "fedora",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "fedoraproject",
        "version": "27"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "novell",
        "version": "42.2"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "17.04"
      },
      {
        "model": "dnsmasq",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "14.04"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.1"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "novell",
        "version": "42.3"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "16.04"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.9,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "ruckus",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "technicolor",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "zyxel",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "dnsmasq",
        "version": null
      },
      {
        "model": "ubuntu",
        "scope": null,
        "trust": 0.8,
        "vendor": "canonical",
        "version": null
      },
      {
        "model": "gnu/linux",
        "scope": null,
        "trust": 0.8,
        "vendor": "debian",
        "version": null
      },
      {
        "model": "fedora",
        "scope": null,
        "trust": 0.8,
        "vendor": "fedora",
        "version": null
      },
      {
        "model": "dnsmasq",
        "scope": "lt",
        "trust": 0.8,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "enterprise linux desktop",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux server",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux workstation",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "redhat",
        "version": "-47.4"
      },
      {
        "model": "scalance w1750d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "17.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "16.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "14.04"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.75"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.72"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.71"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.70"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.65"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.64"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.63"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.62"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.61"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.60"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.59"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.58"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.57"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.56"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.55"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.54"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.53"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.52"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.51"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.50"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.49"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.48"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.47"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.46"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.45"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.44"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.43"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.42"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.41"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.40"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.38"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.37"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.36"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.35"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.34"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.33"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.30"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.29"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.28"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.27"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.26"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.25"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.24"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.23"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.22"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.21"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.20"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.19"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.9"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.8"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.3"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.996"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.992"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.98"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.96"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.95"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.4"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.2"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.37"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.0"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server for arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.2"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update suppor",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.2"
      },
      {
        "model": "enterprise linux server year extended upd",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.3"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5"
      },
      {
        "model": "enterprise linux long life server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5.9"
      },
      {
        "model": "enterprise linux hpc node optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux hpc node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux for scientific computing",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update supp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power little endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power big endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux desktop optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "6"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "opensuse",
        "version": "42.3"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "opensuse",
        "version": "42.2"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.10"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "6.0.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "5.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "5.0.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "4.4.4"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "8.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "6.0"
      },
      {
        "model": "linux sparc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux s/390",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux powerpc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux mips",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-32",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-30",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux amd64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "7"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "6"
      },
      {
        "model": "dnsmasq",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.8"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.7"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.11"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.8"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:canonical:ubuntu",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:debian:debian_linux",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:fedoraproject:fedora",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/a:thekelleys:dnsmasq",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_desktop",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_server",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_workstation",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Gabriel Campana, Kevin Hamacher and Ron Bowes of the Google Security Team,Felix Wilhelm, Fermin J. Serna",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2017-13704",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 5.0,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2017-13704",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.9,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2017-13704",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.8,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2017-13704",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2017-13704",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201708-1115",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "VULMON",
            "id": "CVE-2017-13704",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "In dnsmasq before 2.78, if the DNS packet size does not match the expected size, the size parameter in a memset call gets a negative value. As it is an unsigned value, memset ends up writing up to 0xffffffff zero\u0027s (0xffffffffffffffff in 64 bit platforms), making dnsmasq crash. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Contains an input validation vulnerability.Service operation interruption (DoS) There is a possibility of being put into a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities:\n1. A buffer-overflow vulnerability\n2. Multiple denial-of-service vulnerabilities\nAttackers can exploit these issues to execute arbitrary code within the  context of affected device or cause a denial-of-service condition. \nThis BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      },
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-13704"
      }
    ],
    "trust": 2.97
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2017-13704",
        "trust": 3.1
      },
      {
        "db": "CERT/CC",
        "id": "VU#973527",
        "trust": 2.5
      },
      {
        "db": "BID",
        "id": "101085",
        "trust": 2.0
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-17-332-01",
        "trust": 2.0
      },
      {
        "db": "BID",
        "id": "101977",
        "trust": 1.4
      },
      {
        "db": "SECTRACK",
        "id": "1039474",
        "trust": 1.1
      },
      {
        "db": "SIEMENS",
        "id": "SSA-689071",
        "trust": 1.1
      },
      {
        "db": "JVN",
        "id": "JVNVU93453933",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-13704",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "id": "VAR-201710-1267",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.25396827
  },
  "last_update_date": "2024-08-14T13:16:16.970000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "FEDORA-2017-274d763ed8",
        "trust": 0.8,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/4TK6DWC53WSU6633EVZL7H4PCWBYHMHK/"
      },
      {
        "title": "CHANGELOG",
        "trust": 0.8,
        "url": "http://thekelleys.org.uk/dnsmasq/CHANGELOG"
      },
      {
        "title": "Fix CVE-2017-13704, which resulted in a crash on a large DNS query.",
        "trust": 0.8,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git;a=commit;h=63437ffbb58837b214b4b92cb1c54bc5f3279928"
      },
      {
        "title": "USN-3430-2",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-2/"
      },
      {
        "title": "USN-3430-1",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-1/"
      },
      {
        "title": "dnsmasq: Multiple Critical and Important vulnerabilities",
        "trust": 0.8,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "title": "Dnsmasq Enter the fix for the verification vulnerability",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=92838"
      },
      {
        "title": "Debian CVElist Bug Report Logs: dnsmasq: CVE-2017-13704: Size parameter overflow via large DNS query",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_cvelist_bugreportlogs\u0026qid=fa8aad66cae5df51d49e1cdce2fe4a42"
      },
      {
        "title": "Red Hat: CVE-2017-13704",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2017-13704"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=7f490a104360d6f65bee18ec7bfa18a3"
      },
      {
        "title": "Brocade Security Advisories: BSA-2017-455",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=brocade_security_advisories\u0026qid=f173c512f0a725c451f45840ccf64e99"
      },
      {
        "title": "Oracle Solaris Third Party Bulletins: Oracle Solaris Third Party Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_solaris_third_party_bulletins\u0026qid=6283337cd31f81f24d445925f2138c0e"
      },
      {
        "title": "Threatpost",
        "trust": 0.1,
        "url": "https://threatpost.com/google-warns-of-dos-and-rce-bugs-in-dnsmasq/128238/"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-20",
        "trust": 1.8
      },
      {
        "problemtype": "CWE-191",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.8,
        "url": "https://security.googleblog.com/2017/10/behind-masq-yet-more-dns-and-dhcp.html"
      },
      {
        "trust": 2.3,
        "url": "http://www.securityfocus.com/bid/101085"
      },
      {
        "trust": 2.0,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-17-332-01"
      },
      {
        "trust": 1.7,
        "url": "http://www.thekelleys.org.uk/dnsmasq/doc.html"
      },
      {
        "trust": 1.7,
        "url": "https://www.kb.cert.org/vuls/id/973527"
      },
      {
        "trust": 1.2,
        "url": "http://www.securityfocus.com/bid/101977"
      },
      {
        "trust": 1.1,
        "url": "http://thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 1.1,
        "url": "http://www.securitytracker.com/id/1039474"
      },
      {
        "trust": 1.1,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "trust": 1.1,
        "url": "https://www.synology.com/support/security/synology_sa_17_59_dnsmasq"
      },
      {
        "trust": 1.1,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-689071.pdf"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-13704"
      },
      {
        "trust": 1.0,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git%3ba=commit%3bh=63437ffbb58837b214b4b92cb1c54bc5f3279928"
      },
      {
        "trust": 1.0,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/4tk6dwc53wsu6633evzl7h4pcwbyhmhk/"
      },
      {
        "trust": 1.0,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 1.0,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 0.9,
        "url": "http://www.thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14491.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14492.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14493.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14494.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14495.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/kubernetes/kubernetes/blob/master/changelog.md"
      },
      {
        "trust": 0.9,
        "url": "http://www.slackware.com/security/viewer.php?l=slackware-security\u0026y=2017\u0026m=slackware-security.601472"
      },
      {
        "trust": 0.9,
        "url": "https://source.android.com/security/bulletin/2017-10-01"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495410"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495411"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495412"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495415"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495416"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495510"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-14491"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-14492"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-14493"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-14494"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-14495"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-14496"
      },
      {
        "trust": 0.9,
        "url": "https://www.debian.org/security/2017/dsa-3989"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14496.py"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/errata/rhsa-2017:2836"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/errata/rhsa-2017:2837"
      },
      {
        "trust": 0.8,
        "url": "https://www.ruckuswireless.com/security"
      },
      {
        "trust": 0.8,
        "url": "https://www.zyxel.com/support/announcement_dnsmasq_vulnerabilities.shtml"
      },
      {
        "trust": 0.8,
        "url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-13704"
      },
      {
        "trust": 0.8,
        "url": "http://jvn.jp/vu/jvnvu93453933/index.html"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-13704"
      },
      {
        "trust": 0.6,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409bug1495409"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-17-332-01"
      },
      {
        "trust": 0.3,
        "url": "http://subscriber.communications.siemens.com/"
      },
      {
        "trust": 0.3,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409 bug 1495409"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/20.html"
      },
      {
        "trust": 0.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss@lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 0.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss@lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 0.1,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/4tk6dwc53wsu6633evzl7h4pcwbyhmhk/"
      },
      {
        "trust": 0.1,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git;a=commit;h=63437ffbb58837b214b4b92cb1c54bc5f3279928"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://bugs.debian.org/cgi-bin/bugreport.cgi?bug=877102"
      },
      {
        "trust": 0.1,
        "url": "https://threatpost.com/google-warns-of-dos-and-rce-bugs-in-dnsmasq/128238/"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-10-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2017-10-03T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "date": "2017-11-28T00:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-10-24T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "date": "2017-08-28T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "date": "2017-10-03T01:29:01.637000",
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2018-02-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2018-05-11T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-13704"
      },
      {
        "date": "2019-05-15T17:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-11-29T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008617"
      },
      {
        "date": "2020-10-14T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      },
      {
        "date": "2023-11-07T02:38:41.510000",
        "db": "NVD",
        "id": "CVE-2017-13704"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "network",
    "sources": [
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Dnsmasq contains multiple vulnerabilities",
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Input Validation Error",
    "sources": [
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201708-1115"
      }
    ],
    "trust": 0.9
  }
}

var-202312-0199
Vulnerability from variot

A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2) (All versions < V8.0), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2) (All versions < V8.0), SCALANCE M804PB (6GK5804-0AP00-2AA2) (All versions < V8.0), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) (All versions < V8.0), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) (All versions < V8.0), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) (All versions < V8.0), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) (All versions < V8.0), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) (All versions < V8.0), SCALANCE M874-2 (6GK5874-2AA00-2AA2) (All versions < V8.0), SCALANCE M874-3 (6GK5874-3AA00-2AA2) (All versions < V8.0), SCALANCE M876-3 (6GK5876-3AA02-2BA2) (All versions < V8.0), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) (All versions < V8.0), SCALANCE M876-4 (6GK5876-4AA10-2BA2) (All versions < V8.0), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) (All versions < V8.0), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) (All versions < V8.0), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) (All versions < V8.0), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) (All versions < V8.0), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) (All versions < V8.0), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) (All versions < V8.0), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) (All versions < V8.0). An Improper Neutralization of Special Elements used in an OS Command with root privileges vulnerability exists in the handling of the DDNS configuration. This could allow malicious local administrators to issue commands on system level after a successful IP address update. 6gk6108-4am00-2ba2 firmware, 6gk6108-4am00-2da2 firmware, 6gk5804-0ap00-2aa2 Several Siemens products, such as firmware, OS A command injection vulnerability exists.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. SCALANCE M-800, MUM-800 and S615 as well as RUGGEDCOM RM1224 are industrial routers.

Siemens SCALANCE M-800/S615 series has an operating system command injection vulnerability that allows an attacker to execute commands on the system

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202312-0199",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m876-4",
        "scope": "lt",
        "trust": 1.8,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m876-3",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance mum856-1",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "6gk5876-3aa02-2ea2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk6108-4am00-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5856-2ea00-3da1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5816-1ba00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5812-1ba00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5816-1aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5615-0aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5856-2ea00-3aa1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5876-4aa10-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5876-3aa02-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5615-0aa01-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5826-2ab00-2ab2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5874-3aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5876-4aa00-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5874-2aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5853-2ea00-2da1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5812-1aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5804-0ap00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5876-4aa00-2da2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk6108-4am00-2da2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "8.0"
      },
      {
        "model": "6gk5853-2ea00-2da1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5812-1aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5856-2ea00-3aa1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5874-3aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5615-0aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5816-1ba00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-3aa02-2ea2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5615-0aa01-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5874-2aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-4aa00-2da2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-4aa10-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-3aa02-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5816-1aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk6108-4am00-2da2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5804-0ap00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk6108-4am00-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5812-1ba00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5826-2ab00-2ab2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5856-2ea00-3da1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-4aa00-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte eu",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "ruggedcom rm1224 lte nam",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m804pb",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m874-2",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m874-3",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance mum853-1",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance s615 eec",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "cve": "CVE-2023-49691",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "MULTIPLE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 8.3,
            "confidentialityImpact": "COMPLETE",
            "exploitabilityScore": 6.4,
            "id": "CNVD-2023-97258",
            "impactScore": 10.0,
            "integrityImpact": "COMPLETE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:M/C:C/I:C/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "LOCAL",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 6.7,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 0.8,
            "id": "CVE-2023-49691",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "HIGH",
            "baseScore": 7.2,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 1.2,
            "id": "CVE-2023-49691",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Local",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 6.7,
            "baseSeverity": "Medium",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "CVE-2023-49691",
            "impactScore": null,
            "integrityImpact": "High",
            "privilegesRequired": "High",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:L/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2023-49691",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2023-49691",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2023-49691",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2023-97258",
            "trust": 0.6,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2) (All versions \u003c V8.0), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2) (All versions \u003c V8.0), SCALANCE M804PB (6GK5804-0AP00-2AA2) (All versions \u003c V8.0), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) (All versions \u003c V8.0), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) (All versions \u003c V8.0), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) (All versions \u003c V8.0), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) (All versions \u003c V8.0), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) (All versions \u003c V8.0), SCALANCE M874-2 (6GK5874-2AA00-2AA2) (All versions \u003c V8.0), SCALANCE M874-3 (6GK5874-3AA00-2AA2) (All versions \u003c V8.0), SCALANCE M876-3 (6GK5876-3AA02-2BA2) (All versions \u003c V8.0), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) (All versions \u003c V8.0), SCALANCE M876-4 (6GK5876-4AA10-2BA2) (All versions \u003c V8.0), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) (All versions \u003c V8.0), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) (All versions \u003c V8.0), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) (All versions \u003c V8.0), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) (All versions \u003c V8.0), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) (All versions \u003c V8.0), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) (All versions \u003c V8.0), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) (All versions \u003c V8.0). An Improper Neutralization of Special Elements used in an OS Command with root privileges vulnerability exists in the handling of the DDNS configuration. This could allow malicious local administrators to issue commands on system level after a successful IP address update. 6gk6108-4am00-2ba2 firmware, 6gk6108-4am00-2da2 firmware, 6gk5804-0ap00-2aa2 Several Siemens products, such as firmware, OS A command injection vulnerability exists.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. SCALANCE M-800, MUM-800 and S615 as well as RUGGEDCOM RM1224 are industrial routers. \n\r\n\r\nSiemens SCALANCE M-800/S615 series has an operating system command injection vulnerability that allows an attacker to execute commands on the system",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      }
    ],
    "trust": 2.16
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2023-49691",
        "trust": 3.2
      },
      {
        "db": "SIEMENS",
        "id": "SSA-180704",
        "trust": 2.4
      },
      {
        "db": "SIEMENS",
        "id": "SSA-602936",
        "trust": 1.0
      },
      {
        "db": "SIEMENS",
        "id": "SSA-690517",
        "trust": 1.0
      },
      {
        "db": "JVN",
        "id": "JVNVU91198149",
        "trust": 0.8
      },
      {
        "db": "JVN",
        "id": "JVNVU93250330",
        "trust": 0.8
      },
      {
        "db": "JVN",
        "id": "JVNVU98271228",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-24-165-12",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-24-046-09",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-23-348-14",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "id": "VAR-202312-0199",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      }
    ],
    "trust": 1.5
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      }
    ]
  },
  "last_update_date": "2024-08-14T12:46:32.774000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Patch for Siemens SCALANCE M-800/S615 series operating system command injection vulnerability",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/500366"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-78",
        "trust": 1.0
      },
      {
        "problemtype": "OS Command injection (CWE-78) [ others ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 1.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-180704.pdf"
      },
      {
        "trust": 1.6,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-180704.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-602936.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-690517.html"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu98271228/"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu91198149/index.html"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu93250330/index.html"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2023-49691"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-23-348-14"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-24-046-09"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-24-165-12"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-12-14T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "date": "2024-01-15T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "date": "2023-12-12T12:15:15.990000",
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-12-13T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2023-97258"
      },
      {
        "date": "2024-06-17T05:39:00",
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      },
      {
        "date": "2024-08-13T08:15:09.340000",
        "db": "NVD",
        "id": "CVE-2023-49691"
      }
    ]
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "in multiple Siemens products \u00a0OS\u00a0 Command injection vulnerability",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019858"
      }
    ],
    "trust": 0.8
  }
}

var-201705-3221
Vulnerability from variot

Specially crafted PROFINET DCP packets sent on a local Ethernet segment (Layer 2) to an affected product could cause a denial of service condition of that product. Human interaction is required to recover the system. PROFIBUS interfaces are not affected. SIMATIC HMI is an industrial device from Siemens AG, Germany. The SIMATIC HMI panels are used for operator control and monitoring of machines and equipment. Multiple Siemens Products is prone to multiple denial-of-service vulnerabilities. Attackers can exploit these issues to cause a denial-of-service condition. Manual restart of the server is required to resume normal operation. A vulnerability has been identified in SIMATIC CP 343-1 Std (All versions), SIMATIC CP 343-1 Lean (All versions), SIMATIC CP 343-1 Adv (All versions), SIMATIC CP 443-1 Std (All versions < V3.2.17), SIMATIC CP 443-1 Adv (All versions < V3.2.17), SIMATIC CP 443-1 OPC-UA (All versions), SIMATIC CP 1243-1 (All versions < V2.1.82), SIMATIC CP 1243-1 IRC (All versions < V2.1.82), SIMATIC CP 1243-1 IEC (All versions), SIMATIC CP 1243-1 DNP3 (All versions), SIMATIC CM 1542-1 (All versions < V2.0), SIMATIC CM 1542SP-1 (All versions < V1.0.15), SIMATIC CP 1542SP-1 IRC (All versions < V1.0.15), SIMATIC CP 1543SP-1 (All versions < V1.0.15), SIMATIC CP 1543-1 (All versions < V2.1), SIMATIC RF650R (All versions < V3.0), SIMATIC RF680R (All versions < V3.0), SIMATIC RF685R (All versions < V3.0), SIMATIC CP 1616 (All versions < V2.7), SIMATIC CP 1604 (All versions < V2.7), SIMATIC DK-16xx PN IO (All versions < V2.7), SCALANCE X-200 (All versions < V5.2.2), SCALANCE X-200 IRT (All versions), SCALANCE X-300/X408 (All versions < V4.1.0), SCALANCE X414 (All versions < V3.10.2), SCALANCE XM400 (All versions < V6.1), SCALANCE XR500 (All versions < V6.1), SCALANCE W700 (All versions < V6.1), SCALANCE M-800, S615 (All versions < V4.03), Softnet PROFINET IO for PC-based Windows systems (All versions < V14 SP1), IE/PB-Link (All versions < V3.0), IE/AS-i Link PN IO (All versions), SIMATIC Teleservice Adapter Standard Modem, IE Basic, IE Advanced (All versions), SITOP PSU8600 PROFINET (All versions < V1.2.0), SITOP UPS1600 PROFINET (All versions < V2.2.0), SIMATIC ET 200AL (All versions < V1.0.2), SIMATIC ET 200ecoPN (All versions), SIMATIC ET 200M (All versions), SIMATIC ET 200MP IM155-5 PN BA (All versions < V4.0.1), SIMATIC ET 200MP IM155-5 PN ST (All versions < V4.1), SIMATIC ET 200MP (except IM155-5 PN BA and IM155-5 PN ST) (All versions), SIMATIC ET 200pro (All versions), SIMATIC ET 200S (All versions), SIMATIC ET 200SP IM155-6 PN ST (All versions < V4.1.0), SIMATIC ET 200SP (except IM155-6 PN ST) (All versions), SIMATIC PN/PN Coupler (All versions < V4.0), Development/Evaluation Kit DK Standard Ethernet Controller (All versions < V4.1.1 Patch04), Development/Evaluation Kit EK-ERTEC 200P (All versions < V4.4.0 Patch01), Development/Evaluation Kit EK-ERTEC 200 (All versions < V4.2.1 Patch03), SIMATIC S7-200 SMART (All versions < V2.3), SIMATIC S7-300 incl. F and T (All versions < V3.X.14), SIMATIC S7-400 PN/DP V6 Incl. F (All versions < V6.0.6), SIMATIC S7-400-H V6 (All versions < V6.0.7), SIMATIC S7-400 PN/DP V7 Incl. F (All versions < V7.0.2), SIMATIC S7-410 (All versions < V8.2), SIMATIC S7-1200 incl. F (All versions < V4.2.1), SIMATIC S7-1500 incl. F, T, and TF (All versions < V2.1), SIMATIC S7-1500 Software Controller incl. F (All versions < V2.1), SIMATIC WinAC RTX 2010 incl. F (All versions), SIRIUS ACT 3SU1 interface module PROFINET (All versions), SIRIUS Soft Starter 3RW44 PN (All versions), SIRIUS Motor Starter M200D PROFINET (All versions), SIMOCODE pro V PROFINET (All versions < V2.0.0), SINAMICS DCM w. PN (All versions < V1.4 SP1 HF5), SINAMICS DCP w. PN (All versions < V1.2 HF 1), SINAMICS G110M w. PN (All versions < V4.7 SP6 HF3), SINAMICS G120(C/P/D) w. PN (All versions < V4.7 SP6 HF3), SINAMICS G130 V4.7 w. PN (All versions < V4.7 HF27), SINAMICS G150 V4.7 w. PN (V4.7: All versions < V4.7 HF27), SINAMICS G130 V4.8 w. PN (All versions < V4.8 HF4), SINAMICS G150 V4.8 w. PN (All versions < V4.8 HF4), SINAMICS S110 w. PN (All versions < V4.4 SP3 HF5), SINAMICS S120 V4.7 w. PN (All versions < V4.7 HF27), and others. This vulnerability affects only SIMATIC HMI Multi Panels and HMI Mobile Panels, and S7-300/S7-400 devices. Siemens SIMATIC S7-300 F, etc. Siemens SIMATIC S7-300 F is a process controller. SIMATIC HMI Comfort Panels are touch screens

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201705-3221",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "sinumerik 840d sl",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "sinumerik 828d",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinumerik 828d",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic hmi comfort panels",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic hmi mobile panels",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics dcp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.2"
      },
      {
        "model": "simatic cp 343-1 lean",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1.3"
      },
      {
        "model": "sinamics g150",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics g130",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.03"
      },
      {
        "model": "simatic rf685r",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simotion",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic et 200mp",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.0.1"
      },
      {
        "model": "simatic cp 1543sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "sitop psu8600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.2.0"
      },
      {
        "model": "softnet profinet io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "14"
      },
      {
        "model": "simatic et 200m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic hmi comfort panels",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "15.1"
      },
      {
        "model": "ek-ertec 200 pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.1"
      },
      {
        "model": "simatic cm 1542sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "sinamics g120\\ pn",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic cp 1616",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "simatic cp 443-1 std",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2.17"
      },
      {
        "model": "ie\\/as-i link pn io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics dcm",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.4"
      },
      {
        "model": "simatic s7-300",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.3.17"
      },
      {
        "model": "simatic s7-200 smart",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "ups1600 profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.2.0"
      },
      {
        "model": "sinamics dcp",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.2"
      },
      {
        "model": "pn\\/pn coupler",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.0"
      },
      {
        "model": "simatic winac rtx",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2010"
      },
      {
        "model": "simatic cp 1543sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic cp 443-1 adv",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2.17"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.1"
      },
      {
        "model": "simatic cp 343-1 std",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1.3"
      },
      {
        "model": "scalance x408",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "sinamics g150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "ek-ertec 200p pn io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4.0"
      },
      {
        "model": "simatic cp 1243-1 iec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 343-1 adv",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "softnet profinet io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "14"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic hmi multi panels",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "15.1"
      },
      {
        "model": "simatic cm 1542-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "sinamics s120",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic teleservice adapter ie basic modem",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics v90 pn",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.01"
      },
      {
        "model": "simatic cp 443-1 opc-ua",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "simatic winac rtx",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2010"
      },
      {
        "model": "simatic s7-1500 software controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "simatic teleservice adapter standard modem",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic teleservice adapter ie advanced modem",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic hmi mobile panels",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "15.1"
      },
      {
        "model": "sinamics g110m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic et 200pro",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic s7-1200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.1"
      },
      {
        "model": "simatic tdc cpu555",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.1"
      },
      {
        "model": "scalance xr500",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "simatic cp 1604",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "sinamics s110 pn",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.1"
      },
      {
        "model": "simatic cp 1243-1 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "simatic cp 1542sp-1 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "simatic s7-400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0.6"
      },
      {
        "model": "sirius act 3su1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.0"
      },
      {
        "model": "sinamics s150",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance x200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.2"
      },
      {
        "model": "sinamics dcm",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.4"
      },
      {
        "model": "simatic et 200al",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.2"
      },
      {
        "model": "simatic rf650r",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "ek-ertec 200p pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4.0"
      },
      {
        "model": "simatic dk-16xx pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "sinamics s120",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinumerik 828d",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance x300",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "ie\\/pb-link",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "sinamics s110 pn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.03"
      },
      {
        "model": "simatic et 200sp",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.0"
      },
      {
        "model": "sinumerik 828d",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "scalance x200 irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.4.0"
      },
      {
        "model": "sirius motor starter m200d profinet",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic et 200ecopn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics g130",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance x414",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.10.2"
      },
      {
        "model": "simatic tdc cp51m1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.8"
      },
      {
        "model": "sinamics g110m",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic s7-1500",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "ek-ertec 200 pn io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.1"
      },
      {
        "model": "simatic rf680r",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simotion",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "sirius soft starter 3rw44 pn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics s150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic cp 1243-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "simatic cp 1243-1 dnp3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "simatic cp 1543-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "simatic et 200s",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simocode pro v profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0.0"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ek-ertec 200 pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ek-ertec 200p pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ie/as-i link pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ie/pb-link",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "pn/pn coupler",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w700",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x200 irt",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x200",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x300",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x408",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x414",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm400",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr500",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cm 1542-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1243-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1542sp-1 irc",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1542sp-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1543-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1543sp-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1604",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1616",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 adv",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 lean",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 std",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 adv",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 opc-ua",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 std",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic dk-16xx pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200al",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200ecopn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200m",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200mp",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200pro",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200s",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200sp",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic hmi multi panels",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf650r",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf680r",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf685r",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-1200",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-1500 software controller",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-1500",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-200 smart",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-300",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-400",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic teleservice adapter ie advanced",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic teleservice adapter ie basic",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic teleservice adapter standard modem",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic winac rtx 2010",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simocode pro v profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simotion",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics dcm",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics dcp",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g110m",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g120 w. pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g130",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g150",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s110 w. pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s120",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s150",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics v90 w. pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinumerik 828d",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinumerik 840d sl",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sirius act 3su1 interface module profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sirius motor starter m200d profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sirius soft starter 3rw44 pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sitop psu8600",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sitop ups1600 profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "softnet profinet io",
        "scope": "eq",
        "trust": 0.8,
        "vendor": "siemens",
        "version": "for pc-based windows systems firmware"
      },
      {
        "model": "simatic hmi multi panels",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g150",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic hmi mobile panels",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s120",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic hmi comfort panels",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s110 w. pn",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "sinumerik 828d",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "sinumerik 840d sl",
        "version": "*"
      },
      {
        "model": "ups1600 profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "softnet profinet io",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sitop psu8600",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sirius soft starter 3rw44 pn",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sirius act 3su1",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinumerik 840d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinumerik 828d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinamics sm150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sm120",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7.5"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7.4"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics gm150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics gl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics gh150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simotion",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic winac rtx",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "20100"
      },
      {
        "model": "simatic teleservice adapter standard modem",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-400",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-300",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-200 smart",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-1500",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic rf685r",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic rf680r",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic rf650r",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic et",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "2000"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "443-10"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "343-10"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16260"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16160"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16040"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1543-12.0.28"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1543-10"
      },
      {
        "model": "simatic cp 1542sp-1",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic cp irc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-80"
      },
      {
        "model": "simatic cp lte eu/us",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-70"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-10"
      },
      {
        "model": "simatic cp gprs",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1242-7v20"
      },
      {
        "model": "scalance xr500",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance xm400",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x4140"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x4084.0"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x4083.0"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x3000"
      },
      {
        "model": "scalance irt",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x2000"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x2000"
      },
      {
        "model": "scalance w700 series",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.4"
      },
      {
        "model": "scalance w700 series",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.5.4"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.02"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "ie/as-i link pn io",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "22?0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "19?0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "15?0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "12?0"
      },
      {
        "model": "e/pb-link",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinumerik 828d",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sm120 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics sl150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics gm150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics gl150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics gh150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic rf685r",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic rf680r",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic cp",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16162.7"
      },
      {
        "model": "simatic cp 1604d",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "simatic cp irc",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-82.1.82"
      },
      {
        "model": "simatic cp lte eu/us",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-72.1.82"
      },
      {
        "model": "simatic cp gprs",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1242-7v22.1.82"
      },
      {
        "model": "simatic rf650r",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic cp",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "443-13.2.17"
      },
      {
        "model": "simatic cp",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "15431.2.1"
      },
      {
        "model": "simatic cm1542",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1.2"
      },
      {
        "model": "scalance w700",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "22?1.1.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "19?1.1.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "15?1.1.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "12?1.1.1"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 std",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1542sp 1 irc",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1543sp 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1543 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf650r",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf680r",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf685r",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1616",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1604",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic dk 16xx pn io",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x200",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 lean",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x200 irt",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x300",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x408",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x414",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xm400",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr500",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance w700",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance m 800",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance s615",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "softnet profinet io",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 adv",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ie pb link",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ie as i link pn io",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic teleservice adapter standard modem",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic teleservice adapter ie basic modem",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic teleservice adapter ie advanced modem",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sitop psu8600",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ups1600 profinet",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200al",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200ecopn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200m",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 std",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200mp",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200pro",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200s",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200sp",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "pn pn coupler",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "dk standard ethernet controller",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ek ertec 200p pn io",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ek ertec 200 pn io",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 200 smart",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 300",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 adv",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 400",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 1200",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 1500",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 1500 controller",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic winac rtx 2010",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sirius act 3su1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sirius soft starter 3rw44 pn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sirius motor starter m200d profinet",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simocode pro v profinet",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics dcm",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 opc ua",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics dcp",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g110m",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g120 c p d w pn",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g130",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g150",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics s110 w pn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics s120",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics s150",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics v90 w pn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simotion",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1243 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic hmi comfort panels",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic hmi multi panels",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic hmi mobile panels",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cm 1542 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1542sp 1",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:siemens:dk_standard_ethernet_controller_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ek-ertec_200_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ek-ertec_200p_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ie%2Fpb-link_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ie%2Fas-i_link_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:pn%2Fpn_coupler_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_m-800_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_s615_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_w700_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x200irt_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x200_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x300_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x408_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x414_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_xm400_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_xr500_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cm_1542-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1243-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1542sp-1_irc_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1542sp-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1543-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1543sp-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1604_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1616_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_343-1_lean_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_343-1_adv_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_343-1_std_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_adv_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_std_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_opc-ua_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_dk-16xx_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200al_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200ecopn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200m_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200mp_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200pro_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200s_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200sp_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_hmi_mobile_panels",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_hmi_multi_panels",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_rf650r_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_rf680r_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_rf685r_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-1200_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-1500_software_controller_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-1500_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-200_smart_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-300_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-400_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_teleservice_adapter_ie_advanced_modem_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_teleservice_adapter_ie_basic_modem_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_teleservice_adapter_standard_modem_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_winac_rtx_2010_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simocode_pro_v_profinet_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simotion_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_dcm_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_dcp_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g110m_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g120%28c%2Fp%2Fd%29_w._pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g130_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g150_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics__s110_w._pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_s120_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_s150_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_v90_w._pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinumerik_828d_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinumerik_840d_sl_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sirius_act_3su1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sirius_motor_starter_m200d_profinet_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sirius_soft_starter_3rw44_pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sitop_psu8600_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ups1600_profinet_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:softnet_profinet_io_firmware",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Duan JinTong, Ma ShaoShuai, and Cheng Lei from NSFOCUS Security Team.",
    "sources": [
      {
        "db": "BID",
        "id": "98369"
      }
    ],
    "trust": 0.3
  },
  "cve": "CVE-2017-2681",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "CVE-2017-2681",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.8,
            "vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "CNVD-2017-06153",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.6,
            "vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "IVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "33467505-7492-4ae1-b978-12f61201709a",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.2,
            "vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.9 [IVD]"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "VULHUB",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "VHN-110884",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.1,
            "vectorString": "AV:A/AC:L/AU:N/C:N/I:N/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "ADJACENT",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 6.5,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 2.8,
            "id": "CVE-2017-2681",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:A/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Adjacent Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 6.5,
            "baseSeverity": "Medium",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "CVE-2017-2681",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2017-2681",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2017-2681",
            "trust": 1.0,
            "value": "High"
          },
          {
            "author": "NVD",
            "id": "CVE-2017-2681",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2017-06153",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201705-639",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "IVD",
            "id": "33467505-7492-4ae1-b978-12f61201709a",
            "trust": 0.2,
            "value": "MEDIUM"
          },
          {
            "author": "VULHUB",
            "id": "VHN-110884",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Specially crafted PROFINET DCP packets sent on a local Ethernet segment (Layer 2) to an affected product could cause a denial of service condition of that product. Human interaction is required to recover the system. PROFIBUS interfaces are not affected. SIMATIC HMI is an industrial device from Siemens AG, Germany. The SIMATIC HMI panels are used for operator control and monitoring of machines and equipment. Multiple Siemens Products is prone to multiple denial-of-service vulnerabilities. \nAttackers can exploit these issues to cause a denial-of-service condition. Manual restart of the server is required to resume normal operation. A vulnerability has been identified in SIMATIC CP 343-1 Std (All versions), SIMATIC CP 343-1 Lean (All versions), SIMATIC CP 343-1 Adv (All versions), SIMATIC CP 443-1 Std (All versions \u003c V3.2.17), SIMATIC CP 443-1 Adv (All versions \u003c V3.2.17), SIMATIC CP 443-1 OPC-UA (All versions), SIMATIC CP 1243-1 (All versions \u003c V2.1.82), SIMATIC CP 1243-1 IRC (All versions \u003c V2.1.82), SIMATIC CP 1243-1 IEC (All versions), SIMATIC CP 1243-1 DNP3 (All versions), SIMATIC CM 1542-1 (All versions \u003c V2.0), SIMATIC CM 1542SP-1 (All versions \u003c V1.0.15), SIMATIC CP 1542SP-1 IRC (All versions \u003c V1.0.15), SIMATIC CP 1543SP-1 (All versions \u003c V1.0.15), SIMATIC CP 1543-1 (All versions \u003c V2.1), SIMATIC RF650R (All versions \u003c V3.0), SIMATIC RF680R (All versions \u003c V3.0), SIMATIC RF685R (All versions \u003c V3.0), SIMATIC CP 1616 (All versions \u003c V2.7), SIMATIC CP 1604 (All versions \u003c V2.7), SIMATIC DK-16xx PN IO (All versions \u003c V2.7), SCALANCE X-200 (All versions \u003c V5.2.2), SCALANCE X-200 IRT (All versions), SCALANCE X-300/X408 (All versions \u003c V4.1.0), SCALANCE X414 (All versions \u003c V3.10.2), SCALANCE XM400 (All versions \u003c V6.1), SCALANCE XR500 (All versions \u003c V6.1), SCALANCE W700 (All versions \u003c V6.1), SCALANCE M-800, S615 (All versions \u003c V4.03), Softnet PROFINET IO for PC-based Windows systems (All versions \u003c V14 SP1), IE/PB-Link (All versions \u003c V3.0), IE/AS-i Link PN IO (All versions), SIMATIC Teleservice Adapter Standard Modem, IE Basic, IE Advanced (All versions), SITOP PSU8600 PROFINET (All versions \u003c V1.2.0), SITOP UPS1600 PROFINET (All versions \u003c V2.2.0), SIMATIC ET 200AL (All versions \u003c V1.0.2), SIMATIC ET 200ecoPN (All versions), SIMATIC ET 200M (All versions), SIMATIC ET 200MP IM155-5 PN BA (All versions \u003c V4.0.1), SIMATIC ET 200MP IM155-5 PN ST (All versions \u003c V4.1), SIMATIC ET 200MP (except IM155-5 PN BA and IM155-5 PN ST) (All versions), SIMATIC ET 200pro (All versions), SIMATIC ET 200S (All versions), SIMATIC ET 200SP IM155-6 PN ST (All versions \u003c V4.1.0), SIMATIC ET 200SP (except IM155-6 PN ST) (All versions), SIMATIC PN/PN Coupler (All versions \u003c V4.0), Development/Evaluation Kit DK Standard Ethernet Controller (All versions \u003c V4.1.1 Patch04), Development/Evaluation Kit EK-ERTEC 200P (All versions \u003c V4.4.0 Patch01), Development/Evaluation Kit EK-ERTEC 200 (All versions \u003c V4.2.1 Patch03), SIMATIC S7-200 SMART (All versions \u003c V2.3), SIMATIC S7-300 incl. F and T (All versions \u003c V3.X.14), SIMATIC S7-400 PN/DP V6 Incl. F (All versions \u003c V6.0.6), SIMATIC S7-400-H V6 (All versions \u003c V6.0.7), SIMATIC S7-400 PN/DP V7 Incl. F (All versions \u003c V7.0.2), SIMATIC S7-410 (All versions \u003c V8.2), SIMATIC S7-1200 incl. F (All versions \u003c V4.2.1), SIMATIC S7-1500 incl. F, T, and TF (All versions \u003c V2.1), SIMATIC S7-1500 Software Controller incl. F (All versions \u003c V2.1), SIMATIC WinAC RTX 2010 incl. F (All versions), SIRIUS ACT 3SU1 interface module PROFINET (All versions), SIRIUS Soft Starter 3RW44 PN (All versions), SIRIUS Motor Starter M200D PROFINET (All versions), SIMOCODE pro V PROFINET (All versions \u003c V2.0.0), SINAMICS DCM w. PN (All versions \u003c V1.4 SP1 HF5), SINAMICS DCP w. PN (All versions \u003c V1.2 HF 1), SINAMICS G110M w. PN (All versions \u003c V4.7 SP6 HF3), SINAMICS G120(C/P/D) w. PN (All versions \u003c V4.7 SP6 HF3), SINAMICS G130 V4.7 w. PN (All versions \u003c V4.7 HF27), SINAMICS G150 V4.7 w. PN (V4.7: All versions \u003c V4.7 HF27), SINAMICS G130 V4.8 w. PN (All versions \u003c V4.8 HF4), SINAMICS G150 V4.8 w. PN (All versions \u003c V4.8 HF4), SINAMICS S110 w. PN (All versions \u003c V4.4 SP3 HF5), SINAMICS S120 V4.7 w. PN (All versions \u003c V4.7 HF27), and others. This vulnerability affects only SIMATIC HMI Multi Panels and HMI Mobile Panels, and S7-300/S7-400 devices. Siemens SIMATIC S7-300 F, etc. Siemens SIMATIC S7-300 F is a process controller. SIMATIC HMI Comfort Panels are touch screens",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      }
    ],
    "trust": 2.7
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2017-2681",
        "trust": 3.6
      },
      {
        "db": "SIEMENS",
        "id": "SSA-293562",
        "trust": 2.6
      },
      {
        "db": "BID",
        "id": "98369",
        "trust": 2.0
      },
      {
        "db": "SECTRACK",
        "id": "1038463",
        "trust": 1.7
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-17-129-02",
        "trust": 1.7
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-18-023-02",
        "trust": 0.3
      },
      {
        "db": "SIEMENS",
        "id": "SSA-284673",
        "trust": 0.3
      },
      {
        "db": "IVD",
        "id": "33467505-7492-4AE1-B978-12F61201709A",
        "trust": 0.2
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "id": "VAR-201705-3221",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      }
    ],
    "trust": 1.5072591204444445
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "ICS"
        ],
        "sub_category": null,
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      }
    ]
  },
  "last_update_date": "2024-09-10T22:44:00.340000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-293562",
        "trust": 0.8,
        "url": "https://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-293562.pdf"
      },
      {
        "title": "Patch for Siemens SIMATIC HMI Denial of Service Vulnerability",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/93365"
      },
      {
        "title": "Multiple Siemens Product security vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=70109"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-400",
        "trust": 1.0
      },
      {
        "problemtype": "CWE-20",
        "trust": 0.9
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.6,
        "url": "https://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-293562.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://www.securityfocus.com/bid/98369"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-293562.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://www.securitytracker.com/id/1038463"
      },
      {
        "trust": 1.1,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-17-129-02"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-293562.html"
      },
      {
        "trust": 0.8,
        "url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-2681"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-2681"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-17-129-02"
      },
      {
        "trust": 0.3,
        "url": "http://subscriber.communications.siemens.com/"
      },
      {
        "trust": 0.3,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-18-023-02"
      },
      {
        "trust": 0.3,
        "url": "https://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-284673.pdf"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-05-09T00:00:00",
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "date": "2017-05-09T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "date": "2017-05-11T00:00:00",
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "date": "2017-05-08T00:00:00",
        "db": "BID",
        "id": "98369"
      },
      {
        "date": "2017-06-16T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "date": "2017-05-12T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "date": "2017-05-11T10:29:00.180000",
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-05-09T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      },
      {
        "date": "2020-09-29T00:00:00",
        "db": "VULHUB",
        "id": "VHN-110884"
      },
      {
        "date": "2018-05-09T14:00:00",
        "db": "BID",
        "id": "98369"
      },
      {
        "date": "2017-09-11T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-004135"
      },
      {
        "date": "2022-03-10T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      },
      {
        "date": "2024-09-10T10:15:03.063000",
        "db": "NVD",
        "id": "CVE-2017-2681"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote or local",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens SIMATIC HMI Denial of service vulnerability",
    "sources": [
      {
        "db": "IVD",
        "id": "33467505-7492-4ae1-b978-12f61201709a"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06153"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "resource management error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-639"
      }
    ],
    "trust": 0.6
  }
}

var-201710-1433
Vulnerability from variot

Heap-based buffer overflow in dnsmasq before 2.78 allows remote attackers to cause a denial of service (crash) or execute arbitrary code via a crafted DNS response. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Exists in a buffer error vulnerability.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities: 1. A buffer-overflow vulnerability 2. This BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities. This issue only affected configurations using one of these options: enable-ra, ra-only, slaac, ra-names, ra-advrouter, or ra-stateless. (CVE-2017-14493)

  • An information leak was found in dnsmasq in the DHCPv6 relay code. (CVE-2017-14494)

  • A memory exhaustion flaw was found in dnsmasq in the EDNS0 code. This issue only affected configurations using one of the options: add-mac, add-cpe-id, or add-subnet. (CVE-2017-14495)

  • An integer underflow flaw leading to a buffer over-read was found in dnsmasq in the EDNS0 code. This issue only affected configurations using one of the options: add-mac, add-cpe-id, or add-subnet. =========================================================================== Ubuntu Security Notice USN-3430-3 January 04, 2018

dnsmasq regression

A security issue affects these releases of Ubuntu and its derivatives:

  • Ubuntu 12.04 ESM

Summary:

USN-3430-2 introduced regression in Dnsmasq.

Software Description: - dnsmasq: Small caching DNS proxy and DHCP/TFTP server

Details:

USN-3430-2 fixed several vulnerabilities. The update introduced a new regression that breaks DNS resolution. This update addresses the problem.

We apologize for the inconvenience.

Original advisory details:

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14491)

Felix Wilhelm, Fermin J. (CVE-2017-14492)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DHCPv6 requests. (CVE-2017-14493)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DHCPv6 packets. (CVE-2017-14494)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. A remote attacker could use this issue to cause Dnsmasq to consume memory, resulting in a denial of service. (CVE-2017-14495)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14496)

Update instructions:

The problem can be corrected by updating your system to the following package versions:

Ubuntu 12.04 ESM: dnsmasq=C2=A02.59-4ubuntu0.4 dnsmasq-base2.59-4ubuntu0.4 dnsmasq-utils2.59-4ubuntu0.4

After a standard system update you need to reboot your computer to make all the necessary changes. 7.3) - ppc64, ppc64le, s390x, x86_64

  1. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1

===================================================================== Red Hat Security Advisory

Synopsis: Critical: dnsmasq security update Advisory ID: RHSA-2017:2839-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2017:2839 Issue date: 2017-10-02 CVE Names: CVE-2017-14491 =====================================================================

  1. Summary:

An update for dnsmasq is now available for Red Hat Enterprise Linux 6.2 Advanced Update Support, Red Hat Enterprise Linux 6.4 Advanced Update Support, Red Hat Enterprise Linux 6.5 Advanced Update Support, Red Hat Enterprise Linux 6.5 Telco Extended Update Support, Red Hat Enterprise Linux 6.6 Advanced Update Support, Red Hat Enterprise Linux 6.6 Telco Extended Update Support, and Red Hat Enterprise Linux 6.7 Extended Update Support.

Red Hat Product Security has rated this update as having a security impact of Critical. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.

  1. Relevant releases/architectures:

Red Hat Enterprise Linux HPC Node EUS (v. 6.7) - x86_64 Red Hat Enterprise Linux HPC Node Optional EUS (v. 6.7) - x86_64 Red Hat Enterprise Linux Server AUS (v. 6.2) - x86_64 Red Hat Enterprise Linux Server AUS (v. 6.4) - x86_64 Red Hat Enterprise Linux Server AUS (v. 6.5) - x86_64 Red Hat Enterprise Linux Server AUS (v. 6.6) - x86_64 Red Hat Enterprise Linux Server EUS (v. 6.7) - i386, ppc64, s390x, x86_64 Red Hat Enterprise Linux Server Optional AUS (v. 6.4) - x86_64 Red Hat Enterprise Linux Server Optional AUS (v. 6.5) - x86_64 Red Hat Enterprise Linux Server Optional AUS (v. 6.6) - x86_64 Red Hat Enterprise Linux Server Optional EUS (v. 6.7) - i386, ppc64, s390x, x86_64 Red Hat Enterprise Linux Server Optional TUS (v. 6.5) - x86_64 Red Hat Enterprise Linux Server Optional TUS (v. 6.6) - x86_64 Red Hat Enterprise Linux Server TUS (v. 6.5) - x86_64 Red Hat Enterprise Linux Server TUS (v. 6.6) - x86_64

  1. Description:

The dnsmasq packages contain Dnsmasq, a lightweight DNS (Domain Name Server) forwarder and DHCP (Dynamic Host Configuration Protocol) server.

Security Fix(es):

  • A heap buffer overflow was found in dnsmasq in the code responsible for building DNS replies. (CVE-2017-14491)

Red Hat would like to thank Felix Wilhelm (Google Security Team), Fermin J. Serna (Google Security Team), Gabriel Campana (Google Security Team), Kevin Hamacher (Google Security Team), and Ron Bowes (Google Security Team) for reporting this issue.

  1. Solution:

For details on how to apply this update, which includes the changes described in this advisory, refer to:

https://access.redhat.com/articles/11258

  1. Bugs fixed (https://bugzilla.redhat.com/):

1495409 - CVE-2017-14491 dnsmasq: heap overflow in the code responsible for building DNS replies

  1. Package List:

Red Hat Enterprise Linux HPC Node EUS (v. 6.7):

Source: dnsmasq-2.48-16.el6_7.1.src.rpm

x86_64: dnsmasq-2.48-16.el6_7.1.x86_64.rpm dnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm

Red Hat Enterprise Linux HPC Node Optional EUS (v. 6.7):

x86_64: dnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm dnsmasq-utils-2.48-16.el6_7.1.x86_64.rpm

Red Hat Enterprise Linux Server AUS (v. 6.2):

Source: dnsmasq-2.48-5.el6_2.2.src.rpm

x86_64: dnsmasq-2.48-5.el6_2.2.x86_64.rpm dnsmasq-debuginfo-2.48-5.el6_2.2.x86_64.rpm

Red Hat Enterprise Linux Server AUS (v. 6.4):

Source: dnsmasq-2.48-13.el6_4.1.src.rpm

x86_64: dnsmasq-2.48-13.el6_4.1.x86_64.rpm dnsmasq-debuginfo-2.48-13.el6_4.1.x86_64.rpm

Red Hat Enterprise Linux Server AUS (v. 6.5):

Source: dnsmasq-2.48-13.el6_5.1.src.rpm

x86_64: dnsmasq-2.48-13.el6_5.1.x86_64.rpm dnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm

Red Hat Enterprise Linux Server TUS (v. 6.5):

Source: dnsmasq-2.48-13.el6_5.1.src.rpm

x86_64: dnsmasq-2.48-13.el6_5.1.x86_64.rpm dnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm

Red Hat Enterprise Linux Server AUS (v. 6.6):

Source: dnsmasq-2.48-14.el6_6.1.src.rpm

x86_64: dnsmasq-2.48-14.el6_6.1.x86_64.rpm dnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm

Red Hat Enterprise Linux Server TUS (v. 6.6):

Source: dnsmasq-2.48-14.el6_6.1.src.rpm

x86_64: dnsmasq-2.48-14.el6_6.1.x86_64.rpm dnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm

Red Hat Enterprise Linux Server EUS (v. 6.7):

Source: dnsmasq-2.48-16.el6_7.1.src.rpm

i386: dnsmasq-2.48-16.el6_7.1.i686.rpm dnsmasq-debuginfo-2.48-16.el6_7.1.i686.rpm

ppc64: dnsmasq-2.48-16.el6_7.1.ppc64.rpm dnsmasq-debuginfo-2.48-16.el6_7.1.ppc64.rpm

s390x: dnsmasq-2.48-16.el6_7.1.s390x.rpm dnsmasq-debuginfo-2.48-16.el6_7.1.s390x.rpm

x86_64: dnsmasq-2.48-16.el6_7.1.x86_64.rpm dnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm

Red Hat Enterprise Linux Server Optional AUS (v. 6.4):

Source: dnsmasq-2.48-13.el6_4.1.src.rpm

x86_64: dnsmasq-debuginfo-2.48-13.el6_4.1.x86_64.rpm dnsmasq-utils-2.48-13.el6_4.1.x86_64.rpm

Red Hat Enterprise Linux Server Optional AUS (v. 6.5):

Source: dnsmasq-2.48-13.el6_5.1.src.rpm

x86_64: dnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm dnsmasq-utils-2.48-13.el6_5.1.x86_64.rpm

Red Hat Enterprise Linux Server Optional TUS (v. 6.5):

Source: dnsmasq-2.48-13.el6_5.1.src.rpm

x86_64: dnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm dnsmasq-utils-2.48-13.el6_5.1.x86_64.rpm

Red Hat Enterprise Linux Server Optional AUS (v. 6.6):

x86_64: dnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm dnsmasq-utils-2.48-14.el6_6.1.x86_64.rpm

Red Hat Enterprise Linux Server Optional TUS (v. 6.6):

x86_64: dnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm dnsmasq-utils-2.48-14.el6_6.1.x86_64.rpm

Red Hat Enterprise Linux Server Optional EUS (v. 6.7):

i386: dnsmasq-debuginfo-2.48-16.el6_7.1.i686.rpm dnsmasq-utils-2.48-16.el6_7.1.i686.rpm

ppc64: dnsmasq-debuginfo-2.48-16.el6_7.1.ppc64.rpm dnsmasq-utils-2.48-16.el6_7.1.ppc64.rpm

s390x: dnsmasq-debuginfo-2.48-16.el6_7.1.s390x.rpm dnsmasq-utils-2.48-16.el6_7.1.s390x.rpm

x86_64: dnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm dnsmasq-utils-2.48-16.el6_7.1.x86_64.rpm

These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/

  1. References:

https://access.redhat.com/security/cve/CVE-2017-14491 https://access.redhat.com/security/updates/classification/#critical https://access.redhat.com/security/vulnerabilities/3199382

  1. Contact:

The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/

Copyright 2017 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1

iD8DBQFZ0nLUXlSAg2UNWIIRAn39AKDCsn16dEmmA7DazjU2IOpWLIFp8QCeODoG 7t7GGwkabW2pC2Wcr35n/G8= =S/6b -----END PGP SIGNATURE-----

-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce .

Affected packages

-------------------------------------------------------------------
 Package              /     Vulnerable     /            Unaffected
-------------------------------------------------------------------

1 net-dns/dnsmasq < 2.78 >= 2.78

Description

Multiple vulnerabilities have been discovered in Dnsmasq.

Workaround

There is no known workaround at this time.

Resolution

All Dnsmasq users should upgrade to the latest version:

# emerge --sync # emerge --ask --oneshot --verbose ">=net-dns/dnsmasq-2.78"

References

[ 1 ] CVE-2017-14491 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14491 [ 2 ] CVE-2017-14492 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14492 [ 3 ] CVE-2017-14493 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14493 [ 4 ] CVE-2017-14494 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14494 [ 5 ] CVE-2017-14495 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14495 [ 6 ] CVE-2017-14496 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14496

Availability

This GLSA and any updates to it are available for viewing at the Gentoo Security Website:

https://security.gentoo.org/glsa/201710-27

Concerns?

Security is a primary focus of Gentoo Linux and ensuring the confidentiality and security of our users' machines is of utmost importance to us. Any security concerns should be addressed to security@gentoo.org or alternatively, you may file a bug at https://bugs.gentoo.org.

License

Copyright 2017 Gentoo Foundation, Inc; referenced text belongs to its owner(s).

The contents of this document are licensed under the Creative Commons - Attribution / Share Alike license.

http://creativecommons.org/licenses/by-sa/2.5

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201710-1433",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "leap",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "opensuse",
        "version": "42.3"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "opensuse",
        "version": "42.2"
      },
      {
        "model": "linux enterprise server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "suse",
        "version": "12"
      },
      {
        "model": "arubaos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.5.3.3"
      },
      {
        "model": "arubaos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.4.4.16"
      },
      {
        "model": "arubaos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.5.4.0"
      },
      {
        "model": "router manager",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "synology",
        "version": "1.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "14.04"
      },
      {
        "model": "diskstation manager",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "synology",
        "version": "6.1"
      },
      {
        "model": "geforce experience",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "nvidia",
        "version": "3.10.0.55"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "8.0"
      },
      {
        "model": "arubaos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.3.1.25"
      },
      {
        "model": "arubaos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.5.1.9"
      },
      {
        "model": "arubaos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.5.3.0"
      },
      {
        "model": "scalance w1750d",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.5.1.5"
      },
      {
        "model": "diskstation manager",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "synology",
        "version": "6.0"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "linux enterprise server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "suse",
        "version": "11"
      },
      {
        "model": "linux enterprise point of sale",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "suse",
        "version": "11"
      },
      {
        "model": "linux enterprise debuginfo",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "suse",
        "version": "11"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "12.04"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.0"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.0"
      },
      {
        "model": "arubaos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.5.4.2"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0"
      },
      {
        "model": "geforce experience",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "nvidia",
        "version": "3.0"
      },
      {
        "model": "eos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.18"
      },
      {
        "model": "arubaos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "8.1.0.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.0"
      },
      {
        "model": "arubaos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.3.1"
      },
      {
        "model": "eos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.16"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "16.04"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "linux for tegra",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "nvidia",
        "version": "r21.6"
      },
      {
        "model": "arubaos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.4.4.0"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "arubaos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "8.1.0.4"
      },
      {
        "model": "eos",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.15"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "17.04"
      },
      {
        "model": "eos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.16.13m"
      },
      {
        "model": "honor v9 play",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "huawei",
        "version": "jimmy-al00ac00b135"
      },
      {
        "model": "eos",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.18.4.2f"
      },
      {
        "model": "eos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.17"
      },
      {
        "model": "linux for tegra",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "nvidia",
        "version": "r24.2.2"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.1"
      },
      {
        "model": "diskstation manager",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "synology",
        "version": "5.2"
      },
      {
        "model": "arubaos",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "arubanetworks",
        "version": "6.5.0.0"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.0"
      },
      {
        "model": "eos",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "arista",
        "version": "4.17.8m"
      },
      {
        "model": "dnsmasq",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.9,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "ruckus",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "technicolor",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "zyxel",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "dnsmasq",
        "version": null
      },
      {
        "model": "ubuntu",
        "scope": null,
        "trust": 0.8,
        "vendor": "canonical",
        "version": null
      },
      {
        "model": "red hat enterprise linux server",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30ec\u30c3\u30c9\u30cf\u30c3\u30c8",
        "version": null
      },
      {
        "model": "red hat enterprise linux workstation",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30ec\u30c3\u30c9\u30cf\u30c3\u30c8",
        "version": null
      },
      {
        "model": "red hat enterprise linux desktop",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30ec\u30c3\u30c9\u30cf\u30c3\u30c8",
        "version": null
      },
      {
        "model": "leap",
        "scope": null,
        "trust": 0.8,
        "vendor": "opensuse",
        "version": null
      },
      {
        "model": "gnu/linux",
        "scope": null,
        "trust": 0.8,
        "vendor": "debian",
        "version": null
      },
      {
        "model": "dnsmasq",
        "scope": null,
        "trust": 0.8,
        "vendor": "thekelleys",
        "version": null
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "redhat",
        "version": "-47.4"
      },
      {
        "model": "scalance w1750d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "17.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "16.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "14.04"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.75"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.72"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.71"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.70"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.65"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.64"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.63"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.62"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.61"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.60"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.59"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.58"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.57"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.56"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.55"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.54"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.53"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.52"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.51"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.50"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.49"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.48"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.47"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.46"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.45"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.44"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.43"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.42"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.41"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.40"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.38"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.37"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.36"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.35"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.34"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.33"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.30"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.29"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.28"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.27"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.26"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.25"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.24"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.23"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.22"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.21"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.20"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.19"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.9"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.8"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.3"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.996"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.992"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.98"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.96"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.95"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.4"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.2"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.37"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.0"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server for arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.2"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update suppor",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.2"
      },
      {
        "model": "enterprise linux server year extended upd",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.3"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5"
      },
      {
        "model": "enterprise linux long life server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5.9"
      },
      {
        "model": "enterprise linux hpc node optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux hpc node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux for scientific computing",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update supp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power little endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power big endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux desktop optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.10"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "6.0.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "5.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "5.0.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "4.4.4"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "8.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "6.0"
      },
      {
        "model": "fedora",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "fedoraproject",
        "version": "27"
      },
      {
        "model": "linux sparc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux s/390",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux powerpc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux mips",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-32",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-30",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux amd64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "7"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "6"
      },
      {
        "model": "dnsmasq",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.8"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.7"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.11"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.8"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Red Hat",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "db": "PACKETSTORM",
        "id": "144472"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2017-14491",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 7.5,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 10.0,
            "id": "CVE-2017-14491",
            "impactScore": 6.4,
            "integrityImpact": "PARTIAL",
            "severity": "HIGH",
            "trust": 1.9,
            "vectorString": "AV:N/AC:L/Au:N/C:P/I:P/A:P",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 9.8,
            "baseSeverity": "CRITICAL",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 3.9,
            "id": "CVE-2017-14491",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 9.8,
            "baseSeverity": "Critical",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "CVE-2017-14491",
            "impactScore": null,
            "integrityImpact": "High",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2017-14491",
            "trust": 1.0,
            "value": "CRITICAL"
          },
          {
            "author": "NVD",
            "id": "CVE-2017-14491",
            "trust": 0.8,
            "value": "Critical"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201709-747",
            "trust": 0.6,
            "value": "CRITICAL"
          },
          {
            "author": "VULMON",
            "id": "CVE-2017-14491",
            "trust": 0.1,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Heap-based buffer overflow in dnsmasq before 2.78 allows remote attackers to cause a denial of service (crash) or execute arbitrary code via a crafted DNS response. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Exists in a buffer error vulnerability.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities:\n1. A buffer-overflow vulnerability\n2. \nThis BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities. This issue only affected\nconfigurations using one of these options: enable-ra, ra-only, slaac,\nra-names, ra-advrouter, or ra-stateless. (CVE-2017-14493)\n\n* An information leak was found in dnsmasq in the DHCPv6 relay code. (CVE-2017-14494)\n\n* A memory exhaustion flaw was found in dnsmasq in the EDNS0 code. This issue only affected configurations\nusing one of the options: add-mac, add-cpe-id, or add-subnet. \n(CVE-2017-14495)\n\n* An integer underflow flaw leading to a buffer over-read was found in\ndnsmasq in the EDNS0 code. This issue only affected\nconfigurations using one of the options: add-mac, add-cpe-id, or\nadd-subnet. \n===========================================================================\nUbuntu Security Notice USN-3430-3\nJanuary 04, 2018\n\ndnsmasq regression\n===========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 12.04 ESM\n\nSummary:\n\nUSN-3430-2 introduced regression in Dnsmasq. \n\nSoftware Description:\n- dnsmasq: Small caching DNS proxy and DHCP/TFTP server\n\nDetails:\n\nUSN-3430-2 fixed several vulnerabilities. The update introduced a new\nregression that breaks DNS resolution. This update addresses the\nproblem. \n\nWe apologize for the inconvenience. \n\nOriginal advisory details:\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. \n(CVE-2017-14491)\n\nFelix Wilhelm, Fermin J. (CVE-2017-14492)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DHCPv6 requests. \n(CVE-2017-14493)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DHCPv6 packets. (CVE-2017-14494)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. A remote\nattacker could use this issue to cause Dnsmasq to consume memory,\nresulting in a denial of service. (CVE-2017-14495)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14496)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 12.04 ESM:\n dnsmasq=C2=A02.59-4ubuntu0.4\n dnsmasq-base2.59-4ubuntu0.4\n dnsmasq-utils2.59-4ubuntu0.4\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes. 7.3) - ppc64, ppc64le, s390x, x86_64\n\n3. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n=====================================================================\n                   Red Hat Security Advisory\n\nSynopsis:          Critical: dnsmasq security update\nAdvisory ID:       RHSA-2017:2839-01\nProduct:           Red Hat Enterprise Linux\nAdvisory URL:      https://access.redhat.com/errata/RHSA-2017:2839\nIssue date:        2017-10-02\nCVE Names:         CVE-2017-14491 \n=====================================================================\n\n1. Summary:\n\nAn update for dnsmasq is now available for Red Hat Enterprise Linux 6.2\nAdvanced Update Support, Red Hat Enterprise Linux 6.4 Advanced Update\nSupport, Red Hat Enterprise Linux 6.5 Advanced Update Support, Red Hat\nEnterprise Linux 6.5 Telco Extended Update Support, Red Hat Enterprise\nLinux 6.6 Advanced Update Support, Red Hat Enterprise Linux 6.6 Telco\nExtended Update Support, and Red Hat Enterprise Linux 6.7 Extended Update\nSupport. \n\nRed Hat Product Security has rated this update as having a security impact\nof Critical. A Common Vulnerability Scoring System (CVSS) base score, which\ngives a detailed severity rating, is available for each vulnerability from\nthe CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux HPC Node EUS (v. 6.7) - x86_64\nRed Hat Enterprise Linux HPC Node Optional EUS (v. 6.7) - x86_64\nRed Hat Enterprise Linux Server AUS (v. 6.2) - x86_64\nRed Hat Enterprise Linux Server AUS (v. 6.4) - x86_64\nRed Hat Enterprise Linux Server AUS (v. 6.5) - x86_64\nRed Hat Enterprise Linux Server AUS (v. 6.6) - x86_64\nRed Hat Enterprise Linux Server EUS (v. 6.7) - i386, ppc64, s390x, x86_64\nRed Hat Enterprise Linux Server Optional AUS (v. 6.4) - x86_64\nRed Hat Enterprise Linux Server Optional AUS (v. 6.5) - x86_64\nRed Hat Enterprise Linux Server Optional AUS (v. 6.6) - x86_64\nRed Hat Enterprise Linux Server Optional EUS (v. 6.7) - i386, ppc64, s390x, x86_64\nRed Hat Enterprise Linux Server Optional TUS (v. 6.5) - x86_64\nRed Hat Enterprise Linux Server Optional TUS (v. 6.6) - x86_64\nRed Hat Enterprise Linux Server TUS (v. 6.5) - x86_64\nRed Hat Enterprise Linux Server TUS (v. 6.6) - x86_64\n\n3. Description:\n\nThe dnsmasq packages contain Dnsmasq, a lightweight DNS (Domain Name\nServer) forwarder and DHCP (Dynamic Host Configuration Protocol) server. \n\nSecurity Fix(es):\n\n* A heap buffer overflow was found in dnsmasq in the code responsible for\nbuilding DNS replies. \n(CVE-2017-14491)\n\nRed Hat would like to thank Felix Wilhelm (Google Security Team), Fermin J. \nSerna (Google Security Team), Gabriel Campana (Google Security Team), Kevin\nHamacher (Google Security Team), and Ron Bowes (Google Security Team) for\nreporting this issue. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1495409 - CVE-2017-14491 dnsmasq: heap overflow in the code responsible for building DNS replies\n\n6. Package List:\n\nRed Hat Enterprise Linux HPC Node EUS (v. 6.7):\n\nSource:\ndnsmasq-2.48-16.el6_7.1.src.rpm\n\nx86_64:\ndnsmasq-2.48-16.el6_7.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm\n\nRed Hat Enterprise Linux HPC Node Optional EUS (v. 6.7):\n\nx86_64:\ndnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm\ndnsmasq-utils-2.48-16.el6_7.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server AUS (v. 6.2):\n\nSource:\ndnsmasq-2.48-5.el6_2.2.src.rpm\n\nx86_64:\ndnsmasq-2.48-5.el6_2.2.x86_64.rpm\ndnsmasq-debuginfo-2.48-5.el6_2.2.x86_64.rpm\n\nRed Hat Enterprise Linux Server AUS (v. 6.4):\n\nSource:\ndnsmasq-2.48-13.el6_4.1.src.rpm\n\nx86_64:\ndnsmasq-2.48-13.el6_4.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-13.el6_4.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server AUS (v. 6.5):\n\nSource:\ndnsmasq-2.48-13.el6_5.1.src.rpm\n\nx86_64:\ndnsmasq-2.48-13.el6_5.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server TUS (v. 6.5):\n\nSource:\ndnsmasq-2.48-13.el6_5.1.src.rpm\n\nx86_64:\ndnsmasq-2.48-13.el6_5.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server AUS (v. 6.6):\n\nSource:\ndnsmasq-2.48-14.el6_6.1.src.rpm\n\nx86_64:\ndnsmasq-2.48-14.el6_6.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server TUS (v. 6.6):\n\nSource:\ndnsmasq-2.48-14.el6_6.1.src.rpm\n\nx86_64:\ndnsmasq-2.48-14.el6_6.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server EUS (v. 6.7):\n\nSource:\ndnsmasq-2.48-16.el6_7.1.src.rpm\n\ni386:\ndnsmasq-2.48-16.el6_7.1.i686.rpm\ndnsmasq-debuginfo-2.48-16.el6_7.1.i686.rpm\n\nppc64:\ndnsmasq-2.48-16.el6_7.1.ppc64.rpm\ndnsmasq-debuginfo-2.48-16.el6_7.1.ppc64.rpm\n\ns390x:\ndnsmasq-2.48-16.el6_7.1.s390x.rpm\ndnsmasq-debuginfo-2.48-16.el6_7.1.s390x.rpm\n\nx86_64:\ndnsmasq-2.48-16.el6_7.1.x86_64.rpm\ndnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional AUS (v. 6.4):\n\nSource:\ndnsmasq-2.48-13.el6_4.1.src.rpm\n\nx86_64:\ndnsmasq-debuginfo-2.48-13.el6_4.1.x86_64.rpm\ndnsmasq-utils-2.48-13.el6_4.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional AUS (v. 6.5):\n\nSource:\ndnsmasq-2.48-13.el6_5.1.src.rpm\n\nx86_64:\ndnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm\ndnsmasq-utils-2.48-13.el6_5.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional TUS (v. 6.5):\n\nSource:\ndnsmasq-2.48-13.el6_5.1.src.rpm\n\nx86_64:\ndnsmasq-debuginfo-2.48-13.el6_5.1.x86_64.rpm\ndnsmasq-utils-2.48-13.el6_5.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional AUS (v. 6.6):\n\nx86_64:\ndnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm\ndnsmasq-utils-2.48-14.el6_6.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional TUS (v. 6.6):\n\nx86_64:\ndnsmasq-debuginfo-2.48-14.el6_6.1.x86_64.rpm\ndnsmasq-utils-2.48-14.el6_6.1.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional EUS (v. 6.7):\n\ni386:\ndnsmasq-debuginfo-2.48-16.el6_7.1.i686.rpm\ndnsmasq-utils-2.48-16.el6_7.1.i686.rpm\n\nppc64:\ndnsmasq-debuginfo-2.48-16.el6_7.1.ppc64.rpm\ndnsmasq-utils-2.48-16.el6_7.1.ppc64.rpm\n\ns390x:\ndnsmasq-debuginfo-2.48-16.el6_7.1.s390x.rpm\ndnsmasq-utils-2.48-16.el6_7.1.s390x.rpm\n\nx86_64:\ndnsmasq-debuginfo-2.48-16.el6_7.1.x86_64.rpm\ndnsmasq-utils-2.48-16.el6_7.1.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security.  Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2017-14491\nhttps://access.redhat.com/security/updates/classification/#critical\nhttps://access.redhat.com/security/vulnerabilities/3199382\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2017 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niD8DBQFZ0nLUXlSAg2UNWIIRAn39AKDCsn16dEmmA7DazjU2IOpWLIFp8QCeODoG\n7t7GGwkabW2pC2Wcr35n/G8=\n=S/6b\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. \n\nAffected packages\n=================\n\n    -------------------------------------------------------------------\n     Package              /     Vulnerable     /            Unaffected\n    -------------------------------------------------------------------\n  1  net-dns/dnsmasq               \u003c 2.78                     \u003e= 2.78 \n\nDescription\n===========\n\nMultiple vulnerabilities have been discovered in Dnsmasq. \n\nWorkaround\n==========\n\nThere is no known workaround at this time. \n\nResolution\n==========\n\nAll Dnsmasq users should upgrade to the latest version:\n\n  # emerge --sync\n  # emerge --ask --oneshot --verbose \"\u003e=net-dns/dnsmasq-2.78\"\n\nReferences\n==========\n\n[ 1 ] CVE-2017-14491\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14491\n[ 2 ] CVE-2017-14492\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14492\n[ 3 ] CVE-2017-14493\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14493\n[ 4 ] CVE-2017-14494\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14494\n[ 5 ] CVE-2017-14495\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14495\n[ 6 ] CVE-2017-14496\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14496\n\nAvailability\n============\n\nThis GLSA and any updates to it are available for viewing at\nthe Gentoo Security Website:\n\n https://security.gentoo.org/glsa/201710-27\n\nConcerns?\n=========\n\nSecurity is a primary focus of Gentoo Linux and ensuring the\nconfidentiality and security of our users\u0027 machines is of utmost\nimportance to us. Any security concerns should be addressed to\nsecurity@gentoo.org or alternatively, you may file a bug at\nhttps://bugs.gentoo.org. \n\nLicense\n=======\n\nCopyright 2017 Gentoo Foundation, Inc; referenced text\nbelongs to its owner(s). \n\nThe contents of this document are licensed under the\nCreative Commons - Attribution / Share Alike license. \n\nhttp://creativecommons.org/licenses/by-sa/2.5\n",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      },
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "PACKETSTORM",
        "id": "144472"
      }
    ],
    "trust": 3.78
  },
  "exploit_availability": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "reference": "https://vulmon.com/exploitdetails?qidtp=exploitdb\u0026qid=42941",
        "trust": 0.1,
        "type": "exploit"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2017-14491",
        "trust": 4.8
      },
      {
        "db": "CERT/CC",
        "id": "VU#973527",
        "trust": 3.6
      },
      {
        "db": "BID",
        "id": "101085",
        "trust": 2.0
      },
      {
        "db": "BID",
        "id": "101977",
        "trust": 2.0
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-17-332-01",
        "trust": 2.0
      },
      {
        "db": "SECTRACK",
        "id": "1039474",
        "trust": 1.7
      },
      {
        "db": "SIEMENS",
        "id": "SSA-689071",
        "trust": 1.7
      },
      {
        "db": "PACKETSTORM",
        "id": "144480",
        "trust": 1.7
      },
      {
        "db": "EXPLOIT-DB",
        "id": "42941",
        "trust": 1.7
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-24-074-07",
        "trust": 0.8
      },
      {
        "db": "JVN",
        "id": "JVNVU93453933",
        "trust": 0.8
      },
      {
        "db": "JVN",
        "id": "JVNVU93656033",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14491",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144490",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144484",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "145652",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144474",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144477",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144481",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144482",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144706",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144472",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "PACKETSTORM",
        "id": "144472"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "id": "VAR-201710-1433",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.4653654075
  },
  "last_update_date": "2024-09-19T21:39:14.789000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Multiple\u00a0Critical\u00a0and\u00a0Important\u00a0vulnerabilities",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-1/"
      },
      {
        "title": "Dnsmasq Buffer error vulnerability fix",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=92843"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172838 - Security Advisory"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172841 - Security Advisory"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172840 - Security Advisory"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172839 - Security Advisory"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172837 - Security Advisory"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172836 - Security Advisory"
      },
      {
        "title": "Debian CVElist Bug Report Logs: dnsmasq: CVE-2017-13704: Size parameter overflow via large DNS query",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_cvelist_bugreportlogs\u0026qid=fa8aad66cae5df51d49e1cdce2fe4a42"
      },
      {
        "title": "Arch Linux Issues: ",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=CVE-2017-14491"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-2"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq regression",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-3"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-1"
      },
      {
        "title": "Debian Security Advisories: DSA-3989-1 dnsmasq -- security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=5c18698ecfe74c7de381531f8ed44dcf"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=7f490a104360d6f65bee18ec7bfa18a3"
      },
      {
        "title": "Amazon Linux 2: ALAS2-2019-1251",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=ALAS2-2019-1251"
      },
      {
        "title": "Arch Linux Advisories: [ASA-201710-1] dnsmasq: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-201710-1"
      },
      {
        "title": "Amazon Linux AMI: ALAS-2017-907",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux_ami\u0026qid=ALAS-2017-907"
      },
      {
        "title": "Oracle VM Server for x86 Bulletins: Oracle VM Server for x86 Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_vm_server_for_x86_bulletins\u0026qid=b1921e7bf61366a1d7f889a7cdefa932"
      },
      {
        "title": "Oracle Solaris Third Party Bulletins: Oracle Solaris Third Party Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_solaris_third_party_bulletins\u0026qid=6283337cd31f81f24d445925f2138c0e"
      },
      {
        "title": "Oracle Linux Bulletins: Oracle Linux Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=7251d5e5f2b1771951980ad7cfde50ba"
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/suhaad79/aws-k8s-kops-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/calvinkkd/aws-k8s-kkd-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/simonelle/aws-k8s-kops-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/scholzj/aws-k8s-kops-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/bisiman2/aws-k8s-kops-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/honey336/-aws-k8s-kops-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible -1\naws-k8s-kops-ansible\naws-k8s-kops-ansible\naws-k8s-kops-ansible\naws-k8s-kops-ansible",
        "trust": 0.1,
        "url": "https://github.com/Andreadote/aws-k8s-kops-ansible "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/RavitejaAdepudi/KopsCluster "
      },
      {
        "title": "Kubernetes setup on Amazon AWS using Kops and Ansible",
        "trust": 0.1,
        "url": "https://github.com/lorerunner/devops_kubenerates_aws "
      },
      {
        "title": "Kaosagnt\u0027s Ansible Everyday Utils",
        "trust": 0.1,
        "url": "https://github.com/kaosagnt/ansible-everyday "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/xbl3/awesome-cve-poc_qazbnm456 "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/lnick2023/nicenice "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/qazbnm456/awesome-cve-poc "
      },
      {
        "title": "Threatpost",
        "trust": 0.1,
        "url": "https://threatpost.com/google-warns-of-dos-and-rce-bugs-in-dnsmasq/128238/"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-787",
        "trust": 1.0
      },
      {
        "problemtype": "Buffer error (CWE-119) [NVD evaluation ]",
        "trust": 0.8
      },
      {
        "problemtype": " Heap-based buffer overflow (CWE-122) [IPA evaluation ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 3.5,
        "url": "https://www.kb.cert.org/vuls/id/973527"
      },
      {
        "trust": 3.1,
        "url": "http://www.debian.org/security/2017/dsa-3989"
      },
      {
        "trust": 2.9,
        "url": "http://www.securityfocus.com/bid/101085"
      },
      {
        "trust": 2.8,
        "url": "https://security.googleblog.com/2017/10/behind-masq-yet-more-dns-and-dhcp.html"
      },
      {
        "trust": 2.3,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "trust": 2.1,
        "url": "https://access.redhat.com/errata/rhsa-2017:2837"
      },
      {
        "trust": 2.1,
        "url": "https://access.redhat.com/errata/rhsa-2017:2836"
      },
      {
        "trust": 2.0,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-17-332-01"
      },
      {
        "trust": 1.9,
        "url": "https://access.redhat.com/errata/rhsa-2017:2838"
      },
      {
        "trust": 1.9,
        "url": "http://www.ubuntu.com/usn/usn-3430-1"
      },
      {
        "trust": 1.8,
        "url": "https://www.exploit-db.com/exploits/42941/"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2017:2841"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2017:2840"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2017:2839"
      },
      {
        "trust": 1.8,
        "url": "http://www.ubuntu.com/usn/usn-3430-2"
      },
      {
        "trust": 1.8,
        "url": "https://security.gentoo.org/glsa/201710-27"
      },
      {
        "trust": 1.8,
        "url": "http://www.ubuntu.com/usn/usn-3430-3"
      },
      {
        "trust": 1.7,
        "url": "http://www.thekelleys.org.uk/dnsmasq/doc.html"
      },
      {
        "trust": 1.7,
        "url": "http://www.securitytracker.com/id/1039474"
      },
      {
        "trust": 1.7,
        "url": "http://thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 1.7,
        "url": "http://lists.opensuse.org/opensuse-security-announce/2017-10/msg00006.html"
      },
      {
        "trust": 1.7,
        "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4561"
      },
      {
        "trust": 1.7,
        "url": "http://www.securityfocus.com/bid/101977"
      },
      {
        "trust": 1.7,
        "url": "https://www.synology.com/support/security/synology_sa_17_59_dnsmasq"
      },
      {
        "trust": 1.7,
        "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2017-005.txt"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-689071.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4560"
      },
      {
        "trust": 1.7,
        "url": "https://www.broadcom.com/support/fibre-channel-networking/security-advisories/brocade-security-advisory-2017-449/"
      },
      {
        "trust": 1.7,
        "url": "http://lists.opensuse.org/opensuse-security-announce/2017-10/msg00005.html"
      },
      {
        "trust": 1.7,
        "url": "http://lists.opensuse.org/opensuse-security-announce/2017-10/msg00004.html"
      },
      {
        "trust": 1.7,
        "url": "https://www.broadcom.com/support/fibre-channel-networking/security-advisories/brocade-security-advisory-2017-449"
      },
      {
        "trust": 1.7,
        "url": "http://packetstormsecurity.com/files/144480/dnsmasq-2-byte-heap-based-overflow.html"
      },
      {
        "trust": 1.7,
        "url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20171103-01-dnsmasq-en"
      },
      {
        "trust": 1.7,
        "url": "http://lists.opensuse.org/opensuse-security-announce/2017-10/msg00003.html"
      },
      {
        "trust": 1.7,
        "url": "https://www.arista.com/en/support/advisories-notices/security-advisories/3577-security-advisory-30"
      },
      {
        "trust": 1.7,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14491"
      },
      {
        "trust": 1.5,
        "url": "https://access.redhat.com/security/cve/cve-2017-14491"
      },
      {
        "trust": 1.1,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git%3ba=commit%3bh=0549c73b7ea6b22a3c49beb4d432f185a81efcbc"
      },
      {
        "trust": 1.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 1.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 1.1,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/5mmpcjoyppl4b5rby4u425pwg7eetdtd/"
      },
      {
        "trust": 1.1,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/yxrz2w6tv6nlujc5nofbsg6pzsmdtypv/"
      },
      {
        "trust": 1.1,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/527knn34rn2sb6mbjg7cksebwye3tjeb/"
      },
      {
        "trust": 1.1,
        "url": "https://access.redhat.com/security/cve/cve-2017-14492"
      },
      {
        "trust": 1.1,
        "url": "https://access.redhat.com/security/cve/cve-2017-14493"
      },
      {
        "trust": 1.1,
        "url": "https://access.redhat.com/security/cve/cve-2017-14494"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14495"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14496"
      },
      {
        "trust": 0.9,
        "url": "http://www.thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14491.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14492.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14493.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14494.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14495.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/kubernetes/kubernetes/blob/master/changelog.md"
      },
      {
        "trust": 0.9,
        "url": "http://www.slackware.com/security/viewer.php?l=slackware-security\u0026y=2017\u0026m=slackware-security.601472"
      },
      {
        "trust": 0.9,
        "url": "https://source.android.com/security/bulletin/2017-10-01"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495410"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495411"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495412"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495415"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495416"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495510"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-13704"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14496.py"
      },
      {
        "trust": 0.8,
        "url": "https://www.ruckuswireless.com/security"
      },
      {
        "trust": 0.8,
        "url": "https://www.zyxel.com/support/announcement_dnsmasq_vulnerabilities.shtml"
      },
      {
        "trust": 0.8,
        "url": "http://jvn.jp/vu/jvnvu93453933/index.html"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu93656033/index.html"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-24-074-07"
      },
      {
        "trust": 0.6,
        "url": "https://access.redhat.com/security/updates/classification/#critical"
      },
      {
        "trust": 0.6,
        "url": "https://access.redhat.com/articles/11258"
      },
      {
        "trust": 0.6,
        "url": "https://access.redhat.com/security/team/contact/"
      },
      {
        "trust": 0.6,
        "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
      },
      {
        "trust": 0.6,
        "url": "https://bugzilla.redhat.com/):"
      },
      {
        "trust": 0.6,
        "url": "https://access.redhat.com/security/team/key/"
      },
      {
        "trust": 0.6,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/5mmpcjoyppl4b5rby4u425pwg7eetdtd/"
      },
      {
        "trust": 0.6,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409bug1495409"
      },
      {
        "trust": 0.6,
        "url": "https://www.mail-archive.com/dnsmasq-discuss@lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 0.6,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/527knn34rn2sb6mbjg7cksebwye3tjeb/"
      },
      {
        "trust": 0.6,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git;a=commit;h=0549c73b7ea6b22a3c49beb4d432f185a81efcbc"
      },
      {
        "trust": 0.6,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/yxrz2w6tv6nlujc5nofbsg6pzsmdtypv/"
      },
      {
        "trust": 0.6,
        "url": "https://www.mail-archive.com/dnsmasq-discuss@lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-17-332-01"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14494"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14492"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14493"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14496"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14495"
      },
      {
        "trust": 0.3,
        "url": "http://subscriber.communications.siemens.com/"
      },
      {
        "trust": 0.3,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409 bug 1495409"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/787.html"
      },
      {
        "trust": 0.1,
        "url": "https://github.com/suhaad79/aws-k8s-kops-ansible"
      },
      {
        "trust": 0.1,
        "url": "https://github.com/scholzj/aws-k8s-kops-ansible"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/bugs/1741262"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14495"
      },
      {
        "trust": 0.1,
        "url": "http://creativecommons.org/licenses/by-sa/2.5"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14493"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14492"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14491"
      },
      {
        "trust": 0.1,
        "url": "https://security.gentoo.org/"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14496"
      },
      {
        "trust": 0.1,
        "url": "https://bugs.gentoo.org."
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14494"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "PACKETSTORM",
        "id": "144472"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "PACKETSTORM",
        "id": "144472"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-10-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2017-10-04T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "date": "2017-11-28T00:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-10-24T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "date": "2017-10-03T20:21:00",
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "date": "2017-10-03T05:19:24",
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "date": "2018-01-04T17:50:40",
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "date": "2017-10-02T08:55:00",
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "date": "2017-10-02T11:11:00",
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "date": "2017-10-03T05:18:12",
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "date": "2017-10-03T05:18:27",
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "date": "2017-10-23T13:54:05",
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "date": "2017-10-02T08:33:00",
        "db": "PACKETSTORM",
        "id": "144472"
      },
      {
        "date": "2017-09-18T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "date": "2017-10-04T01:29:02.870000",
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2018-02-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2023-11-07T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-14491"
      },
      {
        "date": "2019-05-15T17:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2024-03-22T07:54:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008618"
      },
      {
        "date": "2022-04-24T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      },
      {
        "date": "2023-11-07T02:39:01.190000",
        "db": "NVD",
        "id": "CVE-2017-14491"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-747"
      }
    ],
    "trust": 0.9
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Dnsmasq contains multiple vulnerabilities",
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "overflow, arbitrary",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "144474"
      },
      {
        "db": "PACKETSTORM",
        "id": "144477"
      },
      {
        "db": "PACKETSTORM",
        "id": "144481"
      },
      {
        "db": "PACKETSTORM",
        "id": "144482"
      },
      {
        "db": "PACKETSTORM",
        "id": "144472"
      }
    ],
    "trust": 0.6
  }
}

var-202103-0982
Vulnerability from variot

A vulnerability has been identified in RUGGEDCOM RM1224 (All versions >= V4.3 and < V6.4), SCALANCE M-800 (All versions >= V4.3 and < V6.4), SCALANCE S615 (All versions >= V4.3 and < V6.4), SCALANCE SC-600 Family (All versions >= V2.0 and < V2.1.3), SCALANCE XB-200 (All versions < V4.1), SCALANCE XC-200 (All versions < V4.1), SCALANCE XF-200BA (All versions < V4.1), SCALANCE XM400 (All versions < V6.2), SCALANCE XP-200 (All versions < V4.1), SCALANCE XR-300WG (All versions < V4.1), SCALANCE XR500 (All versions < V6.2). Affected devices contain a stack-based buffer overflow vulnerability in the handling of STP BPDU frames that could allow a remote attacker to trigger a denial-of-service condition or potentially remote code execution. Successful exploitation requires the passive listening feature of the device to be active. plural Siemens The product contains a vulnerability related to out-of-bounds writing.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put into a state. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from attacks from untrusted networks. SCALANCE M-800/S615 industrial routers are used for secure remote access to the factory through mobilenetworks (such as GPRS or UMTS). It has an integrated security function of firewall to prevent unauthorized access, and VPN can protect data transmission. SCALANCE X switches are used to connect industrial components, such as programmable logic controllers (PLC) or human machine interfaces (HMI). RUGGEDCOM RM1224 is a 4G router for wireless IP communication from Ethernet-based devices via LTE (4G)-mobile radio.

Siemens SCALANCE and RuggedCmd devices have stack overflow vulnerabilities

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202103-0982",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m-800",
        "scope": "gte",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance s615",
        "scope": "gte",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance xm400",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "6.2"
      },
      {
        "model": "scalance xr500",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "6.2"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "gte",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance x300wg",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "scalance sc632-2c",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "scalance xc-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "scalance sc646-2c",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "scalance xp-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "scalance xb-200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1"
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "scalance sc642-2c",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "scalance sc636-2c",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "scalance sc622-2c",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "scalance sc-646-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-622-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xm400",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-642-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-632-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xr500",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-636-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-600 family",
        "scope": "gte",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "2.0,\u003c2.1.3"
      },
      {
        "model": "scalance family",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "xx200\u003c4.1"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "cve": "CVE-2021-25667",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 5.8,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 6.5,
            "id": "CVE-2021-25667",
            "impactScore": 6.4,
            "integrityImpact": "PARTIAL",
            "severity": "MEDIUM",
            "trust": 1.9,
            "vectorString": "AV:A/AC:L/Au:N/C:P/I:P/A:P",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 8.3,
            "confidentialityImpact": "COMPLETE",
            "exploitabilityScore": 6.5,
            "id": "CNVD-2021-16434",
            "impactScore": 10.0,
            "integrityImpact": "COMPLETE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:A/AC:L/Au:N/C:C/I:C/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "ADJACENT",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 8.8,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 2.8,
            "id": "CVE-2021-25667",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:A/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Adjacent Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 8.8,
            "baseSeverity": "High",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "CVE-2021-25667",
            "impactScore": null,
            "integrityImpact": "High",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2021-25667",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2021-25667",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2021-16434",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202103-683",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "VULMON",
            "id": "CVE-2021-25667",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "A vulnerability has been identified in RUGGEDCOM RM1224 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE M-800 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE S615 (All versions \u003e= V4.3 and \u003c V6.4), SCALANCE SC-600 Family (All versions \u003e= V2.0 and \u003c V2.1.3), SCALANCE XB-200 (All versions \u003c V4.1), SCALANCE XC-200 (All versions \u003c V4.1), SCALANCE XF-200BA (All versions \u003c V4.1), SCALANCE XM400 (All versions \u003c V6.2), SCALANCE XP-200 (All versions \u003c V4.1), SCALANCE XR-300WG (All versions \u003c V4.1), SCALANCE XR500 (All versions \u003c V6.2). Affected devices contain a stack-based buffer overflow vulnerability in the handling of STP BPDU frames that could allow a remote attacker to trigger a denial-of-service condition or potentially remote code execution. Successful exploitation requires the passive listening feature of the device to be active. plural Siemens The product contains a vulnerability related to out-of-bounds writing.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put into a state. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from attacks from untrusted networks. SCALANCE M-800/S615 industrial routers are used for secure remote access to the factory through mobilenetworks (such as GPRS or UMTS). It has an integrated security function of firewall to prevent unauthorized access, and VPN can protect data transmission. SCALANCE X switches are used to connect industrial components, such as programmable logic controllers (PLC) or human machine interfaces (HMI). RUGGEDCOM RM1224 is a 4G router for wireless IP communication from Ethernet-based devices via LTE (4G)-mobile radio. \n\r\n\r\nSiemens SCALANCE and RuggedCmd devices have stack overflow vulnerabilities",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-25667"
      }
    ],
    "trust": 2.25
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2021-25667",
        "trust": 3.1
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-21-068-03",
        "trust": 2.5
      },
      {
        "db": "SIEMENS",
        "id": "SSA-979775",
        "trust": 2.3
      },
      {
        "db": "JVN",
        "id": "JVNVU93441670",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.0846",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-25667",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "id": "VAR-202103-0982",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      }
    ],
    "trust": 1.188444047
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "ICS"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      }
    ]
  },
  "last_update_date": "2024-08-14T12:38:21.061000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-979775",
        "trust": 0.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-979775.pdf"
      },
      {
        "title": "Siemens RUGGEDCOM RM1224 Buffer error vulnerability fix",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=144543"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=02a3bef451a548084110a18d27dea153"
      },
      {
        "title": "",
        "trust": 0.1,
        "url": "https://github.com/Live-Hack-CVE/CVE-2021-25667 "
      },
      {
        "title": "Threatpost",
        "trust": 0.1,
        "url": "https://threatpost.com/namewreck-bugs-businesses/165385/"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-121",
        "trust": 1.0
      },
      {
        "problemtype": "CWE-787",
        "trust": 1.0
      },
      {
        "problemtype": "Out-of-bounds writing (CWE-787) [NVD Evaluation ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 3.1,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-03"
      },
      {
        "trust": 2.3,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-979775.pdf"
      },
      {
        "trust": 1.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-25667"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu93441670/"
      },
      {
        "trust": 0.6,
        "url": "https://vigilance.fr/vulnerability/siemens-ruggedcom-rm1224-buffer-overflow-via-stp-bpdu-frames-34782"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.0846"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/121.html"
      },
      {
        "trust": 0.1,
        "url": "https://github.com/live-hack-cve/cve-2021-25667"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://threatpost.com/namewreck-bugs-businesses/165385/"
      },
      {
        "trust": 0.1,
        "url": "https://cert-portal.siemens.com/productcert/txt/ssa-979775.txt"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-03-11T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "date": "2021-03-15T00:00:00",
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "date": "2021-11-22T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "date": "2021-03-09T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      },
      {
        "date": "2021-03-15T17:15:21.690000",
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-03-23T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2021-16434"
      },
      {
        "date": "2022-10-19T00:00:00",
        "db": "VULMON",
        "id": "CVE-2021-25667"
      },
      {
        "date": "2021-11-22T09:03:00",
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      },
      {
        "date": "2021-04-23T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      },
      {
        "date": "2022-10-19T19:26:06.117000",
        "db": "NVD",
        "id": "CVE-2021-25667"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote or local",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "plural \u00a0Siemens\u00a0 Out-of-bounds write vulnerabilities in the product",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004470"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "buffer error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-683"
      }
    ],
    "trust": 0.6
  }
}

var-201809-1153
Vulnerability from variot

The Linux kernel, versions 3.9+, is vulnerable to a denial of service attack with low rates of specially modified packets targeting IP fragment re-assembly. An attacker may cause a denial of service condition by sending specially crafted IP fragments. Various vulnerabilities in IP fragmentation have been discovered and fixed over the years. The current vulnerability (CVE-2018-5391) became exploitable in the Linux kernel with the increase of the IP fragment reassembly queue size. Service disruption as a result (DoS) There is a possibility of being attacked.

Bug Fix(es):

  • The kernel-rt packages have been upgraded to the 3.10.0-693.43.1 source tree, which provides a number of bug fixes over the previous version. (BZ#1632422)

  • -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256

====================================================================
Red Hat Security Advisory

Synopsis: Important: kernel security, bug fix, and enhancement update Advisory ID: RHSA-2018:3083-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:3083 Issue date: 2018-10-30 CVE Names: CVE-2015-8830 CVE-2016-4913 CVE-2017-0861 CVE-2017-10661 CVE-2017-17805 CVE-2017-18208 CVE-2017-18232 CVE-2017-18344 CVE-2018-1092 CVE-2018-1094 CVE-2018-1118 CVE-2018-1120 CVE-2018-1130 CVE-2018-5344 CVE-2018-5391 CVE-2018-5803 CVE-2018-5848 CVE-2018-7740 CVE-2018-7757 CVE-2018-8781 CVE-2018-10322 CVE-2018-10878 CVE-2018-10879 CVE-2018-10881 CVE-2018-10883 CVE-2018-10902 CVE-2018-10940 CVE-2018-13405 CVE-2018-1000026 ==================================================================== 1. Summary:

An update for kernel is now available for Red Hat Enterprise Linux 7.

Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.

  1. Relevant releases/architectures:

Red Hat Enterprise Linux Client (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Client Optional (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64 Red Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64 Red Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64 Red Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Workstation Optional (v. 7) - x86_64 Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch, ppc64le, s390x Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7) - ppc64le

  1. Description:

The kernel packages contain the Linux kernel, the core of any Linux operating system.

Security Fix(es):

  • A flaw named FragmentSmack was found in the way the Linux kernel handled reassembly of fragmented IPv4 and IPv6 packets. (CVE-2018-5391)

  • kernel: out-of-bounds access in the show_timer function in kernel/time/posix-timers.c (CVE-2017-18344)

  • kernel: Integer overflow in udl_fb_mmap() can allow attackers to execute code in kernel space (CVE-2018-8781)

  • kernel: MIDI driver race condition leads to a double-free (CVE-2018-10902)

  • kernel: Missing check in inode_init_owner() does not clear SGID bit on non-directories for non-members (CVE-2018-13405)

  • kernel: AIO write triggers integer overflow in some protocols (CVE-2015-8830)

  • kernel: Use-after-free in snd_pcm_info function in ALSA subsystem potentially leads to privilege escalation (CVE-2017-0861)

  • kernel: Handling of might_cancel queueing is not properly pretected against race (CVE-2017-10661)

  • kernel: Salsa20 encryption algorithm does not correctly handle zero-length inputs allowing local attackers to cause denial of service (CVE-2017-17805)

  • kernel: Inifinite loop vulnerability in madvise_willneed() function allows local denial of service (CVE-2017-18208)

  • kernel: fuse-backed file mmap-ed onto process cmdline arguments causes denial of service (CVE-2018-1120)

  • kernel: a null pointer dereference in dccp_write_xmit() leads to a system crash (CVE-2018-1130)

  • kernel: drivers/block/loop.c mishandles lo_release serialization allowing denial of service (CVE-2018-5344)

  • kernel: Missing length check of payload in _sctp_make_chunk() function allows denial of service (CVE-2018-5803)

  • kernel: buffer overflow in drivers/net/wireless/ath/wil6210/wmi.c:wmi_set_ie() may lead to memory corruption (CVE-2018-5848)

  • kernel: out-of-bound write in ext4_init_block_bitmap function with a crafted ext4 image (CVE-2018-10878)

  • kernel: Improper validation in bnx2x network card driver can allow for denial of service attacks via crafted packet (CVE-2018-1000026)

  • kernel: Information leak when handling NM entries containing NUL (CVE-2016-4913)

  • kernel: Mishandling mutex within libsas allowing local Denial of Service (CVE-2017-18232)

  • kernel: NULL pointer dereference in ext4_process_freed_data() when mounting crafted ext4 image (CVE-2018-1092)

  • kernel: NULL pointer dereference in ext4_xattr_inode_hash() causes crash with crafted ext4 image (CVE-2018-1094)

  • kernel: vhost: Information disclosure in vhost/vhost.c:vhost_new_msg() (CVE-2018-1118)

  • kernel: Denial of service in resv_map_release function in mm/hugetlb.c (CVE-2018-7740)

  • kernel: Memory leak in the sas_smp_get_phy_events function in drivers/scsi/libsas/sas_expander.c (CVE-2018-7757)

  • kernel: Invalid pointer dereference in xfs_ilock_attr_map_shared() when mounting crafted xfs image allowing denial of service (CVE-2018-10322)

  • kernel: use-after-free detected in ext4_xattr_set_entry with a crafted file (CVE-2018-10879)

  • kernel: out-of-bound access in ext4_get_group_info() when mounting and operating a crafted ext4 image (CVE-2018-10881)

  • kernel: stack-out-of-bounds write in jbd2_journal_dirty_metadata function (CVE-2018-10883)

  • kernel: incorrect memory bounds check in drivers/cdrom/cdrom.c (CVE-2018-10940)

Red Hat would like to thank Juha-Matti Tilli (Aalto University - Department of Communications and Networking and Nokia Bell Labs) for reporting CVE-2018-5391; Trend Micro Zero Day Initiative for reporting CVE-2018-10902; Qualys Research Labs for reporting CVE-2018-1120; Evgenii Shatokhin (Virtuozzo Team) for reporting CVE-2018-1130; and Wen Xu for reporting CVE-2018-1092 and CVE-2018-1094.

  1. Solution:

For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section.

Additional Changes:

For detailed information on changes in this release, see the Red Hat Enterprise Linux 7.6 Release Notes linked from the References section.

For details on how to apply this update, which includes the changes described in this advisory, refer to:

https://access.redhat.com/articles/11258

The system must be rebooted for this update to take effect.

  1. Bugs fixed (https://bugzilla.redhat.com/):

1314275 - CVE-2015-8830 kernel: AIO write triggers integer overflow in some protocols 1322930 - [RFE] Allow xfs to modify labels on mounted filesystem 1337528 - CVE-2016-4913 kernel: Information leak when handling NM entries containing NUL 1481136 - CVE-2017-10661 kernel: Handling of might_cancel queueing is not properly pretected against race 1488484 - GRE: IFLA_MTU ignored on NEWLINK 1504058 - kernel panic with nfsd while removing locks on file close 1507027 - [ESXi][RHEL7.6]x86/vmware: Add paravirt sched clock 1528312 - CVE-2017-17805 kernel: Salsa20 encryption algorithm does not correctly handle zero-length inputs allowing local attackers to cause denial-of-service 1533909 - CVE-2018-5344 kernel: drivers/block/loop.c mishandles lo_release serialization allowing denial-of-service 1541846 - CVE-2018-1000026 kernel: Improper validation in bnx2x network card driver can allow for denial of service attacks via crafted packet 1542494 - VMs with NVMe devices passed through sometimes fail to be launched 1551051 - CVE-2018-5803 kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service 1551565 - CVE-2017-18208 kernel: Inifinite loop vulnerability in mm/madvise.c:madvise_willneed() function allows local denial of service 1552867 - CVE-2018-7740 kernel: Denial of service in resv_map_release function in mm/hugetlb.c 1553361 - CVE-2018-7757 kernel: Memory leak in the sas_smp_get_phy_events function in drivers/scsi/libsas/sas_expander.c 1557434 - bio too big device md0 (1024 > 256) 1557599 - [RFE] Rebase ipset (kernel) to latest upstream 1558066 - CVE-2017-18232 kernel: Mishandling mutex within libsas allowing local Denial of Service 1558328 - Kernel data path test with OVS 2.9 + DPDK 17.11 fails with low throughput 1560777 - CVE-2018-1092 kernel: NULL pointer dereference in ext4/mballoc.c:ext4_process_freed_data() when mounting crafted ext4 image 1560788 - CVE-2018-1094 kernel: NULL pointer dereference in ext4/xattr.c:ext4_xattr_inode_hash() causes crash with crafted ext4 image 1561162 - [RHEL7.5] Extreme performance impact caused by raid resync 1563697 - Triming on full pool can trigger 'dm_pool_alloc_data_block' failed: error = -28 1563994 - CVE-2017-0861 kernel: Use-after-free in snd_pcm_info function in ALSA subsystem potentially leads to privilege escalation 1564186 - XFS may block endlessly in xlog_wait() on IO error 1568167 - crypto aesni-intel aes(gcm) is broken for IPsec 1571062 - CVE-2018-8781 kernel: Integer overflow in drivers/gpu/drm/udl/udl_fb.c:udl_fb_mmap() can allow attackers to execute code in kernel space 1571623 - CVE-2018-10322 kernel: Invalid pointer dereference in xfs_ilock_attr_map_shared() when mounting crafted xfs image allowing denial of service 1572983 - conntrack doesn't track packets in specific network namespace if those packets were processed by CT --notrack target in other network namespace 1573699 - CVE-2018-1118 kernel: vhost: Information disclosure in vhost/vhost.c:vhost_new_msg() 1575472 - CVE-2018-1120 kernel: fuse-backed file mmap-ed onto process cmdline arguments causes denial of service 1576419 - CVE-2018-1130 kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash 1577408 - CVE-2018-10940 kernel: incorrect memory bounds check in drivers/cdrom/cdrom.c 1584775 - VMs hung after migration 1590720 - CVE-2018-10902 kernel: MIDI driver race condition leads to a double-free 1590799 - CVE-2018-5848 kernel: buffer overflow in drivers/net/wireless/ath/wil6210/wmi.c:wmi_set_ie() may lead to memory corruption 1592654 - [NVMe Device Assignment] Guest reboot failed from the NVMe assigned which os installed on 1596802 - CVE-2018-10878 kernel: out-of-bound write in ext4_init_block_bitmap function with a crafted ext4 image 1596806 - CVE-2018-10879 kernel: use-after-free detected in ext4_xattr_set_entry with a crafted file 1596828 - CVE-2018-10881 kernel: out-of-bound access in ext4_get_group_info() when mounting and operating a crafted ext4 image 1596846 - CVE-2018-10883 kernel: stack-out-of-bounds write in jbd2_journal_dirty_metadata function 1599161 - CVE-2018-13405 kernel: Missing check in fs/inode.c:inode_init_owner() does not clear SGID bit on non-directories for non-members 1609664 - CVE-2018-5391 kernel: IP fragments with random offsets allow a remote denial of service (FragmentSmack) 1609717 - [unwinder] CPU spins indefinitely in __save_stack_trace() call chain 1610958 - CVE-2017-18344 kernel: out-of-bounds access in the show_timer function in kernel/time/posix-timers.c

  1. Package List:

Red Hat Enterprise Linux Client (v. 7):

Source: kernel-3.10.0-957.el7.src.rpm

noarch: kernel-abi-whitelists-3.10.0-957.el7.noarch.rpm kernel-doc-3.10.0-957.el7.noarch.rpm

x86_64: bpftool-3.10.0-957.el7.x86_64.rpm kernel-3.10.0-957.el7.x86_64.rpm kernel-debug-3.10.0-957.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debug-devel-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-devel-3.10.0-957.el7.x86_64.rpm kernel-headers-3.10.0-957.el7.x86_64.rpm kernel-tools-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-3.10.0-957.el7.x86_64.rpm perf-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux Client Optional (v. 7):

x86_64: kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux ComputeNode (v. 7):

Source: kernel-3.10.0-957.el7.src.rpm

noarch: kernel-abi-whitelists-3.10.0-957.el7.noarch.rpm kernel-doc-3.10.0-957.el7.noarch.rpm

x86_64: bpftool-3.10.0-957.el7.x86_64.rpm kernel-3.10.0-957.el7.x86_64.rpm kernel-debug-3.10.0-957.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debug-devel-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-devel-3.10.0-957.el7.x86_64.rpm kernel-headers-3.10.0-957.el7.x86_64.rpm kernel-tools-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-3.10.0-957.el7.x86_64.rpm perf-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux ComputeNode Optional (v. 7):

x86_64: kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux Server (v. 7):

Source: kernel-3.10.0-957.el7.src.rpm

noarch: kernel-abi-whitelists-3.10.0-957.el7.noarch.rpm kernel-doc-3.10.0-957.el7.noarch.rpm

ppc64: kernel-3.10.0-957.el7.ppc64.rpm kernel-bootwrapper-3.10.0-957.el7.ppc64.rpm kernel-debug-3.10.0-957.el7.ppc64.rpm kernel-debug-debuginfo-3.10.0-957.el7.ppc64.rpm kernel-debug-devel-3.10.0-957.el7.ppc64.rpm kernel-debuginfo-3.10.0-957.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-957.el7.ppc64.rpm kernel-devel-3.10.0-957.el7.ppc64.rpm kernel-headers-3.10.0-957.el7.ppc64.rpm kernel-tools-3.10.0-957.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-957.el7.ppc64.rpm kernel-tools-libs-3.10.0-957.el7.ppc64.rpm perf-3.10.0-957.el7.ppc64.rpm perf-debuginfo-3.10.0-957.el7.ppc64.rpm python-perf-3.10.0-957.el7.ppc64.rpm python-perf-debuginfo-3.10.0-957.el7.ppc64.rpm

ppc64le: kernel-3.10.0-957.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-957.el7.ppc64le.rpm kernel-debug-3.10.0-957.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm kernel-devel-3.10.0-957.el7.ppc64le.rpm kernel-headers-3.10.0-957.el7.ppc64le.rpm kernel-tools-3.10.0-957.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-tools-libs-3.10.0-957.el7.ppc64le.rpm perf-3.10.0-957.el7.ppc64le.rpm perf-debuginfo-3.10.0-957.el7.ppc64le.rpm python-perf-3.10.0-957.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm

s390x: kernel-3.10.0-957.el7.s390x.rpm kernel-debug-3.10.0-957.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-957.el7.s390x.rpm kernel-debug-devel-3.10.0-957.el7.s390x.rpm kernel-debuginfo-3.10.0-957.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-957.el7.s390x.rpm kernel-devel-3.10.0-957.el7.s390x.rpm kernel-headers-3.10.0-957.el7.s390x.rpm kernel-kdump-3.10.0-957.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-957.el7.s390x.rpm kernel-kdump-devel-3.10.0-957.el7.s390x.rpm perf-3.10.0-957.el7.s390x.rpm perf-debuginfo-3.10.0-957.el7.s390x.rpm python-perf-3.10.0-957.el7.s390x.rpm python-perf-debuginfo-3.10.0-957.el7.s390x.rpm

x86_64: bpftool-3.10.0-957.el7.x86_64.rpm kernel-3.10.0-957.el7.x86_64.rpm kernel-debug-3.10.0-957.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debug-devel-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-devel-3.10.0-957.el7.x86_64.rpm kernel-headers-3.10.0-957.el7.x86_64.rpm kernel-tools-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-3.10.0-957.el7.x86_64.rpm perf-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):

noarch: kernel-abi-whitelists-3.10.0-957.el7.noarch.rpm kernel-doc-3.10.0-957.el7.noarch.rpm

ppc64le: kernel-3.10.0-957.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-957.el7.ppc64le.rpm kernel-debug-3.10.0-957.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm kernel-devel-3.10.0-957.el7.ppc64le.rpm kernel-headers-3.10.0-957.el7.ppc64le.rpm kernel-tools-3.10.0-957.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-tools-libs-3.10.0-957.el7.ppc64le.rpm perf-3.10.0-957.el7.ppc64le.rpm perf-debuginfo-3.10.0-957.el7.ppc64le.rpm python-perf-3.10.0-957.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm

s390x: kernel-3.10.0-957.el7.s390x.rpm kernel-debug-3.10.0-957.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-957.el7.s390x.rpm kernel-debug-devel-3.10.0-957.el7.s390x.rpm kernel-debuginfo-3.10.0-957.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-957.el7.s390x.rpm kernel-devel-3.10.0-957.el7.s390x.rpm kernel-headers-3.10.0-957.el7.s390x.rpm kernel-kdump-3.10.0-957.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-957.el7.s390x.rpm kernel-kdump-devel-3.10.0-957.el7.s390x.rpm perf-3.10.0-957.el7.s390x.rpm perf-debuginfo-3.10.0-957.el7.s390x.rpm python-perf-3.10.0-957.el7.s390x.rpm python-perf-debuginfo-3.10.0-957.el7.s390x.rpm

Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7):

ppc64le: kernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debug-devel-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-957.el7.ppc64le.rpm perf-debuginfo-3.10.0-957.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm

Red Hat Enterprise Linux Server Optional (v. 7):

ppc64: kernel-debug-debuginfo-3.10.0-957.el7.ppc64.rpm kernel-debuginfo-3.10.0-957.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-957.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-957.el7.ppc64.rpm kernel-tools-libs-devel-3.10.0-957.el7.ppc64.rpm perf-debuginfo-3.10.0-957.el7.ppc64.rpm python-perf-debuginfo-3.10.0-957.el7.ppc64.rpm

ppc64le: kernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debug-devel-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-957.el7.ppc64le.rpm perf-debuginfo-3.10.0-957.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm

x86_64: kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux Workstation (v. 7):

Source: kernel-3.10.0-957.el7.src.rpm

noarch: kernel-abi-whitelists-3.10.0-957.el7.noarch.rpm kernel-doc-3.10.0-957.el7.noarch.rpm

x86_64: bpftool-3.10.0-957.el7.x86_64.rpm kernel-3.10.0-957.el7.x86_64.rpm kernel-debug-3.10.0-957.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debug-devel-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-devel-3.10.0-957.el7.x86_64.rpm kernel-headers-3.10.0-957.el7.x86_64.rpm kernel-tools-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-3.10.0-957.el7.x86_64.rpm perf-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

Red Hat Enterprise Linux Workstation Optional (v. 7):

x86_64: kernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm perf-debuginfo-3.10.0-957.el7.x86_64.rpm python-perf-debuginfo-3.10.0-957.el7.x86_64.rpm

These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/

  1. References:

https://access.redhat.com/security/cve/CVE-2015-8830 https://access.redhat.com/security/cve/CVE-2016-4913 https://access.redhat.com/security/cve/CVE-2017-0861 https://access.redhat.com/security/cve/CVE-2017-10661 https://access.redhat.com/security/cve/CVE-2017-17805 https://access.redhat.com/security/cve/CVE-2017-18208 https://access.redhat.com/security/cve/CVE-2017-18232 https://access.redhat.com/security/cve/CVE-2017-18344 https://access.redhat.com/security/cve/CVE-2018-1092 https://access.redhat.com/security/cve/CVE-2018-1094 https://access.redhat.com/security/cve/CVE-2018-1118 https://access.redhat.com/security/cve/CVE-2018-1120 https://access.redhat.com/security/cve/CVE-2018-1130 https://access.redhat.com/security/cve/CVE-2018-5344 https://access.redhat.com/security/cve/CVE-2018-5391 https://access.redhat.com/security/cve/CVE-2018-5803 https://access.redhat.com/security/cve/CVE-2018-5848 https://access.redhat.com/security/cve/CVE-2018-7740 https://access.redhat.com/security/cve/CVE-2018-7757 https://access.redhat.com/security/cve/CVE-2018-8781 https://access.redhat.com/security/cve/CVE-2018-10322 https://access.redhat.com/security/cve/CVE-2018-10878 https://access.redhat.com/security/cve/CVE-2018-10879 https://access.redhat.com/security/cve/CVE-2018-10881 https://access.redhat.com/security/cve/CVE-2018-10883 https://access.redhat.com/security/cve/CVE-2018-10902 https://access.redhat.com/security/cve/CVE-2018-10940 https://access.redhat.com/security/cve/CVE-2018-13405 https://access.redhat.com/security/cve/CVE-2018-1000026 https://access.redhat.com/security/updates/classification/#important https://access.redhat.com/articles/3553061 https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/7/html/7.6_release_notes/index

  1. Contact:

The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/

Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1

iQIVAwUBW9gSCNzjgjWX9erEAQgpqw/8DyLe13g3SkrL6Mem7I/zcrJkZ3n8FB++ q4ewa71pzsPl5pZHDVPF0696m9WsMlaRDtnJGtKBxBmpUbjKTnMqxNp/xYyPqMBC BSHEF/njMwEEa0XPWv2UikNGFR9bM4NlVdxWktgeC6UVuX3iqnkIm/CvPEiKq13D GycbTIdnazhugeu/Rh6qVUgxVWd4ljc+HGBUrnWn6Rhw8DhKWm/S8xgpDpw86qEl 8CxnEjP00QMLo9nHmSVkm8ZobJV3MNhX8iO/UnRkvYGAZ3kl8/VnVmgs5sXHGqM2 aLzkDrgRf0zIVbcoaae1O26Rs4OwRL2DXDBxJ/3I6KASFzCYBcmtpjTsNyL8GX+D 76gKiCzhezunu4b8ErADGDcxLCU4W9LGs9repXNDEjdqY4qJ0kFTpmM4wm3Zpn0Z lyb17zxoXHATGPCgDFVyuL+g8TmOgUdhemNTLAQJXrVRsMxA06l446G3i66UwvQL qmSiknOs7Dzpt+8DdkGqPMJOA6t1ismtk9CO9BstYzxU1ebS6zUusHo0Iavw2v2D gPxsHl2GehMf9M2JHUygJTevcoyBB6OEZtmRdTmIRU9m8d8+90Cig8YwIk1kzZlq XrbwWjP8Mk+g21YGMMi+ksN0LFWf5rVYTRnvKMq7QLrSpjiravS7+gF6ZOH49XRs 0B91wOl3vSo=yaM6 -----END PGP SIGNATURE-----

-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . Description:

The kernel-rt packages provide the Real Time Linux Kernel, which enables fine-tuning for systems with extremely high determinism requirements. ========================================================================== Ubuntu Security Notice USN-3742-3 August 21, 2018

linux-lts-trusty regressions

A security issue affects these releases of Ubuntu and its derivatives:

  • Ubuntu 12.04 ESM

Summary:

USN-3742-2 introduced regressions in the Linux Hardware Enablement (HWE) kernel for Ubuntu 12.04 ESM.

Software Description: - linux-lts-trusty: Linux hardware enablement kernel from Trusty for Precise ESM

Details:

USN-3742-2 introduced mitigations in the Linux Hardware Enablement (HWE) kernel for Ubuntu 12.04 ESM to address L1 Terminal Fault (L1TF) vulnerabilities (CVE-2018-3620, CVE-2018-3646). Unfortunately, the update introduced regressions that caused kernel panics when booting in some environments as well as preventing Java applications from starting.

We apologize for the inconvenience.

Original advisory details:

It was discovered that memory present in the L1 data cache of an Intel CPU core may be exposed to a malicious process that is executing on the CPU core. This vulnerability is also known as L1 Terminal Fault (L1TF). A local attacker in a guest virtual machine could use this to expose sensitive information (memory from other guests or the host OS). (CVE-2018-3646)

It was discovered that memory present in the L1 data cache of an Intel CPU core may be exposed to a malicious process that is executing on the CPU core. This vulnerability is also known as L1 Terminal Fault (L1TF). A local attacker could use this to expose sensitive information (memory from the kernel or other processes). (CVE-2018-3620)

Andrey Konovalov discovered an out-of-bounds read in the POSIX timers subsystem in the Linux kernel. (CVE-2018-5391)

Update instructions:

The problem can be corrected by updating your system to the following package versions:

Ubuntu 12.04 ESM: linux-image-3.13.0-156-generic 3.13.0-156.206~precise1 linux-image-3.13.0-156-generic-lpae 3.13.0-156.206~precise1 linux-image-generic-lpae-lts-trusty 3.13.0.156.146 linux-image-generic-lts-trusty 3.13.0.156.146

After a standard system update you need to reboot your computer to make all the necessary changes.

ATTENTION: Due to an unavoidable ABI change the kernel updates have been given a new version number, which requires you to recompile and reinstall all third party kernel modules you might have installed. Unless you manually uninstalled the standard kernel metapackages (e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual, linux-powerpc), a standard system upgrade will automatically perform this as well. 6.5) - x86_64

Bug Fix(es):

  • Previously, invalid headers in the sk_buff struct led to an indefinite loop in the tcp_collapse() function. As a consequence, the system became unresponsive. This update backports the upstream changes that remove the problematic code in tcp_collapse(). (BZ#1629632)

  • 6.6) - noarch, x86_64

  • Maintaining the denial of service condition requires continuous two-way TCP sessions to a reachable open port, thus the attacks cannot be performed using spoofed IP addresses.

Red Hat would like to thank Juha-Matti Tilli (Aalto University - Department of Communications and Networking and Nokia Bell Labs) for reporting CVE-2018-5390 and CVE-2018-5391 and Qualys Research Labs for reporting CVE-2018-14634.

Bug Fix(es):

  • After updating the system to prevent the L1 Terminal Fault (L1TF) vulnerability, only one thread was detected on systems that offer processing of two threads on a single processor core. With this update, the "__max_smt_threads()" function has been fixed. As a result, both threads are now detected correctly in the described situation. (BZ#1625334)

  • Previously, a kernel panic occurred when the kernel tried to make an out of bound access to the array that describes the L1 Terminal Fault (L1TF) mitigation state on systems without Extended Page Tables (EPT) support. This update extends the array of mitigation states to cover all the states, which effectively prevents out of bound array access. Also, this update enables rejecting invalid, irrelevant values, that might be erroneously provided by the userspace. As a result, the kernel no longer panics in the described scenario. (BZ#1629633)

4

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201809-1153",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "canonical",
        "version": "16.04"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "canonical",
        "version": "14.04"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "canonical",
        "version": "12.04"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "canonical",
        "version": "18.04"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip link controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "kernel",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "linux",
        "version": "3.9"
      },
      {
        "model": "big-ip domain name system",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "windows 10",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "big-ip domain name system",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "big-ip link controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "windows server 2008",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "big-ip application security manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "big-ip analytics",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "big-ip link controller",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "scalance sc-600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "windows 10",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "1803"
      },
      {
        "model": "big-ip link controller",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "big-ip link controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "windows server 2012",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "simatic rf188",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.3"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.5"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "big-ip domain name system",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "8.0"
      },
      {
        "model": "windows 8.1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "windows server 2016",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "1709"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "big-ip application security manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip analytics",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "big-ip domain name system",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "simatic rf186ci",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.3"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.0"
      },
      {
        "model": "windows rt 8.1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "windows 10",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "1703"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "simatic net cp 1243-7 lte us",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip analytics",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "windows server 2012",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "r2"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "scalance w1700 ieee 802.11ac",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "simatic net cp 1543-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.2"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip domain name system",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip application security manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "simatic net cp 1242-7",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2"
      },
      {
        "model": "windows server 2016",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "big-ip application security manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "windows server 2008",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "r2"
      },
      {
        "model": "simatic rf188ci",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.3"
      },
      {
        "model": "big-ip analytics",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "simatic net cp 1243-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "simatic rf186c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.3"
      },
      {
        "model": "big-ip analytics",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip link controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "sinema remote connect server",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0.1"
      },
      {
        "model": "simatic net cp 1542sp-1 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "windows server 2016",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "1803"
      },
      {
        "model": "sinema remote connect server",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1"
      },
      {
        "model": "big-ip analytics",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip analytics",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip link controller",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip application security manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "big-ip application security manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip domain name system",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip domain name system",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "big-ip edge gateway",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "simatic net cp 1243-7 lte eu",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2"
      },
      {
        "model": "big-ip application security manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "simatic rf185c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.3"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "kernel",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "linux",
        "version": "4.18"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "big-ip link controller",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip application security manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "ruggedcom rox ii",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.13.3"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "windows 10",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "1607"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.1.3"
      },
      {
        "model": "big-ip analytics",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "simatic net cp 1243-8 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2"
      },
      {
        "model": "big-ip link controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "big-ip advanced firewall manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip domain name system",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "windows 10",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": "1709"
      },
      {
        "model": "big-ip application acceleration manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip application security manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.0"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "big-ip application security manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "windows 7",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": "big-ip analytics",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip domain name system",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "big-ip webaccelerator",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "scalance w700 ieee 802.11a\\/b\\/g\\/n",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.4"
      },
      {
        "model": "big-ip access policy manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.6.5.1"
      },
      {
        "model": "simatic net cp 1543sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "big-ip domain name system",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.1.1"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip fraud protection service",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.5"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "big-ip link controller",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "12.1.0"
      },
      {
        "model": "big-ip global traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "13.0.0"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.0"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "6.7"
      },
      {
        "model": "big-ip policy enforcement manager",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.1.2.4"
      },
      {
        "model": "simatic net cp 1542sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "big-ip local traffic manager",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "14.0.0"
      },
      {
        "model": "big-ip analytics",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "f5",
        "version": "11.5.1"
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "arista",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "check point",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "debian gnu linux",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "microsoft",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "suse linux",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "ubuntu",
        "version": null
      },
      {
        "model": "kernel",
        "scope": null,
        "trust": 0.8,
        "vendor": "linux",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:linux:linux_kernel",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Juha-Matti Tilli, The vulnerability was publicly disclosed externally.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2018-5391",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2018-5391",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 1.1,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "acInsufInfo": null,
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "NVD",
            "availabilityImpact": "COMPLETE",
            "availabilityRequirement": "NOT DEFINED",
            "baseScore": 7.8,
            "collateralDamagePotential": "NOT DEFINED",
            "confidentialityImpact": "NONE",
            "confidentialityRequirement": "NOT DEFINED",
            "enviromentalScore": 6.6,
            "exploitability": "UNPROVEN",
            "exploitabilityScore": 10.0,
            "id": "CVE-2018-5391",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "integrityRequirement": "NOT DEFINED",
            "obtainAllPrivilege": null,
            "obtainOtherPrivilege": null,
            "obtainUserPrivilege": null,
            "remediationLevel": "NOT DEFINED",
            "reportConfidence": "NOT DEFINED",
            "severity": "HIGH",
            "targetDistribution": "HIGH",
            "trust": 0.8,
            "userInteractionRequired": null,
            "vector_string": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "acInsufInfo": null,
            "accessComplexity": "Low",
            "accessVector": "Network",
            "authentication": "None",
            "author": "JPCERT/CC",
            "availabilityImpact": "Complete",
            "baseScore": 7.8,
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "JVNDB-2018-006630",
            "impactScore": null,
            "integrityImpact": "None",
            "obtainAllPrivilege": null,
            "obtainOtherPrivilege": null,
            "obtainUserPrivilege": null,
            "severity": "High",
            "trust": 0.8,
            "userInteractionRequired": null,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "VULHUB",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "VHN-135422",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 0.1,
            "vectorString": "AV:N/AC:L/AU:N/C:N/I:N/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2018-5391",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "JPCERT/CC",
            "availabilityImpact": "High",
            "baseScore": 7.5,
            "baseSeverity": "High",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "JVNDB-2018-006630",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2018-5391",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2018-5391",
            "trust": 0.8,
            "value": "HIGH"
          },
          {
            "author": "JPCERT/CC",
            "id": "JVNDB-2018-006630",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201808-570",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "VULHUB",
            "id": "VHN-135422",
            "trust": 0.1,
            "value": "HIGH"
          },
          {
            "author": "VULMON",
            "id": "CVE-2018-5391",
            "trust": 0.1,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "The Linux kernel, versions 3.9+, is vulnerable to a denial of service attack with low rates of specially modified packets targeting IP fragment re-assembly. An attacker may cause a denial of service condition by sending specially crafted IP fragments. Various vulnerabilities in IP fragmentation have been discovered and fixed over the years. The current vulnerability (CVE-2018-5391) became exploitable in the Linux kernel with the increase of the IP fragment reassembly queue size. Service disruption as a result (DoS) There is a possibility of being attacked. \n\nBug Fix(es):\n\n* The kernel-rt packages have been upgraded to the 3.10.0-693.43.1 source\ntree, which provides a number of bug fixes over the previous version. \n(BZ#1632422)\n\n4. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n====================================================================                   \nRed Hat Security Advisory\n\nSynopsis:          Important: kernel security, bug fix, and enhancement update\nAdvisory ID:       RHSA-2018:3083-01\nProduct:           Red Hat Enterprise Linux\nAdvisory URL:      https://access.redhat.com/errata/RHSA-2018:3083\nIssue date:        2018-10-30\nCVE Names:         CVE-2015-8830 CVE-2016-4913 CVE-2017-0861\n                   CVE-2017-10661 CVE-2017-17805 CVE-2017-18208\n                   CVE-2017-18232 CVE-2017-18344 CVE-2018-1092\n                   CVE-2018-1094 CVE-2018-1118 CVE-2018-1120\n                   CVE-2018-1130 CVE-2018-5344 CVE-2018-5391\n                   CVE-2018-5803 CVE-2018-5848 CVE-2018-7740\n                   CVE-2018-7757 CVE-2018-8781 CVE-2018-10322\n                   CVE-2018-10878 CVE-2018-10879 CVE-2018-10881\n                   CVE-2018-10883 CVE-2018-10902 CVE-2018-10940\n                   CVE-2018-13405 CVE-2018-1000026\n====================================================================\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Client Optional (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64\nRed Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64\nRed Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 7) - x86_64\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch, ppc64le, s390x\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7) - ppc64le\n\n3. Description:\n\nThe kernel packages contain the Linux kernel, the core of any Linux\noperating system. \n\nSecurity Fix(es):\n\n* A flaw named FragmentSmack was found in the way the Linux kernel handled\nreassembly of fragmented IPv4 and IPv6 packets. (CVE-2018-5391)\n\n* kernel: out-of-bounds access in the show_timer function in\nkernel/time/posix-timers.c (CVE-2017-18344)\n\n* kernel: Integer overflow in udl_fb_mmap() can allow attackers to execute\ncode in kernel space (CVE-2018-8781)\n\n* kernel: MIDI driver race condition leads to a double-free\n(CVE-2018-10902)\n\n* kernel: Missing check in inode_init_owner() does not clear SGID bit on\nnon-directories for non-members (CVE-2018-13405)\n\n* kernel: AIO write triggers integer overflow in some protocols\n(CVE-2015-8830)\n\n* kernel: Use-after-free in snd_pcm_info function in ALSA subsystem\npotentially leads to privilege escalation (CVE-2017-0861)\n\n* kernel: Handling of might_cancel queueing is not properly pretected\nagainst race (CVE-2017-10661)\n\n* kernel: Salsa20 encryption algorithm does not correctly handle\nzero-length inputs allowing local attackers to cause denial of service\n(CVE-2017-17805)\n\n* kernel: Inifinite loop vulnerability in madvise_willneed() function\nallows local denial of service (CVE-2017-18208)\n\n* kernel: fuse-backed file mmap-ed onto process cmdline arguments causes\ndenial of service (CVE-2018-1120)\n\n* kernel: a null pointer dereference in dccp_write_xmit() leads to a system\ncrash (CVE-2018-1130)\n\n* kernel: drivers/block/loop.c mishandles lo_release serialization allowing\ndenial of service (CVE-2018-5344)\n\n* kernel: Missing length check of payload in _sctp_make_chunk() function\nallows denial of service (CVE-2018-5803)\n\n* kernel: buffer overflow in\ndrivers/net/wireless/ath/wil6210/wmi.c:wmi_set_ie() may lead to memory\ncorruption (CVE-2018-5848)\n\n* kernel: out-of-bound write in ext4_init_block_bitmap function with a\ncrafted ext4 image (CVE-2018-10878)\n\n* kernel: Improper validation in bnx2x network card driver can allow for\ndenial of service attacks via crafted packet (CVE-2018-1000026)\n\n* kernel: Information leak when handling NM entries containing NUL\n(CVE-2016-4913)\n\n* kernel: Mishandling mutex within libsas allowing local Denial of Service\n(CVE-2017-18232)\n\n* kernel: NULL pointer dereference in ext4_process_freed_data() when\nmounting crafted ext4 image (CVE-2018-1092)\n\n* kernel: NULL pointer dereference in ext4_xattr_inode_hash() causes crash\nwith crafted ext4 image (CVE-2018-1094)\n\n* kernel: vhost: Information disclosure in vhost/vhost.c:vhost_new_msg()\n(CVE-2018-1118)\n\n* kernel: Denial of service in resv_map_release function in mm/hugetlb.c\n(CVE-2018-7740)\n\n* kernel: Memory leak in the sas_smp_get_phy_events function in\ndrivers/scsi/libsas/sas_expander.c (CVE-2018-7757)\n\n* kernel: Invalid pointer dereference in xfs_ilock_attr_map_shared() when\nmounting crafted xfs image allowing denial of service (CVE-2018-10322)\n\n* kernel: use-after-free detected in ext4_xattr_set_entry with a crafted\nfile (CVE-2018-10879)\n\n* kernel: out-of-bound access in ext4_get_group_info() when mounting and\noperating a crafted ext4 image (CVE-2018-10881)\n\n* kernel: stack-out-of-bounds write in jbd2_journal_dirty_metadata function\n(CVE-2018-10883)\n\n* kernel: incorrect memory bounds check in drivers/cdrom/cdrom.c\n(CVE-2018-10940)\n\nRed Hat would like to thank Juha-Matti Tilli (Aalto University - Department\nof Communications and Networking and Nokia Bell Labs) for reporting\nCVE-2018-5391; Trend Micro Zero Day Initiative for reporting\nCVE-2018-10902; Qualys Research Labs for reporting CVE-2018-1120; Evgenii\nShatokhin (Virtuozzo Team) for reporting CVE-2018-1130; and Wen Xu for\nreporting CVE-2018-1092 and CVE-2018-1094. \n\n4. Solution:\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n\nAdditional Changes:\n\nFor detailed information on changes in this release, see the Red Hat\nEnterprise Linux 7.6 Release Notes linked from the References section. \n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\nThe system must be rebooted for this update to take effect. \n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1314275 - CVE-2015-8830 kernel: AIO write triggers integer overflow in some protocols\n1322930 - [RFE] Allow xfs to modify labels on mounted filesystem\n1337528 - CVE-2016-4913 kernel: Information leak when handling NM entries containing NUL\n1481136 - CVE-2017-10661 kernel: Handling of might_cancel queueing is not properly pretected against race\n1488484 - GRE: IFLA_MTU ignored on NEWLINK\n1504058 - kernel panic with nfsd while removing locks on file close\n1507027 - [ESXi][RHEL7.6]x86/vmware: Add paravirt sched clock\n1528312 - CVE-2017-17805 kernel: Salsa20 encryption algorithm does not correctly handle zero-length inputs allowing local attackers to cause denial-of-service\n1533909 - CVE-2018-5344 kernel: drivers/block/loop.c mishandles lo_release serialization allowing denial-of-service\n1541846 - CVE-2018-1000026 kernel: Improper validation in bnx2x network card driver can allow for denial of service attacks via crafted packet\n1542494 - VMs with  NVMe devices passed through sometimes fail to be launched\n1551051 - CVE-2018-5803 kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service\n1551565 - CVE-2017-18208 kernel: Inifinite loop vulnerability in mm/madvise.c:madvise_willneed() function allows local denial of service\n1552867 - CVE-2018-7740 kernel: Denial of service in resv_map_release function in mm/hugetlb.c\n1553361 - CVE-2018-7757 kernel: Memory leak in the sas_smp_get_phy_events function in drivers/scsi/libsas/sas_expander.c\n1557434 - bio too big device md0 (1024 \u003e 256)\n1557599 - [RFE] Rebase ipset (kernel) to latest upstream\n1558066 - CVE-2017-18232 kernel: Mishandling mutex within libsas allowing local Denial of Service\n1558328 - Kernel data path test with OVS 2.9 + DPDK 17.11 fails with low throughput\n1560777 - CVE-2018-1092 kernel: NULL pointer dereference in ext4/mballoc.c:ext4_process_freed_data() when mounting crafted ext4 image\n1560788 - CVE-2018-1094 kernel: NULL pointer dereference in ext4/xattr.c:ext4_xattr_inode_hash() causes crash with crafted ext4 image\n1561162 - [RHEL7.5] Extreme performance impact caused by raid resync\n1563697 - Triming on full pool can trigger \u0027dm_pool_alloc_data_block\u0027 failed: error = -28\n1563994 - CVE-2017-0861 kernel: Use-after-free in snd_pcm_info function in ALSA subsystem potentially leads to privilege escalation\n1564186 - XFS may block endlessly in  xlog_wait() on IO error\n1568167 - crypto aesni-intel aes(gcm) is broken for IPsec\n1571062 - CVE-2018-8781 kernel: Integer overflow in drivers/gpu/drm/udl/udl_fb.c:udl_fb_mmap() can allow attackers to execute code in kernel space\n1571623 - CVE-2018-10322 kernel: Invalid pointer dereference in xfs_ilock_attr_map_shared() when mounting crafted xfs image allowing denial of service\n1572983 - conntrack doesn\u0027t track packets in specific network namespace if those packets were processed by CT --notrack target in other network namespace\n1573699 - CVE-2018-1118 kernel: vhost: Information disclosure in vhost/vhost.c:vhost_new_msg()\n1575472 - CVE-2018-1120 kernel: fuse-backed file mmap-ed onto process cmdline arguments causes denial of service\n1576419 - CVE-2018-1130 kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash\n1577408 - CVE-2018-10940 kernel: incorrect memory bounds check in drivers/cdrom/cdrom.c\n1584775 - VMs hung after migration\n1590720 - CVE-2018-10902 kernel: MIDI driver race condition leads to a double-free\n1590799 - CVE-2018-5848 kernel: buffer overflow in drivers/net/wireless/ath/wil6210/wmi.c:wmi_set_ie() may lead to memory corruption\n1592654 - [NVMe Device Assignment] Guest reboot failed from the NVMe assigned which os installed on\n1596802 - CVE-2018-10878 kernel: out-of-bound write in ext4_init_block_bitmap function with a crafted ext4 image\n1596806 - CVE-2018-10879 kernel: use-after-free detected in ext4_xattr_set_entry with a crafted file\n1596828 - CVE-2018-10881 kernel: out-of-bound access in ext4_get_group_info() when mounting and operating a crafted ext4 image\n1596846 - CVE-2018-10883 kernel: stack-out-of-bounds write in jbd2_journal_dirty_metadata function\n1599161 - CVE-2018-13405 kernel: Missing check in fs/inode.c:inode_init_owner() does not clear SGID bit on non-directories for non-members\n1609664 - CVE-2018-5391 kernel: IP fragments with random offsets allow a remote denial of service (FragmentSmack)\n1609717 - [unwinder] CPU spins indefinitely in __save_stack_trace() call chain\n1610958 - CVE-2017-18344 kernel: out-of-bounds access in the show_timer function in kernel/time/posix-timers.c\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\nkernel-3.10.0-957.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-957.el7.noarch.rpm\nkernel-doc-3.10.0-957.el7.noarch.rpm\n\nx86_64:\nbpftool-3.10.0-957.el7.x86_64.rpm\nkernel-3.10.0-957.el7.x86_64.rpm\nkernel-debug-3.10.0-957.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-devel-3.10.0-957.el7.x86_64.rpm\nkernel-headers-3.10.0-957.el7.x86_64.rpm\nkernel-tools-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-957.el7.x86_64.rpm\nperf-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Client Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\nkernel-3.10.0-957.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-957.el7.noarch.rpm\nkernel-doc-3.10.0-957.el7.noarch.rpm\n\nx86_64:\nbpftool-3.10.0-957.el7.x86_64.rpm\nkernel-3.10.0-957.el7.x86_64.rpm\nkernel-debug-3.10.0-957.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-devel-3.10.0-957.el7.x86_64.rpm\nkernel-headers-3.10.0-957.el7.x86_64.rpm\nkernel-tools-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-957.el7.x86_64.rpm\nperf-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\nkernel-3.10.0-957.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-957.el7.noarch.rpm\nkernel-doc-3.10.0-957.el7.noarch.rpm\n\nppc64:\nkernel-3.10.0-957.el7.ppc64.rpm\nkernel-bootwrapper-3.10.0-957.el7.ppc64.rpm\nkernel-debug-3.10.0-957.el7.ppc64.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.ppc64.rpm\nkernel-debug-devel-3.10.0-957.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-957.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-957.el7.ppc64.rpm\nkernel-devel-3.10.0-957.el7.ppc64.rpm\nkernel-headers-3.10.0-957.el7.ppc64.rpm\nkernel-tools-3.10.0-957.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.ppc64.rpm\nkernel-tools-libs-3.10.0-957.el7.ppc64.rpm\nperf-3.10.0-957.el7.ppc64.rpm\nperf-debuginfo-3.10.0-957.el7.ppc64.rpm\npython-perf-3.10.0-957.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-957.el7.ppc64.rpm\n\nppc64le:\nkernel-3.10.0-957.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-957.el7.ppc64le.rpm\nkernel-debug-3.10.0-957.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm\nkernel-devel-3.10.0-957.el7.ppc64le.rpm\nkernel-headers-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-957.el7.ppc64le.rpm\nperf-3.10.0-957.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-957.el7.ppc64le.rpm\npython-perf-3.10.0-957.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-957.el7.s390x.rpm\nkernel-debug-3.10.0-957.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.s390x.rpm\nkernel-debug-devel-3.10.0-957.el7.s390x.rpm\nkernel-debuginfo-3.10.0-957.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-957.el7.s390x.rpm\nkernel-devel-3.10.0-957.el7.s390x.rpm\nkernel-headers-3.10.0-957.el7.s390x.rpm\nkernel-kdump-3.10.0-957.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-957.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-957.el7.s390x.rpm\nperf-3.10.0-957.el7.s390x.rpm\nperf-debuginfo-3.10.0-957.el7.s390x.rpm\npython-perf-3.10.0-957.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-957.el7.s390x.rpm\n\nx86_64:\nbpftool-3.10.0-957.el7.x86_64.rpm\nkernel-3.10.0-957.el7.x86_64.rpm\nkernel-debug-3.10.0-957.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-devel-3.10.0-957.el7.x86_64.rpm\nkernel-headers-3.10.0-957.el7.x86_64.rpm\nkernel-tools-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-957.el7.x86_64.rpm\nperf-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):\n\nnoarch:\nkernel-abi-whitelists-3.10.0-957.el7.noarch.rpm\nkernel-doc-3.10.0-957.el7.noarch.rpm\n\nppc64le:\nkernel-3.10.0-957.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-957.el7.ppc64le.rpm\nkernel-debug-3.10.0-957.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm\nkernel-devel-3.10.0-957.el7.ppc64le.rpm\nkernel-headers-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-957.el7.ppc64le.rpm\nperf-3.10.0-957.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-957.el7.ppc64le.rpm\npython-perf-3.10.0-957.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-957.el7.s390x.rpm\nkernel-debug-3.10.0-957.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.s390x.rpm\nkernel-debug-devel-3.10.0-957.el7.s390x.rpm\nkernel-debuginfo-3.10.0-957.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-957.el7.s390x.rpm\nkernel-devel-3.10.0-957.el7.s390x.rpm\nkernel-headers-3.10.0-957.el7.s390x.rpm\nkernel-kdump-3.10.0-957.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-957.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-957.el7.s390x.rpm\nperf-3.10.0-957.el7.s390x.rpm\nperf-debuginfo-3.10.0-957.el7.s390x.rpm\npython-perf-3.10.0-957.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-957.el7.s390x.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7):\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-957.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 7):\n\nppc64:\nkernel-debug-debuginfo-3.10.0-957.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-957.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-957.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.ppc64.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.ppc64.rpm\nperf-debuginfo-3.10.0-957.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-957.el7.ppc64.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-957.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-957.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\nkernel-3.10.0-957.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-957.el7.noarch.rpm\nkernel-doc-3.10.0-957.el7.noarch.rpm\n\nx86_64:\nbpftool-3.10.0-957.el7.x86_64.rpm\nkernel-3.10.0-957.el7.x86_64.rpm\nkernel-debug-3.10.0-957.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-devel-3.10.0-957.el7.x86_64.rpm\nkernel-headers-3.10.0-957.el7.x86_64.rpm\nkernel-tools-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-957.el7.x86_64.rpm\nperf-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-957.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-957.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-957.el7.x86_64.rpm\nperf-debuginfo-3.10.0-957.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-957.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security.  Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2015-8830\nhttps://access.redhat.com/security/cve/CVE-2016-4913\nhttps://access.redhat.com/security/cve/CVE-2017-0861\nhttps://access.redhat.com/security/cve/CVE-2017-10661\nhttps://access.redhat.com/security/cve/CVE-2017-17805\nhttps://access.redhat.com/security/cve/CVE-2017-18208\nhttps://access.redhat.com/security/cve/CVE-2017-18232\nhttps://access.redhat.com/security/cve/CVE-2017-18344\nhttps://access.redhat.com/security/cve/CVE-2018-1092\nhttps://access.redhat.com/security/cve/CVE-2018-1094\nhttps://access.redhat.com/security/cve/CVE-2018-1118\nhttps://access.redhat.com/security/cve/CVE-2018-1120\nhttps://access.redhat.com/security/cve/CVE-2018-1130\nhttps://access.redhat.com/security/cve/CVE-2018-5344\nhttps://access.redhat.com/security/cve/CVE-2018-5391\nhttps://access.redhat.com/security/cve/CVE-2018-5803\nhttps://access.redhat.com/security/cve/CVE-2018-5848\nhttps://access.redhat.com/security/cve/CVE-2018-7740\nhttps://access.redhat.com/security/cve/CVE-2018-7757\nhttps://access.redhat.com/security/cve/CVE-2018-8781\nhttps://access.redhat.com/security/cve/CVE-2018-10322\nhttps://access.redhat.com/security/cve/CVE-2018-10878\nhttps://access.redhat.com/security/cve/CVE-2018-10879\nhttps://access.redhat.com/security/cve/CVE-2018-10881\nhttps://access.redhat.com/security/cve/CVE-2018-10883\nhttps://access.redhat.com/security/cve/CVE-2018-10902\nhttps://access.redhat.com/security/cve/CVE-2018-10940\nhttps://access.redhat.com/security/cve/CVE-2018-13405\nhttps://access.redhat.com/security/cve/CVE-2018-1000026\nhttps://access.redhat.com/security/updates/classification/#important\nhttps://access.redhat.com/articles/3553061\nhttps://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/7/html/7.6_release_notes/index\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBW9gSCNzjgjWX9erEAQgpqw/8DyLe13g3SkrL6Mem7I/zcrJkZ3n8FB++\nq4ewa71pzsPl5pZHDVPF0696m9WsMlaRDtnJGtKBxBmpUbjKTnMqxNp/xYyPqMBC\nBSHEF/njMwEEa0XPWv2UikNGFR9bM4NlVdxWktgeC6UVuX3iqnkIm/CvPEiKq13D\nGycbTIdnazhugeu/Rh6qVUgxVWd4ljc+HGBUrnWn6Rhw8DhKWm/S8xgpDpw86qEl\n8CxnEjP00QMLo9nHmSVkm8ZobJV3MNhX8iO/UnRkvYGAZ3kl8/VnVmgs5sXHGqM2\naLzkDrgRf0zIVbcoaae1O26Rs4OwRL2DXDBxJ/3I6KASFzCYBcmtpjTsNyL8GX+D\n76gKiCzhezunu4b8ErADGDcxLCU4W9LGs9repXNDEjdqY4qJ0kFTpmM4wm3Zpn0Z\nlyb17zxoXHATGPCgDFVyuL+g8TmOgUdhemNTLAQJXrVRsMxA06l446G3i66UwvQL\nqmSiknOs7Dzpt+8DdkGqPMJOA6t1ismtk9CO9BstYzxU1ebS6zUusHo0Iavw2v2D\ngPxsHl2GehMf9M2JHUygJTevcoyBB6OEZtmRdTmIRU9m8d8+90Cig8YwIk1kzZlq\nXrbwWjP8Mk+g21YGMMi+ksN0LFWf5rVYTRnvKMq7QLrSpjiravS7+gF6ZOH49XRs\n0B91wOl3vSo=yaM6\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. Description:\n\nThe kernel-rt packages provide the Real Time Linux Kernel, which enables\nfine-tuning for systems with extremely high determinism requirements. ==========================================================================\nUbuntu Security Notice USN-3742-3\nAugust 21, 2018\n\nlinux-lts-trusty regressions\n==========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 12.04 ESM\n\nSummary:\n\nUSN-3742-2 introduced regressions in the Linux Hardware Enablement\n(HWE) kernel for Ubuntu 12.04 ESM. \n\nSoftware Description:\n- linux-lts-trusty: Linux hardware enablement kernel from Trusty for Precise ESM\n\nDetails:\n\nUSN-3742-2 introduced mitigations in the Linux Hardware Enablement\n(HWE) kernel for Ubuntu 12.04 ESM to address L1 Terminal Fault (L1TF)\nvulnerabilities (CVE-2018-3620, CVE-2018-3646). Unfortunately, the\nupdate introduced regressions that caused kernel panics when booting\nin some environments as well as preventing Java applications from\nstarting. \n\nWe apologize for the inconvenience. \n\nOriginal advisory details:\n\n It was discovered that memory present in the L1 data cache of an Intel CPU\n core may be exposed to a malicious process that is executing on the CPU\n core. This vulnerability is also known as L1 Terminal Fault (L1TF). A local\n attacker in a guest virtual machine could use this to expose sensitive\n information (memory from other guests or the host OS). (CVE-2018-3646)\n\n It was discovered that memory present in the L1 data cache of an Intel CPU\n core may be exposed to a malicious process that is executing on the CPU\n core. This vulnerability is also known as L1 Terminal Fault (L1TF). A local\n attacker could use this to expose sensitive information (memory from the\n kernel or other processes). (CVE-2018-3620)\n\n Andrey Konovalov discovered an out-of-bounds read in the POSIX\n timers subsystem in the Linux kernel. (CVE-2018-5391)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 12.04 ESM:\n  linux-image-3.13.0-156-generic  3.13.0-156.206~precise1\n  linux-image-3.13.0-156-generic-lpae  3.13.0-156.206~precise1\n  linux-image-generic-lpae-lts-trusty  3.13.0.156.146\n  linux-image-generic-lts-trusty  3.13.0.156.146\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes. \n\nATTENTION: Due to an unavoidable ABI change the kernel updates have\nbeen given a new version number, which requires you to recompile and\nreinstall all third party kernel modules you might have installed. \nUnless you manually uninstalled the standard kernel metapackages\n(e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual,\nlinux-powerpc), a standard system upgrade will automatically perform\nthis as well. 6.5) - x86_64\n\n3. \n\nBug Fix(es):\n\n* Previously, invalid headers in the sk_buff struct led to an indefinite\nloop in the tcp_collapse() function. As a consequence, the system became\nunresponsive. This update backports the upstream changes that remove the\nproblematic code in tcp_collapse(). (BZ#1629632)\n\n4. 6.6) - noarch, x86_64\n\n3. Maintaining the denial of service\ncondition requires continuous two-way TCP sessions to a reachable open\nport, thus the attacks cannot be performed using spoofed IP addresses. \n\nRed Hat would like to thank Juha-Matti Tilli (Aalto University - Department\nof Communications and Networking and Nokia Bell Labs) for reporting\nCVE-2018-5390 and CVE-2018-5391 and Qualys Research Labs for reporting\nCVE-2018-14634. \n\nBug Fix(es):\n\n* After updating the system to prevent the L1 Terminal Fault (L1TF)\nvulnerability, only one thread was detected on systems that offer\nprocessing of two threads on a single processor core. With this update, the\n\"__max_smt_threads()\" function has been fixed. As a result, both threads\nare now detected correctly in the described situation. (BZ#1625334)\n\n* Previously, a kernel panic occurred when the kernel tried to make an out\nof bound access to the array that describes the L1 Terminal Fault (L1TF)\nmitigation state on systems without Extended Page Tables (EPT) support. \nThis update extends the array of mitigation states to cover all the states,\nwhich effectively prevents out of bound array access. Also, this update\nenables rejecting invalid, irrelevant values, that might be erroneously\nprovided by the userspace. As a result, the kernel no longer panics in the\ndescribed scenario. (BZ#1629633)\n\n4",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      },
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "db": "PACKETSTORM",
        "id": "150312"
      },
      {
        "db": "PACKETSTORM",
        "id": "150068"
      },
      {
        "db": "PACKETSTORM",
        "id": "150057"
      },
      {
        "db": "PACKETSTORM",
        "id": "148914"
      },
      {
        "db": "PACKETSTORM",
        "id": "149024"
      },
      {
        "db": "PACKETSTORM",
        "id": "149830"
      },
      {
        "db": "PACKETSTORM",
        "id": "149826"
      },
      {
        "db": "PACKETSTORM",
        "id": "148916"
      }
    ],
    "trust": 3.24
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#641765",
        "trust": 3.4
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391",
        "trust": 3.4
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2019/06/28/2",
        "trust": 1.8
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2019/07/06/4",
        "trust": 1.8
      },
      {
        "db": "OPENWALL",
        "id": "OSS-SECURITY/2019/07/06/3",
        "trust": 1.8
      },
      {
        "db": "SIEMENS",
        "id": "SSA-377115",
        "trust": 1.8
      },
      {
        "db": "SECTRACK",
        "id": "1041476",
        "trust": 1.8
      },
      {
        "db": "SECTRACK",
        "id": "1041637",
        "trust": 1.8
      },
      {
        "db": "BID",
        "id": "105108",
        "trust": 1.8
      },
      {
        "db": "JVN",
        "id": "JVNVU93630542",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570",
        "trust": 0.7
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2019.0545",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2019.0623",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2019.0854",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2020.1315",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2019.0675",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-105-05",
        "trust": 0.6
      },
      {
        "db": "PACKETSTORM",
        "id": "148928",
        "trust": 0.1
      },
      {
        "db": "VULHUB",
        "id": "VHN-135422",
        "trust": 0.1
      },
      {
        "db": "VULMON",
        "id": "CVE-2018-5391",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "150312",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "150068",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "150057",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "148914",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "149024",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "149830",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "149826",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "148916",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "PACKETSTORM",
        "id": "150312"
      },
      {
        "db": "PACKETSTORM",
        "id": "150068"
      },
      {
        "db": "PACKETSTORM",
        "id": "150057"
      },
      {
        "db": "PACKETSTORM",
        "id": "148914"
      },
      {
        "db": "PACKETSTORM",
        "id": "149024"
      },
      {
        "db": "PACKETSTORM",
        "id": "149830"
      },
      {
        "db": "PACKETSTORM",
        "id": "149826"
      },
      {
        "db": "PACKETSTORM",
        "id": "148916"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "id": "VAR-201809-1153",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      }
    ],
    "trust": 0.6094988166666666
  },
  "last_update_date": "2024-09-19T20:26:19.120000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "\u682a\u5f0f\u4f1a\u793e\u30a4\u30f3\u30bf\u30fc\u30cd\u30c3\u30c8\u30a4\u30cb\u30b7\u30a2\u30c6\u30a3\u30d6\u304b\u3089\u306e\u60c5\u5831",
        "trust": 0.8,
        "url": "https://jvn.jp/vu/JVNVU93630542/317632/index.html"
      },
      {
        "title": "Linux kernel Security vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=84156"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182846 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security, bug fix, and enhancement update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20183459 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182785 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182925 - Security Advisory"
      },
      {
        "title": "Debian Security Advisories: DSA-4272-1 linux -- security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=c4fc75c3940ecd62e6e3d43c90c1ead1"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182791 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182924 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20183590 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security, bug fix, and enhancement update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20183540 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182933 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel-rt security and bug fix update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20183586 - Security Advisory"
      },
      {
        "title": "Arch Linux Advisories: [ASA-201903-11] linux-hardened: denial of service",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-201903-11"
      },
      {
        "title": "Ubuntu Security Notice: linux-hwe, linux-azure, linux-gcp vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3740-2"
      },
      {
        "title": "IBM: IBM Security Bulletin: Vulnerability in the Linux kernel affects IBM SAN Volume Controller, IBM Storwize, IBM Spectrum Virtualize and IBM FlashSystem products (CVE-2018-5391)",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=0e5803196f7b186e3c0e200d43325ad6"
      },
      {
        "title": "Red Hat: CVE-2018-5391",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2018-5391"
      },
      {
        "title": "Cisco: Linux Kernel IP Fragment Reassembly Denial of Service Vulnerability Affecting Cisco Products: August 2018",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=cisco_security_advisories_and_alerts_ciscoproducts\u0026qid=cisco-sa-20180824-linux-ip-fragment"
      },
      {
        "title": "Ubuntu Security Notice: linux, linux-aws, linux-azure, linux-gcp, linux-kvm, linux-oem, linux-raspi2 vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3740-1"
      },
      {
        "title": "Arch Linux Issues: ",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=CVE-2018-5391"
      },
      {
        "title": "Ubuntu Security Notice: linux regressions",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3741-3"
      },
      {
        "title": "Ubuntu Security Notice: linux-lts-xenial, linux-aws vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3741-2"
      },
      {
        "title": "IBM: IBM Security Bulletin: This Power System update is being released to address CVE-2018-5391",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=c5babfeb02fdf3e145c777d8eb6dfd0f"
      },
      {
        "title": "Ubuntu Security Notice: linux, linux-aws, linux-kvm, linux-raspi2, linux-snapdragon vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3741-1"
      },
      {
        "title": "IBM: IBM Security Bulletin: IBM has announced a release for IBM Security Identity Governance and Intelligence in response to security vulnerability (CVE-2018-5391)",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=cb5671de27781f97454cf1b56d2087e0"
      },
      {
        "title": "IBM: IBM Security Bulletin: IBM MQ Appliance is affected by a kernel vulnerability (CVE-2018-5391)",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=4b24750b4f4494d02c26c4b32a0e107a"
      },
      {
        "title": "Ubuntu Security Notice: linux-lts-trusty regressions",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3742-3"
      },
      {
        "title": "Ubuntu Security Notice: linux-lts-trusty vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3742-2"
      },
      {
        "title": "Ubuntu Security Notice: linux vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3742-1"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=d3eead9065d15844d9f0f319ebc3ef51"
      },
      {
        "title": "Amazon Linux AMI: ALAS-2018-1058",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux_ami\u0026qid=ALAS-2018-1058"
      },
      {
        "title": "Amazon Linux 2: ALAS2-2018-1058",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=ALAS2-2018-1058"
      },
      {
        "title": "Palo Alto Networks Security Advisory: ",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=palo_alto_networks_security_advisory\u0026qid=0944feb15e174ce784cc2c5c40d923ea"
      },
      {
        "title": "Red Hat: Important: kernel-alt security, bug fix, and enhancement update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182948 - Security Advisory"
      },
      {
        "title": "Palo Alto Networks Security Advisory: CVE-2018-5391 Information about FragmentSmack findings",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=palo_alto_networks_security_advisory\u0026qid=3c616fb9e55ec6924cfd6ba2622c6c7e"
      },
      {
        "title": "Red Hat: Important: kernel security, bug fix, and enhancement update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20183083 - Security Advisory"
      },
      {
        "title": "Red Hat: Important: kernel-rt security, bug fix, and enhancement update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20183096 - Security Advisory"
      },
      {
        "title": "Symantec Security Advisories: Linux Kernel Aug 2017 - Sep 2018 Vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=symantec_security_advisories\u0026qid=b3193a96468975c04eb9f136ca9abec4"
      },
      {
        "title": "IBM: IBM Security Bulletin: IBM Security Guardium is affected by Red Hat kernel vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=75b9d198a73a91d81765c8b428423224"
      },
      {
        "title": "Oracle Linux Bulletins: Oracle Linux Bulletin - July 2018",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=204a1aa9ebf7b5f47151e8b011269862"
      },
      {
        "title": "Oracle VM Server for x86 Bulletins: Oracle VM Server for x86 Bulletin - July 2018",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_vm_server_for_x86_bulletins\u0026qid=05b5bbd6fb289370b459faf1f4e3919d"
      },
      {
        "title": "Oracle Linux Bulletins: Oracle Linux Bulletin - October 2018",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=9cb9a8ed428c6faca615e91d2f1a216d"
      },
      {
        "title": "IBM: IBM Security Bulletin: Multiple Security Vulnerabilities have been fixed in IBM Security Privileged Identity Manager Appliance.",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=f5bb2b180c7c77e5a02747a1f31830d9"
      },
      {
        "title": "IBM: IBM Security Bulletin: IBM API Connect has addressed multiple vulnerabilities in Developer Portal\u2019s dependencies \u2013 Cumulative list from June 28, 2018 to December 13, 2018",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=43da2cd72c1e378d8d94ecec029fcc61"
      },
      {
        "title": "my_ref",
        "trust": 0.1,
        "url": "https://github.com/chetanshirke/my_ref "
      },
      {
        "title": "",
        "trust": 0.1,
        "url": "https://github.com/ozipoetra/natvps-dns "
      },
      {
        "title": "cve_diff_checker",
        "trust": 0.1,
        "url": "https://github.com/lcatro/cve_diff_checker "
      },
      {
        "title": "SamsungReleaseNotes",
        "trust": 0.1,
        "url": "https://github.com/samreleasenotes/SamsungReleaseNotes "
      },
      {
        "title": "BleepingComputer",
        "trust": 0.1,
        "url": "https://www.bleepingcomputer.com/news/security/windows-systems-vulnerable-to-fragmentsmack-90s-like-dos-bug/"
      },
      {
        "title": "BleepingComputer",
        "trust": 0.1,
        "url": "https://www.bleepingcomputer.com/news/linux/two-ddos-friendly-bugs-fixed-in-linux-kernel/"
      },
      {
        "title": "BleepingComputer",
        "trust": 0.1,
        "url": "https://www.bleepingcomputer.com/news/security/over-80-cisco-products-affected-by-fragmentsmack-dos-bug/"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-400",
        "trust": 1.8
      },
      {
        "problemtype": "CWE-20",
        "trust": 1.1
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 3.0,
        "url": "http://www.securityfocus.com/bid/105108"
      },
      {
        "trust": 2.7,
        "url": "https://www.kb.cert.org/vuls/id/641765"
      },
      {
        "trust": 2.4,
        "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00017.html"
      },
      {
        "trust": 1.9,
        "url": "https://access.redhat.com/errata/rhsa-2018:2924"
      },
      {
        "trust": 1.9,
        "url": "https://access.redhat.com/errata/rhsa-2018:2933"
      },
      {
        "trust": 1.9,
        "url": "https://access.redhat.com/errata/rhsa-2018:3083"
      },
      {
        "trust": 1.9,
        "url": "https://access.redhat.com/errata/rhsa-2018:3096"
      },
      {
        "trust": 1.9,
        "url": "https://access.redhat.com/errata/rhsa-2018:3586"
      },
      {
        "trust": 1.8,
        "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2018-004.txt"
      },
      {
        "trust": 1.8,
        "url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200115-01-linux-en"
      },
      {
        "trust": 1.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-377115.pdf"
      },
      {
        "trust": 1.8,
        "url": "https://security.netapp.com/advisory/ntap-20181003-0002/"
      },
      {
        "trust": 1.8,
        "url": "https://www.debian.org/security/2018/dsa-4272"
      },
      {
        "trust": 1.8,
        "url": "https://git.kernel.org/pub/scm/linux/kernel/git/davem/net-next.git/commit/?id=c30f1fc041b74ecdb072dd44f858750414b8b19f"
      },
      {
        "trust": 1.8,
        "url": "https://lists.debian.org/debian-lts-announce/2018/08/msg00014.html"
      },
      {
        "trust": 1.8,
        "url": "http://www.openwall.com/lists/oss-security/2019/06/28/2"
      },
      {
        "trust": 1.8,
        "url": "http://www.openwall.com/lists/oss-security/2019/07/06/3"
      },
      {
        "trust": 1.8,
        "url": "http://www.openwall.com/lists/oss-security/2019/07/06/4"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:2785"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:2791"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:2846"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:2925"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:2948"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:3459"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:3540"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/errata/rhsa-2018:3590"
      },
      {
        "trust": 1.8,
        "url": "http://www.securitytracker.com/id/1041476"
      },
      {
        "trust": 1.8,
        "url": "http://www.securitytracker.com/id/1041637"
      },
      {
        "trust": 1.8,
        "url": "https://usn.ubuntu.com/3740-1/"
      },
      {
        "trust": 1.8,
        "url": "https://usn.ubuntu.com/3740-2/"
      },
      {
        "trust": 1.8,
        "url": "https://usn.ubuntu.com/3741-1/"
      },
      {
        "trust": 1.8,
        "url": "https://usn.ubuntu.com/3741-2/"
      },
      {
        "trust": 1.8,
        "url": "https://usn.ubuntu.com/3742-1/"
      },
      {
        "trust": 1.8,
        "url": "https://usn.ubuntu.com/3742-2/"
      },
      {
        "trust": 1.6,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5391"
      },
      {
        "trust": 1.1,
        "url": "https://support.f5.com/csp/article/k74374841?utm_source=f5support\u0026amp%3butm_medium=rss"
      },
      {
        "trust": 0.8,
        "url": "about vulnerability notes"
      },
      {
        "trust": 0.8,
        "url": "contact us about this vulnerability"
      },
      {
        "trust": 0.8,
        "url": "provide a vendor statement"
      },
      {
        "trust": 0.8,
        "url": "https://www.arista.com/en/support/advisories-notices/security-advisories/5782-security-advisory-37"
      },
      {
        "trust": 0.8,
        "url": "https://supportcenter.checkpoint.com/supportcenter/portal?eventsubmit_dogoviewsolutiondetails=\u0026solutionid=sk134253"
      },
      {
        "trust": 0.8,
        "url": "https://security-tracker.debian.org/tracker/cve-2018-5391"
      },
      {
        "trust": 0.8,
        "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180022"
      },
      {
        "trust": 0.8,
        "url": "https://access.redhat.com/articles/3553061https://bugzilla.redhat.com/show_bug.cgi?id=cve-2018-5391"
      },
      {
        "trust": 0.8,
        "url": "https://www.suse.com/security/cve/cve-2018-5391"
      },
      {
        "trust": 0.8,
        "url": "https://people.canonical.com/"
      },
      {
        "trust": 0.8,
        "url": "https://www.broadcom.com/support/fibre-channel-networking/security-advisories/brocade-security-advisory-2018-690"
      },
      {
        "trust": 0.8,
        "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-5391"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu93630542/"
      },
      {
        "trust": 0.6,
        "url": "https://support.f5.com/csp/article/k74374841?utm_source=f5support\u0026utm_medium=rss"
      },
      {
        "trust": 0.6,
        "url": "https://www.suse.com/support/update/announcement/2019/suse-su-20190541-1.html"
      },
      {
        "trust": 0.6,
        "url": "https://security.business.xerox.com/wp-content/uploads/2019/11/cert_security_mini_bulletin_xrx19ak_for_altalinkb80xx-c80xx.pdf"
      },
      {
        "trust": 0.6,
        "url": "http://www.ibm.com/support/docview.wss"
      },
      {
        "trust": 0.6,
        "url": "http://www.ibm.com/support/docview.wss?uid=ibm10872368"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2020.1315/"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/75930"
      },
      {
        "trust": 0.6,
        "url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190123-01-linux-cn"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/76246"
      },
      {
        "trust": 0.6,
        "url": "http://www.ibm.com/support/docview.wss?uid=ibm10792535"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/76474"
      },
      {
        "trust": 0.6,
        "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180824-linux-ip-fragment"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-20-105-05"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/77246"
      },
      {
        "trust": 0.6,
        "url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200115-01-linux-cn"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-105-05"
      },
      {
        "trust": 0.5,
        "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/articles/3553061"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/cve/cve-2018-5391"
      },
      {
        "trust": 0.5,
        "url": "https://bugzilla.redhat.com/):"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/team/key/"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/articles/11258"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/team/contact/"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/updates/classification/#important"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5390"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18344"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2018-14634"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2017-18344"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10675"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14634"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2018-10675"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/vulnerabilities/mutagen-astronomy"
      },
      {
        "trust": 0.3,
        "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/l1tf"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3646"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3620"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-13405"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-7740"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5803"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2017-18232"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5344"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-1094"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18208"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10940"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17805"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10881"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-1092"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-1120"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-13405"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18232"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000026"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1094"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-7757"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10940"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-0861"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1118"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1130"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2017-10661"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2017-17805"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10879"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10902"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2015-8830"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10883"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-7740"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-5848"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10322"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2016-4913"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10883"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-1118"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-5803"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10878"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10879"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10902"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-1000026"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2017-0861"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-8781"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2015-8830"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10322"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10881"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1092"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5848"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2016-4913"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2017-18208"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-1130"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-10661"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1120"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-10878"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-5344"
      },
      {
        "trust": 0.2,
        "url": "https://usn.ubuntu.com/usn/usn-3741-1"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2018-5390"
      },
      {
        "trust": 0.1,
        "url": "https://support.f5.com/csp/article/k74374841?utm_source=f5support\u0026amp;amp;utm_medium=rss"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/20.html"
      },
      {
        "trust": 0.1,
        "url": "https://github.com/chetanshirke/my_ref"
      },
      {
        "trust": 0.1,
        "url": "https://tools.cisco.com/security/center/viewalert.x?alertid=58766"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/7/html/7.6_release_notes/index"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/7/html/7.6_release_notes/index.html"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux/4.4.0-133.159"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux-raspi2/4.4.0-1094.102"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux-snapdragon/4.4.0-1098.103"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux-aws/4.4.0-1065.75"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux-kvm/4.4.0-1031.37"
      },
      {
        "trust": 0.1,
        "url": "https://usn.ubuntu.com/usn/usn-3742-2"
      },
      {
        "trust": 0.1,
        "url": "https://usn.ubuntu.com/usn/usn-3742-3"
      },
      {
        "trust": 0.1,
        "url": "https://bugs.launchpad.net/ubuntu/+source/linux/+bug/1787258"
      },
      {
        "trust": 0.1,
        "url": "https://bugs.launchpad.net/ubuntu/+source/linux/+bug/1787127"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux-aws/4.4.0-1027.30"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/linux-lts-xenial/4.4.0-133.159~14.04.1"
      },
      {
        "trust": 0.1,
        "url": "https://usn.ubuntu.com/usn/usn-3741-2"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "PACKETSTORM",
        "id": "150312"
      },
      {
        "db": "PACKETSTORM",
        "id": "150068"
      },
      {
        "db": "PACKETSTORM",
        "id": "150057"
      },
      {
        "db": "PACKETSTORM",
        "id": "148914"
      },
      {
        "db": "PACKETSTORM",
        "id": "149024"
      },
      {
        "db": "PACKETSTORM",
        "id": "149830"
      },
      {
        "db": "PACKETSTORM",
        "id": "149826"
      },
      {
        "db": "PACKETSTORM",
        "id": "148916"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "db": "PACKETSTORM",
        "id": "150312"
      },
      {
        "db": "PACKETSTORM",
        "id": "150068"
      },
      {
        "db": "PACKETSTORM",
        "id": "150057"
      },
      {
        "db": "PACKETSTORM",
        "id": "148914"
      },
      {
        "db": "PACKETSTORM",
        "id": "149024"
      },
      {
        "db": "PACKETSTORM",
        "id": "149830"
      },
      {
        "db": "PACKETSTORM",
        "id": "149826"
      },
      {
        "db": "PACKETSTORM",
        "id": "148916"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2018-08-14T00:00:00",
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "date": "2018-09-06T00:00:00",
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "date": "2018-09-06T00:00:00",
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "date": "2018-08-28T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "date": "2018-11-13T18:04:13",
        "db": "PACKETSTORM",
        "id": "150312"
      },
      {
        "date": "2018-10-31T01:11:41",
        "db": "PACKETSTORM",
        "id": "150068"
      },
      {
        "date": "2018-10-31T01:00:50",
        "db": "PACKETSTORM",
        "id": "150057"
      },
      {
        "date": "2018-08-15T04:42:46",
        "db": "PACKETSTORM",
        "id": "148914"
      },
      {
        "date": "2018-08-21T20:20:00",
        "db": "PACKETSTORM",
        "id": "149024"
      },
      {
        "date": "2018-10-17T15:42:07",
        "db": "PACKETSTORM",
        "id": "149830"
      },
      {
        "date": "2018-10-17T15:40:19",
        "db": "PACKETSTORM",
        "id": "149826"
      },
      {
        "date": "2018-08-15T04:42:57",
        "db": "PACKETSTORM",
        "id": "148916"
      },
      {
        "date": "2018-08-20T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "date": "2018-09-06T21:29:00.363000",
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2018-10-12T00:00:00",
        "db": "CERT/CC",
        "id": "VU#641765"
      },
      {
        "date": "2022-12-28T00:00:00",
        "db": "VULHUB",
        "id": "VHN-135422"
      },
      {
        "date": "2023-11-07T00:00:00",
        "db": "VULMON",
        "id": "CVE-2018-5391"
      },
      {
        "date": "2019-07-26T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2018-006630"
      },
      {
        "date": "2022-12-29T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      },
      {
        "date": "2023-11-07T02:58:42.587000",
        "db": "NVD",
        "id": "CVE-2018-5391"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Linux kernel IP fragment re-assembly vulnerable to denial of service",
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#641765"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "input validation error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201808-570"
      }
    ],
    "trust": 0.6
  }
}

var-202210-0430
Vulnerability from variot

A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (All versions < V7.1.2), RUGGEDCOM RM1224 LTE(4G) NAM (All versions < V7.1.2), SCALANCE M804PB (All versions < V7.1.2), SCALANCE M812-1 ADSL-Router (Annex A) (All versions < V7.1.2), SCALANCE M812-1 ADSL-Router (Annex B) (All versions < V7.1.2), SCALANCE M816-1 ADSL-Router (Annex A) (All versions < V7.1.2), SCALANCE M816-1 ADSL-Router (Annex B) (All versions < V7.1.2), SCALANCE M826-2 SHDSL-Router (All versions < V7.1.2), SCALANCE M874-2 (All versions < V7.1.2), SCALANCE M874-3 (All versions < V7.1.2), SCALANCE M876-3 (EVDO) (All versions < V7.1.2), SCALANCE M876-3 (ROK) (All versions < V7.1.2), SCALANCE M876-4 (All versions < V7.1.2), SCALANCE M876-4 (EU) (All versions < V7.1.2), SCALANCE M876-4 (NAM) (All versions < V7.1.2), SCALANCE MUM853-1 (EU) (All versions < V7.1.2), SCALANCE MUM856-1 (EU) (All versions < V7.1.2), SCALANCE MUM856-1 (RoW) (All versions < V7.1.2), SCALANCE S615 (All versions < V7.1.2), SCALANCE S615 EEC (All versions < V7.1.2), SCALANCE WAM763-1 (All versions >= V1.1.0 < V2.0), SCALANCE WAM766-1 (EU) (All versions >= V1.1.0 < V2.0), SCALANCE WAM766-1 (US) (All versions >= V1.1.0 < V2.0), SCALANCE WAM766-1 EEC (EU) (All versions >= V1.1.0 < V2.0), SCALANCE WAM766-1 EEC (US) (All versions >= V1.1.0 < V2.0), SCALANCE WUM763-1 (All versions >= V1.1.0 < V2.0), SCALANCE WUM763-1 (All versions >= V1.1.0 < V2.0), SCALANCE WUM766-1 (EU) (All versions >= V1.1.0 < V2.0), SCALANCE WUM766-1 (US) (All versions >= V1.1.0 < V2.0). Affected devices with TCP Event service enabled do not properly handle malformed packets. This could allow an unauthenticated remote attacker to cause a denial of service condition and reboot the device thus possibly affecting other network resources.

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202210-0430",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m874-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance wam766-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.0"
      },
      {
        "model": "scalance m804pb",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance mum856-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance wum763-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.0"
      },
      {
        "model": "scalance m874-3",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance m876-3",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance mum853-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance m826-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance m812-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance wam763-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.0"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance wum766-1",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.0"
      },
      {
        "model": "scalance m816-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      },
      {
        "model": "scalance m876-4",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1.2"
      }
    ],
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Martin Grubhofer and Michael Messner of Siemens Energy reported this vulnerability to Siemens.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-31766",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "HIGH",
            "baseScore": 8.6,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2022-31766",
            "impactScore": 4.0,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "CHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:C/C:N/I:N/A:H",
            "version": "3.1"
          }
        ],
        "severity": [
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-31766",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-31766",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202210-395",
            "trust": 0.6,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (All versions \u003c V7.1.2), RUGGEDCOM RM1224 LTE(4G) NAM (All versions \u003c V7.1.2), SCALANCE M804PB (All versions \u003c V7.1.2), SCALANCE M812-1 ADSL-Router (Annex A) (All versions \u003c V7.1.2), SCALANCE M812-1 ADSL-Router (Annex B) (All versions \u003c V7.1.2), SCALANCE M816-1 ADSL-Router (Annex A) (All versions \u003c V7.1.2), SCALANCE M816-1 ADSL-Router (Annex B) (All versions \u003c V7.1.2), SCALANCE M826-2 SHDSL-Router (All versions \u003c V7.1.2), SCALANCE M874-2 (All versions \u003c V7.1.2), SCALANCE M874-3 (All versions \u003c V7.1.2), SCALANCE M876-3 (EVDO) (All versions \u003c V7.1.2), SCALANCE M876-3 (ROK) (All versions \u003c V7.1.2), SCALANCE M876-4 (All versions \u003c V7.1.2), SCALANCE M876-4 (EU) (All versions \u003c V7.1.2), SCALANCE M876-4 (NAM) (All versions \u003c V7.1.2), SCALANCE MUM853-1 (EU) (All versions \u003c V7.1.2), SCALANCE MUM856-1 (EU) (All versions \u003c V7.1.2), SCALANCE MUM856-1 (RoW) (All versions \u003c V7.1.2), SCALANCE S615 (All versions \u003c V7.1.2), SCALANCE S615 EEC (All versions \u003c V7.1.2), SCALANCE WAM763-1 (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WAM766-1 (EU) (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WAM766-1 (US) (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WAM766-1 EEC (EU) (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WAM766-1 EEC (US) (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WUM763-1 (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WUM763-1 (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WUM766-1 (EU) (All versions \u003e= V1.1.0 \u003c V2.0), SCALANCE WUM766-1 (US) (All versions \u003e= V1.1.0 \u003c V2.0). Affected devices with TCP Event service enabled do not properly handle malformed packets.\r\nThis could allow an unauthenticated remote attacker to cause a denial of service condition and reboot the device thus possibly affecting other network resources.",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ],
    "trust": 1.0
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-31766",
        "trust": 1.6
      },
      {
        "db": "SIEMENS",
        "id": "SSA-697140",
        "trust": 1.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-286-08",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2022.5100",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "id": "VAR-202210-0430",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.39285713
  },
  "last_update_date": "2024-08-14T13:42:20.454000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Siemens RUGGEDCOM RM1224 Enter the fix for the verification error vulnerability",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=210522"
      }
    ],
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-20",
        "trust": 1.0
      }
    ],
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 1.6,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-697140.pdf"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-286-08"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2022.5100"
      },
      {
        "trust": 0.6,
        "url": "https://vigilance.fr/vulnerability/ruggedcom-rm1224-denial-of-service-via-tcp-event-service-39512"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-31766/"
      }
    ],
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-10-11T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      },
      {
        "date": "2022-10-11T11:15:09.810000",
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-03-15T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      },
      {
        "date": "2023-11-07T03:47:41.190000",
        "db": "NVD",
        "id": "CVE-2022-31766"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens RUGGEDCOM RM1224 Input validation error vulnerability",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      }
    ],
    "trust": 0.6
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "input validation error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202210-395"
      }
    ],
    "trust": 0.6
  }
}

var-202002-0449
Vulnerability from variot

Profinet-IO (PNIO) stack versions prior V06.00 do not properly limit internal resource allocation when multiple legitimate diagnostic package requests are sent to the DCE-RPC interface. This could lead to a denial of service condition due to lack of memory for devices that include a vulnerable version of the stack.

The security vulnerability could be exploited by an attacker with network access to an affected device. Successful exploitation requires no system privileges and no user interaction. An attacker could use the vulnerability to compromise the availability of the device. Several Siemens products contain resource exhaustion vulnerabilities.Service operation interruption (DoS) It may be put into a state. Both Siemens SCALANCE X-200IRT and SCALANCE XB-200 are products of the German company Siemens. SCALANCE X-200IRT is an industrial Ethernet switch. SCALANCE XB-200 is a managed industrial Ethernet switch. The vulnerability stems from the program's failure to limit the allocation of memory resources. A remote attacker can use the vulnerability by sending a specially crafted package to cause a denial of service. A vulnerability has been identified in Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200 (All Versions < V4.5), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P (All Versions < V4.6), PROFINET Driver for Controller (All Versions < V2.1), RUGGEDCOM RM1224 (All versions < V4.3), SCALANCE M-800 / S615 (All versions < V4.3), SCALANCE W700 IEEE 802.11n (All versions <= V6.0.1), SCALANCE X-200 switch family (incl. SIPLUS NET variants) (All versions), SCALANCE X-200IRT switch family (incl. SIPLUS NET variants) (All Versions < V5.3), SCALANCE X-300 switch family (incl. X408 and SIPLUS NET variants) (All versions), SCALANCE XB-200, XC-200, XP-200, XF-200BA and XR-300WG (All Versions < V3.0), SCALANCE XM-400 switch family (All Versions < V6.0), SCALANCE XR-500 switch family (All Versions < V6.0), SIMATIC CP 1616 and CP 1604 (All Versions < V2.8), SIMATIC CP 343-1 (incl. SIPLUS NET variants) (All versions), SIMATIC CP 343-1 Advanced (incl. SIPLUS NET variants) (All versions), SIMATIC CP 343-1 ERPC (All versions), SIMATIC CP 343-1 LEAN (incl. SIPLUS NET variants) (All versions), SIMATIC CP 443-1 (incl. SIPLUS NET variants) (All versions), SIMATIC CP 443-1 Advanced (incl. SIPLUS NET variants) (All versions), SIMATIC CP 443-1 OPC UA (All versions), SIMATIC ET200AL IM 157-1 PN (All versions), SIMATIC ET200M IM153-4 PN IO HF (incl. SIPLUS variants) (All versions), SIMATIC ET200M IM153-4 PN IO ST (incl. SIPLUS variants) (All versions), SIMATIC ET200MP IM155-5 PN HF (incl. SIPLUS variants) (All Versions < V4.2.0), SIMATIC ET200MP IM155-5 PN ST (incl. SIPLUS variants) (All Versions < V4.1.0), SIMATIC ET200S (incl. SIPLUS variants) (All versions), SIMATIC ET200SP IM155-6 PN Basic (incl. SIPLUS variants) (All versions), SIMATIC ET200SP IM155-6 PN HF (incl. SIPLUS variants) (All Versions < V3.3.1), SIMATIC ET200SP IM155-6 PN ST (incl. SIPLUS variants) (All Versions < V4.1.0), SIMATIC ET200ecoPN (except 6ES7148-6JD00-0AB0 and 6ES7146-6FF00-0AB0) (All versions), SIMATIC ET200pro, IM 154-3 PN HF (All versions), SIMATIC ET200pro, IM 154-4 PN HF (All versions), SIMATIC IPC Support, Package for VxWorks (All versions), SIMATIC MV400 family (All versions), SIMATIC PN/PN Coupler 6ES7158-3AD01-0XA0 (incl. SIPLUS NET variant) (All Versions), SIMATIC RF180C (All versions), SIMATIC RF182C (All versions), SIMATIC RF600 family (All versions < V3), SINAMICS DCP (All Versions < V1.3), SOFTNET-IE PNIO (All versions)

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202002-0449",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance xb-200",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "scalance xc-200",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "scalance xp-200",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "scalance xr-300wg",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "sinamics dcp",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "1.3"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "simatic et200mp im155-5 pn hf",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.2.0"
      },
      {
        "model": "simatic et200mp im155-5 pn st",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "simatic et200sp im155-6 pn hf",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "3.3.1"
      },
      {
        "model": "simatic et200sp im155-6 pn st",
        "scope": "lt",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "scalance xb-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic mv440",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic ipc support",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic rf600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "im 154-4 pn hf",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "simatic et200m im153-4 pn io st",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 343-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic et200ecopn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic mv420",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x-200irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.3"
      },
      {
        "model": "simatic rf180c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic et200al im 157-1 pn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0.1"
      },
      {
        "model": "scalance x-400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "scalance xr528",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "simatic cp 443-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm-400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "simatic cp 1616",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.8"
      },
      {
        "model": "scalance xc-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance x-300",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "simatic et200sp im155-6 pn basic",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "profinet driver",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "ek-ertec 200p",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.6"
      },
      {
        "model": "scalance xp-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 343-1 advanced",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 343-1 erpc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "simatic et200pro",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 343-1 lean",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 443-1 advanced",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic et200s",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "simatic cp 443-1 opc ua",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "im 154-3 pn hf",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic pn\\/pn coupler",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 1604",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.8"
      },
      {
        "model": "scalance xf-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ek-ertec 200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "simatic rf182c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic et200m im153-4 pn io hf",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ek-ertec 200",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ek-ertec 200p p",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "profinet driver",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ruggedcom rm1224",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic ipc support",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp lean",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "simatic cp advanced",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "simatic rf182c",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic pn/pn coupler 6es7158-3ad01-0xa0",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1616\u003c2.8"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1604\u003c2.8"
      },
      {
        "model": "simatic cp advanced",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "443-1"
      },
      {
        "model": "development/evaluation kits for profinet io dk standard ethernet controller",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "development/evaluation kits for profinet io ek-ertec",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "200\u003c4.5"
      },
      {
        "model": "development/evaluation kits for profinet io ek-ertec 200p",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "4.6"
      },
      {
        "model": "profinet driver for controller",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "scalance m-800/s615",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "4.3"
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": "lte",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "\u003c=6.0.1"
      },
      {
        "model": "scalance switch",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x-200"
      },
      {
        "model": "scalance x-200irt switch",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "5.3"
      },
      {
        "model": "scalance switch",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x-300"
      },
      {
        "model": "scalance xm-400 switch",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "scalance xr-500 switch",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "6.0"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "simatic cp erpc",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "443-1"
      },
      {
        "model": "simatic cp opc ua",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "443-1"
      },
      {
        "model": "simatic et200al im pn",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "157-1"
      },
      {
        "model": "simatic et200m im153-4 pn io hf",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et200m im153-4 pn io st",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et200s",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et200sp im155-6 pn basic",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et200ecopn",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic ipc support,package for vxworks",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et200pro,im pn hf",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "154-3"
      },
      {
        "model": "simatic et200pro,im pn hf",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "154-4"
      },
      {
        "model": "simatic mv400",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf180c",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf600",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "3"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "scalance xp 200",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "scalance xb 200",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "scalance xr 300wg",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "scalance xc 200",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "dk standard ethernet controller",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "profinet driver",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic ipc support",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x 200irt",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x 200irt pro",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x 300",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr 300",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ek ertec 200",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xf 200ba",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x 400",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xm 400",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr524",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr526",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr528",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr552",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1616",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1604",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ek ertec 200p",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 advanced",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 erpc",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 lean",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 advanced",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 opc ua",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200al im 157 1 pn",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200m im153 4 pn io hf",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200m im153 4 pn io st",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ruggedcom rm1224",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200mp im155 5 pn hf",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200mp im155 5 pn st",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200s",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200sp im155 6 pn basic",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200sp im155 6 pn hf",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200sp im155 6 pn st",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200ecopn",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et200pro",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "im 154 3 pn hf",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "im 154 4 pn hf",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance m 800",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic mv440",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic mv420",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic pn pn coupler",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf180c",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf182c",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf600",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics dcp",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance s615",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance w700 ieee 802 11n",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xf 200",
        "version": "*"
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:siemens:dk_standard_ethernet_controller_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ek-ertec_200_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ek-ertec_200p_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/a:siemens:profinet_driver",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ruggedcom_rm1224_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_m-800_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_s615_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_w700_ieee_802.11n_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_xc-200_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/a:siemens:simatic_ipc_support",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Yuval Ardon and Matan Dobrushin of OTORIO reported this vulnerability to CISA and Siemens.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2019-13946",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2019-13946",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 1.1,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "acInsufInfo": null,
            "accessComplexity": "Low",
            "accessVector": "Network",
            "authentication": "None",
            "author": "NVD",
            "availabilityImpact": "Complete",
            "baseScore": 7.8,
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "JVNDB-2019-014603",
            "impactScore": null,
            "integrityImpact": "None",
            "obtainAllPrivilege": null,
            "obtainOtherPrivilege": null,
            "obtainUserPrivilege": null,
            "severity": "High",
            "trust": 0.8,
            "userInteractionRequired": null,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CNVD-2020-23039",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "IVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 0.2,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.9 [IVD]"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2019-13946",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 7.5,
            "baseSeverity": "High",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "JVNDB-2019-014603",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2019-13946",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2019-13946",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "JVNDB-2019-014603",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2020-23039",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202002-455",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "IVD",
            "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9",
            "trust": 0.2,
            "value": "HIGH"
          },
          {
            "author": "VULMON",
            "id": "CVE-2019-13946",
            "trust": 0.1,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Profinet-IO (PNIO) stack versions prior V06.00 do not properly limit\ninternal resource allocation when multiple legitimate diagnostic package\nrequests are sent to the DCE-RPC interface. \nThis could lead to a denial of service condition due to lack of memory\nfor devices that include a vulnerable version of the stack. \n\nThe security vulnerability could be exploited by an attacker with network\naccess to an affected device. Successful exploitation requires no system\nprivileges and no user interaction. An attacker could use the vulnerability\nto compromise the availability of the device. Several Siemens products contain resource exhaustion vulnerabilities.Service operation interruption (DoS) It may be put into a state. Both Siemens SCALANCE X-200IRT and SCALANCE XB-200 are products of the German company Siemens. SCALANCE X-200IRT is an industrial Ethernet switch. SCALANCE XB-200 is a managed industrial Ethernet switch. The vulnerability stems from the program\u0027s failure to limit the allocation of memory resources. A remote attacker can use the vulnerability by sending a specially crafted package to cause a denial of service. A vulnerability has been identified in Development/Evaluation Kits for PROFINET IO: DK Standard Ethernet Controller (All versions), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200 (All Versions \u003c V4.5), Development/Evaluation Kits for PROFINET IO: EK-ERTEC 200P (All Versions \u003c V4.6), PROFINET Driver for Controller (All Versions \u003c V2.1), RUGGEDCOM RM1224 (All versions \u003c V4.3), SCALANCE M-800 / S615 (All versions \u003c V4.3), SCALANCE W700 IEEE 802.11n (All versions \u003c= V6.0.1), SCALANCE X-200 switch family (incl. SIPLUS NET variants) (All versions), SCALANCE X-200IRT switch family (incl. SIPLUS NET variants) (All Versions \u003c V5.3), SCALANCE X-300 switch family (incl. X408 and SIPLUS NET variants) (All versions), SCALANCE XB-200, XC-200, XP-200, XF-200BA and XR-300WG (All Versions \u003c V3.0), SCALANCE XM-400 switch family (All Versions \u003c V6.0), SCALANCE XR-500 switch family (All Versions \u003c V6.0), SIMATIC CP 1616 and CP 1604 (All Versions \u003c V2.8), SIMATIC CP 343-1 (incl. SIPLUS NET variants) (All versions), SIMATIC CP 343-1 Advanced (incl. SIPLUS NET variants) (All versions), SIMATIC CP 343-1 ERPC (All versions), SIMATIC CP 343-1 LEAN (incl. SIPLUS NET variants) (All versions), SIMATIC CP 443-1 (incl. SIPLUS NET variants) (All versions), SIMATIC CP 443-1 Advanced (incl. SIPLUS NET variants) (All versions), SIMATIC CP 443-1 OPC UA (All versions), SIMATIC ET200AL IM 157-1 PN (All versions), SIMATIC ET200M IM153-4 PN IO HF (incl. SIPLUS variants) (All versions), SIMATIC ET200M IM153-4 PN IO ST (incl. SIPLUS variants) (All versions), SIMATIC ET200MP IM155-5 PN HF (incl. SIPLUS variants) (All Versions \u003c V4.2.0), SIMATIC ET200MP IM155-5 PN ST (incl. SIPLUS variants) (All Versions \u003c V4.1.0), SIMATIC ET200S (incl. SIPLUS variants) (All versions), SIMATIC ET200SP IM155-6 PN Basic (incl. SIPLUS variants) (All versions), SIMATIC ET200SP IM155-6 PN HF (incl. SIPLUS variants) (All Versions \u003c V3.3.1), SIMATIC ET200SP IM155-6 PN ST (incl. SIPLUS variants) (All Versions \u003c V4.1.0), SIMATIC ET200ecoPN (except 6ES7148-6JD00-0AB0 and 6ES7146-6FF00-0AB0) (All versions), SIMATIC ET200pro, IM 154-3 PN HF (All versions), SIMATIC ET200pro, IM 154-4 PN HF (All versions), SIMATIC IPC Support, Package for VxWorks (All versions), SIMATIC MV400 family (All versions), SIMATIC PN/PN Coupler 6ES7158-3AD01-0XA0 (incl. SIPLUS NET variant) (All Versions), SIMATIC RF180C (All versions), SIMATIC RF182C (All versions), SIMATIC RF600 family (All versions \u003c V3), SINAMICS DCP (All Versions \u003c V1.3), SOFTNET-IE PNIO (All versions)",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946"
      }
    ],
    "trust": 2.43
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2019-13946",
        "trust": 3.3
      },
      {
        "db": "SIEMENS",
        "id": "SSA-780073",
        "trust": 1.7
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-04",
        "trust": 1.5
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-05",
        "trust": 1.2
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-08",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-07",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-03",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-09",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-02",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-06",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-01",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-20-042-10",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2020.0486",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2020.0486.2",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2020.0486.3",
        "trust": 0.6
      },
      {
        "db": "IVD",
        "id": "1044E3A5-DC26-4D11-BF22-4B3EB64F5CC9",
        "trust": 0.2
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "id": "VAR-202002-0449",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      }
    ],
    "trust": 1.5791541156410256
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "ICS",
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      },
      {
        "category": [
          "ICS"
        ],
        "sub_category": null,
        "trust": 0.2
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      }
    ]
  },
  "last_update_date": "2024-08-14T13:07:26.862000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-780073",
        "trust": 0.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-780073.pdf"
      },
      {
        "title": "Patch for Multiple Siemens product resource management error vulnerabilities",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/214023"
      },
      {
        "title": "Multiple Siemens Product resource management error vulnerability fixes",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=108751"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=8b423421a5be04457be73209a34b15cb"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-400",
        "trust": 1.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.1,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-04"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-780073.pdf"
      },
      {
        "trust": 1.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2019-13946"
      },
      {
        "trust": 1.2,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-05"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-780073.html"
      },
      {
        "trust": 0.8,
        "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-13946"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-10"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-09"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-08"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-07"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-06"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-03"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-02"
      },
      {
        "trust": 0.6,
        "url": "https://www.us-cert.gov/ics/advisories/icsa-20-042-01"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2020.0486/"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2020.0486.2/"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2020.0486.3/"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-20-042-04"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/400.html"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://www.cisa.gov/uscert/ics/advisories/icsa-20-042-04"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      },
      {
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2020-02-11T00:00:00",
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "date": "2020-04-16T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "date": "2020-02-11T00:00:00",
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "date": "2020-03-04T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "date": "2020-02-11T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      },
      {
        "date": "2020-02-11T16:15:15.023000",
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2020-04-16T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2020-23039"
      },
      {
        "date": "2022-04-12T00:00:00",
        "db": "VULMON",
        "id": "CVE-2019-13946"
      },
      {
        "date": "2020-03-11T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      },
      {
        "date": "2023-04-12T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      },
      {
        "date": "2024-07-09T12:15:04.920000",
        "db": "NVD",
        "id": "CVE-2019-13946"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Resource exhaustion vulnerabilities in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2019-014603"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Resource management error",
    "sources": [
      {
        "db": "IVD",
        "id": "1044e3a5-dc26-4d11-bf22-4b3eb64f5cc9"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202002-455"
      }
    ],
    "trust": 0.8
  }
}

var-202208-0611
Vulnerability from variot

Affected devices do not properly sanitize an input field. This could allow an authenticated remote attacker with administrative privileges to inject code or spawn a system root shell. SCALANCE M-800 firmware, SCALANCE S615 firmware, SCALANCE SC-600 Multiple Siemens products such as firmware have unspecified vulnerabilities.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. SCALANCE M-800, MUM-800 and S615 and RUGGEDCOM RM1224 industrial routers are used for secure remote access to plants via mobile networks (e.g. GPRS or UMTS) and have integrated security functions of firewalls to prevent unauthorized access, as well as VPNs to Secure data transmission. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from untrusted network attacks. They allow filtering incoming and outgoing network connections in different ways. The SCALANCE W-1700 product is a wireless communication device based on the IEEE 802.11ac standard. SCALANCE W-700 products are wireless communication devices based on the IEEE 802.11ax standard. SCALANCE X switches are used to connect industrial components such as programmable logic controllers (PLC) or human machine interfaces (HMI).

A command injection vulnerability exists in Siemens SCALANCE products, which results from an affected device failing to properly filter input fields. A vulnerability has been identified in SCALANCE M-800 / S615 (All versions), SCALANCE SC-600 family (All versions < V2.3.1), SCALANCE W-1700 IEEE 802.11ac family (All versions), SCALANCE W-700 IEEE 802.11ax family (All versions), SCALANCE W-700 IEEE 802.11n family (All versions), SCALANCE XB-200 switch family (All versions), SCALANCE XC-200 switch family (All versions), SCALANCE XF-200BA switch family (All versions), SCALANCE XM-400 Family (All versions), SCALANCE XP-200 switch family (All versions), SCALANCE XR-300WG switch family (All versions), SCALANCE XR-500 Family (All versions)

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202208-0611",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance xr552-12m 2hr2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11ac",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc-600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xb208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xr324-12m ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba irt",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm400",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr500",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208 \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb213-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr328-4c wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216 \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m 2hr2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12m 2hr2 l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11ax",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb213-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr326-2c poe wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m 2hr2 l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xc208g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc-646-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb205-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-600",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11ax",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb216",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-622-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb213-3ld",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-632-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb213-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-642-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11ac",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb205-3ld",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-636-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb208",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800 s615",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "/"
      },
      {
        "model": "scalance sc-600 family",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v2.3.1"
      },
      {
        "model": "scalance w-700 ieee 802.11ax family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w-700 ieee 802.11n family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w-1700 ieee 802.11ac family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf-200ba switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm-400 family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr-300wg switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr-500 family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens has reported these vulnerabilities to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-36323",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 10.0,
            "confidentialityImpact": "COMPLETE",
            "exploitabilityScore": 10.0,
            "id": "CNVD-2022-56476",
            "impactScore": 10.0,
            "integrityImpact": "COMPLETE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:N/C:C/I:C/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "HIGH",
            "baseScore": 9.1,
            "baseSeverity": "CRITICAL",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 2.3,
            "id": "CVE-2022-36323",
            "impactScore": 6.0,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "CHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.2,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 1.2,
            "id": "CVE-2022-36323",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "OTHER",
            "availabilityImpact": "High",
            "baseScore": 9.1,
            "baseSeverity": "Critical",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "JVNDB-2022-014933",
            "impactScore": null,
            "integrityImpact": "High",
            "privilegesRequired": "High",
            "scope": "Changed",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:H/UI:N/S:C/C:H/I:H/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-36323",
            "trust": 1.0,
            "value": "CRITICAL"
          },
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-36323",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "OTHER",
            "id": "JVNDB-2022-014933",
            "trust": 0.8,
            "value": "Critical"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2022-56476",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202208-2715",
            "trust": 0.6,
            "value": "CRITICAL"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices do not properly sanitize an input field.  This could allow an authenticated remote attacker with administrative privileges to inject code or spawn a system root shell. SCALANCE M-800 firmware, SCALANCE S615 firmware, SCALANCE SC-600 Multiple Siemens products such as firmware have unspecified vulnerabilities.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. SCALANCE M-800, MUM-800 and S615 and RUGGEDCOM RM1224 industrial routers are used for secure remote access to plants via mobile networks (e.g. GPRS or UMTS) and have integrated security functions of firewalls to prevent unauthorized access, as well as VPNs to Secure data transmission. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from untrusted network attacks. They allow filtering incoming and outgoing network connections in different ways. The SCALANCE W-1700 product is a wireless communication device based on the IEEE 802.11ac standard. SCALANCE W-700 products are wireless communication devices based on the IEEE 802.11ax standard. SCALANCE X switches are used to connect industrial components such as programmable logic controllers (PLC) or human machine interfaces (HMI). \n\r\n\r\nA command injection vulnerability exists in Siemens SCALANCE products, which results from an affected device failing to properly filter input fields. A vulnerability has been identified in SCALANCE M-800 / S615 (All versions), SCALANCE SC-600 family (All versions \u003c V2.3.1), SCALANCE W-1700 IEEE 802.11ac family (All versions), SCALANCE W-700 IEEE 802.11ax family (All versions), SCALANCE W-700 IEEE 802.11n family (All versions), SCALANCE XB-200 switch family (All versions), SCALANCE XC-200 switch family (All versions), SCALANCE XF-200BA switch family (All versions), SCALANCE XM-400 Family (All versions), SCALANCE XP-200 switch family (All versions), SCALANCE XR-300WG switch family (All versions), SCALANCE XR-500 Family (All versions)",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36323"
      }
    ],
    "trust": 2.25
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-36323",
        "trust": 3.9
      },
      {
        "db": "SIEMENS",
        "id": "SSA-710008",
        "trust": 3.1
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-223-07",
        "trust": 1.5
      },
      {
        "db": "JVN",
        "id": "JVNVU90767165",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2022.4032",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36323",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36323"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "id": "VAR-202208-0611",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      }
    ],
    "trust": 1.2477712656666666
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      }
    ]
  },
  "last_update_date": "2024-08-14T14:17:45.411000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Patch for Siemens SCALANCE product command injection vulnerability",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/343616"
      },
      {
        "title": "Siemens SCALANCE Security vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=243185"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "NVD-CWE-Other",
        "trust": 1.0
      },
      {
        "problemtype": "CWE-74",
        "trust": 1.0
      },
      {
        "problemtype": "others (CWE-Other) [NVD evaluation ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.5,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu90767165/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-36323"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-223-07"
      },
      {
        "trust": 0.6,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-710008.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2022.4032"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-36323/"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-223-07"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/74.html"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://www.cisa.gov/uscert/ics/advisories/icsa-22-223-07"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36323"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36323"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-12T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "VULMON",
        "id": "CVE-2022-36323"
      },
      {
        "date": "2023-09-22T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      },
      {
        "date": "2022-08-10T12:15:12.863000",
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-12T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2022-56476"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "VULMON",
        "id": "CVE-2022-36323"
      },
      {
        "date": "2023-09-22T08:25:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      },
      {
        "date": "2023-06-28T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      },
      {
        "date": "2023-06-27T19:43:45.920000",
        "db": "NVD",
        "id": "CVE-2022-36323"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Vulnerabilities in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014933"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2715"
      }
    ],
    "trust": 0.6
  }
}

var-202208-0610
Vulnerability from variot

Affected devices do not properly handle the renegotiation of SSL/TLS parameters. This could allow an unauthenticated remote attacker to bypass the TCP brute force prevention and lead to a denial of service condition for the duration of the attack. SCALANCE M-800 firmware, SCALANCE S615 firmware, scalance w700 ieee 802.11ax Multiple Siemens products, including firmware, contain vulnerabilities related to limited or unthrottled resource allocation.Service operation interruption (DoS) It may be in a state. The SCALANCE M-800, MUM-800 and S615 and RUGGEDCOM RM1224 industrial routers are used for secure remote access to plants via mobile networks (e.g. GPRS or UMTS) and have integrated security functions for firewalls to prevent unauthorized access, as well as VPN to Secure data transmission. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from untrusted network attacks. They allow filtering incoming and outgoing network connections in different ways. The SCALANCE W-1700 product is a wireless communication device based on the IEEE 802.11ac standard. SCALANCE W-700 products are wireless communication devices based on the IEEE 802.11ax standard. SCALANCE X switches are used to connect industrial components such as programmable logic controllers (PLC) or human machine interfaces (HMI). A vulnerability has been identified in SCALANCE M-800 / S615 (All versions), SCALANCE W-1700 IEEE 802.11ac family (All versions), SCALANCE W-700 IEEE 802.11ax family (All versions), SCALANCE W-700 IEEE 802.11n family (All versions), SCALANCE XB-200 switch family (All versions), SCALANCE XC-200 switch family (All versions), SCALANCE XF-200BA switch family (All versions), SCALANCE XM-400 Family (All versions), SCALANCE XP-200 switch family (All versions), SCALANCE XR-300WG switch family (All versions), SCALANCE XR-500 Family (All versions)

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202208-0610",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance xc206-2sfp g",
        "scope": null,
        "trust": 1.6,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xr552-12m 2hr2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11ac",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-12m ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba irt",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm400",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr500",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208 \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb213-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr328-4c wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216 \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m 2hr2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12m 2hr2 l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11ax",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb213-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr326-2c poe wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m 2hr2 l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb216",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11ax",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb213-3ld",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb213-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11ac",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb205-3ld",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb208",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800 s615",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "/"
      },
      {
        "model": "scalance w-700 ieee 802.11ax family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w-700 ieee 802.11n family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w-1700 ieee 802.11ac family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf-200ba switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm-400 family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr-300wg switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr-500 family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens has reported these vulnerabilities to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-36324",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CNVD-2022-56475",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2022-36324",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 7.5,
            "baseSeverity": "High",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "CVE-2022-36324",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-36324",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-36324",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2022-36324",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2022-56475",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202208-2714",
            "trust": 0.6,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices do not properly handle the renegotiation of SSL/TLS parameters. This could allow an unauthenticated remote attacker to bypass the TCP brute force prevention and lead to a denial of service condition for the duration of the attack. SCALANCE M-800 firmware, SCALANCE S615 firmware, scalance w700 ieee 802.11ax Multiple Siemens products, including firmware, contain vulnerabilities related to limited or unthrottled resource allocation.Service operation interruption (DoS) It may be in a state. The SCALANCE M-800, MUM-800 and S615 and RUGGEDCOM RM1224 industrial routers are used for secure remote access to plants via mobile networks (e.g. GPRS or UMTS) and have integrated security functions for firewalls to prevent unauthorized access, as well as VPN to Secure data transmission. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from untrusted network attacks. They allow filtering incoming and outgoing network connections in different ways. The SCALANCE W-1700 product is a wireless communication device based on the IEEE 802.11ac standard. SCALANCE W-700 products are wireless communication devices based on the IEEE 802.11ax standard. SCALANCE X switches are used to connect industrial components such as programmable logic controllers (PLC) or human machine interfaces (HMI). A vulnerability has been identified in SCALANCE M-800 / S615 (All versions), SCALANCE W-1700 IEEE 802.11ac family (All versions), SCALANCE W-700 IEEE 802.11ax family (All versions), SCALANCE W-700 IEEE 802.11n family (All versions), SCALANCE XB-200 switch family (All versions), SCALANCE XC-200 switch family (All versions), SCALANCE XF-200BA switch family (All versions), SCALANCE XM-400 Family (All versions), SCALANCE XP-200 switch family (All versions), SCALANCE XR-300WG switch family (All versions), SCALANCE XR-500 Family (All versions)",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36324"
      }
    ],
    "trust": 2.25
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-36324",
        "trust": 3.9
      },
      {
        "db": "SIEMENS",
        "id": "SSA-710008",
        "trust": 3.1
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-223-07",
        "trust": 1.5
      },
      {
        "db": "JVN",
        "id": "JVNVU90767165",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2022.4032",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36324",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36324"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "id": "VAR-202208-0610",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      }
    ],
    "trust": 1.2363483332142855
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      }
    ]
  },
  "last_update_date": "2024-08-14T14:17:48.847000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Patch for Unknown Vulnerability in Siemens SCALANCE Products",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/343621"
      },
      {
        "title": "Multiple Siemens SCALANCE Product security vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=207453"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-770",
        "trust": 1.0
      },
      {
        "problemtype": "Allocation of resources without limits or throttling (CWE-770) [NVD evaluation ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.5,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu90767165/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-36324"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-223-07"
      },
      {
        "trust": 0.6,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-710008.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2022.4032"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-36324/"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-223-07"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/770.html"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://www.cisa.gov/uscert/ics/advisories/icsa-22-223-07"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36324"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36324"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-12T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "VULMON",
        "id": "CVE-2022-36324"
      },
      {
        "date": "2023-09-22T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      },
      {
        "date": "2022-08-10T12:15:12.930000",
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-12T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2022-56475"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "VULMON",
        "id": "CVE-2022-36324"
      },
      {
        "date": "2023-09-22T08:25:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      },
      {
        "date": "2022-09-14T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      },
      {
        "date": "2023-02-23T16:19:42.137000",
        "db": "NVD",
        "id": "CVE-2022-36324"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Vulnerability in limiting or non-slotting resource allocation in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014932"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2714"
      }
    ],
    "trust": 0.6
  }
}

var-202108-2222
Vulnerability from variot

libcurl keeps previously used connections in a connection pool for subsequenttransfers to reuse, if one of them matches the setup.Due to errors in the logic, the config matching function did not take 'issuercert' into account and it compared the involved paths case insensitively,which could lead to libcurl reusing wrong connections.File paths are, or can be, case sensitive on many systems but not all, and caneven vary depending on used file systems.The comparison also didn't include the 'issuer cert' which a transfer can setto qualify how to verify the server certificate. A security issue has been found in curl before version 7.78.0. The comparison also didn't include the 'issuer cert' which a transfer can set to qualify how to verify the server certificate. ========================================================================== Ubuntu Security Notice USN-5021-1 July 22, 2021

curl vulnerabilities

A security issue affects these releases of Ubuntu and its derivatives:

  • Ubuntu 21.04
  • Ubuntu 20.04 LTS
  • Ubuntu 18.04 LTS

Summary:

Several security issues were fixed in curl.

Software Description: - curl: HTTP, HTTPS, and FTP client and client libraries

Details:

Harry Sintonen and Tomas Hoger discovered that curl incorrectly handled TELNET connections when the -t option was used on the command line. Uninitialized data possibly containing sensitive information could be sent to the remote server, contrary to expectations. (CVE-2021-22898, CVE-2021-22925)

Harry Sintonen discovered that curl incorrectly reused connections in the connection pool. This could result in curl reusing the wrong connections. (CVE-2021-22924)

Update instructions:

The problem can be corrected by updating your system to the following package versions:

Ubuntu 21.04: curl 7.74.0-1ubuntu2.1 libcurl3-gnutls 7.74.0-1ubuntu2.1 libcurl3-nss 7.74.0-1ubuntu2.1 libcurl4 7.74.0-1ubuntu2.1

Ubuntu 20.04 LTS: curl 7.68.0-1ubuntu2.6 libcurl3-gnutls 7.68.0-1ubuntu2.6 libcurl3-nss 7.68.0-1ubuntu2.6 libcurl4 7.68.0-1ubuntu2.6

Ubuntu 18.04 LTS: curl 7.58.0-2ubuntu3.14 libcurl3-gnutls 7.58.0-2ubuntu3.14 libcurl3-nss 7.58.0-2ubuntu3.14 libcurl4 7.58.0-2ubuntu3.14

In general, a standard system update will make all the necessary changes. Description:

Red Hat 3scale API Management delivers centralized API management features through a distributed, cloud-hosted layer. It includes built-in features to help in building a more successful API program, including access control, rate limits, payment gateway integration, and developer experience tools. Bugs fixed (https://bugzilla.redhat.com/):

1869800 - CVE-2020-8911 aws/aws-sdk-go: CBC padding oracle issue in AWS S3 Crypto SDK for golang 1869801 - CVE-2020-8912 aws-sdk-go: In-band key negotiation issue in AWS S3 Crypto SDK for golang 1930083 - CVE-2021-3442 PT RHOAM: XSS in 3scale at various places

  1. Bugs fixed (https://bugzilla.redhat.com/):

2007489 - RHACM 2.1.12 images 2010991 - CVE-2021-32687 redis: Integer overflow issue with intsets 2011000 - CVE-2021-32675 redis: Denial of service via Redis Standard Protocol (RESP) request 2011001 - CVE-2021-32672 redis: Out of bounds read in lua debugger protocol parser 2011004 - CVE-2021-32628 redis: Integer overflow bug in the ziplist data structure 2011010 - CVE-2021-32627 redis: Integer overflow issue with Streams 2011017 - CVE-2021-32626 redis: Lua scripts can overflow the heap-based Lua stack 2011020 - CVE-2021-41099 redis: Integer overflow issue with strings

  1. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256

===================================================================== Red Hat Security Advisory

Synopsis: Moderate: curl security update Advisory ID: RHSA-2021:3582-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2021:3582 Issue date: 2021-09-21 CVE Names: CVE-2021-22922 CVE-2021-22923 CVE-2021-22924 =====================================================================

  1. Summary:

An update for curl is now available for Red Hat Enterprise Linux 8.

Red Hat Product Security has rated this update as having a security impact of Moderate. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.

  1. Relevant releases/architectures:

Red Hat Enterprise Linux BaseOS (v. 8) - aarch64, ppc64le, s390x, x86_64

  1. Description:

The curl packages provide the libcurl library and the curl utility for downloading files from servers using various protocols, including HTTP, FTP, and LDAP.

Security Fix(es):

  • curl: Content not matching hash in Metalink is not being discarded (CVE-2021-22922)

  • curl: Metalink download sends credentials (CVE-2021-22923)

  • curl: Bad connection reuse due to flawed path name checks (CVE-2021-22924)

For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section.

  1. Solution:

For details on how to apply this update, which includes the changes described in this advisory, refer to:

https://access.redhat.com/articles/11258

  1. Bugs fixed (https://bugzilla.redhat.com/):

1981435 - CVE-2021-22922 curl: Content not matching hash in Metalink is not being discarded 1981438 - CVE-2021-22923 curl: Metalink download sends credentials 1981460 - CVE-2021-22924 curl: Bad connection reuse due to flawed path name checks

  1. Package List:

Red Hat Enterprise Linux BaseOS (v. 8):

Source: curl-7.61.1-18.el8_4.1.src.rpm

aarch64: curl-7.61.1-18.el8_4.1.aarch64.rpm curl-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm curl-debugsource-7.61.1-18.el8_4.1.aarch64.rpm curl-minimal-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm libcurl-7.61.1-18.el8_4.1.aarch64.rpm libcurl-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm libcurl-devel-7.61.1-18.el8_4.1.aarch64.rpm libcurl-minimal-7.61.1-18.el8_4.1.aarch64.rpm libcurl-minimal-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm

ppc64le: curl-7.61.1-18.el8_4.1.ppc64le.rpm curl-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm curl-debugsource-7.61.1-18.el8_4.1.ppc64le.rpm curl-minimal-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm libcurl-7.61.1-18.el8_4.1.ppc64le.rpm libcurl-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm libcurl-devel-7.61.1-18.el8_4.1.ppc64le.rpm libcurl-minimal-7.61.1-18.el8_4.1.ppc64le.rpm libcurl-minimal-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm

s390x: curl-7.61.1-18.el8_4.1.s390x.rpm curl-debuginfo-7.61.1-18.el8_4.1.s390x.rpm curl-debugsource-7.61.1-18.el8_4.1.s390x.rpm curl-minimal-debuginfo-7.61.1-18.el8_4.1.s390x.rpm libcurl-7.61.1-18.el8_4.1.s390x.rpm libcurl-debuginfo-7.61.1-18.el8_4.1.s390x.rpm libcurl-devel-7.61.1-18.el8_4.1.s390x.rpm libcurl-minimal-7.61.1-18.el8_4.1.s390x.rpm libcurl-minimal-debuginfo-7.61.1-18.el8_4.1.s390x.rpm

x86_64: curl-7.61.1-18.el8_4.1.x86_64.rpm curl-debuginfo-7.61.1-18.el8_4.1.i686.rpm curl-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm curl-debugsource-7.61.1-18.el8_4.1.i686.rpm curl-debugsource-7.61.1-18.el8_4.1.x86_64.rpm curl-minimal-debuginfo-7.61.1-18.el8_4.1.i686.rpm curl-minimal-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm libcurl-7.61.1-18.el8_4.1.i686.rpm libcurl-7.61.1-18.el8_4.1.x86_64.rpm libcurl-debuginfo-7.61.1-18.el8_4.1.i686.rpm libcurl-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm libcurl-devel-7.61.1-18.el8_4.1.i686.rpm libcurl-devel-7.61.1-18.el8_4.1.x86_64.rpm libcurl-minimal-7.61.1-18.el8_4.1.i686.rpm libcurl-minimal-7.61.1-18.el8_4.1.x86_64.rpm libcurl-minimal-debuginfo-7.61.1-18.el8_4.1.i686.rpm libcurl-minimal-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm

These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/

  1. References:

https://access.redhat.com/security/cve/CVE-2021-22922 https://access.redhat.com/security/cve/CVE-2021-22923 https://access.redhat.com/security/cve/CVE-2021-22924 https://access.redhat.com/security/updates/classification/#moderate

  1. Contact:

The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/

Copyright 2021 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1

iQIVAwUBYUmbl9zjgjWX9erEAQi0VRAAkVIQKLPCBEK+Dy1js5VwXXZssOhvgmm/ xe9piCdrgBrbILxPEY0hkPYCmw3hKsRWD3FCMou6275HUJydJQpqANDmP/msUZOE LYJcM6cMWR7/2HWtgx6BQ5z6PZte+vzetzoHPDjI8O25kqd+BfT6JN0wCzKUQrUO auFPz1Sqj3UG1PHB62fSBJ4MpmRrCtJJh/Q84Rfp2JilVmsCpAOCm+gHEye3tu49 yF0fSA+JLS9Ut1XzaktucevPiwApj2dmxuagGFftvPzaP+cMz5V7Hv5akI89uapk L+Q4T37Fx53MQg+CAI1uDg2jxkfk96fijCoM2oczsQW4Np0HWH2tyAkg9+gJCB3h KScu9RXUr3uYCSoy9zyurEceoGbJWDRvh9B/0BNhY6ywjG+c/+bXAJDDs0pA049g CkpJERsNGhgXgDm+ONgVwxaHDRKlcX6wYTgyWfAw9qOLmhZrQbhfSzt9ebhpd0HL Avv8qpCjtxTx5E9QBAlnDcUCb3cqQkD3/j9y9I4zAtAFoF6oWQ4xqQO8cJqGNPZ/ qztENtA7CKd0bgYEPOuujdWtTnK/s3iww+LRkCuzHNzNneQGeSziZJfB38rlKCLq lZHwCRl0EYrfcjBziwR6LLbpEe2u6vdsQKDfPXHuld+wfgYTTmtxhTVPMy8FKSf5 TuOJZuxQys4= =DwWr -----END PGP SIGNATURE-----

-- RHSA-announce mailing list RHSA-announce@redhat.com https://listman.redhat.com/mailman/listinfo/rhsa-announce . Summary:

The Migration Toolkit for Containers (MTC) 1.6.0 is now available. Description:

The Migration Toolkit for Containers (MTC) enables you to migrate Kubernetes resources, persistent volume data, and internal container images between OpenShift Container Platform clusters, using the MTC web console or the Kubernetes API. Bugs fixed (https://bugzilla.redhat.com/):

1878824 - Web console is not accessible when deployed on OpenShift cluster on IBM Cloud 1887526 - "Stage" pods fail when migrating from classic OpenShift source cluster on IBM Cloud with block storage 1899562 - MigMigration custom resource does not display an error message when a migration fails because of volume mount error 1936886 - Service account token of existing remote cluster cannot be updated by using the web console 1936894 - "Ready" status of MigHook and MigPlan custom resources is not synchronized automatically 1949117 - "Migration plan resources" page displays a permanent error message when a migration plan is deleted from the backend 1951869 - MigPlan custom resource does not detect invalid source cluster reference 1968621 - Paused deployment config causes a migration to hang 1970338 - Parallel migrations fail because the initial backup is missing 1974737 - Migration plan name length in the "Migration plan" wizard is not validated 1975369 - "Debug view" link text on "Migration plans" page can be improved 1975372 - Destination namespace in MigPlan custom resource is not validated 1976895 - Namespace mapping cannot be changed using the Migration Plan wizard 1981810 - "Excluded" resources are not excluded from the migration 1982026 - Direct image migration fails if the source URI contains a double slash ("//") 1994985 - Web console crashes when a MigPlan custom resource is created with an empty namespaces list 1996169 - When "None" is selected as the target storage class in the web console, the setting is ignored and the default storage class is used 1996627 - MigPlan custom resource displays a "PvUsageAnalysisFailed" warning after a successful PVC migration 1996784 - "Migration resources" tree on the "Migration details" page is not displayed 1996902 - "Select all" checkbox on the "Namespaces" page of the "Migration plan" wizard remains selected after a namespace is unselected 1996904 - "Migration" dialogs on the "Migration plans" page display inconsistent capitalization 1996906 - "Migration details" page link is displayed for a migration plan with no associated migrations 1996938 - Search function on "Migration plans" page displays no results 1997051 - Indirect migration from MTC 1.5.1 to 1.6.0 fails during "StageBackup" phase 1997127 - Direct volume migration "retry" feature does not work correctly after a network failure 1997173 - Migration of custom resource definitions to OpenShift Container Platform 4.9 fails because of API version incompatibility 1997180 - "migration-log-reader" pod does not log invalid Rsync options 1997665 - Selected PVCs in the "State migration" dialog are reset because of background polling 1997694 - "Update operator" link on the "Clusters" page is incorrect 1997827 - "Migration plan" wizard displays PVC names incorrectly formatted after running state migration 1998062 - Rsync pod uses upstream image 1998283 - "Migration step details" link on the "Migrations" page does not work 1998550 - "Migration plan" wizard does not support certain screen resolutions 1998581 - "Migration details" link on "Migration plans" page displays "latestIsFailed" error 1999113 - "oc describe" and "oc log" commands on "Migration resources" tree cannot be copied after failed migration 1999381 - MigPlan custom resource displays "Stage completed with warnings" status after successful migration 1999528 - Position of the "Add migration plan" button is different from the other "Add" buttons 1999765 - "Migrate" button on "State migration" dialog is enabled when no PVCs are selected 1999784 - CVE-2021-3749 nodejs-axios: Regular expression denial of service in trim function 2000205 - "Options" menu on the "Migration details" page displays incorrect items 2000218 - Validation incorrectly blocks namespace mapping if a source cluster namespace is the same as the destination namespace 2000243 - "Migration plan" wizard does not allow a migration within the same cluster 2000644 - Invalid migration plan causes "controller" pod to crash 2000875 - State migration status on "Migrations" page displays "Stage succeeded" message 2000979 - "clusterIPs" parameter of "service" object can cause Velero errors 2001089 - Direct volume migration fails because of missing CA path configuration 2001173 - Migration plan requires two clusters 2001786 - Migration fails during "Stage Backup" step because volume path on host not found 2001829 - Migration does not complete when the namespace contains a cron job with a PVC 2001941 - Fixing PVC conflicts in state migration plan using the web console causes the migration to run twice 2002420 - "Stage" pod not created for completed application pod, causing the "mig-controller" to stall 2002608 - Migration of unmounted PVC fails during "StageBackup" phase 2002897 - Rollback migration does not complete when the namespace contains a cron job 2003603 - "View logs" dialog displays the "--selector" option, which does not print all logs 2004601 - Migration plan status on "Migration plans" page is "Ready" after migration completed with warnings 2004923 - Web console displays "New operator version available" notification for incorrect operator 2005143 - Combining Rsync and Stunnel in a single pod can degrade performance 2006316 - Web console cannot create migration plan in a proxy environment 2007175 - Web console cannot be launched in a proxy environment

  1. JIRA issues fixed (https://issues.jboss.org/):

MIG-785 - Search for "Crane" in the Operator Hub should display the Migration Toolkit for Containers

  1. Summary:

Red Hat Advanced Cluster Management for Kubernetes 2.1.11 General Availability release images, which provide a security fix and update the container images. Description:

Red Hat Advanced Cluster Management for Kubernetes 2.1.11 images

Red Hat Advanced Cluster Management for Kubernetes provides the capabilities to address common challenges that administrators and site reliability engineers face as they work across a range of public and private cloud environments. Clusters and applications are all visible and managed from a single console—with security policy built in.

This advisory contains updates to one or more container images for Red Hat Advanced Cluster Management for Kubernetes.

Container updates:

  • RHACM 2.1.11 images (BZ# 1999375)

  • Solution:

Before applying this update, make sure all previously released errata relevant to your system have been applied. To apply this upgrade, you must upgrade your OpenShift Container Platform version to 4.6, or later. Bugs fixed (https://bugzilla.redhat.com/):

1963121 - CVE-2021-23017 nginx: Off-by-one in ngx_resolver_copy() when labels are followed by a pointer to a root domain name 1999375 - RHACM 2.1.11 images

  1. These flaws may allow remote attackers to obtain sensitive information, leak authentication or cookie header data or facilitate a denial of service attack.

For the stable distribution (bullseye), these problems have been fixed in version 7.74.0-1.3+deb11u2.

We recommend that you upgrade your curl packages.

For the detailed security status of curl please refer to its security tracker page at: https://security-tracker.debian.org/tracker/curl

Further information about Debian Security Advisories, how to apply these updates to your system and frequently asked questions can be found at: https://www.debian.org/security/

Mailing list: debian-security-announce@lists.debian.org -----BEGIN PGP SIGNATURE-----

iQKTBAEBCgB9FiEErPPQiO8y7e9qGoNf2a0UuVE7UeQFAmLoBaNfFIAAAAAALgAo aXNzdWVyLWZwckBub3RhdGlvbnMub3BlbnBncC5maWZ0aGhvcnNlbWFuLm5ldEFD RjNEMDg4RUYzMkVERUY2QTFBODM1RkQ5QUQxNEI5NTEzQjUxRTQACgkQ2a0UuVE7 UeTf9A//VWkco2gxCMMe8JDcL9sLD0B5L8KGRxbPBYmpE1l2kCpiW9QGVwCN3q2K i8xo0jmRxSwSXDmAE17aTtGT66vU8vQSHewty031TcvWKBoAJpKRTbazfdOy/vDD waofTEaUClFt3NNiR3gigRU6OFV/9MWlUWwCJ/Wgd5osJTQCyWV/iHz3FJluc1Gp rXamYLnWGUJbIZgMFEo7TqIyb91P0PrX4hpnCcnhvY4ci5NWOj2qaoWGhgF+f9gz Uao91GTOnuTyoY3apKzifdO5dih9zJttnRKUgHkn9YCGxanljoPjHRYOavWdN6bE yIpT/Xw2dy05Fzydb73bDurQP+mkyWGZA+S8gxtbY7S7OylRS9iHSfyUpAVEM/Ab SPkGQl6vBKr7dmyHkdIlbViste6kcmhQQete9E3tM18MkyK0NbBiUj+pShNPC+SF REStal14ZE+DSwFKp5UA8izEh0G5RC5VUVhB/jtoxym2rvmIamk5YqCS1rupGP9R 1Y+Jm8CywBrKHl5EzAVUswC5xDAArWdXRvrgHCeElnkwuCwRC8AgRiYFFRulWKwt TV5qveehnzSc2z5IDc/tdiPWNJhJu/blNN8BauG8zmJV4ZhZP9EO1FCLE7DpqQ38 EPtUTMXaMQR1W15He51auBQwJgSiX1II+5jh6PeZTKBKnJgLYNA= =3E71 -----END PGP SIGNATURE-----

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202108-2222",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m804pb",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "universal forwarder",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "splunk",
        "version": "9.1.0"
      },
      {
        "model": "simatic rtu3030c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0.14"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "solidfire \\\u0026 hci management node",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "sinema remote connect server",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "scalance m816-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "simatic cp 1543-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0.22"
      },
      {
        "model": "simatic rtu 3041c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0.14"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "11.0"
      },
      {
        "model": "universal forwarder",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "splunk",
        "version": "9.0.6"
      },
      {
        "model": "sinec infrastructure network services",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.1.1"
      },
      {
        "model": "universal forwarder",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "splunk",
        "version": "9.0.0"
      },
      {
        "model": "mysql server",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.0.26"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "10.0"
      },
      {
        "model": "fedora",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "fedoraproject",
        "version": "33"
      },
      {
        "model": "mysql server",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "5.7.0"
      },
      {
        "model": "sinema remote connect",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1"
      },
      {
        "model": "universal forwarder",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "splunk",
        "version": "8.2.0"
      },
      {
        "model": "simatic rtu3010c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0.14"
      },
      {
        "model": "logo\\! cmr2040",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ruggedcomrm 1224 lte",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "simatic cp 1545-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1"
      },
      {
        "model": "scalance m876-3",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "scalance m812-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "mysql server",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.0.0"
      },
      {
        "model": "logo\\! cmr2020",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance mum856-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "simatic rtu3031c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.0.14"
      },
      {
        "model": "scalance m876-4",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "peoplesoft enterprise peopletools",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.58"
      },
      {
        "model": "libcurl",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "haxx",
        "version": "7.10.4"
      },
      {
        "model": "scalance m874-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "siplus net cp 1543-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0.22"
      },
      {
        "model": "universal forwarder",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "splunk",
        "version": "8.2.12"
      },
      {
        "model": "peoplesoft enterprise peopletools",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.57"
      },
      {
        "model": "scalance m874-3",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "libcurl",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "haxx",
        "version": "7.77.0"
      },
      {
        "model": "peoplesoft enterprise peopletools",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "8.59"
      },
      {
        "model": "mysql server",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "oracle",
        "version": "5.7.36"
      },
      {
        "model": "scalance m826-2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.1"
      },
      {
        "model": "solidfire baseboard management controller",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "cloud backup",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      },
      {
        "model": "clustered data ontap",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "netapp",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Red Hat",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "164523"
      },
      {
        "db": "PACKETSTORM",
        "id": "164562"
      },
      {
        "db": "PACKETSTORM",
        "id": "164511"
      },
      {
        "db": "PACKETSTORM",
        "id": "164583"
      },
      {
        "db": "PACKETSTORM",
        "id": "164221"
      },
      {
        "db": "PACKETSTORM",
        "id": "164342"
      },
      {
        "db": "PACKETSTORM",
        "id": "164282"
      },
      {
        "db": "PACKETSTORM",
        "id": "164948"
      }
    ],
    "trust": 0.8
  },
  "cve": "CVE-2021-22924",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "MEDIUM",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "NONE",
            "baseScore": 4.3,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 8.6,
            "id": "CVE-2021-22924",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.0,
            "vectorString": "AV:N/AC:M/Au:N/C:P/I:N/A:N",
            "version": "2.0"
          },
          {
            "accessComplexity": "MEDIUM",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "VULHUB",
            "availabilityImpact": "NONE",
            "baseScore": 4.3,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 8.6,
            "id": "VHN-381398",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.1,
            "vectorString": "AV:N/AC:M/AU:N/C:P/I:N/A:N",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "HIGH",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "NONE",
            "baseScore": 3.7,
            "baseSeverity": "LOW",
            "confidentialityImpact": "LOW",
            "exploitabilityScore": 2.2,
            "id": "CVE-2021-22924",
            "impactScore": 1.4,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:H/PR:N/UI:N/S:U/C:L/I:N/A:N",
            "version": "3.1"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2021-22924",
            "trust": 1.0,
            "value": "LOW"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202107-1569",
            "trust": 0.6,
            "value": "LOW"
          },
          {
            "author": "VULHUB",
            "id": "VHN-381398",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "libcurl keeps previously used connections in a connection pool for subsequenttransfers to reuse, if one of them matches the setup.Due to errors in the logic, the config matching function did not take \u0027issuercert\u0027 into account and it compared the involved paths *case insensitively*,which could lead to libcurl reusing wrong connections.File paths are, or can be, case sensitive on many systems but not all, and caneven vary depending on used file systems.The comparison also didn\u0027t include the \u0027issuer cert\u0027 which a transfer can setto qualify how to verify the server certificate. A security issue has been found in curl before version 7.78.0. The comparison also didn\u0027t include the \u0027issuer cert\u0027 which a transfer can set to qualify how to verify the server certificate. ==========================================================================\nUbuntu Security Notice USN-5021-1\nJuly 22, 2021\n\ncurl vulnerabilities\n==========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 21.04\n- Ubuntu 20.04 LTS\n- Ubuntu 18.04 LTS\n\nSummary:\n\nSeveral security issues were fixed in curl. \n\nSoftware Description:\n- curl: HTTP, HTTPS, and FTP client and client libraries\n\nDetails:\n\nHarry Sintonen and Tomas Hoger discovered that curl incorrectly handled\nTELNET connections when the -t option was used on the command line. \nUninitialized data possibly containing sensitive information could be sent\nto the remote server, contrary to expectations. (CVE-2021-22898,\nCVE-2021-22925)\n\nHarry Sintonen discovered that curl incorrectly reused connections in the\nconnection pool. This could result in curl reusing the wrong connections. \n(CVE-2021-22924)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 21.04:\n  curl                            7.74.0-1ubuntu2.1\n  libcurl3-gnutls                 7.74.0-1ubuntu2.1\n  libcurl3-nss                    7.74.0-1ubuntu2.1\n  libcurl4                        7.74.0-1ubuntu2.1\n\nUbuntu 20.04 LTS:\n  curl                            7.68.0-1ubuntu2.6\n  libcurl3-gnutls                 7.68.0-1ubuntu2.6\n  libcurl3-nss                    7.68.0-1ubuntu2.6\n  libcurl4                        7.68.0-1ubuntu2.6\n\nUbuntu 18.04 LTS:\n  curl                            7.58.0-2ubuntu3.14\n  libcurl3-gnutls                 7.58.0-2ubuntu3.14\n  libcurl3-nss                    7.58.0-2ubuntu3.14\n  libcurl4                        7.58.0-2ubuntu3.14\n\nIn general, a standard system update will make all the necessary changes. Description:\n\nRed Hat 3scale API Management delivers centralized API management features\nthrough a distributed, cloud-hosted layer. It includes built-in features to\nhelp in building a more successful API program, including access control,\nrate limits, payment gateway integration, and developer experience tools. Bugs fixed (https://bugzilla.redhat.com/):\n\n1869800 - CVE-2020-8911 aws/aws-sdk-go: CBC padding oracle issue in AWS S3 Crypto SDK for golang\n1869801 - CVE-2020-8912 aws-sdk-go: In-band key negotiation issue in AWS S3 Crypto SDK for golang\n1930083 - CVE-2021-3442 PT RHOAM: XSS in 3scale at various places\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n2007489 - RHACM 2.1.12 images\n2010991 - CVE-2021-32687 redis: Integer overflow issue with intsets\n2011000 - CVE-2021-32675 redis: Denial of service via Redis Standard Protocol (RESP) request\n2011001 - CVE-2021-32672 redis: Out of bounds read in lua debugger protocol parser\n2011004 - CVE-2021-32628 redis: Integer overflow bug in the ziplist data structure\n2011010 - CVE-2021-32627 redis: Integer overflow issue with Streams\n2011017 - CVE-2021-32626 redis: Lua scripts can overflow the heap-based Lua stack\n2011020 - CVE-2021-41099 redis: Integer overflow issue with strings\n\n5. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n=====================================================================\n                   Red Hat Security Advisory\n\nSynopsis:          Moderate: curl security update\nAdvisory ID:       RHSA-2021:3582-01\nProduct:           Red Hat Enterprise Linux\nAdvisory URL:      https://access.redhat.com/errata/RHSA-2021:3582\nIssue date:        2021-09-21\nCVE Names:         CVE-2021-22922 CVE-2021-22923 CVE-2021-22924 \n=====================================================================\n\n1. Summary:\n\nAn update for curl is now available for Red Hat Enterprise Linux 8. \n\nRed Hat Product Security has rated this update as having a security impact\nof Moderate. A Common Vulnerability Scoring System (CVSS) base score, which\ngives a detailed severity rating, is available for each vulnerability from\nthe CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux BaseOS (v. 8) - aarch64, ppc64le, s390x, x86_64\n\n3. Description:\n\nThe curl packages provide the libcurl library and the curl utility for\ndownloading files from servers using various protocols, including HTTP,\nFTP, and LDAP. \n\nSecurity Fix(es):\n\n* curl: Content not matching hash in Metalink is not being discarded\n(CVE-2021-22922)\n\n* curl: Metalink download sends credentials (CVE-2021-22923)\n\n* curl: Bad connection reuse due to flawed path name checks\n(CVE-2021-22924)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1981435 - CVE-2021-22922 curl: Content not matching hash in Metalink is not being discarded\n1981438 - CVE-2021-22923 curl: Metalink download sends credentials\n1981460 - CVE-2021-22924 curl: Bad connection reuse due to flawed path name checks\n\n6. Package List:\n\nRed Hat Enterprise Linux BaseOS (v. 8):\n\nSource:\ncurl-7.61.1-18.el8_4.1.src.rpm\n\naarch64:\ncurl-7.61.1-18.el8_4.1.aarch64.rpm\ncurl-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm\ncurl-debugsource-7.61.1-18.el8_4.1.aarch64.rpm\ncurl-minimal-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm\nlibcurl-7.61.1-18.el8_4.1.aarch64.rpm\nlibcurl-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm\nlibcurl-devel-7.61.1-18.el8_4.1.aarch64.rpm\nlibcurl-minimal-7.61.1-18.el8_4.1.aarch64.rpm\nlibcurl-minimal-debuginfo-7.61.1-18.el8_4.1.aarch64.rpm\n\nppc64le:\ncurl-7.61.1-18.el8_4.1.ppc64le.rpm\ncurl-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm\ncurl-debugsource-7.61.1-18.el8_4.1.ppc64le.rpm\ncurl-minimal-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm\nlibcurl-7.61.1-18.el8_4.1.ppc64le.rpm\nlibcurl-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm\nlibcurl-devel-7.61.1-18.el8_4.1.ppc64le.rpm\nlibcurl-minimal-7.61.1-18.el8_4.1.ppc64le.rpm\nlibcurl-minimal-debuginfo-7.61.1-18.el8_4.1.ppc64le.rpm\n\ns390x:\ncurl-7.61.1-18.el8_4.1.s390x.rpm\ncurl-debuginfo-7.61.1-18.el8_4.1.s390x.rpm\ncurl-debugsource-7.61.1-18.el8_4.1.s390x.rpm\ncurl-minimal-debuginfo-7.61.1-18.el8_4.1.s390x.rpm\nlibcurl-7.61.1-18.el8_4.1.s390x.rpm\nlibcurl-debuginfo-7.61.1-18.el8_4.1.s390x.rpm\nlibcurl-devel-7.61.1-18.el8_4.1.s390x.rpm\nlibcurl-minimal-7.61.1-18.el8_4.1.s390x.rpm\nlibcurl-minimal-debuginfo-7.61.1-18.el8_4.1.s390x.rpm\n\nx86_64:\ncurl-7.61.1-18.el8_4.1.x86_64.rpm\ncurl-debuginfo-7.61.1-18.el8_4.1.i686.rpm\ncurl-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm\ncurl-debugsource-7.61.1-18.el8_4.1.i686.rpm\ncurl-debugsource-7.61.1-18.el8_4.1.x86_64.rpm\ncurl-minimal-debuginfo-7.61.1-18.el8_4.1.i686.rpm\ncurl-minimal-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm\nlibcurl-7.61.1-18.el8_4.1.i686.rpm\nlibcurl-7.61.1-18.el8_4.1.x86_64.rpm\nlibcurl-debuginfo-7.61.1-18.el8_4.1.i686.rpm\nlibcurl-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm\nlibcurl-devel-7.61.1-18.el8_4.1.i686.rpm\nlibcurl-devel-7.61.1-18.el8_4.1.x86_64.rpm\nlibcurl-minimal-7.61.1-18.el8_4.1.i686.rpm\nlibcurl-minimal-7.61.1-18.el8_4.1.x86_64.rpm\nlibcurl-minimal-debuginfo-7.61.1-18.el8_4.1.i686.rpm\nlibcurl-minimal-debuginfo-7.61.1-18.el8_4.1.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security.  Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2021-22922\nhttps://access.redhat.com/security/cve/CVE-2021-22923\nhttps://access.redhat.com/security/cve/CVE-2021-22924\nhttps://access.redhat.com/security/updates/classification/#moderate\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2021 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBYUmbl9zjgjWX9erEAQi0VRAAkVIQKLPCBEK+Dy1js5VwXXZssOhvgmm/\nxe9piCdrgBrbILxPEY0hkPYCmw3hKsRWD3FCMou6275HUJydJQpqANDmP/msUZOE\nLYJcM6cMWR7/2HWtgx6BQ5z6PZte+vzetzoHPDjI8O25kqd+BfT6JN0wCzKUQrUO\nauFPz1Sqj3UG1PHB62fSBJ4MpmRrCtJJh/Q84Rfp2JilVmsCpAOCm+gHEye3tu49\nyF0fSA+JLS9Ut1XzaktucevPiwApj2dmxuagGFftvPzaP+cMz5V7Hv5akI89uapk\nL+Q4T37Fx53MQg+CAI1uDg2jxkfk96fijCoM2oczsQW4Np0HWH2tyAkg9+gJCB3h\nKScu9RXUr3uYCSoy9zyurEceoGbJWDRvh9B/0BNhY6ywjG+c/+bXAJDDs0pA049g\nCkpJERsNGhgXgDm+ONgVwxaHDRKlcX6wYTgyWfAw9qOLmhZrQbhfSzt9ebhpd0HL\nAvv8qpCjtxTx5E9QBAlnDcUCb3cqQkD3/j9y9I4zAtAFoF6oWQ4xqQO8cJqGNPZ/\nqztENtA7CKd0bgYEPOuujdWtTnK/s3iww+LRkCuzHNzNneQGeSziZJfB38rlKCLq\nlZHwCRl0EYrfcjBziwR6LLbpEe2u6vdsQKDfPXHuld+wfgYTTmtxhTVPMy8FKSf5\nTuOJZuxQys4=\n=DwWr\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://listman.redhat.com/mailman/listinfo/rhsa-announce\n. Summary:\n\nThe Migration Toolkit for Containers (MTC) 1.6.0 is now available. Description:\n\nThe Migration Toolkit for Containers (MTC) enables you to migrate\nKubernetes resources, persistent volume data, and internal container images\nbetween OpenShift Container Platform clusters, using the MTC web console or\nthe Kubernetes API. Bugs fixed (https://bugzilla.redhat.com/):\n\n1878824 - Web console is not accessible when deployed on OpenShift cluster on IBM Cloud\n1887526 - \"Stage\" pods fail when migrating from classic OpenShift source cluster on IBM Cloud with block storage\n1899562 - MigMigration custom resource does not display an error message when a migration fails because of volume mount error\n1936886 - Service account token of existing remote cluster cannot be updated by using the web console\n1936894 - \"Ready\" status of MigHook and MigPlan custom resources is not synchronized automatically\n1949117 - \"Migration plan resources\" page displays a permanent error message when a migration plan is deleted from the backend\n1951869 - MigPlan custom resource does not detect invalid source cluster reference\n1968621 - Paused deployment config causes a migration to hang\n1970338 - Parallel migrations fail because the initial backup is missing\n1974737 - Migration plan name length in the \"Migration plan\" wizard is not validated\n1975369 - \"Debug view\" link text on \"Migration plans\" page can be improved\n1975372 - Destination namespace in MigPlan custom resource is not validated\n1976895 - Namespace mapping cannot be changed using the Migration Plan wizard\n1981810 - \"Excluded\" resources are not excluded from the migration\n1982026 - Direct image migration fails if the source URI contains a double slash (\"//\")\n1994985 - Web console crashes when a MigPlan custom resource is created with an empty namespaces list\n1996169 - When \"None\" is selected as the target storage class in the web console, the setting is ignored and the default storage class is used\n1996627 - MigPlan custom resource displays a \"PvUsageAnalysisFailed\" warning after a successful PVC migration\n1996784 - \"Migration resources\" tree on the \"Migration details\" page is not displayed\n1996902 - \"Select all\" checkbox on the \"Namespaces\" page of the \"Migration plan\" wizard remains selected after a namespace is unselected\n1996904 - \"Migration\" dialogs on the \"Migration plans\" page display inconsistent capitalization\n1996906 - \"Migration details\" page link is displayed for a migration plan with no associated migrations\n1996938 - Search function on \"Migration plans\" page displays no results\n1997051 - Indirect migration from MTC 1.5.1 to 1.6.0 fails during \"StageBackup\" phase\n1997127 - Direct volume migration \"retry\" feature does not work correctly after a network failure\n1997173 - Migration of custom resource definitions to OpenShift Container Platform 4.9 fails because of API version incompatibility\n1997180 - \"migration-log-reader\" pod does not log invalid Rsync options\n1997665 - Selected PVCs in the \"State migration\" dialog are reset because of background polling\n1997694 - \"Update operator\" link on the \"Clusters\" page is incorrect\n1997827 - \"Migration plan\" wizard displays PVC names incorrectly formatted after running state migration\n1998062 - Rsync pod uses upstream image\n1998283 - \"Migration step details\" link on the \"Migrations\" page does not work\n1998550 - \"Migration plan\" wizard does not support certain screen resolutions\n1998581 - \"Migration details\" link on \"Migration plans\" page displays \"latestIsFailed\" error\n1999113 - \"oc describe\" and \"oc log\" commands on \"Migration resources\" tree cannot be copied after failed migration\n1999381 - MigPlan custom resource displays \"Stage completed with warnings\" status after successful migration\n1999528 - Position of the \"Add migration plan\" button is different from the other \"Add\" buttons\n1999765 - \"Migrate\" button on \"State migration\" dialog is enabled when no PVCs are selected\n1999784 - CVE-2021-3749 nodejs-axios: Regular expression denial of service in trim function\n2000205 - \"Options\" menu on the \"Migration details\" page displays incorrect items\n2000218 - Validation incorrectly blocks namespace mapping if a source cluster namespace is the same as the destination namespace\n2000243 - \"Migration plan\" wizard does not allow a migration within the same cluster\n2000644 - Invalid migration plan causes \"controller\" pod to crash\n2000875 - State migration status on \"Migrations\" page displays \"Stage succeeded\" message\n2000979 - \"clusterIPs\" parameter of \"service\" object can cause Velero errors\n2001089 - Direct volume migration fails because of missing CA path configuration\n2001173 - Migration plan requires two clusters\n2001786 - Migration fails during \"Stage Backup\" step because volume path on host not found\n2001829 - Migration does not complete when the namespace contains a cron job with a PVC\n2001941 - Fixing PVC conflicts in state migration plan using the web console causes the migration to run twice\n2002420 - \"Stage\" pod not created for completed application pod, causing the \"mig-controller\" to stall\n2002608 - Migration of unmounted PVC fails during \"StageBackup\" phase\n2002897 - Rollback migration does not complete when the namespace contains a cron job\n2003603 - \"View logs\" dialog displays the \"--selector\" option, which does not print all logs\n2004601 - Migration plan status on \"Migration plans\" page is \"Ready\" after migration completed with warnings\n2004923 - Web console displays \"New operator version available\" notification for incorrect operator\n2005143 - Combining Rsync and Stunnel in a single pod can degrade performance\n2006316 - Web console cannot create migration plan in a proxy environment\n2007175 - Web console cannot be launched in a proxy environment\n\n5. JIRA issues fixed (https://issues.jboss.org/):\n\nMIG-785 - Search for \"Crane\" in the Operator Hub should display the Migration Toolkit for Containers\n\n6. Summary:\n\nRed Hat Advanced Cluster Management for Kubernetes 2.1.11 General\nAvailability release images, which provide a security fix and update the\ncontainer images. Description:\n\nRed Hat Advanced Cluster Management for Kubernetes 2.1.11 images\n\nRed Hat Advanced Cluster Management for Kubernetes provides the\ncapabilities to address common challenges that administrators and site\nreliability engineers face as they work across a range of public and\nprivate cloud environments. Clusters and applications are all visible and\nmanaged from a single console\u2014with security policy built in. \n\nThis advisory contains updates to one or more container images for Red Hat\nAdvanced Cluster Management for Kubernetes. \n\nContainer updates:\n\n* RHACM 2.1.11 images (BZ# 1999375)\n\n3. Solution:\n\nBefore applying this update, make sure all previously released errata\nrelevant to your system have been applied. To apply this upgrade,\nyou \nmust upgrade your OpenShift Container Platform version to 4.6, or later. Bugs fixed (https://bugzilla.redhat.com/):\n\n1963121 - CVE-2021-23017 nginx: Off-by-one in ngx_resolver_copy() when labels are followed by a pointer to a root domain name\n1999375 - RHACM 2.1.11 images\n\n5. These flaws may allow remote attackers to obtain sensitive\ninformation, leak authentication or cookie header data or facilitate a\ndenial of service attack. \n\nFor the stable distribution (bullseye), these problems have been fixed in\nversion 7.74.0-1.3+deb11u2. \n\nWe recommend that you upgrade your curl packages. \n\nFor the detailed security status of curl please refer to\nits security tracker page at:\nhttps://security-tracker.debian.org/tracker/curl\n\nFurther information about Debian Security Advisories, how to apply\nthese updates to your system and frequently asked questions can be\nfound at: https://www.debian.org/security/\n\nMailing list: debian-security-announce@lists.debian.org\n-----BEGIN PGP SIGNATURE-----\n\niQKTBAEBCgB9FiEErPPQiO8y7e9qGoNf2a0UuVE7UeQFAmLoBaNfFIAAAAAALgAo\naXNzdWVyLWZwckBub3RhdGlvbnMub3BlbnBncC5maWZ0aGhvcnNlbWFuLm5ldEFD\nRjNEMDg4RUYzMkVERUY2QTFBODM1RkQ5QUQxNEI5NTEzQjUxRTQACgkQ2a0UuVE7\nUeTf9A//VWkco2gxCMMe8JDcL9sLD0B5L8KGRxbPBYmpE1l2kCpiW9QGVwCN3q2K\ni8xo0jmRxSwSXDmAE17aTtGT66vU8vQSHewty031TcvWKBoAJpKRTbazfdOy/vDD\nwaofTEaUClFt3NNiR3gigRU6OFV/9MWlUWwCJ/Wgd5osJTQCyWV/iHz3FJluc1Gp\nrXamYLnWGUJbIZgMFEo7TqIyb91P0PrX4hpnCcnhvY4ci5NWOj2qaoWGhgF+f9gz\nUao91GTOnuTyoY3apKzifdO5dih9zJttnRKUgHkn9YCGxanljoPjHRYOavWdN6bE\nyIpT/Xw2dy05Fzydb73bDurQP+mkyWGZA+S8gxtbY7S7OylRS9iHSfyUpAVEM/Ab\nSPkGQl6vBKr7dmyHkdIlbViste6kcmhQQete9E3tM18MkyK0NbBiUj+pShNPC+SF\nREStal14ZE+DSwFKp5UA8izEh0G5RC5VUVhB/jtoxym2rvmIamk5YqCS1rupGP9R\n1Y+Jm8CywBrKHl5EzAVUswC5xDAArWdXRvrgHCeElnkwuCwRC8AgRiYFFRulWKwt\nTV5qveehnzSc2z5IDc/tdiPWNJhJu/blNN8BauG8zmJV4ZhZP9EO1FCLE7DpqQ38\nEPtUTMXaMQR1W15He51auBQwJgSiX1II+5jh6PeZTKBKnJgLYNA=\n=3E71\n-----END PGP SIGNATURE-----\n",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      },
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-22924"
      },
      {
        "db": "PACKETSTORM",
        "id": "163637"
      },
      {
        "db": "PACKETSTORM",
        "id": "164523"
      },
      {
        "db": "PACKETSTORM",
        "id": "164562"
      },
      {
        "db": "PACKETSTORM",
        "id": "164511"
      },
      {
        "db": "PACKETSTORM",
        "id": "164583"
      },
      {
        "db": "PACKETSTORM",
        "id": "164221"
      },
      {
        "db": "PACKETSTORM",
        "id": "164342"
      },
      {
        "db": "PACKETSTORM",
        "id": "164282"
      },
      {
        "db": "PACKETSTORM",
        "id": "164948"
      },
      {
        "db": "PACKETSTORM",
        "id": "169318"
      }
    ],
    "trust": 1.98
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2021-22924",
        "trust": 2.8
      },
      {
        "db": "SIEMENS",
        "id": "SSA-732250",
        "trust": 1.7
      },
      {
        "db": "SIEMENS",
        "id": "SSA-484086",
        "trust": 1.7
      },
      {
        "db": "SIEMENS",
        "id": "SSA-389290",
        "trust": 1.7
      },
      {
        "db": "HACKERONE",
        "id": "1223565",
        "trust": 1.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164948",
        "trust": 0.8
      },
      {
        "db": "PACKETSTORM",
        "id": "164583",
        "trust": 0.8
      },
      {
        "db": "PACKETSTORM",
        "id": "164755",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "163637",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164523",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164562",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164511",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164221",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164342",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "164282",
        "trust": 0.7
      },
      {
        "db": "PACKETSTORM",
        "id": "169318",
        "trust": 0.7
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3211",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2022.4266",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3941",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3878",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3472",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3430",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.2473",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3485",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2022.1637",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.2526",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.2755",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3167",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2023.3146",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3499",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.3649",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2022042566",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021092811",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021072212",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021112309",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021110313",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021080210",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021090834",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021092221",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021072814",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2021102116",
        "trust": 0.6
      },
      {
        "db": "CS-HELP",
        "id": "SB2022031104",
        "trust": 0.6
      },
      {
        "db": "PACKETSTORM",
        "id": "166714",
        "trust": 0.6
      },
      {
        "db": "PACKETSTORM",
        "id": "164555",
        "trust": 0.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-132-13",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569",
        "trust": 0.6
      },
      {
        "db": "PACKETSTORM",
        "id": "165008",
        "trust": 0.1
      },
      {
        "db": "VULHUB",
        "id": "VHN-381398",
        "trust": 0.1
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-22924",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-22924"
      },
      {
        "db": "PACKETSTORM",
        "id": "163637"
      },
      {
        "db": "PACKETSTORM",
        "id": "164523"
      },
      {
        "db": "PACKETSTORM",
        "id": "164562"
      },
      {
        "db": "PACKETSTORM",
        "id": "164511"
      },
      {
        "db": "PACKETSTORM",
        "id": "164583"
      },
      {
        "db": "PACKETSTORM",
        "id": "164221"
      },
      {
        "db": "PACKETSTORM",
        "id": "164342"
      },
      {
        "db": "PACKETSTORM",
        "id": "164282"
      },
      {
        "db": "PACKETSTORM",
        "id": "164948"
      },
      {
        "db": "PACKETSTORM",
        "id": "169318"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "id": "VAR-202108-2222",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      }
    ],
    "trust": 0.7410993499999999
  },
  "last_update_date": "2024-09-19T20:42:00.776000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Arch Linux Repair measures for trust management problem vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=157203"
      },
      {
        "title": "Arch Linux Issues: ",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=CVE-2021-22924 log"
      },
      {
        "title": "Arch Linux Advisories: [ASA-202107-61] libcurl-compat: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-202107-61"
      },
      {
        "title": "Arch Linux Advisories: [ASA-202107-60] lib32-curl: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-202107-60"
      },
      {
        "title": "Arch Linux Advisories: [ASA-202107-64] lib32-libcurl-gnutls: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-202107-64"
      },
      {
        "title": "Arch Linux Advisories: [ASA-202107-62] lib32-libcurl-compat: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-202107-62"
      },
      {
        "title": "Arch Linux Advisories: [ASA-202107-63] libcurl-gnutls: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-202107-63"
      },
      {
        "title": "Arch Linux Advisories: [ASA-202107-59] curl: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-202107-59"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2021-22924"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-706",
        "trust": 1.1
      },
      {
        "problemtype": "CWE-20",
        "trust": 1.0
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-389290.pdf"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-484086.pdf"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-732250.pdf"
      },
      {
        "trust": 1.7,
        "url": "https://security.netapp.com/advisory/ntap-20210902-0003/"
      },
      {
        "trust": 1.7,
        "url": "https://www.debian.org/security/2022/dsa-5197"
      },
      {
        "trust": 1.7,
        "url": "https://hackerone.com/reports/1223565"
      },
      {
        "trust": 1.7,
        "url": "https://www.oracle.com/security-alerts/cpujan2022.html"
      },
      {
        "trust": 1.7,
        "url": "https://www.oracle.com/security-alerts/cpuoct2021.html"
      },
      {
        "trust": 1.7,
        "url": "https://lists.debian.org/debian-lts-announce/2021/08/msg00017.html"
      },
      {
        "trust": 1.7,
        "url": "https://lists.debian.org/debian-lts-announce/2022/08/msg00017.html"
      },
      {
        "trust": 1.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-22924"
      },
      {
        "trust": 1.0,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22924"
      },
      {
        "trust": 1.0,
        "url": "https://lists.apache.org/thread.html/r61db8e7dcb56dc000a5387a88f7a473bacec5ee01b9ff3f55308aacc%40%3cdev.kafka.apache.org%3e"
      },
      {
        "trust": 1.0,
        "url": "https://lists.apache.org/thread.html/r61db8e7dcb56dc000a5387a88f7a473bacec5ee01b9ff3f55308aacc%40%3cusers.kafka.apache.org%3e"
      },
      {
        "trust": 1.0,
        "url": "https://lists.apache.org/thread.html/rbf4ce74b0d1fa9810dec50ba3ace0caeea677af7c27a97111c06ccb7%40%3cdev.kafka.apache.org%3e"
      },
      {
        "trust": 1.0,
        "url": "https://lists.apache.org/thread.html/rbf4ce74b0d1fa9810dec50ba3ace0caeea677af7c27a97111c06ccb7%40%3cusers.kafka.apache.org%3e"
      },
      {
        "trust": 1.0,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce%40lists.fedoraproject.org/message/frucw2uvnyudzf72dqlfqr4pjec6cf7v/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22922"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22923"
      },
      {
        "trust": 0.8,
        "url": "https://access.redhat.com/security/cve/cve-2021-22922"
      },
      {
        "trust": 0.8,
        "url": "https://listman.redhat.com/mailman/listinfo/rhsa-announce"
      },
      {
        "trust": 0.8,
        "url": "https://access.redhat.com/security/team/contact/"
      },
      {
        "trust": 0.8,
        "url": "https://access.redhat.com/security/cve/cve-2021-22923"
      },
      {
        "trust": 0.8,
        "url": "https://bugzilla.redhat.com/):"
      },
      {
        "trust": 0.7,
        "url": "https://lists.fedoraproject.org/archives/list/package-announce@lists.fedoraproject.org/message/frucw2uvnyudzf72dqlfqr4pjec6cf7v/"
      },
      {
        "trust": 0.7,
        "url": "https://lists.apache.org/thread.html/r61db8e7dcb56dc000a5387a88f7a473bacec5ee01b9ff3f55308aacc@%3cdev.kafka.apache.org%3e"
      },
      {
        "trust": 0.7,
        "url": "https://lists.apache.org/thread.html/rbf4ce74b0d1fa9810dec50ba3ace0caeea677af7c27a97111c06ccb7@%3cdev.kafka.apache.org%3e"
      },
      {
        "trust": 0.7,
        "url": "https://lists.apache.org/thread.html/r61db8e7dcb56dc000a5387a88f7a473bacec5ee01b9ff3f55308aacc@%3cusers.kafka.apache.org%3e"
      },
      {
        "trust": 0.7,
        "url": "https://lists.apache.org/thread.html/rbf4ce74b0d1fa9810dec50ba3ace0caeea677af7c27a97111c06ccb7@%3cusers.kafka.apache.org%3e"
      },
      {
        "trust": 0.7,
        "url": "https://access.redhat.com/security/cve/cve-2021-36222"
      },
      {
        "trust": 0.7,
        "url": "https://access.redhat.com/security/cve/cve-2021-37750"
      },
      {
        "trust": 0.7,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-36222"
      },
      {
        "trust": 0.6,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-37750"
      },
      {
        "trust": 0.6,
        "url": "https://access.redhat.com/security/updates/classification/#important"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164342/red-hat-security-advisory-2021-3694-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164282/red-hat-security-advisory-2021-3653-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2022042566"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-132-13"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.2755"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021112309"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164555/red-hat-security-advisory-2021-3917-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164755/red-hat-security-advisory-2021-4104-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3649"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2023.3146"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3211"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164523/red-hat-security-advisory-2021-3873-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3430"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3472"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021072814"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3499"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021080210"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164221/red-hat-security-advisory-2021-3582-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164511/red-hat-security-advisory-2021-3851-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164583/red-hat-security-advisory-2021-3949-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://vigilance.fr/vulnerability/curl-information-disclosure-via-connection-reuse-35955"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.2526"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021092221"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3878"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021072212"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021110313"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164948/red-hat-security-advisory-2021-4618-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.ibm.com/support/pages/node/6495409"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3167"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/169318/debian-security-advisory-5197-1.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.2473"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021092811"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3485"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/163637/ubuntu-security-notice-usn-5021-1.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.3941"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/166714/red-hat-security-advisory-2022-1354-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021090834"
      },
      {
        "trust": 0.6,
        "url": "https://packetstormsecurity.com/files/164562/red-hat-security-advisory-2021-3925-01.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2022.4266"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2022.1637"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2021102116"
      },
      {
        "trust": 0.6,
        "url": "https://www.cybersecurity-help.cz/vdb/sb2022031104"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3653"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/documentation/en-us/red_hat_advanced_cluster_mana"
      },
      {
        "trust": 0.5,
        "url": "https://access.redhat.com/security/cve/cve-2021-3653"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-32626"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-32687"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32626"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32675"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23017"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-32675"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-41099"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32627"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32687"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32628"
      },
      {
        "trust": 0.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32672"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-23017"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-32627"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-32672"
      },
      {
        "trust": 0.4,
        "url": "https://access.redhat.com/security/cve/cve-2021-32628"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-41099"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2021-3656"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3656"
      },
      {
        "trust": 0.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-37576"
      },
      {
        "trust": 0.3,
        "url": "https://access.redhat.com/security/cve/cve-2021-37576"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22898"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22543"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-23840"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-22543"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2016-4658"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2016-4658"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32690"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-32690"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23841"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-23841"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23840"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/updates/classification/#moderate"
      },
      {
        "trust": 0.2,
        "url": "https://access.redhat.com/security/cve/cve-2021-3749"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22947"
      },
      {
        "trust": 0.2,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22946"
      },
      {
        "trust": 0.1,
        "url": "http://seclists.org/oss-sec/2021/q3/26"
      },
      {
        "trust": 0.1,
        "url": "https://security.archlinux.org/cve-2021-22924"
      },
      {
        "trust": 0.1,
        "url": "https://security.archlinux.org/asa-202107-61"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/curl/7.74.0-1ubuntu2.1"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/curl/7.58.0-2ubuntu3.14"
      },
      {
        "trust": 0.1,
        "url": "https://ubuntu.com/security/notices/usn-5021-1"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22925"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/curl/7.68.0-1ubuntu2.6"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-23434"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3873"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-23434"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-21670"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-25648"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-21670"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-25741"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-25648"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-21671"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3925"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-21671"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-25741"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3715"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-8912"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-8911"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-27218"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3442"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8911"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-3715"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-27218"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-3442"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-8912"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/documentation/en-us/red_hat_3scale_api_management"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3851"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3949"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3582"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/team/key/"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/articles/11258"
      },
      {
        "trust": 0.1,
        "url": "https://issues.jboss.org/):"
      },
      {
        "trust": 0.1,
        "url": "https://docs.openshift.com/container-platform/4.8/migration_toolkit_for_con"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-38201"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-38201"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3694"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3749"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-27777"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-29154"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-31535"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:3653"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32399"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-29650"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-27777"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-29154"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-32399"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-29650"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22555"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-31535"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-22555"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-33929"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-0512"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-32803"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-3733"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-33930"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3711"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/errata/rhsa-2021:4618"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3733"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2020-36385"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-3712"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-32804"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-33623"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-33938"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-33929"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2020-36385"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32804"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-22947"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-0512"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-3711"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-33930"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-33623"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-22946"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-33928"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-3712"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-33938"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-32803"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/cve/cve-2021-33928"
      },
      {
        "trust": 0.1,
        "url": "https://www.debian.org/security/faq"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-27782"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-32205"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-27775"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-32206"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-27774"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-32207"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-27781"
      },
      {
        "trust": 0.1,
        "url": "https://www.debian.org/security/"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-27776"
      },
      {
        "trust": 0.1,
        "url": "https://security-tracker.debian.org/tracker/curl"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-22576"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-22945"
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-22924"
      },
      {
        "db": "PACKETSTORM",
        "id": "163637"
      },
      {
        "db": "PACKETSTORM",
        "id": "164523"
      },
      {
        "db": "PACKETSTORM",
        "id": "164562"
      },
      {
        "db": "PACKETSTORM",
        "id": "164511"
      },
      {
        "db": "PACKETSTORM",
        "id": "164583"
      },
      {
        "db": "PACKETSTORM",
        "id": "164221"
      },
      {
        "db": "PACKETSTORM",
        "id": "164342"
      },
      {
        "db": "PACKETSTORM",
        "id": "164282"
      },
      {
        "db": "PACKETSTORM",
        "id": "164948"
      },
      {
        "db": "PACKETSTORM",
        "id": "169318"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "db": "VULMON",
        "id": "CVE-2021-22924"
      },
      {
        "db": "PACKETSTORM",
        "id": "163637"
      },
      {
        "db": "PACKETSTORM",
        "id": "164523"
      },
      {
        "db": "PACKETSTORM",
        "id": "164562"
      },
      {
        "db": "PACKETSTORM",
        "id": "164511"
      },
      {
        "db": "PACKETSTORM",
        "id": "164583"
      },
      {
        "db": "PACKETSTORM",
        "id": "164221"
      },
      {
        "db": "PACKETSTORM",
        "id": "164342"
      },
      {
        "db": "PACKETSTORM",
        "id": "164282"
      },
      {
        "db": "PACKETSTORM",
        "id": "164948"
      },
      {
        "db": "PACKETSTORM",
        "id": "169318"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-08-05T00:00:00",
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "date": "2021-07-22T23:15:11",
        "db": "PACKETSTORM",
        "id": "163637"
      },
      {
        "date": "2021-10-15T15:06:44",
        "db": "PACKETSTORM",
        "id": "164523"
      },
      {
        "date": "2021-10-20T15:45:47",
        "db": "PACKETSTORM",
        "id": "164562"
      },
      {
        "date": "2021-10-14T15:19:59",
        "db": "PACKETSTORM",
        "id": "164511"
      },
      {
        "date": "2021-10-21T15:31:47",
        "db": "PACKETSTORM",
        "id": "164583"
      },
      {
        "date": "2021-09-21T15:40:44",
        "db": "PACKETSTORM",
        "id": "164221"
      },
      {
        "date": "2021-09-30T16:27:16",
        "db": "PACKETSTORM",
        "id": "164342"
      },
      {
        "date": "2021-09-24T15:49:04",
        "db": "PACKETSTORM",
        "id": "164282"
      },
      {
        "date": "2021-11-12T17:01:04",
        "db": "PACKETSTORM",
        "id": "164948"
      },
      {
        "date": "2022-08-28T19:12:00",
        "db": "PACKETSTORM",
        "id": "169318"
      },
      {
        "date": "2021-07-21T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      },
      {
        "date": "2021-08-05T21:15:11.380000",
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-10-28T00:00:00",
        "db": "VULHUB",
        "id": "VHN-381398"
      },
      {
        "date": "2023-06-05T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      },
      {
        "date": "2024-03-27T15:11:45.923000",
        "db": "NVD",
        "id": "CVE-2021-22924"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "163637"
      },
      {
        "db": "PACKETSTORM",
        "id": "169318"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      }
    ],
    "trust": 0.8
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "libcurl Resource Management Error Vulnerability",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      }
    ],
    "trust": 0.6
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "resource management error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202107-1569"
      }
    ],
    "trust": 0.6
  }
}

var-202208-0612
Vulnerability from variot

Affected devices do not properly sanitize data introduced by an user when rendering the web interface. This could allow an authenticated remote attacker with administrative privileges to inject code and lead to a DOM-based XSS. SCALANCE M-800 firmware, SCALANCE S615 firmware, SCALANCE SC-600 Multiple Siemens products such as firmware have unspecified vulnerabilities.Information may be obtained and information may be tampered with. SCALANCE M-800, MUM-800 and S615 and RUGGEDCOM RM1224 industrial routers are used for secure remote access to plants via mobile networks (e.g. GPRS or UMTS) and have integrated security functions of firewalls to prevent unauthorized access, as well as VPNs to Secure data transmission. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from untrusted network attacks. They allow filtering incoming and outgoing network connections in different ways. The SCALANCE W-1700 product is a wireless communication device based on the IEEE 802.11ac standard. SCALANCE W-700 products are wireless communication devices based on the IEEE 802.11ax standard. SCALANCE X switches are used to connect industrial components such as programmable logic controllers (PLC) or human machine interfaces (HMI). A vulnerability has been identified in SCALANCE M-800 / S615 (All versions), SCALANCE SC-600 family (All versions < V2.3.1), SCALANCE W-1700 IEEE 802.11ac family (All versions), SCALANCE W-700 IEEE 802.11ax family (All versions), SCALANCE W-700 IEEE 802.11n family (All versions), SCALANCE XB-200 switch family (All versions), SCALANCE XC-200 switch family (All versions), SCALANCE XF-200BA switch family (All versions), SCALANCE XM-400 Family (All versions), SCALANCE XP-200 switch family (All versions), SCALANCE XR-300WG switch family (All versions), SCALANCE XR-500 Family (All versions)

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202208-0612",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance xr552-12m 2hr2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11ac",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc-600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xb208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xr324-12m ts",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba irt",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm400",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr500",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208 \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb213-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr328-4c wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc216-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216 \\",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf-200ba",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m 2hr2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12m 2hr2 l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700 ieee 802.11ax",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb213-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr326-2c poe wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr552-12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp-200",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc208g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528-6m 2hr2 l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xp216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr324-4m eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr528",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xc208g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3.1"
      },
      {
        "model": "scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526-8c l3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr526",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr-300wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc-646-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb205-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-600",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc206-2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11ax",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb216",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-622-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xc-200",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb213-3ld",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-632-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb213-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-642-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11ac",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance w700 ieee 802.11n",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb205-3ld",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-636-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance xb208",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800 s615",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "/"
      },
      {
        "model": "scalance sc-600 family",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v2.3.1"
      },
      {
        "model": "scalance w-700 ieee 802.11ax family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w-700 ieee 802.11n family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w-1700 ieee 802.11ac family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf-200ba switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm-400 family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp-200 switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr-300wg switch family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr-500 family",
        "scope": null,
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens has reported these vulnerabilities to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-36325",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 10.0,
            "confidentialityImpact": "COMPLETE",
            "exploitabilityScore": 10.0,
            "id": "CNVD-2022-56474",
            "impactScore": 10.0,
            "integrityImpact": "COMPLETE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:N/C:C/I:C/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "NONE",
            "baseScore": 4.8,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "LOW",
            "exploitabilityScore": 1.7,
            "id": "CVE-2022-36325",
            "impactScore": 2.7,
            "integrityImpact": "LOW",
            "privilegesRequired": "HIGH",
            "scope": "CHANGED",
            "trust": 1.0,
            "userInteraction": "REQUIRED",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:C/C:L/I:L/A:N",
            "version": "3.1"
          },
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "HIGH",
            "baseScore": 6.8,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 0.9,
            "id": "CVE-2022-36325",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "REQUIRED",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:R/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "NVD",
            "availabilityImpact": "None",
            "baseScore": 4.8,
            "baseSeverity": "Medium",
            "confidentialityImpact": "Low",
            "exploitabilityScore": null,
            "id": "CVE-2022-36325",
            "impactScore": null,
            "integrityImpact": "Low",
            "privilegesRequired": "High",
            "scope": "Changed",
            "trust": 0.8,
            "userInteraction": "Required",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:H/UI:R/S:C/C:L/I:L/A:N",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-36325",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-36325",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "NVD",
            "id": "CVE-2022-36325",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2022-56474",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202208-2711",
            "trust": 0.6,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices do not properly sanitize data introduced by an user when rendering the web interface. This could allow an authenticated remote attacker with administrative privileges to inject code and lead to a DOM-based XSS. SCALANCE M-800 firmware, SCALANCE S615 firmware, SCALANCE SC-600 Multiple Siemens products such as firmware have unspecified vulnerabilities.Information may be obtained and information may be tampered with. SCALANCE M-800, MUM-800 and S615 and RUGGEDCOM RM1224 industrial routers are used for secure remote access to plants via mobile networks (e.g. GPRS or UMTS) and have integrated security functions of firewalls to prevent unauthorized access, as well as VPNs to Secure data transmission. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from untrusted network attacks. They allow filtering incoming and outgoing network connections in different ways. The SCALANCE W-1700 product is a wireless communication device based on the IEEE 802.11ac standard. SCALANCE W-700 products are wireless communication devices based on the IEEE 802.11ax standard. SCALANCE X switches are used to connect industrial components such as programmable logic controllers (PLC) or human machine interfaces (HMI). A vulnerability has been identified in SCALANCE M-800 / S615 (All versions), SCALANCE SC-600 family (All versions \u003c V2.3.1), SCALANCE W-1700 IEEE 802.11ac family (All versions), SCALANCE W-700 IEEE 802.11ax family (All versions), SCALANCE W-700 IEEE 802.11n family (All versions), SCALANCE XB-200 switch family (All versions), SCALANCE XC-200 switch family (All versions), SCALANCE XF-200BA switch family (All versions), SCALANCE XM-400 Family (All versions), SCALANCE XP-200 switch family (All versions), SCALANCE XR-300WG switch family (All versions), SCALANCE XR-500 Family (All versions)",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36325"
      }
    ],
    "trust": 2.25
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-36325",
        "trust": 3.9
      },
      {
        "db": "SIEMENS",
        "id": "SSA-710008",
        "trust": 3.1
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-223-07",
        "trust": 1.5
      },
      {
        "db": "JVN",
        "id": "JVNVU90767165",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2022.4032",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36325",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36325"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "id": "VAR-202208-0612",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      }
    ],
    "trust": 1.2477712656666666
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      }
    ]
  },
  "last_update_date": "2024-08-14T14:17:48.938000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Patch for Unknown Vulnerability in Siemens SCALANCE Products (CNVD-2022-56474)",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/343626"
      },
      {
        "title": "Siemens SCALANCE Security vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=243184"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-80",
        "trust": 1.0
      },
      {
        "problemtype": "NVD-CWE-Other",
        "trust": 1.0
      },
      {
        "problemtype": "others (CWE-Other) [NVD evaluation ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.5,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-710008.pdf"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu90767165/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-36325"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-223-07"
      },
      {
        "trust": 0.6,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-710008.html"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-36325/"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2022.4032"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-223-07"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/80.html"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://www.cisa.gov/uscert/ics/advisories/icsa-22-223-07"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36325"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "db": "VULMON",
        "id": "CVE-2022-36325"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-12T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "VULMON",
        "id": "CVE-2022-36325"
      },
      {
        "date": "2023-09-22T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      },
      {
        "date": "2022-08-10T12:15:12.997000",
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2022-08-12T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2022-56474"
      },
      {
        "date": "2022-08-10T00:00:00",
        "db": "VULMON",
        "id": "CVE-2022-36325"
      },
      {
        "date": "2023-09-22T08:25:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      },
      {
        "date": "2023-06-28T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      },
      {
        "date": "2023-06-27T19:51:47.307000",
        "db": "NVD",
        "id": "CVE-2022-36325"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Vulnerabilities in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-014931"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202208-2711"
      }
    ],
    "trust": 0.6
  }
}

var-202212-1136
Vulnerability from variot

Affected devices do not check the TFTP blocksize correctly. This could allow an authenticated attacker to read from an uninitialized buffer that potentially contains previously allocated data. ruggedcom rm1224 lte(4g) eu firmware, ruggedcom rm1224 lte(4g) nam firmware, scalance m804pb Multiple Siemens products, including firmware, contain a vulnerability related to improper validation of quantities specified in input.Information may be obtained. SCALANCE M-800, MUM-800 and S615 as well as RUGGEDCOM RM1224 are industrial routers.

The Siemens SCALANCE M-800/S615 series has an information disclosure vulnerability due to the affected device not properly checking the TFTP block size

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202212-1136",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m876-4",
        "scope": "lt",
        "trust": 1.8,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m876-3",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance mum856-1",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance w778-1 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w788-2 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xp208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2 eec m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w788-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb213-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w761-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2ia m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204-2ba",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc224",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance mum853-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w786-2 sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte\\ eu",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr326-2c poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb213-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w721-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr328-4c wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb205-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w788-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc224-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance s615 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m804pb",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "ruggedcom rm1224 lte\\ nam",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w786-2ia rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum763-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum766-1 6ghz",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m876-4",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204 dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1 6ghz",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm416-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w738-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w1788-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208 poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr526-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1 ecc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w748-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc224-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr552-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w722-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xm408-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 m12 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w734-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance m874-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance sc626-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xc216-3g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-2 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr528-6m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1748-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm408-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m874-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance wam763-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w778-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum766-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xb216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr324wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr326-2c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc206-2sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w788-2 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance mum856-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m876-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb205-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204-2bca dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615 eec",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m876-4",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte eu",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-622-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-636-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte nam",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance mum856-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m876-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc626-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m874-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-642-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance mum853-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m804pb",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-646-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-632-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m874-2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte eu",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "ruggedcom rm1224 lte nam",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m804pb",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m874-2",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance m874-3",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance mum853-1",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      },
      {
        "model": "scalance s615 eec",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v8.0"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens reported these vulnerabilities to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-46143",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "MULTIPLE",
            "author": "CNVD",
            "availabilityImpact": "NONE",
            "baseScore": 3.3,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 6.4,
            "id": "CNVD-2023-97251",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "LOW",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:M/C:P/I:N/A:N",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "NONE",
            "baseScore": 2.7,
            "baseSeverity": "LOW",
            "confidentialityImpact": "LOW",
            "exploitabilityScore": 1.2,
            "id": "CVE-2022-46143",
            "impactScore": 1.4,
            "integrityImpact": "NONE",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:U/C:L/I:N/A:N",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "OTHER",
            "availabilityImpact": "None",
            "baseScore": 2.7,
            "baseSeverity": "Low",
            "confidentialityImpact": "Low",
            "exploitabilityScore": null,
            "id": "JVNDB-2022-023553",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "High",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:H/UI:N/S:U/C:L/I:N/A:N",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-46143",
            "trust": 1.0,
            "value": "LOW"
          },
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-46143",
            "trust": 1.0,
            "value": "LOW"
          },
          {
            "author": "OTHER",
            "id": "JVNDB-2022-023553",
            "trust": 0.8,
            "value": "Low"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2023-97251",
            "trust": 0.6,
            "value": "LOW"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202212-3089",
            "trust": 0.6,
            "value": "LOW"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices do not check the TFTP blocksize correctly. This could allow an authenticated attacker to read from an uninitialized buffer that potentially contains previously allocated data. ruggedcom rm1224 lte(4g) eu firmware, ruggedcom rm1224 lte(4g) nam firmware, scalance m804pb Multiple Siemens products, including firmware, contain a vulnerability related to improper validation of quantities specified in input.Information may be obtained. SCALANCE M-800, MUM-800 and S615 as well as RUGGEDCOM RM1224 are industrial routers. \n\r\n\r\nThe Siemens SCALANCE M-800/S615 series has an information disclosure vulnerability due to the affected device not properly checking the TFTP block size",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      }
    ],
    "trust": 2.16
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-46143",
        "trust": 3.8
      },
      {
        "db": "SIEMENS",
        "id": "SSA-413565",
        "trust": 2.4
      },
      {
        "db": "SIEMENS",
        "id": "SSA-180704",
        "trust": 1.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-349-04",
        "trust": 1.4
      },
      {
        "db": "JVN",
        "id": "JVNVU91561630",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "id": "VAR-202212-1136",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      }
    ],
    "trust": 1.2398166874999998
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      }
    ]
  },
  "last_update_date": "2024-08-14T12:11:36.523000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Patch for Siemens SCALANCE M-800/S615 series information leakage vulnerability",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/500346"
      },
      {
        "title": "Siemens part of the product Security vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=218338"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-1284",
        "trust": 1.0
      },
      {
        "problemtype": "Improper validation of quantity specified in input (CWE-1284) [ others ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.4,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
      },
      {
        "trust": 1.6,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-180704.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-413565.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-180704.pdf"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu91561630/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-46143"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-349-04"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-349-04"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-46143/"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-12-14T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "date": "2023-11-29T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "date": "2022-12-13T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      },
      {
        "date": "2022-12-13T16:15:25.137000",
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-12-13T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2023-97251"
      },
      {
        "date": "2023-11-29T03:03:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      },
      {
        "date": "2022-12-20T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      },
      {
        "date": "2024-08-13T08:15:05.483000",
        "db": "NVD",
        "id": "CVE-2022-46143"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Vulnerability in multiple Siemens products related to improper validation of quantities specified in inputs",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023553"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3089"
      }
    ],
    "trust": 0.6
  }
}

var-201609-0482
Vulnerability from variot

The integrated web server on Siemens SCALANCE M-800 and S615 modules with firmware before 4.02 does not set the secure flag for the session cookie in an https session, which makes it easier for remote attackers to capture this cookie by intercepting its transmission within an http session. The SCALANCE M series are industrial routers used to secure remote access.

SIEMENS SCALANCE m-800 / S61 module has an information disclosure vulnerability. Attackers can use vulnerabilities to obtain sensitive information, posing a risk of information leakage. Successful exploits may lead to other attacks. Versions prior to Siemens Scalance M-800 / S615 4.02 are vulnerable. Both Siemens Scalance M-800 and S615 are products of Siemens, Germany. The former is an industrial router and the latter is a firewall

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201609-0482",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance s615",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.01"
      },
      {
        "model": "scalance m-800",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.01"
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 0.8,
        "vendor": "siemens",
        "version": "4.02"
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 0.8,
        "vendor": "siemens",
        "version": "4.02"
      },
      {
        "model": "scalance m-800 s615",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "/"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "4.01"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "4.01"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance s-615",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.02"
      },
      {
        "model": "scalance m-800",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.02"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "BID",
        "id": "93115"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/h:siemens:scalance_m-800",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_m-800_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/h:siemens:scalance_s615",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_s615_firmware",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Alexander Van Maele and Tijl Deneut from HOWEST.",
    "sources": [
      {
        "db": "BID",
        "id": "93115"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      }
    ],
    "trust": 0.9
  },
  "cve": "CVE-2016-7090",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "MEDIUM",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "NONE",
            "baseScore": 4.3,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 8.6,
            "id": "CVE-2016-7090",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.8,
            "vectorString": "AV:N/AC:M/Au:N/C:P/I:N/A:N",
            "version": "2.0"
          },
          {
            "accessComplexity": "HIGH",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "NONE",
            "baseScore": 2.6,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 4.9,
            "id": "CNVD-2016-07905",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "LOW",
            "trust": 0.6,
            "vectorString": "AV:N/AC:H/Au:N/C:P/I:N/A:N",
            "version": "2.0"
          },
          {
            "accessComplexity": "MEDIUM",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "VULHUB",
            "availabilityImpact": "NONE",
            "baseScore": 4.3,
            "confidentialityImpact": "PARTIAL",
            "exploitabilityScore": 8.6,
            "id": "VHN-95910",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.1,
            "vectorString": "AV:N/AC:M/AU:N/C:P/I:N/A:N",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "HIGH",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "NONE",
            "baseScore": 4.0,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "LOW",
            "exploitabilityScore": 2.2,
            "id": "CVE-2016-7090",
            "impactScore": 1.4,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "CHANGED",
            "trust": 1.8,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.0/AV:N/AC:H/PR:N/UI:N/S:C/C:L/I:N/A:N",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2016-7090",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "NVD",
            "id": "CVE-2016-7090",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2016-07905",
            "trust": 0.6,
            "value": "LOW"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201609-573",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "VULHUB",
            "id": "VHN-95910",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "The integrated web server on Siemens SCALANCE M-800 and S615 modules with firmware before 4.02 does not set the secure flag for the session cookie in an https session, which makes it easier for remote attackers to capture this cookie by intercepting its transmission within an http session. The SCALANCE M series are industrial routers used to secure remote access. \n\nSIEMENS SCALANCE m-800 / S61 module has an information disclosure vulnerability. Attackers can use vulnerabilities to obtain sensitive information, posing a risk of information leakage. Successful exploits may lead to other attacks. \nVersions prior to Siemens Scalance M-800 / S615 4.02 are vulnerable. Both Siemens Scalance M-800 and S615 are products of Siemens, Germany. The former is an industrial router and the latter is a firewall",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "BID",
        "id": "93115"
      },
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      }
    ],
    "trust": 2.52
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2016-7090",
        "trust": 3.4
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-16-271-01",
        "trust": 2.8
      },
      {
        "db": "BID",
        "id": "93115",
        "trust": 2.0
      },
      {
        "db": "SIEMENS",
        "id": "SSA-342135",
        "trust": 2.0
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573",
        "trust": 0.7
      },
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905",
        "trust": 0.6
      },
      {
        "db": "VULHUB",
        "id": "VHN-95910",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "db": "BID",
        "id": "93115"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "id": "VAR-201609-0482",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      }
    ],
    "trust": 1.3438174866666666
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "ICS",
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      }
    ]
  },
  "last_update_date": "2024-08-14T15:34:48.905000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-342135",
        "trust": 0.8,
        "url": "http://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-342135.pdf"
      },
      {
        "title": "Patch for Information disclosure vulnerability in SIEMENS SCALANCE m-800 / S61 module",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/81618"
      },
      {
        "title": "Siemens Scalance M-800  and S615 Repair measures for information disclosure vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=64295"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-200",
        "trust": 1.9
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.8,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-16-271-01"
      },
      {
        "trust": 2.0,
        "url": "http://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-342135.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://www.securityfocus.com/bid/93115"
      },
      {
        "trust": 0.8,
        "url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2016-7090"
      },
      {
        "trust": 0.8,
        "url": "http://web.nvd.nist.gov/view/vuln/detail?vulnid=cve-2016-7090"
      },
      {
        "trust": 0.3,
        "url": "http://www.siemens.com/"
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "db": "BID",
        "id": "93115"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "db": "BID",
        "id": "93115"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2016-09-23T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "date": "2016-09-29T00:00:00",
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "date": "2016-09-22T00:00:00",
        "db": "BID",
        "id": "93115"
      },
      {
        "date": "2016-10-05T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "date": "2016-09-23T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "date": "2016-09-29T10:59:03.893000",
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2016-09-23T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2016-07905"
      },
      {
        "date": "2016-11-28T00:00:00",
        "db": "VULHUB",
        "id": "VHN-95910"
      },
      {
        "date": "2016-09-28T00:02:00",
        "db": "BID",
        "id": "93115"
      },
      {
        "date": "2016-10-05T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      },
      {
        "date": "2016-09-30T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      },
      {
        "date": "2016-11-28T20:37:05.437000",
        "db": "NVD",
        "id": "CVE-2016-7090"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens SCALANCE M-800 and  S615 Module firmware integration  Web Session on server  Cookie Vulnerability that is captured",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2016-005051"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "information disclosure",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201609-573"
      }
    ],
    "trust": 0.6
  }
}

var-202103-0976
Vulnerability from variot

A vulnerability has been identified in RUGGEDCOM RM1224 (V6.3), SCALANCE M-800 (V6.3), SCALANCE S615 (V6.3), SCALANCE SC-600 (All Versions >= V2.1 and < V2.1.3). Multiple failed SSH authentication attempts could trigger a temporary Denial-of-Service under certain conditions. When triggered, the device will reboot automatically. plural Siemens The product is vulnerable to improper restrictions on excessive authentication attempts.Denial of service (DoS) It may be put into a state. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from attacks from untrusted networks. SCALANCE M-800/S615 industrial routers are used for secure remote access to the factory through mobilenetworks (such as GPRS or UMTS). It has an integrated security function of firewall to prevent unauthorized access, and VPN can protect data transmission. RUGGEDCOM RM1224 is a 4G router for wireless IP communication from Ethernet-based devices via LTE (4G)-mobile radio.

Siemens SCALANCE and RUGGEDCOM devices have a denial of service vulnerability. An attacker can use the vulnerability to trigger a temporary denial of service

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202103-0976",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "6.3"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "6.3"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": "eq",
        "trust": 1.6,
        "vendor": "siemens",
        "version": "6.3"
      },
      {
        "model": "scalance sc-600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.3"
      },
      {
        "model": "scalance sc-600",
        "scope": "gte",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "ruggedcom rm1224",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-600",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-600",
        "scope": "gte",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v2.1,\u003c2.1.3"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "cve": "CVE-2021-25676",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 5.0,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2021-25676",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.8,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CNVD-2021-16444",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2021-25676",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 7.5,
            "baseSeverity": "High",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "CVE-2021-25676",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2021-25676",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2021-25676",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2021-16444",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202103-690",
            "trust": 0.6,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "A vulnerability has been identified in RUGGEDCOM RM1224 (V6.3), SCALANCE M-800 (V6.3), SCALANCE S615 (V6.3), SCALANCE SC-600 (All Versions \u003e= V2.1 and \u003c V2.1.3). Multiple failed SSH authentication attempts could trigger a temporary Denial-of-Service under certain conditions. When triggered, the device will reboot automatically. plural Siemens The product is vulnerable to improper restrictions on excessive authentication attempts.Denial of service (DoS) It may be put into a state. SCALANCE SC-600 devices (SC622-2C, SC632-2C, SC636-2C, SC642-2C, SC646-2C) are used to protect trusted industrial networks from attacks from untrusted networks. SCALANCE M-800/S615 industrial routers are used for secure remote access to the factory through mobilenetworks (such as GPRS or UMTS). It has an integrated security function of firewall to prevent unauthorized access, and VPN can protect data transmission. RUGGEDCOM RM1224 is a 4G router for wireless IP communication from Ethernet-based devices via LTE (4G)-mobile radio. \n\r\n\r\nSiemens SCALANCE and RUGGEDCOM devices have a denial of service vulnerability. An attacker can use the vulnerability to trigger a temporary denial of service",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      }
    ],
    "trust": 2.16
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2021-25676",
        "trust": 3.0
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-21-068-02",
        "trust": 2.4
      },
      {
        "db": "SIEMENS",
        "id": "SSA-296266",
        "trust": 2.2
      },
      {
        "db": "JVN",
        "id": "JVNVU93441670",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475",
        "trust": 0.8
      },
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444",
        "trust": 0.6
      },
      {
        "db": "AUSCERT",
        "id": "ESB-2021.0846",
        "trust": 0.6
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "id": "VAR-202103-0976",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      }
    ],
    "trust": 1.09434761
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "ICS"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      }
    ]
  },
  "last_update_date": "2024-08-14T13:17:17.442000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-296266",
        "trust": 0.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-296266.pdf"
      },
      {
        "title": "Siemens RUGGEDCOM Security vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=144282"
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-307",
        "trust": 1.0
      },
      {
        "problemtype": "Inappropriate restriction of excessive authentication attempts (CWE-307) [ Other ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.4,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-21-068-02"
      },
      {
        "trust": 2.2,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-296266.pdf"
      },
      {
        "trust": 1.4,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2021-25676"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu93441670/"
      },
      {
        "trust": 0.6,
        "url": "https://vigilance.fr/vulnerability/siemens-ruggedcom-rm1224-denial-of-service-via-failed-ssh-authentication-34784"
      },
      {
        "trust": 0.6,
        "url": "https://www.auscert.org.au/bulletins/esb-2021.0846"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      },
      {
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-03-11T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "date": "2021-11-22T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "date": "2021-03-09T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      },
      {
        "date": "2021-03-15T17:15:22.127000",
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2021-03-23T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2021-16444"
      },
      {
        "date": "2021-11-22T09:03:00",
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      },
      {
        "date": "2021-03-19T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      },
      {
        "date": "2021-04-20T17:41:15.860000",
        "db": "NVD",
        "id": "CVE-2021-25676"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "plural \u00a0Siemens\u00a0 Vulnerability in improperly limiting excessive authentication attempts in products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2021-004475"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202103-690"
      }
    ],
    "trust": 0.6
  }
}

var-201710-0451
Vulnerability from variot

Memory leak in dnsmasq before 2.78, when the --add-mac, --add-cpe-id or --add-subnet option is specified, allows remote attackers to cause a denial of service (memory consumption) via vectors involving DNS response creation. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Contains a resource management vulnerability.Service operation interruption (DoS) There is a possibility of being put into a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities: 1. A buffer-overflow vulnerability 2. Multiple denial-of-service vulnerabilities Attackers can exploit these issues to execute arbitrary code within the context of affected device or cause a denial-of-service condition. This BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1

===================================================================== Red Hat Security Advisory

Synopsis: Critical: dnsmasq security update Advisory ID: RHSA-2017:2836-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2017:2836 Issue date: 2017-10-02 CVE Names: CVE-2017-14491 CVE-2017-14492 CVE-2017-14493 CVE-2017-14494 CVE-2017-14495 CVE-2017-14496 =====================================================================

  1. Summary:

An update for dnsmasq is now available for Red Hat Enterprise Linux 7.

Red Hat Product Security has rated this update as having a security impact of Critical. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.

  1. Relevant releases/architectures:

Red Hat Enterprise Linux Client (v. 7) - x86_64 Red Hat Enterprise Linux Client Optional (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64 Red Hat Enterprise Linux Server (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Workstation (v. 7) - x86_64 Red Hat Enterprise Linux Workstation Optional (v. 7) - x86_64

  1. Description:

The dnsmasq packages contain Dnsmasq, a lightweight DNS (Domain Name Server) forwarder and DHCP (Dynamic Host Configuration Protocol) server.

Security Fix(es):

  • A heap buffer overflow was found in dnsmasq in the code responsible for building DNS replies. An attacker could send crafted DNS packets to dnsmasq which would cause it to crash or, potentially, execute arbitrary code. (CVE-2017-14491)

  • A heap buffer overflow was discovered in dnsmasq in the IPv6 router advertisement (RA) handling code. This issue only affected configurations using one of these options: enable-ra, ra-only, slaac, ra-names, ra-advrouter, or ra-stateless. (CVE-2017-14492)

  • A stack buffer overflow was found in dnsmasq in the DHCPv6 code. (CVE-2017-14493)

  • An information leak was found in dnsmasq in the DHCPv6 relay code. An attacker on the local network could send crafted DHCPv6 packets to dnsmasq causing it to forward the contents of process memory, potentially leaking sensitive data. (CVE-2017-14494)

  • A memory exhaustion flaw was found in dnsmasq in the EDNS0 code. An attacker could send crafted DNS packets which would trigger memory allocations which would never be freed, leading to unbounded memory consumption and eventually a crash. This issue only affected configurations using one of the options: add-mac, add-cpe-id, or add-subnet. (CVE-2017-14495)

  • An integer underflow flaw leading to a buffer over-read was found in dnsmasq in the EDNS0 code. An attacker could send crafted DNS packets to dnsmasq which would cause it to crash. This issue only affected configurations using one of the options: add-mac, add-cpe-id, or add-subnet. (CVE-2017-14496)

Red Hat would like to thank Felix Wilhelm (Google Security Team), Fermin J. Serna (Google Security Team), Gabriel Campana (Google Security Team), Kevin Hamacher (Google Security Team), and Ron Bowes (Google Security Team) for reporting these issues.

  1. Solution:

For details on how to apply this update, which includes the changes described in this advisory, refer to:

https://access.redhat.com/articles/11258

  1. Bugs fixed (https://bugzilla.redhat.com/):

1495409 - CVE-2017-14491 dnsmasq: heap overflow in the code responsible for building DNS replies 1495410 - CVE-2017-14492 dnsmasq: heap overflow in the IPv6 router advertisement code 1495411 - CVE-2017-14493 dnsmasq: stack buffer overflow in the DHCPv6 code 1495412 - CVE-2017-14494 dnsmasq: information leak in the DHCPv6 relay code 1495415 - CVE-2017-14495 dnsmasq: memory exhaustion vulnerability in the EDNS0 code 1495416 - CVE-2017-14496 dnsmasq: integer underflow leading to buffer over-read in the EDNS0 code

  1. Package List:

Red Hat Enterprise Linux Client (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Client Optional (v. 7):

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux ComputeNode (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux ComputeNode Optional (v. 7):

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Server (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

aarch64: dnsmasq-2.76-2.el7_4.2.aarch64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm

ppc64: dnsmasq-2.76-2.el7_4.2.ppc64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm

ppc64le: dnsmasq-2.76-2.el7_4.2.ppc64le.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm

s390x: dnsmasq-2.76-2.el7_4.2.s390x.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Server Optional (v. 7):

aarch64: dnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm dnsmasq-utils-2.76-2.el7_4.2.aarch64.rpm

ppc64: dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm dnsmasq-utils-2.76-2.el7_4.2.ppc64.rpm

ppc64le: dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm dnsmasq-utils-2.76-2.el7_4.2.ppc64le.rpm

s390x: dnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm dnsmasq-utils-2.76-2.el7_4.2.s390x.rpm

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Workstation (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Workstation Optional (v. 7):

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/

  1. References:

https://access.redhat.com/security/cve/CVE-2017-14491 https://access.redhat.com/security/cve/CVE-2017-14492 https://access.redhat.com/security/cve/CVE-2017-14493 https://access.redhat.com/security/cve/CVE-2017-14494 https://access.redhat.com/security/cve/CVE-2017-14495 https://access.redhat.com/security/cve/CVE-2017-14496 https://access.redhat.com/security/updates/classification/#critical https://access.redhat.com/security/vulnerabilities/3199382

  1. Contact:

The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/

Copyright 2017 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1

iD8DBQFZ0opYXlSAg2UNWIIRAr0dAJ9rIL1FgNTJUf2I9jjKFFlfkCd/kwCfV+bX SfoCV7+qG2nwqlHKLZOlhIU= =iWfU -----END PGP SIGNATURE-----

-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . =========================================================================== Ubuntu Security Notice USN-3430-3 January 04, 2018

dnsmasq regression

A security issue affects these releases of Ubuntu and its derivatives:

  • Ubuntu 12.04 ESM

Summary:

USN-3430-2 introduced regression in Dnsmasq.

Software Description: - dnsmasq: Small caching DNS proxy and DHCP/TFTP server

Details:

USN-3430-2 fixed several vulnerabilities. The update introduced a new regression that breaks DNS resolution. This update addresses the problem.

We apologize for the inconvenience.

Original advisory details:

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14491)

Felix Wilhelm, Fermin J. (CVE-2017-14492)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DHCPv6 requests. (CVE-2017-14493)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DHCPv6 packets. (CVE-2017-14494)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14495)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. A remote attacker could use this issue to cause Dnsmasq to crash, resulting in a denial of service. (CVE-2017-14496)

Update instructions:

The problem can be corrected by updating your system to the following package versions:

Ubuntu 12.04 ESM: dnsmasq=C2=A02.59-4ubuntu0.4 dnsmasq-base2.59-4ubuntu0.4 dnsmasq-utils2.59-4ubuntu0.4

After a standard system update you need to reboot your computer to make all the necessary changes.

Affected packages

-------------------------------------------------------------------
 Package              /     Vulnerable     /            Unaffected
-------------------------------------------------------------------

1 net-dns/dnsmasq < 2.78 >= 2.78

Description

Multiple vulnerabilities have been discovered in Dnsmasq.

Workaround

There is no known workaround at this time.

Resolution

All Dnsmasq users should upgrade to the latest version:

# emerge --sync # emerge --ask --oneshot --verbose ">=net-dns/dnsmasq-2.78"

References

[ 1 ] CVE-2017-14491 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14491 [ 2 ] CVE-2017-14492 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14492 [ 3 ] CVE-2017-14493 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14493 [ 4 ] CVE-2017-14494 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14494 [ 5 ] CVE-2017-14495 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14495 [ 6 ] CVE-2017-14496 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14496

Availability

This GLSA and any updates to it are available for viewing at the Gentoo Security Website:

https://security.gentoo.org/glsa/201710-27

Concerns?

Security is a primary focus of Gentoo Linux and ensuring the confidentiality and security of our users' machines is of utmost importance to us. Any security concerns should be addressed to security@gentoo.org or alternatively, you may file a bug at https://bugs.gentoo.org.

License

Copyright 2017 Gentoo Foundation, Inc; referenced text belongs to its owner(s).

The contents of this document are licensed under the Creative Commons - Attribution / Share Alike license.

http://creativecommons.org/licenses/by-sa/2.5

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201710-0451",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "17.04"
      },
      {
        "model": "dnsmasq",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "14.04"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.1"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "16.04"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.9,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "ruckus",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "technicolor",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "zyxel",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "dnsmasq",
        "version": null
      },
      {
        "model": "ubuntu",
        "scope": null,
        "trust": 0.8,
        "vendor": "canonical",
        "version": null
      },
      {
        "model": "gnu/linux",
        "scope": null,
        "trust": 0.8,
        "vendor": "debian",
        "version": null
      },
      {
        "model": "leap",
        "scope": null,
        "trust": 0.8,
        "vendor": "opensuse",
        "version": null
      },
      {
        "model": "dnsmasq",
        "scope": "lt",
        "trust": 0.8,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "enterprise linux desktop",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux server",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux workstation",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "redhat",
        "version": "-47.4"
      },
      {
        "model": "scalance w1750d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "17.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "16.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "14.04"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.75"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.72"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.71"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.70"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.65"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.64"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.63"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.62"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.61"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.60"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.59"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.58"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.57"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.56"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.55"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.54"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.53"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.52"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.51"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.50"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.49"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.48"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.47"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.46"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.45"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.44"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.43"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.42"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.41"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.40"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.38"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.37"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.36"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.35"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.34"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.33"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.30"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.29"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.28"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.27"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.26"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.25"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.24"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.23"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.22"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.21"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.20"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.19"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.9"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.8"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.3"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.996"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.992"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.98"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.96"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.95"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.4"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.2"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.37"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.0"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server for arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.2"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update suppor",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.2"
      },
      {
        "model": "enterprise linux server year extended upd",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.3"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5"
      },
      {
        "model": "enterprise linux long life server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5.9"
      },
      {
        "model": "enterprise linux hpc node optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux hpc node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux for scientific computing",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update supp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power little endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power big endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux desktop optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "6"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "opensuse",
        "version": "42.3"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "opensuse",
        "version": "42.2"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.10"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "6.0.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "5.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "5.0.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "4.4.4"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "8.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "7.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "google",
        "version": "6.0"
      },
      {
        "model": "fedora",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "fedoraproject",
        "version": "27"
      },
      {
        "model": "linux sparc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux s/390",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux powerpc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux mips",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-32",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-30",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux amd64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "7"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "6"
      },
      {
        "model": "dnsmasq",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.8"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.7"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.11"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.8"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:canonical:ubuntu",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:debian:debian_linux",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:opensuse_project:leap",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/a:thekelleys:dnsmasq",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_desktop",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_server",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_workstation",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Gabriel Campana, Kevin Hamacher and Ron Bowes of the Google Security Team,Felix Wilhelm, Fermin J. Serna",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2017-14495",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "PARTIAL",
            "baseScore": 5.0,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2017-14495",
            "impactScore": 2.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.9,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:P",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2017-14495",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.8,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2017-14495",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2017-14495",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201709-743",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "VULMON",
            "id": "CVE-2017-14495",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Memory leak in dnsmasq before 2.78, when the --add-mac, --add-cpe-id or --add-subnet option is specified, allows remote attackers to cause a denial of service (memory consumption) via vectors involving DNS response creation. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Contains a resource management vulnerability.Service operation interruption (DoS) There is a possibility of being put into a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities:\n1. A buffer-overflow vulnerability\n2. Multiple denial-of-service vulnerabilities\nAttackers can exploit these issues to execute arbitrary code within the  context of affected device or cause a denial-of-service condition. \nThis BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n=====================================================================\n                   Red Hat Security Advisory\n\nSynopsis:          Critical: dnsmasq security update\nAdvisory ID:       RHSA-2017:2836-01\nProduct:           Red Hat Enterprise Linux\nAdvisory URL:      https://access.redhat.com/errata/RHSA-2017:2836\nIssue date:        2017-10-02\nCVE Names:         CVE-2017-14491 CVE-2017-14492 CVE-2017-14493 \n                   CVE-2017-14494 CVE-2017-14495 CVE-2017-14496 \n=====================================================================\n\n1. Summary:\n\nAn update for dnsmasq is now available for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Critical. A Common Vulnerability Scoring System (CVSS) base score, which\ngives a detailed severity rating, is available for each vulnerability from\nthe CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - x86_64\nRed Hat Enterprise Linux Client Optional (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64\nRed Hat Enterprise Linux Server (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Workstation (v. 7) - x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 7) - x86_64\n\n3. Description:\n\nThe dnsmasq packages contain Dnsmasq, a lightweight DNS (Domain Name\nServer) forwarder and DHCP (Dynamic Host Configuration Protocol) server. \n\nSecurity Fix(es):\n\n* A heap buffer overflow was found in dnsmasq in the code responsible for\nbuilding DNS replies. An attacker could send crafted DNS packets to dnsmasq\nwhich would cause it to crash or, potentially, execute arbitrary code. \n(CVE-2017-14491)\n\n* A heap buffer overflow was discovered in dnsmasq in the IPv6 router\nadvertisement (RA) handling code. This issue only affected\nconfigurations using one of these options: enable-ra, ra-only, slaac,\nra-names, ra-advrouter, or ra-stateless. (CVE-2017-14492)\n\n* A stack buffer overflow was found in dnsmasq in the DHCPv6 code. (CVE-2017-14493)\n\n* An information leak was found in dnsmasq in the DHCPv6 relay code. An\nattacker on the local network could send crafted DHCPv6 packets to dnsmasq\ncausing it to forward the contents of process memory, potentially leaking\nsensitive data. (CVE-2017-14494)\n\n* A memory exhaustion flaw was found in dnsmasq in the EDNS0 code. An\nattacker could send crafted DNS packets which would trigger memory\nallocations which would never be freed, leading to unbounded memory\nconsumption and eventually a crash. This issue only affected configurations\nusing one of the options: add-mac, add-cpe-id, or add-subnet. \n(CVE-2017-14495)\n\n* An integer underflow flaw leading to a buffer over-read was found in\ndnsmasq in the EDNS0 code. An attacker could send crafted DNS packets to\ndnsmasq which would cause it to crash. This issue only affected\nconfigurations using one of the options: add-mac, add-cpe-id, or\nadd-subnet. (CVE-2017-14496)\n\nRed Hat would like to thank Felix Wilhelm (Google Security Team), Fermin J. \nSerna (Google Security Team), Gabriel Campana (Google Security Team), Kevin\nHamacher (Google Security Team), and Ron Bowes (Google Security Team) for\nreporting these issues. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1495409 - CVE-2017-14491 dnsmasq: heap overflow in the code responsible for building DNS replies\n1495410 - CVE-2017-14492 dnsmasq: heap overflow in the IPv6 router advertisement code\n1495411 - CVE-2017-14493 dnsmasq: stack buffer overflow in the DHCPv6 code\n1495412 - CVE-2017-14494 dnsmasq: information leak in the DHCPv6 relay code\n1495415 - CVE-2017-14495 dnsmasq: memory exhaustion vulnerability in the EDNS0 code\n1495416 - CVE-2017-14496 dnsmasq: integer underflow leading to buffer over-read in the EDNS0 code\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Client Optional (v. 7):\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional (v. 7):\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\naarch64:\ndnsmasq-2.76-2.el7_4.2.aarch64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm\n\nppc64:\ndnsmasq-2.76-2.el7_4.2.ppc64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm\n\nppc64le:\ndnsmasq-2.76-2.el7_4.2.ppc64le.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm\n\ns390x:\ndnsmasq-2.76-2.el7_4.2.s390x.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 7):\n\naarch64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.aarch64.rpm\n\nppc64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.ppc64.rpm\n\nppc64le:\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm\ndnsmasq-utils-2.76-2.el7_4.2.ppc64le.rpm\n\ns390x:\ndnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm\ndnsmasq-utils-2.76-2.el7_4.2.s390x.rpm\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 7):\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security.  Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2017-14491\nhttps://access.redhat.com/security/cve/CVE-2017-14492\nhttps://access.redhat.com/security/cve/CVE-2017-14493\nhttps://access.redhat.com/security/cve/CVE-2017-14494\nhttps://access.redhat.com/security/cve/CVE-2017-14495\nhttps://access.redhat.com/security/cve/CVE-2017-14496\nhttps://access.redhat.com/security/updates/classification/#critical\nhttps://access.redhat.com/security/vulnerabilities/3199382\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2017 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niD8DBQFZ0opYXlSAg2UNWIIRAr0dAJ9rIL1FgNTJUf2I9jjKFFlfkCd/kwCfV+bX\nSfoCV7+qG2nwqlHKLZOlhIU=\n=iWfU\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. \n===========================================================================\nUbuntu Security Notice USN-3430-3\nJanuary 04, 2018\n\ndnsmasq regression\n===========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 12.04 ESM\n\nSummary:\n\nUSN-3430-2 introduced regression in Dnsmasq. \n\nSoftware Description:\n- dnsmasq: Small caching DNS proxy and DHCP/TFTP server\n\nDetails:\n\nUSN-3430-2 fixed several vulnerabilities. The update introduced a new\nregression that breaks DNS resolution. This update addresses the\nproblem. \n\nWe apologize for the inconvenience. \n\nOriginal advisory details:\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. \n(CVE-2017-14491)\n\nFelix Wilhelm, Fermin J. (CVE-2017-14492)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DHCPv6 requests. \n(CVE-2017-14493)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DHCPv6 packets. (CVE-2017-14494)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14495)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. A remote\nattacker could use this issue to cause Dnsmasq to crash, resulting in\na denial of service. (CVE-2017-14496)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 12.04 ESM:\n dnsmasq=C2=A02.59-4ubuntu0.4\n dnsmasq-base2.59-4ubuntu0.4\n dnsmasq-utils2.59-4ubuntu0.4\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes. \n\nAffected packages\n=================\n\n    -------------------------------------------------------------------\n     Package              /     Vulnerable     /            Unaffected\n    -------------------------------------------------------------------\n  1  net-dns/dnsmasq               \u003c 2.78                     \u003e= 2.78 \n\nDescription\n===========\n\nMultiple vulnerabilities have been discovered in Dnsmasq. \n\nWorkaround\n==========\n\nThere is no known workaround at this time. \n\nResolution\n==========\n\nAll Dnsmasq users should upgrade to the latest version:\n\n  # emerge --sync\n  # emerge --ask --oneshot --verbose \"\u003e=net-dns/dnsmasq-2.78\"\n\nReferences\n==========\n\n[ 1 ] CVE-2017-14491\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14491\n[ 2 ] CVE-2017-14492\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14492\n[ 3 ] CVE-2017-14493\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14493\n[ 4 ] CVE-2017-14494\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14494\n[ 5 ] CVE-2017-14495\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14495\n[ 6 ] CVE-2017-14496\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14496\n\nAvailability\n============\n\nThis GLSA and any updates to it are available for viewing at\nthe Gentoo Security Website:\n\n https://security.gentoo.org/glsa/201710-27\n\nConcerns?\n=========\n\nSecurity is a primary focus of Gentoo Linux and ensuring the\nconfidentiality and security of our users\u0027 machines is of utmost\nimportance to us. Any security concerns should be addressed to\nsecurity@gentoo.org or alternatively, you may file a bug at\nhttps://bugs.gentoo.org. \n\nLicense\n=======\n\nCopyright 2017 Gentoo Foundation, Inc; referenced text\nbelongs to its owner(s). \n\nThe contents of this document are licensed under the\nCreative Commons - Attribution / Share Alike license. \n\nhttp://creativecommons.org/licenses/by-sa/2.5\n",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      },
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      }
    ],
    "trust": 3.42
  },
  "exploit_availability": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "reference": "https://vulmon.com/exploitdetails?qidtp=exploitdb\u0026qid=42945",
        "trust": 0.1,
        "type": "exploit"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#973527",
        "trust": 3.6
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495",
        "trust": 3.6
      },
      {
        "db": "BID",
        "id": "101085",
        "trust": 2.0
      },
      {
        "db": "BID",
        "id": "101977",
        "trust": 2.0
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-17-332-01",
        "trust": 2.0
      },
      {
        "db": "EXPLOIT-DB",
        "id": "42945",
        "trust": 1.7
      },
      {
        "db": "SECTRACK",
        "id": "1039474",
        "trust": 1.7
      },
      {
        "db": "SIEMENS",
        "id": "SSA-689071",
        "trust": 1.7
      },
      {
        "db": "JVN",
        "id": "JVNVU93453933",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14495",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144490",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144484",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "145652",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144469",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144706",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "id": "VAR-201710-0451",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.25396827
  },
  "last_update_date": "2024-08-14T13:03:24.007000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "DSA-3989",
        "trust": 0.8,
        "url": "https://www.debian.org/security/2017/dsa-3989"
      },
      {
        "title": "Security Bulletin: NVIDIA Tegra Jetson L4T contains multiple vulnerabilities; updates for \u201cBlueBorne\u201d and \u201cDnsmasq\u201d.",
        "trust": 0.8,
        "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4561"
      },
      {
        "title": "openSUSE-SU-2017:2633",
        "trust": 0.8,
        "url": "https://lists.opensuse.org/opensuse-security-announce/2017-10/msg00006.html"
      },
      {
        "title": "RHSA-2017:2836",
        "trust": 0.8,
        "url": "https://access.redhat.com/errata/RHSA-2017:2836"
      },
      {
        "title": "CHANGELOG",
        "trust": 0.8,
        "url": "http://thekelleys.org.uk/dnsmasq/CHANGELOG"
      },
      {
        "title": "Security fix, CVE-2017-14495, OOM in DNS response creation.",
        "trust": 0.8,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git;a=commit;h=51eadb692a5123b9838e5a68ecace3ac579a3a45"
      },
      {
        "title": "USN-3430-2",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-2/"
      },
      {
        "title": "USN-3430-1",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-1/"
      },
      {
        "title": "dnsmasq: Multiple Critical and Important vulnerabilities",
        "trust": 0.8,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "title": "Dnsmasq Remediation of resource management error vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=92839"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172836 - Security Advisory"
      },
      {
        "title": "Arch Linux Issues: ",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=CVE-2017-14495"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-2"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq regression",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-3"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-1"
      },
      {
        "title": "Debian Security Advisories: DSA-3989-1 dnsmasq -- security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=5c18698ecfe74c7de381531f8ed44dcf"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=7f490a104360d6f65bee18ec7bfa18a3"
      },
      {
        "title": "Amazon Linux 2: ALAS2-2019-1251",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=ALAS2-2019-1251"
      },
      {
        "title": "Amazon Linux AMI: ALAS-2017-907",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux_ami\u0026qid=ALAS-2017-907"
      },
      {
        "title": "Arch Linux Advisories: [ASA-201710-1] dnsmasq: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-201710-1"
      },
      {
        "title": "Oracle Solaris Third Party Bulletins: Oracle Solaris Third Party Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_solaris_third_party_bulletins\u0026qid=6283337cd31f81f24d445925f2138c0e"
      },
      {
        "title": "Oracle Linux Bulletins: Oracle Linux Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=7251d5e5f2b1771951980ad7cfde50ba"
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/lnick2023/nicenice "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/xbl3/awesome-cve-poc_qazbnm456 "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/qazbnm456/awesome-cve-poc "
      },
      {
        "title": "Threatpost",
        "trust": 0.1,
        "url": "https://threatpost.com/google-warns-of-dos-and-rce-bugs-in-dnsmasq/128238/"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-772",
        "trust": 1.0
      },
      {
        "problemtype": "CWE-400",
        "trust": 0.8
      },
      {
        "problemtype": "CWE-399",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 3.5,
        "url": "https://www.kb.cert.org/vuls/id/973527"
      },
      {
        "trust": 2.9,
        "url": "http://www.securityfocus.com/bid/101085"
      },
      {
        "trust": 2.8,
        "url": "https://security.googleblog.com/2017/10/behind-masq-yet-more-dns-and-dhcp.html"
      },
      {
        "trust": 2.1,
        "url": "https://access.redhat.com/errata/rhsa-2017:2836"
      },
      {
        "trust": 2.0,
        "url": "http://www.ubuntu.com/usn/usn-3430-1"
      },
      {
        "trust": 2.0,
        "url": "http://www.debian.org/security/2017/dsa-3989"
      },
      {
        "trust": 2.0,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-17-332-01"
      },
      {
        "trust": 1.8,
        "url": "https://www.exploit-db.com/exploits/42945/"
      },
      {
        "trust": 1.8,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "trust": 1.8,
        "url": "http://www.ubuntu.com/usn/usn-3430-2"
      },
      {
        "trust": 1.8,
        "url": "https://security.gentoo.org/glsa/201710-27"
      },
      {
        "trust": 1.7,
        "url": "http://www.thekelleys.org.uk/dnsmasq/doc.html"
      },
      {
        "trust": 1.7,
        "url": "http://www.securitytracker.com/id/1039474"
      },
      {
        "trust": 1.7,
        "url": "http://lists.opensuse.org/opensuse-security-announce/2017-10/msg00006.html"
      },
      {
        "trust": 1.7,
        "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4561"
      },
      {
        "trust": 1.7,
        "url": "http://www.securityfocus.com/bid/101977"
      },
      {
        "trust": 1.7,
        "url": "https://www.synology.com/support/security/synology_sa_17_59_dnsmasq"
      },
      {
        "trust": 1.7,
        "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2017-005.txt"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-689071.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 1.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14495"
      },
      {
        "trust": 1.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 1.1,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git%3ba=commit%3bh=51eadb692a5123b9838e5a68ecace3ac579a3a45"
      },
      {
        "trust": 1.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14491"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14492"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14493"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14494"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14495"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14496"
      },
      {
        "trust": 0.9,
        "url": "http://www.thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14491.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14492.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14493.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14494.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14495.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/kubernetes/kubernetes/blob/master/changelog.md"
      },
      {
        "trust": 0.9,
        "url": "http://www.slackware.com/security/viewer.php?l=slackware-security\u0026y=2017\u0026m=slackware-security.601472"
      },
      {
        "trust": 0.9,
        "url": "https://source.android.com/security/bulletin/2017-10-01"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495410"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495411"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495412"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495415"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495416"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495510"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-13704"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14496.py"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/errata/rhsa-2017:2837"
      },
      {
        "trust": 0.8,
        "url": "https://www.ruckuswireless.com/security"
      },
      {
        "trust": 0.8,
        "url": "https://www.zyxel.com/support/announcement_dnsmasq_vulnerabilities.shtml"
      },
      {
        "trust": 0.8,
        "url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-14495"
      },
      {
        "trust": 0.8,
        "url": "http://jvn.jp/vu/jvnvu93453933/index.html"
      },
      {
        "trust": 0.6,
        "url": "https://www.mail-archive.com/dnsmasq-discuss@lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 0.6,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git;a=commit;h=51eadb692a5123b9838e5a68ecace3ac579a3a45"
      },
      {
        "trust": 0.6,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409bug1495409"
      },
      {
        "trust": 0.6,
        "url": "https://www.mail-archive.com/dnsmasq-discuss@lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-17-332-01"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14496"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14491"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14494"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14492"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14493"
      },
      {
        "trust": 0.3,
        "url": "http://subscriber.communications.siemens.com/"
      },
      {
        "trust": 0.3,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409 bug 1495409"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/772.html"
      },
      {
        "trust": 0.1,
        "url": "https://tools.cisco.com/security/center/viewalert.x?alertid=55498"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://usn.ubuntu.com/3430-2/"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/updates/classification/#critical"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/articles/11258"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/team/contact/"
      },
      {
        "trust": 0.1,
        "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
      },
      {
        "trust": 0.1,
        "url": "https://bugzilla.redhat.com/):"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/team/key/"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/bugs/1741262"
      },
      {
        "trust": 0.1,
        "url": "https://www.ubuntu.com/usn/usn-3430-3"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/dnsmasq/2.76-5ubuntu0.1"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/dnsmasq/2.75-1ubuntu0.16.04.3"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/dnsmasq/2.68-1ubuntu0.2"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14495"
      },
      {
        "trust": 0.1,
        "url": "http://creativecommons.org/licenses/by-sa/2.5"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14493"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14492"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14491"
      },
      {
        "trust": 0.1,
        "url": "https://security.gentoo.org/"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14496"
      },
      {
        "trust": 0.1,
        "url": "https://bugs.gentoo.org."
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14494"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-10-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2017-10-03T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "date": "2017-11-28T00:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-10-24T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "date": "2017-10-03T20:21:00",
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "date": "2017-10-03T05:19:24",
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "date": "2018-01-04T17:50:40",
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "date": "2017-10-02T13:13:00",
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "date": "2017-10-23T13:54:05",
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "date": "2017-09-18T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "date": "2017-10-03T01:29:02.153000",
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2018-02-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2023-11-07T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-14495"
      },
      {
        "date": "2019-05-15T17:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-11-29T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008622"
      },
      {
        "date": "2020-10-14T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      },
      {
        "date": "2023-11-07T02:39:01.690000",
        "db": "NVD",
        "id": "CVE-2017-14495"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote",
    "sources": [
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      }
    ],
    "trust": 1.0
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Dnsmasq contains multiple vulnerabilities",
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "resource management error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-743"
      }
    ],
    "trust": 0.6
  }
}

var-202312-0198
Vulnerability from variot

A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2) (All versions < V7.2.2), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2) (All versions < V7.2.2), SCALANCE M804PB (6GK5804-0AP00-2AA2) (All versions < V7.2.2), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) (All versions < V7.2.2), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) (All versions < V7.2.2), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) (All versions < V7.2.2), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) (All versions < V7.2.2), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) (All versions < V7.2.2), SCALANCE M874-2 (6GK5874-2AA00-2AA2) (All versions < V7.2.2), SCALANCE M874-3 (6GK5874-3AA00-2AA2) (All versions < V7.2.2), SCALANCE M876-3 (6GK5876-3AA02-2BA2) (All versions < V7.2.2), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) (All versions < V7.2.2), SCALANCE M876-4 (6GK5876-4AA10-2BA2) (All versions < V7.2.2), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) (All versions < V7.2.2), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) (All versions < V7.2.2), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) (All versions < V7.2.2), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) (All versions < V7.2.2), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) (All versions < V7.2.2), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) (All versions < V7.2.2), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) (All versions < V7.2.2). An Improper Neutralization of Special Elements used in an OS Command with root privileges vulnerability exists in the parsing of the IPSEC configuration. This could allow malicious local administrators to issue commands on system level after a new connection is established. 6gk6108-4am00-2ba2 firmware, 6gk6108-4am00-2da2 firmware, 6gk5804-0ap00-2aa2 Several Siemens products, such as firmware, OS A command injection vulnerability exists.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. SCALANCE M-800, MUM-800 and S615 as well as RUGGEDCOM RM1224 are industrial routers

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202312-0198",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance m876-4",
        "scope": "lt",
        "trust": 1.8,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m876-3",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance mum856-1",
        "scope": "lt",
        "trust": 1.2,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "6gk5876-3aa02-2ea2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5856-2ea00-3da1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5816-1ba00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5812-1ba00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk6108-4am00-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5816-1aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5856-2ea00-3aa1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5615-0aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5874-3aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5876-3aa02-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5876-4aa10-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5876-4aa00-2ba2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5874-2aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5615-0aa01-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5826-2ab00-2ab2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5812-1aa00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5853-2ea00-2da1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5804-0ap00-2aa2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk6108-4am00-2da2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5876-4aa00-2da2",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "7.2.2"
      },
      {
        "model": "6gk5856-2ea00-3aa1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5812-1aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5615-0aa01-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5615-0aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5856-2ea00-3da1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-3aa02-2ea2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-4aa00-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5812-1ba00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5816-1ba00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk6108-4am00-2da2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5826-2ab00-2ab2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5874-2aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk6108-4am00-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-4aa10-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-3aa02-2ba2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5816-1aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5876-4aa00-2da2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5853-2ea00-2da1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5874-3aa00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "6gk5804-0ap00-2aa2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte eu",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "ruggedcom rm1224 lte nam",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m804pb",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m874-2",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance m874-3",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance mum853-1",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      },
      {
        "model": "scalance s615 eec",
        "scope": "lt",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "v7.2.2"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "cve": "CVE-2023-49692",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "MULTIPLE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 8.3,
            "confidentialityImpact": "COMPLETE",
            "exploitabilityScore": 6.4,
            "id": "CNVD-2023-97257",
            "impactScore": 10.0,
            "integrityImpact": "COMPLETE",
            "severity": "HIGH",
            "trust": 0.6,
            "vectorString": "AV:N/AC:L/Au:M/C:C/I:C/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "LOCAL",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 6.7,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 0.8,
            "id": "CVE-2023-49692",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "productcert@siemens.com",
            "availabilityImpact": "HIGH",
            "baseScore": 7.2,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 1.2,
            "id": "CVE-2023-49692",
            "impactScore": 5.9,
            "integrityImpact": "HIGH",
            "privilegesRequired": "HIGH",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:N/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Local",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 6.7,
            "baseSeverity": "Medium",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "CVE-2023-49692",
            "impactScore": null,
            "integrityImpact": "High",
            "privilegesRequired": "High",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:L/AC:L/PR:H/UI:N/S:U/C:H/I:H/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2023-49692",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2023-49692",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2023-49692",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2023-97257",
            "trust": 0.6,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "A vulnerability has been identified in RUGGEDCOM RM1224 LTE(4G) EU (6GK6108-4AM00-2BA2) (All versions \u003c V7.2.2), RUGGEDCOM RM1224 LTE(4G) NAM (6GK6108-4AM00-2DA2) (All versions \u003c V7.2.2), SCALANCE M804PB (6GK5804-0AP00-2AA2) (All versions \u003c V7.2.2), SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) (All versions \u003c V7.2.2), SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) (All versions \u003c V7.2.2), SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) (All versions \u003c V7.2.2), SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) (All versions \u003c V7.2.2), SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) (All versions \u003c V7.2.2), SCALANCE M874-2 (6GK5874-2AA00-2AA2) (All versions \u003c V7.2.2), SCALANCE M874-3 (6GK5874-3AA00-2AA2) (All versions \u003c V7.2.2), SCALANCE M876-3 (6GK5876-3AA02-2BA2) (All versions \u003c V7.2.2), SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) (All versions \u003c V7.2.2), SCALANCE M876-4 (6GK5876-4AA10-2BA2) (All versions \u003c V7.2.2), SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) (All versions \u003c V7.2.2), SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) (All versions \u003c V7.2.2), SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) (All versions \u003c V7.2.2), SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) (All versions \u003c V7.2.2), SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) (All versions \u003c V7.2.2), SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) (All versions \u003c V7.2.2), SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) (All versions \u003c V7.2.2). An Improper Neutralization of Special Elements used in an OS Command with root privileges vulnerability exists in the parsing of the IPSEC configuration. This could allow malicious local administrators to issue commands on system level after a new connection is established. 6gk6108-4am00-2ba2 firmware, 6gk6108-4am00-2da2 firmware, 6gk5804-0ap00-2aa2 Several Siemens products, such as firmware, OS A command injection vulnerability exists.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state. SCALANCE M-800, MUM-800 and S615 as well as RUGGEDCOM RM1224 are industrial routers",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      }
    ],
    "trust": 2.16
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2023-49692",
        "trust": 3.2
      },
      {
        "db": "SIEMENS",
        "id": "SSA-068047",
        "trust": 1.8
      },
      {
        "db": "SIEMENS",
        "id": "SSA-602936",
        "trust": 1.0
      },
      {
        "db": "JVN",
        "id": "JVNVU98271228",
        "trust": 0.8
      },
      {
        "db": "JVN",
        "id": "JVNVU91198149",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-23-348-13",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-24-046-09",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857",
        "trust": 0.8
      },
      {
        "db": "SIEMENS",
        "id": "SSA-077170",
        "trust": 0.6
      },
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "id": "VAR-202312-0198",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      }
    ],
    "trust": 1.5
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "Network device"
        ],
        "sub_category": null,
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      }
    ]
  },
  "last_update_date": "2024-08-14T12:16:28.465000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Patch for Siemens SCALANCE M-800/S615 series operating system command injection vulnerability",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/500316"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-78",
        "trust": 1.0
      },
      {
        "problemtype": "OS Command injection (CWE-78) [ others ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 1.8,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-068047.pdf"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-068047.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-602936.html"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu98271228/"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu91198149/index.html"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2023-49692"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-23-348-13"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-24-046-09"
      },
      {
        "trust": 0.6,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-077170.html"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-12-13T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "date": "2024-01-15T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "date": "2023-12-12T12:15:16.203000",
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-12-13T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2023-97257"
      },
      {
        "date": "2024-02-19T07:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      },
      {
        "date": "2024-08-13T08:15:09.553000",
        "db": "NVD",
        "id": "CVE-2023-49692"
      }
    ]
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "in multiple Siemens products \u00a0OS\u00a0 Command injection vulnerability",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2023-019857"
      }
    ],
    "trust": 0.8
  }
}

var-202212-1134
Vulnerability from variot

Affected devices store the CLI user passwords encrypted in flash memory. Attackers with physical access to the device could retrieve the file and decrypt the CLI user passwords. ruggedcom rm1224 lte(4g) eu firmware, ruggedcom rm1224 lte(4g) nam firmware, scalance m804pb Multiple Siemens products, including firmware, contain vulnerabilities related to storing passwords in a recoverable format.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-202212-1134",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "scalance xr552-12m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1 ecc",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm416-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr326-2c poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc642-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xc224-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr328-4c wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w734-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "siplus net scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc632-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w788-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w738-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr524-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance m874-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc646-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "ruggedcom rm1224 lte\\ eu",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2bca dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc224",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc224-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w748-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w786-2 sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "siplus net scalance xc206-2sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum766-1 6ghz",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w778-1 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr528-6m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m876-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xr326-2c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w778-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w788-2 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb213-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wum766-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc636-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w788-2 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance mum853-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "siplus net scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m804pb",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w774-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2ia m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr526-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2g poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-4c g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w721-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance mum856-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "ruggedcom rm1224 lte\\ nam",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xb205-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m874-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xf204-2ba",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2 eec m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb205-3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-2 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc622-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance w761-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216-3g poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204 dna",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance wum763-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr324wg",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam763-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm408-8c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2sfp g",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 m12 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance wam766-1 6ghz",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w786-2ia rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance wam766-1",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w774-1 m12 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xb213-3ld",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc206-2",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm408-4c",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w788-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp208eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-2 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w722-1 rj45",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w1748-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208 poe",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m876-4",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance xc206-2sfp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w1788-1 m12",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance sc626-2c",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "scalance xc216eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xc208 eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xf204",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xp216poe eec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615 eec",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m812-1 adsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m876-4",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte eu",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-622-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-636-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "ruggedcom rm1224 lte nam",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m816-1 adsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance mum856-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m876-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc626-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m874-3",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-642-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance mum853-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m826-2 shdsl-router",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m804pb",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-646-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance sc-632-2c",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      },
      {
        "model": "scalance m874-2",
        "scope": null,
        "trust": 0.8,
        "vendor": "\u30b7\u30fc\u30e1\u30f3\u30b9",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Siemens reported these vulnerabilities to CISA.",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2022-46142",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "PHYSICAL",
            "author": "productcert@siemens.com",
            "availabilityImpact": "LOW",
            "baseScore": 5.7,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 0.9,
            "id": "CVE-2022-46142",
            "impactScore": 4.7,
            "integrityImpact": "LOW",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:L/A:L",
            "version": "3.1"
          },
          {
            "attackComplexity": "LOW",
            "attackVector": "PHYSICAL",
            "author": "nvd@nist.gov",
            "availabilityImpact": "NONE",
            "baseScore": 4.6,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "HIGH",
            "exploitabilityScore": 0.9,
            "id": "CVE-2022-46142",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Physical",
            "author": "OTHER",
            "availabilityImpact": "Low",
            "baseScore": 5.7,
            "baseSeverity": "Medium",
            "confidentialityImpact": "High",
            "exploitabilityScore": null,
            "id": "JVNDB-2022-023552",
            "impactScore": null,
            "integrityImpact": "Low",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:L/A:L",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2022-46142",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2022-46142",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "OTHER",
            "id": "JVNDB-2022-023552",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-202212-3090",
            "trust": 0.6,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Affected devices store the CLI user passwords encrypted in flash memory. Attackers with physical access to the device could retrieve the file and decrypt the CLI user passwords. ruggedcom rm1224 lte(4g) eu firmware, ruggedcom rm1224 lte(4g) nam firmware, scalance m804pb Multiple Siemens products, including firmware, contain vulnerabilities related to storing passwords in a recoverable format.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      }
    ],
    "trust": 1.62
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2022-46142",
        "trust": 3.2
      },
      {
        "db": "SIEMENS",
        "id": "SSA-413565",
        "trust": 2.4
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-22-349-04",
        "trust": 1.4
      },
      {
        "db": "JVN",
        "id": "JVNVU91561630",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090",
        "trust": 0.6
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "id": "VAR-202212-1134",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.6398166875
  },
  "last_update_date": "2024-08-14T12:13:17.100000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Siemens part of the product Security vulnerabilities",
        "trust": 0.6,
        "url": "http://123.124.177.30/web/xxk/bdxqById.tag?id=218339"
      }
    ],
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-257",
        "trust": 1.0
      },
      {
        "problemtype": "CWE-522",
        "trust": 1.0
      },
      {
        "problemtype": "Password storage in recoverable form (CWE-257) [ others ]",
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.4,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-413565.pdf"
      },
      {
        "trust": 0.8,
        "url": "https://jvn.jp/vu/jvnvu91561630/"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2022-46142"
      },
      {
        "trust": 0.8,
        "url": "https://www.cisa.gov/news-events/ics-advisories/icsa-22-349-04"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-22-349-04"
      },
      {
        "trust": 0.6,
        "url": "https://cxsecurity.com/cveshow/cve-2022-46142/"
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      },
      {
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-11-29T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "date": "2022-12-13T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      },
      {
        "date": "2022-12-13T16:15:25.067000",
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2023-11-29T03:03:00",
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      },
      {
        "date": "2023-03-15T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      },
      {
        "date": "2023-03-14T10:15:24.137000",
        "db": "NVD",
        "id": "CVE-2022-46142"
      }
    ]
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Recoverable password storage vulnerability in multiple Siemens products",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2022-023552"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "other",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-202212-3090"
      }
    ],
    "trust": 0.6
  }
}

var-201710-0452
Vulnerability from variot

Integer underflow in the add_pseudoheader function in dnsmasq before 2.78 , when the --add-mac, --add-cpe-id or --add-subnet option is specified, allows remote attackers to cause a denial of service via a crafted DNS request. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Contains an integer underflow vulnerability.Service operation interruption (DoS) There is a possibility of being put into a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities: 1. A buffer-overflow vulnerability 2. Multiple denial-of-service vulnerabilities Attackers can exploit these issues to execute arbitrary code within the context of affected device or cause a denial-of-service condition. This BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1

===================================================================== Red Hat Security Advisory

Synopsis: Critical: dnsmasq security update Advisory ID: RHSA-2017:2836-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2017:2836 Issue date: 2017-10-02 CVE Names: CVE-2017-14491 CVE-2017-14492 CVE-2017-14493 CVE-2017-14494 CVE-2017-14495 CVE-2017-14496 =====================================================================

  1. Summary:

An update for dnsmasq is now available for Red Hat Enterprise Linux 7.

Red Hat Product Security has rated this update as having a security impact of Critical. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.

  1. Relevant releases/architectures:

Red Hat Enterprise Linux Client (v. 7) - x86_64 Red Hat Enterprise Linux Client Optional (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64 Red Hat Enterprise Linux Server (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Workstation (v. 7) - x86_64 Red Hat Enterprise Linux Workstation Optional (v. 7) - x86_64

  1. Description:

The dnsmasq packages contain Dnsmasq, a lightweight DNS (Domain Name Server) forwarder and DHCP (Dynamic Host Configuration Protocol) server.

Security Fix(es):

  • A heap buffer overflow was found in dnsmasq in the code responsible for building DNS replies. An attacker could send crafted DNS packets to dnsmasq which would cause it to crash or, potentially, execute arbitrary code. (CVE-2017-14491)

  • A heap buffer overflow was discovered in dnsmasq in the IPv6 router advertisement (RA) handling code. This issue only affected configurations using one of these options: enable-ra, ra-only, slaac, ra-names, ra-advrouter, or ra-stateless. (CVE-2017-14492)

  • A stack buffer overflow was found in dnsmasq in the DHCPv6 code. (CVE-2017-14493)

  • An information leak was found in dnsmasq in the DHCPv6 relay code. An attacker on the local network could send crafted DHCPv6 packets to dnsmasq causing it to forward the contents of process memory, potentially leaking sensitive data. (CVE-2017-14494)

  • A memory exhaustion flaw was found in dnsmasq in the EDNS0 code. An attacker could send crafted DNS packets which would trigger memory allocations which would never be freed, leading to unbounded memory consumption and eventually a crash. This issue only affected configurations using one of the options: add-mac, add-cpe-id, or add-subnet. (CVE-2017-14495)

  • An integer underflow flaw leading to a buffer over-read was found in dnsmasq in the EDNS0 code. An attacker could send crafted DNS packets to dnsmasq which would cause it to crash. This issue only affected configurations using one of the options: add-mac, add-cpe-id, or add-subnet. (CVE-2017-14496)

Red Hat would like to thank Felix Wilhelm (Google Security Team), Fermin J. Serna (Google Security Team), Gabriel Campana (Google Security Team), Kevin Hamacher (Google Security Team), and Ron Bowes (Google Security Team) for reporting these issues.

  1. Solution:

For details on how to apply this update, which includes the changes described in this advisory, refer to:

https://access.redhat.com/articles/11258

  1. Bugs fixed (https://bugzilla.redhat.com/):

1495409 - CVE-2017-14491 dnsmasq: heap overflow in the code responsible for building DNS replies 1495410 - CVE-2017-14492 dnsmasq: heap overflow in the IPv6 router advertisement code 1495411 - CVE-2017-14493 dnsmasq: stack buffer overflow in the DHCPv6 code 1495412 - CVE-2017-14494 dnsmasq: information leak in the DHCPv6 relay code 1495415 - CVE-2017-14495 dnsmasq: memory exhaustion vulnerability in the EDNS0 code 1495416 - CVE-2017-14496 dnsmasq: integer underflow leading to buffer over-read in the EDNS0 code

  1. Package List:

Red Hat Enterprise Linux Client (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Client Optional (v. 7):

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux ComputeNode (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux ComputeNode Optional (v. 7):

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Server (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

aarch64: dnsmasq-2.76-2.el7_4.2.aarch64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm

ppc64: dnsmasq-2.76-2.el7_4.2.ppc64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm

ppc64le: dnsmasq-2.76-2.el7_4.2.ppc64le.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm

s390x: dnsmasq-2.76-2.el7_4.2.s390x.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Server Optional (v. 7):

aarch64: dnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm dnsmasq-utils-2.76-2.el7_4.2.aarch64.rpm

ppc64: dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm dnsmasq-utils-2.76-2.el7_4.2.ppc64.rpm

ppc64le: dnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm dnsmasq-utils-2.76-2.el7_4.2.ppc64le.rpm

s390x: dnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm dnsmasq-utils-2.76-2.el7_4.2.s390x.rpm

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Workstation (v. 7):

Source: dnsmasq-2.76-2.el7_4.2.src.rpm

x86_64: dnsmasq-2.76-2.el7_4.2.x86_64.rpm dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm

Red Hat Enterprise Linux Workstation Optional (v. 7):

x86_64: dnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm dnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm

These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/

  1. References:

https://access.redhat.com/security/cve/CVE-2017-14491 https://access.redhat.com/security/cve/CVE-2017-14492 https://access.redhat.com/security/cve/CVE-2017-14493 https://access.redhat.com/security/cve/CVE-2017-14494 https://access.redhat.com/security/cve/CVE-2017-14495 https://access.redhat.com/security/cve/CVE-2017-14496 https://access.redhat.com/security/updates/classification/#critical https://access.redhat.com/security/vulnerabilities/3199382

  1. Contact:

The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/

Copyright 2017 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1

iD8DBQFZ0opYXlSAg2UNWIIRAr0dAJ9rIL1FgNTJUf2I9jjKFFlfkCd/kwCfV+bX SfoCV7+qG2nwqlHKLZOlhIU= =iWfU -----END PGP SIGNATURE-----

-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . =========================================================================== Ubuntu Security Notice USN-3430-3 January 04, 2018

dnsmasq regression

A security issue affects these releases of Ubuntu and its derivatives:

  • Ubuntu 12.04 ESM

Summary:

USN-3430-2 introduced regression in Dnsmasq.

Software Description: - dnsmasq: Small caching DNS proxy and DHCP/TFTP server

Details:

USN-3430-2 fixed several vulnerabilities. The update introduced a new regression that breaks DNS resolution. This update addresses the problem.

We apologize for the inconvenience.

Original advisory details:

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14491)

Felix Wilhelm, Fermin J. (CVE-2017-14492)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DHCPv6 requests. (CVE-2017-14493)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DHCPv6 packets. (CVE-2017-14494)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14495)

Felix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher discovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14496)

Update instructions:

The problem can be corrected by updating your system to the following package versions:

Ubuntu 12.04 ESM: dnsmasq=C2=A02.59-4ubuntu0.4 dnsmasq-base2.59-4ubuntu0.4 dnsmasq-utils2.59-4ubuntu0.4

After a standard system update you need to reboot your computer to make all the necessary changes.

Affected packages

-------------------------------------------------------------------
 Package              /     Vulnerable     /            Unaffected
-------------------------------------------------------------------

1 net-dns/dnsmasq < 2.78 >= 2.78

Description

Multiple vulnerabilities have been discovered in Dnsmasq.

Workaround

There is no known workaround at this time.

Resolution

All Dnsmasq users should upgrade to the latest version:

# emerge --sync # emerge --ask --oneshot --verbose ">=net-dns/dnsmasq-2.78"

References

[ 1 ] CVE-2017-14491 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14491 [ 2 ] CVE-2017-14492 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14492 [ 3 ] CVE-2017-14493 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14493 [ 4 ] CVE-2017-14494 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14494 [ 5 ] CVE-2017-14495 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14495 [ 6 ] CVE-2017-14496 https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14496

Availability

This GLSA and any updates to it are available for viewing at the Gentoo Security Website:

https://security.gentoo.org/glsa/201710-27

Concerns?

Security is a primary focus of Gentoo Linux and ensuring the confidentiality and security of our users' machines is of utmost importance to us. Any security concerns should be addressed to security@gentoo.org or alternatively, you may file a bug at https://bugs.gentoo.org.

License

Copyright 2017 Gentoo Foundation, Inc; referenced text belongs to its owner(s).

The contents of this document are licensed under the Creative Commons - Attribution / Share Alike license.

http://creativecommons.org/licenses/by-sa/2.5

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201710-0452",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "7.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "6.0.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "5.1.1"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "5.0.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "4.4.4"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "8.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "7.1.2"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "7.0"
      },
      {
        "model": "android",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "google",
        "version": "6.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "9.0"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "14.04"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "novell",
        "version": "42.3"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "16.04"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "redhat",
        "version": "7.0"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "novell",
        "version": "42.2"
      },
      {
        "model": "ubuntu linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "canonical",
        "version": "17.04"
      },
      {
        "model": "dnsmasq",
        "scope": "lte",
        "trust": 1.0,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "debian",
        "version": "7.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.9,
        "vendor": "thekelleys",
        "version": "2.77"
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "ruckus",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "technicolor",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "zyxel",
        "version": null
      },
      {
        "model": null,
        "scope": null,
        "trust": 0.8,
        "vendor": "dnsmasq",
        "version": null
      },
      {
        "model": "ubuntu",
        "scope": null,
        "trust": 0.8,
        "vendor": "canonical",
        "version": null
      },
      {
        "model": "gnu/linux",
        "scope": null,
        "trust": 0.8,
        "vendor": "debian",
        "version": null
      },
      {
        "model": "android",
        "scope": null,
        "trust": 0.8,
        "vendor": "google",
        "version": null
      },
      {
        "model": "leap",
        "scope": null,
        "trust": 0.8,
        "vendor": "opensuse",
        "version": null
      },
      {
        "model": "dnsmasq",
        "scope": "lt",
        "trust": 0.8,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "enterprise linux desktop",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux server",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux workstation",
        "scope": null,
        "trust": 0.8,
        "vendor": "red hat",
        "version": null
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "redhat",
        "version": "-47.4"
      },
      {
        "model": "scalance w1750d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "17.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "16.04"
      },
      {
        "model": "linux lts",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "ubuntu",
        "version": "14.04"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.75"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.72"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.71"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.70"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.65"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.64"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.63"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.62"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.61"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.60"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.59"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.58"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.57"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.56"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.55"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.54"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.53"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.52"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.51"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.50"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.49"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.48"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.47"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.46"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.45"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.44"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.43"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.42"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.41"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.40"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.38"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.37"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.36"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.35"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.34"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.33"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.30"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.29"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.28"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.27"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.26"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.25"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.24"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.23"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.22"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.21"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.20"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.2"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.19"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.9"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.8"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.4"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.3"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.18"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.17"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.16"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.15"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.14"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.13"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.12"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.11"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.10"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "1.0"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.996"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.992"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.98"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.96"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.95"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.7"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.6"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.5"
      },
      {
        "model": "dnsmasq",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "0.4"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.2"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "14.0"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.37"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.1"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "slackware",
        "version": "13.0"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux workstation",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server optional aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server for arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux server eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.6"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.5"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6.2"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server tus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server extended update suppor",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux server aus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux server year extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.2"
      },
      {
        "model": "enterprise linux server year extended upd",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-47.3"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5"
      },
      {
        "model": "enterprise linux long life server",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "5.9"
      },
      {
        "model": "enterprise linux hpc node optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux hpc node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux for scientific computing",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update supp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power little endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for power big endian",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power little endian extended update suppo",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for power big endian extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.4"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.3"
      },
      {
        "model": "enterprise linux for ibm z systems extended update support",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "-7.2"
      },
      {
        "model": "enterprise linux for ibm z systems",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.4"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux eus compute node",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux desktop optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux desktop",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "6"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode optional eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode optional",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.3"
      },
      {
        "model": "enterprise linux computenode eus",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7.2"
      },
      {
        "model": "enterprise linux computenode",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "redhat",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "7"
      },
      {
        "model": "linux",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "oracle",
        "version": "6"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "opensuse",
        "version": "42.3"
      },
      {
        "model": "leap",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "opensuse",
        "version": "42.2"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.10"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.7"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5"
      },
      {
        "model": "kubernetes",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.2"
      },
      {
        "model": "fedora",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "fedoraproject",
        "version": "27"
      },
      {
        "model": "linux sparc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux s/390",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux powerpc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux mips",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-32",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux ia-30",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux arm",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "linux amd64",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "debian",
        "version": "6.0"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "7"
      },
      {
        "model": "centos",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "centos",
        "version": "6"
      },
      {
        "model": "dnsmasq",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "thekelleys",
        "version": "2.78"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.8"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.7.7"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.6.11"
      },
      {
        "model": "kubernetes",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "kubernetes",
        "version": "1.5.8"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:canonical:ubuntu",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:debian:debian_linux",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:google:android",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:opensuse_project:leap",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/a:thekelleys:dnsmasq",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_desktop",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_server",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:redhat:enterprise_linux_workstation",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Gabriel Campana, Kevin Hamacher and Ron Bowes of the Google Security Team,Felix Wilhelm, Fermin J. Serna",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      }
    ],
    "trust": 0.6
  },
  "cve": "CVE-2017-14496",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "COMPLETE",
            "baseScore": 7.8,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 10.0,
            "id": "CVE-2017-14496",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "HIGH",
            "trust": 1.9,
            "vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "NETWORK",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 7.5,
            "baseSeverity": "HIGH",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 3.9,
            "id": "CVE-2017-14496",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 1.8,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2017-14496",
            "trust": 1.0,
            "value": "HIGH"
          },
          {
            "author": "NVD",
            "id": "CVE-2017-14496",
            "trust": 0.8,
            "value": "High"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201709-742",
            "trust": 0.6,
            "value": "HIGH"
          },
          {
            "author": "VULMON",
            "id": "CVE-2017-14496",
            "trust": 0.1,
            "value": "HIGH"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Integer underflow in the add_pseudoheader function in dnsmasq before 2.78 , when the --add-mac, --add-cpe-id or --add-subnet option is specified, allows remote attackers to cause a denial of service via a crafted DNS request. Dnsmasq versions 2.77 and earlier contains multiple vulnerabilities. dnsmasq Contains an integer underflow vulnerability.Service operation interruption (DoS) There is a possibility of being put into a state. Multiple Siemens SCALANCE Products are prone to the following security vulnerabilities:\n1. A buffer-overflow vulnerability\n2. Multiple denial-of-service vulnerabilities\nAttackers can exploit these issues to execute arbitrary code within the  context of affected device or cause a denial-of-service condition. \nThis BID is being retired as a duplicate of BID 101085 Dnsmasq VU#973527 Multiple Security Vulnerabilities. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n=====================================================================\n                   Red Hat Security Advisory\n\nSynopsis:          Critical: dnsmasq security update\nAdvisory ID:       RHSA-2017:2836-01\nProduct:           Red Hat Enterprise Linux\nAdvisory URL:      https://access.redhat.com/errata/RHSA-2017:2836\nIssue date:        2017-10-02\nCVE Names:         CVE-2017-14491 CVE-2017-14492 CVE-2017-14493 \n                   CVE-2017-14494 CVE-2017-14495 CVE-2017-14496 \n=====================================================================\n\n1. Summary:\n\nAn update for dnsmasq is now available for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Critical. A Common Vulnerability Scoring System (CVSS) base score, which\ngives a detailed severity rating, is available for each vulnerability from\nthe CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - x86_64\nRed Hat Enterprise Linux Client Optional (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64\nRed Hat Enterprise Linux Server (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 7) - aarch64, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Workstation (v. 7) - x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 7) - x86_64\n\n3. Description:\n\nThe dnsmasq packages contain Dnsmasq, a lightweight DNS (Domain Name\nServer) forwarder and DHCP (Dynamic Host Configuration Protocol) server. \n\nSecurity Fix(es):\n\n* A heap buffer overflow was found in dnsmasq in the code responsible for\nbuilding DNS replies. An attacker could send crafted DNS packets to dnsmasq\nwhich would cause it to crash or, potentially, execute arbitrary code. \n(CVE-2017-14491)\n\n* A heap buffer overflow was discovered in dnsmasq in the IPv6 router\nadvertisement (RA) handling code. This issue only affected\nconfigurations using one of these options: enable-ra, ra-only, slaac,\nra-names, ra-advrouter, or ra-stateless. (CVE-2017-14492)\n\n* A stack buffer overflow was found in dnsmasq in the DHCPv6 code. (CVE-2017-14493)\n\n* An information leak was found in dnsmasq in the DHCPv6 relay code. An\nattacker on the local network could send crafted DHCPv6 packets to dnsmasq\ncausing it to forward the contents of process memory, potentially leaking\nsensitive data. (CVE-2017-14494)\n\n* A memory exhaustion flaw was found in dnsmasq in the EDNS0 code. An\nattacker could send crafted DNS packets which would trigger memory\nallocations which would never be freed, leading to unbounded memory\nconsumption and eventually a crash. This issue only affected configurations\nusing one of the options: add-mac, add-cpe-id, or add-subnet. \n(CVE-2017-14495)\n\n* An integer underflow flaw leading to a buffer over-read was found in\ndnsmasq in the EDNS0 code. An attacker could send crafted DNS packets to\ndnsmasq which would cause it to crash. This issue only affected\nconfigurations using one of the options: add-mac, add-cpe-id, or\nadd-subnet. (CVE-2017-14496)\n\nRed Hat would like to thank Felix Wilhelm (Google Security Team), Fermin J. \nSerna (Google Security Team), Gabriel Campana (Google Security Team), Kevin\nHamacher (Google Security Team), and Ron Bowes (Google Security Team) for\nreporting these issues. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1495409 - CVE-2017-14491 dnsmasq: heap overflow in the code responsible for building DNS replies\n1495410 - CVE-2017-14492 dnsmasq: heap overflow in the IPv6 router advertisement code\n1495411 - CVE-2017-14493 dnsmasq: stack buffer overflow in the DHCPv6 code\n1495412 - CVE-2017-14494 dnsmasq: information leak in the DHCPv6 relay code\n1495415 - CVE-2017-14495 dnsmasq: memory exhaustion vulnerability in the EDNS0 code\n1495416 - CVE-2017-14496 dnsmasq: integer underflow leading to buffer over-read in the EDNS0 code\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Client Optional (v. 7):\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional (v. 7):\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\naarch64:\ndnsmasq-2.76-2.el7_4.2.aarch64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm\n\nppc64:\ndnsmasq-2.76-2.el7_4.2.ppc64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm\n\nppc64le:\ndnsmasq-2.76-2.el7_4.2.ppc64le.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm\n\ns390x:\ndnsmasq-2.76-2.el7_4.2.s390x.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 7):\n\naarch64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.aarch64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.aarch64.rpm\n\nppc64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.ppc64.rpm\n\nppc64le:\ndnsmasq-debuginfo-2.76-2.el7_4.2.ppc64le.rpm\ndnsmasq-utils-2.76-2.el7_4.2.ppc64le.rpm\n\ns390x:\ndnsmasq-debuginfo-2.76-2.el7_4.2.s390x.rpm\ndnsmasq-utils-2.76-2.el7_4.2.s390x.rpm\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\ndnsmasq-2.76-2.el7_4.2.src.rpm\n\nx86_64:\ndnsmasq-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 7):\n\nx86_64:\ndnsmasq-debuginfo-2.76-2.el7_4.2.x86_64.rpm\ndnsmasq-utils-2.76-2.el7_4.2.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security.  Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2017-14491\nhttps://access.redhat.com/security/cve/CVE-2017-14492\nhttps://access.redhat.com/security/cve/CVE-2017-14493\nhttps://access.redhat.com/security/cve/CVE-2017-14494\nhttps://access.redhat.com/security/cve/CVE-2017-14495\nhttps://access.redhat.com/security/cve/CVE-2017-14496\nhttps://access.redhat.com/security/updates/classification/#critical\nhttps://access.redhat.com/security/vulnerabilities/3199382\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2017 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niD8DBQFZ0opYXlSAg2UNWIIRAr0dAJ9rIL1FgNTJUf2I9jjKFFlfkCd/kwCfV+bX\nSfoCV7+qG2nwqlHKLZOlhIU=\n=iWfU\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. \n===========================================================================\nUbuntu Security Notice USN-3430-3\nJanuary 04, 2018\n\ndnsmasq regression\n===========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 12.04 ESM\n\nSummary:\n\nUSN-3430-2 introduced regression in Dnsmasq. \n\nSoftware Description:\n- dnsmasq: Small caching DNS proxy and DHCP/TFTP server\n\nDetails:\n\nUSN-3430-2 fixed several vulnerabilities. The update introduced a new\nregression that breaks DNS resolution. This update addresses the\nproblem. \n\nWe apologize for the inconvenience. \n\nOriginal advisory details:\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. \n(CVE-2017-14491)\n\nFelix Wilhelm, Fermin J. (CVE-2017-14492)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DHCPv6 requests. \n(CVE-2017-14493)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DHCPv6 packets. (CVE-2017-14494)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14495)\n\nFelix Wilhelm, Fermin J. Serna, Gabriel Campana and Kevin Hamacher\ndiscovered that Dnsmasq incorrectly handled DNS requests. (CVE-2017-14496)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 12.04 ESM:\n dnsmasq=C2=A02.59-4ubuntu0.4\n dnsmasq-base2.59-4ubuntu0.4\n dnsmasq-utils2.59-4ubuntu0.4\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes. \n\nAffected packages\n=================\n\n    -------------------------------------------------------------------\n     Package              /     Vulnerable     /            Unaffected\n    -------------------------------------------------------------------\n  1  net-dns/dnsmasq               \u003c 2.78                     \u003e= 2.78 \n\nDescription\n===========\n\nMultiple vulnerabilities have been discovered in Dnsmasq. \n\nWorkaround\n==========\n\nThere is no known workaround at this time. \n\nResolution\n==========\n\nAll Dnsmasq users should upgrade to the latest version:\n\n  # emerge --sync\n  # emerge --ask --oneshot --verbose \"\u003e=net-dns/dnsmasq-2.78\"\n\nReferences\n==========\n\n[ 1 ] CVE-2017-14491\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14491\n[ 2 ] CVE-2017-14492\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14492\n[ 3 ] CVE-2017-14493\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14493\n[ 4 ] CVE-2017-14494\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14494\n[ 5 ] CVE-2017-14495\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14495\n[ 6 ] CVE-2017-14496\n      https://nvd.nist.gov/nvd.cfm?cvename=CVE-2017-14496\n\nAvailability\n============\n\nThis GLSA and any updates to it are available for viewing at\nthe Gentoo Security Website:\n\n https://security.gentoo.org/glsa/201710-27\n\nConcerns?\n=========\n\nSecurity is a primary focus of Gentoo Linux and ensuring the\nconfidentiality and security of our users\u0027 machines is of utmost\nimportance to us. Any security concerns should be addressed to\nsecurity@gentoo.org or alternatively, you may file a bug at\nhttps://bugs.gentoo.org. \n\nLicense\n=======\n\nCopyright 2017 Gentoo Foundation, Inc; referenced text\nbelongs to its owner(s). \n\nThe contents of this document are licensed under the\nCreative Commons - Attribution / Share Alike license. \n\nhttp://creativecommons.org/licenses/by-sa/2.5\n",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      },
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      }
    ],
    "trust": 3.42
  },
  "exploit_availability": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "reference": "https://vulmon.com/exploitdetails?qidtp=exploitdb\u0026qid=42946",
        "trust": 0.1,
        "type": "exploit"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#973527",
        "trust": 3.6
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496",
        "trust": 3.6
      },
      {
        "db": "BID",
        "id": "101085",
        "trust": 2.0
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-17-332-01",
        "trust": 2.0
      },
      {
        "db": "BID",
        "id": "101977",
        "trust": 1.4
      },
      {
        "db": "SECTRACK",
        "id": "1039474",
        "trust": 1.1
      },
      {
        "db": "SIEMENS",
        "id": "SSA-689071",
        "trust": 1.1
      },
      {
        "db": "EXPLOIT-DB",
        "id": "42946",
        "trust": 1.1
      },
      {
        "db": "JVN",
        "id": "JVNVU93453933",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623",
        "trust": 0.8
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742",
        "trust": 0.6
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14496",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144490",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144484",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "145652",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144469",
        "trust": 0.1
      },
      {
        "db": "PACKETSTORM",
        "id": "144706",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "id": "VAR-201710-0452",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "VARIoT devices database",
        "id": null
      }
    ],
    "trust": 0.25396827
  },
  "last_update_date": "2024-08-14T12:07:03.732000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "Android Security Bulletin-October 2017",
        "trust": 0.8,
        "url": "https://source.android.com/security/bulletin/2017-10-01"
      },
      {
        "title": "DSA-3989",
        "trust": 0.8,
        "url": "https://www.debian.org/security/2017/dsa-3989"
      },
      {
        "title": "Security Bulletin: NVIDIA Tegra Jetson L4T contains multiple vulnerabilities; updates for \u201cBlueBorne\u201d and \u201cDnsmasq\u201d.",
        "trust": 0.8,
        "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4561"
      },
      {
        "title": "openSUSE-SU-2017:2633",
        "trust": 0.8,
        "url": "https://lists.opensuse.org/opensuse-security-announce/2017-10/msg00006.html"
      },
      {
        "title": "RHSA-2017:2836",
        "trust": 0.8,
        "url": "https://access.redhat.com/errata/RHSA-2017:2836"
      },
      {
        "title": "CHANGELOG",
        "trust": 0.8,
        "url": "http://thekelleys.org.uk/dnsmasq/CHANGELOG"
      },
      {
        "title": "Security fix, CVE-2017-14496, Integer underflow in DNS response creation.",
        "trust": 0.8,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git;a=commit;h=897c113fda0886a28a986cc6ba17bb93bd6cb1c7"
      },
      {
        "title": "USN-3430-2",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-2/"
      },
      {
        "title": "USN-3430-1",
        "trust": 0.8,
        "url": "https://usn.ubuntu.com/usn/USN-3430-1/"
      },
      {
        "title": "dnsmasq: Multiple Critical and Important vulnerabilities",
        "trust": 0.8,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "title": "The Register",
        "trust": 0.2,
        "url": "https://www.theregister.co.uk/2017/10/03/october_android_patches/"
      },
      {
        "title": "Red Hat: Critical: dnsmasq security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20172836 - Security Advisory"
      },
      {
        "title": "Debian CVElist Bug Report Logs: dnsmasq: CVE-2017-13704: Size parameter overflow via large DNS query",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_cvelist_bugreportlogs\u0026qid=fa8aad66cae5df51d49e1cdce2fe4a42"
      },
      {
        "title": "Arch Linux Issues: ",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_issues\u0026qid=CVE-2017-14496"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-2"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq regression",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-3"
      },
      {
        "title": "Ubuntu Security Notice: dnsmasq vulnerabilities",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3430-1"
      },
      {
        "title": "Debian Security Advisories: DSA-3989-1 dnsmasq -- security update",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=5c18698ecfe74c7de381531f8ed44dcf"
      },
      {
        "title": "Siemens Security Advisories: Siemens Security Advisory",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=7f490a104360d6f65bee18ec7bfa18a3"
      },
      {
        "title": "Amazon Linux 2: ALAS2-2019-1251",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=ALAS2-2019-1251"
      },
      {
        "title": "Amazon Linux AMI: ALAS-2017-907",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux_ami\u0026qid=ALAS-2017-907"
      },
      {
        "title": "Arch Linux Advisories: [ASA-201710-1] dnsmasq: multiple issues",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=arch_linux_advisories\u0026qid=ASA-201710-1"
      },
      {
        "title": "Android Security Bulletins: Android Security Bulletin\u2014October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=android_security_bulletins\u0026qid=b392dd6315d6fbd5f702d9c6d94af9ba"
      },
      {
        "title": "Oracle Solaris Third Party Bulletins: Oracle Solaris Third Party Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_solaris_third_party_bulletins\u0026qid=6283337cd31f81f24d445925f2138c0e"
      },
      {
        "title": "Oracle Linux Bulletins: Oracle Linux Bulletin - October 2017",
        "trust": 0.1,
        "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=7251d5e5f2b1771951980ad7cfde50ba"
      },
      {
        "title": "Safe libc",
        "trust": 0.1,
        "url": "https://github.com/introspection-libc/main "
      },
      {
        "title": "What is this?\nHow does it work?\nHow to build the toolchain\nHow to build a program using the safe libc\nAnd in the real world?",
        "trust": 0.1,
        "url": "https://github.com/pekd/safe-libc "
      },
      {
        "title": "What is this?\nHow does it work?\nHow to build the toolchain\nHow to build a program using the safe libc\nAnd in the real world?",
        "trust": 0.1,
        "url": "https://github.com/introspection-libc/safe-libc "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/lnick2023/nicenice "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/xbl3/awesome-cve-poc_qazbnm456 "
      },
      {
        "title": "Awesome CVE PoC",
        "trust": 0.1,
        "url": "https://github.com/qazbnm456/awesome-cve-poc "
      },
      {
        "title": "Threatpost",
        "trust": 0.1,
        "url": "https://threatpost.com/google-warns-of-dos-and-rce-bugs-in-dnsmasq/128238/"
      }
    ],
    "sources": [
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-191",
        "trust": 1.8
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.9,
        "url": "https://www.kb.cert.org/vuls/id/973527"
      },
      {
        "trust": 2.8,
        "url": "https://security.googleblog.com/2017/10/behind-masq-yet-more-dns-and-dhcp.html"
      },
      {
        "trust": 2.3,
        "url": "http://www.securityfocus.com/bid/101085"
      },
      {
        "trust": 2.1,
        "url": "https://access.redhat.com/errata/rhsa-2017:2836"
      },
      {
        "trust": 2.0,
        "url": "https://source.android.com/security/bulletin/2017-10-01"
      },
      {
        "trust": 2.0,
        "url": "http://www.debian.org/security/2017/dsa-3989"
      },
      {
        "trust": 2.0,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-17-332-01"
      },
      {
        "trust": 1.7,
        "url": "http://www.thekelleys.org.uk/dnsmasq/doc.html"
      },
      {
        "trust": 1.4,
        "url": "http://www.ubuntu.com/usn/usn-3430-1"
      },
      {
        "trust": 1.3,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14496"
      },
      {
        "trust": 1.2,
        "url": "https://www.exploit-db.com/exploits/42946/"
      },
      {
        "trust": 1.2,
        "url": "https://security.gentoo.org/glsa/201710-27"
      },
      {
        "trust": 1.2,
        "url": "http://www.ubuntu.com/usn/usn-3430-2"
      },
      {
        "trust": 1.2,
        "url": "https://access.redhat.com/security/vulnerabilities/3199382"
      },
      {
        "trust": 1.1,
        "url": "http://thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 1.1,
        "url": "http://www.securitytracker.com/id/1039474"
      },
      {
        "trust": 1.1,
        "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4561"
      },
      {
        "trust": 1.1,
        "url": "http://www.securityfocus.com/bid/101977"
      },
      {
        "trust": 1.1,
        "url": "https://www.synology.com/support/security/synology_sa_17_59_dnsmasq"
      },
      {
        "trust": 1.1,
        "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2017-005.txt"
      },
      {
        "trust": 1.1,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-689071.pdf"
      },
      {
        "trust": 1.1,
        "url": "http://lists.opensuse.org/opensuse-security-announce/2017-10/msg00006.html"
      },
      {
        "trust": 1.1,
        "url": "http://thekelleys.org.uk/gitweb/?p=dnsmasq.git%3ba=commit%3bh=897c113fda0886a28a986cc6ba17bb93bd6cb1c7"
      },
      {
        "trust": 1.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11665.html"
      },
      {
        "trust": 1.1,
        "url": "https://www.mail-archive.com/dnsmasq-discuss%40lists.thekelleys.org.uk/msg11664.html"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14491"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14492"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14493"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14494"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14495"
      },
      {
        "trust": 1.0,
        "url": "https://access.redhat.com/security/cve/cve-2017-14496"
      },
      {
        "trust": 0.9,
        "url": "http://www.thekelleys.org.uk/dnsmasq/changelog"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14491.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14492.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14493.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14494.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14495.py"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/kubernetes/kubernetes/blob/master/changelog.md"
      },
      {
        "trust": 0.9,
        "url": "http://www.slackware.com/security/viewer.php?l=slackware-security\u0026y=2017\u0026m=slackware-security.601472"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495410"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495411"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495412"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495415"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495416"
      },
      {
        "trust": 0.9,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495510"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/security/cve/cve-2017-13704"
      },
      {
        "trust": 0.9,
        "url": "https://github.com/google/security-research-pocs/blob/master/vulnerabilities/dnsmasq/cve-2017-14496.py"
      },
      {
        "trust": 0.9,
        "url": "https://access.redhat.com/errata/rhsa-2017:2837"
      },
      {
        "trust": 0.8,
        "url": "https://www.ruckuswireless.com/security"
      },
      {
        "trust": 0.8,
        "url": "https://www.zyxel.com/support/announcement_dnsmasq_vulnerabilities.shtml"
      },
      {
        "trust": 0.8,
        "url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-14496"
      },
      {
        "trust": 0.8,
        "url": "http://jvn.jp/vu/jvnvu93453933/index.html"
      },
      {
        "trust": 0.6,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409bug1495409"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-17-332-01"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14491"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14494"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14492"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14493"
      },
      {
        "trust": 0.5,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14495"
      },
      {
        "trust": 0.3,
        "url": "http://subscriber.communications.siemens.com/"
      },
      {
        "trust": 0.3,
        "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1495409 bug 1495409"
      },
      {
        "trust": 0.1,
        "url": "https://cwe.mitre.org/data/definitions/191.html"
      },
      {
        "trust": 0.1,
        "url": "https://github.com/introspection-libc/main"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov"
      },
      {
        "trust": 0.1,
        "url": "https://github.com/introspection-libc/safe-libc"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/updates/classification/#critical"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/articles/11258"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/team/contact/"
      },
      {
        "trust": 0.1,
        "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
      },
      {
        "trust": 0.1,
        "url": "https://bugzilla.redhat.com/):"
      },
      {
        "trust": 0.1,
        "url": "https://access.redhat.com/security/team/key/"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/bugs/1741262"
      },
      {
        "trust": 0.1,
        "url": "https://www.ubuntu.com/usn/usn-3430-3"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/dnsmasq/2.76-5ubuntu0.1"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/dnsmasq/2.75-1ubuntu0.16.04.3"
      },
      {
        "trust": 0.1,
        "url": "https://launchpad.net/ubuntu/+source/dnsmasq/2.68-1ubuntu0.2"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14495"
      },
      {
        "trust": 0.1,
        "url": "http://creativecommons.org/licenses/by-sa/2.5"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14493"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14492"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14491"
      },
      {
        "trust": 0.1,
        "url": "https://security.gentoo.org/"
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14496"
      },
      {
        "trust": 0.1,
        "url": "https://bugs.gentoo.org."
      },
      {
        "trust": 0.1,
        "url": "https://nvd.nist.gov/nvd.cfm?cvename=cve-2017-14494"
      }
    ],
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-10-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2017-10-03T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "date": "2017-11-28T00:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-10-24T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "date": "2017-10-03T20:21:00",
        "db": "PACKETSTORM",
        "id": "144490"
      },
      {
        "date": "2017-10-03T05:19:24",
        "db": "PACKETSTORM",
        "id": "144484"
      },
      {
        "date": "2018-01-04T17:50:40",
        "db": "PACKETSTORM",
        "id": "145652"
      },
      {
        "date": "2017-10-02T13:13:00",
        "db": "PACKETSTORM",
        "id": "144469"
      },
      {
        "date": "2017-10-23T13:54:05",
        "db": "PACKETSTORM",
        "id": "144706"
      },
      {
        "date": "2017-09-18T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "date": "2017-10-03T01:29:02.200000",
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2018-02-02T00:00:00",
        "db": "CERT/CC",
        "id": "VU#973527"
      },
      {
        "date": "2023-11-07T00:00:00",
        "db": "VULMON",
        "id": "CVE-2017-14496"
      },
      {
        "date": "2019-05-15T17:00:00",
        "db": "BID",
        "id": "101977"
      },
      {
        "date": "2017-10-02T00:00:00",
        "db": "BID",
        "id": "101085"
      },
      {
        "date": "2017-11-29T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-008623"
      },
      {
        "date": "2020-10-14T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      },
      {
        "date": "2023-11-07T02:39:01.783000",
        "db": "NVD",
        "id": "CVE-2017-14496"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "network",
    "sources": [
      {
        "db": "BID",
        "id": "101977"
      },
      {
        "db": "BID",
        "id": "101085"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Dnsmasq contains multiple vulnerabilities",
    "sources": [
      {
        "db": "CERT/CC",
        "id": "VU#973527"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "digital error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201709-742"
      }
    ],
    "trust": 0.6
  }
}

var-201705-3220
Vulnerability from variot

Specially crafted PROFINET DCP broadcast packets could cause a denial of service condition of affected products on a local Ethernet segment (Layer 2). Human interaction is required to recover the systems. PROFIBUS interfaces are not affected. SIMATIC CP, SIMATIC RF600, SCALANCE W700, etc. are all industrial automation products from Siemens AG. A denial of service vulnerability exists in several industrial devices from Siemens. Multiple Siemens Products is prone to multiple denial-of-service vulnerabilities. Attackers can exploit these issues to cause a denial-of-service condition. Manual restart of the server is required to resume normal operation. SIEMENS SIMATIC CP 343-1 Std, CP 343-1 Lean (All versions), SIMATIC CP 343-1 Adv (All versions), SIMATIC CP 443-1 Std, CP 443-1 Adv (All versions before V3.2.17), SIMATIC CP 443-1 OPC-UA (All versions), SIMATIC CP 1243-1 (All versions before V2.1.82), SIMATIC CP 1243-1 IRC (All versions before V2.1.82), SIMATIC CP 1243-1 IEC (All versions), SIMATIC CP 1243-1 DNP3 (All versions), SIMATIC CM 1542-1 (All versions before V2.0), SIMATIC CP 1542SP-1, CP 1542SP-1 IRC, and CP 1543SP-1 (All versions before to V1.0.15), SIMATIC CP 1543-1 (All versions before V2.1), SIMATIC RF650R, RF680R, RF685R (All versions before V3.0), SIMATIC CP 1616, CP 1604, DK-16xx PN IO (All versions before V2.7), SCALANCE X-200 (All versions before V5.2.2), SCALANCE X200 IRT (All versions before V5.4.0), SCALANCE X-300/X408 (All versions before V4.1.0), SCALANCE X414 (All versions before V3.10.2), SCALANCE XM400, XR500 (All versions before V6.1), SCALANCE W700 (All versions before V6.1), SCALANCE M-800, S615 (All versions before V04.03), Softnet PROFINET IO for PC-based Windows systems (All versions before V14 SP1), IE/PB-Link (All versions before V3.0), IE/AS-i Link PN IO (All versions), SIMATIC Teleservice Adapter Standard Modem, IE Basic, IE Advanced (All versions), SITOP PSU8600 PROFINET (All versions before V1.2.0), SITOP UPS1600 PROFINET (All versions before V2.2.0), SIMATIC ET 200AL (All versions before V1.0.2), SIMATIC ET 200ecoPN (All versions), SIMATIC ET 200M (All versions), SIMATIC ET 200MP (All versions before V4.0.1), SIMATIC ET 200pro (All versions), SIMATIC ET 200S (All versions), SIMATIC ET 200SP (All versions before V4.1.0), SIMATIC PN/PN Coupler (All versions before V4.0), DK Standard Ethernet Controller (All versions before V4.1.1 Patch04), EK-ERTEC 200P PN IO (All versions before V4.4.0 Patch01), EK-ERTEC 200 PN IO (All versions before V4.2.1 Patch03), SIMATIC S7-200 SMART (All versions before V2.3), SIMATIC S7-300 incl. F and T (All versions before V3.X.14), SIMATIC S7-400 PN/DP V6 Incl. F (All versions before V6.0.6), SIMATIC S7-400-H V6 (All versions before V6.0.7), SIMATIC S7-400 PN/DP V7 incl. F (All versions), SIMATIC S7-CPU 410 (All versions before V8.2), SIMATIC S7-1200 incl. F (All versions before V4.2.1), SIMATIC S7-1500 incl. F, T, and TF (All versions before V2.1), SIMATIC S7-1500 Software Controller incl. F (All versions before V2.1), SIMATIC WinAC RTX 2010 incl. F (All versions), SIRIUS ACT 3SU1 interface module PROFINET (All versions), SIRIUS Soft starter 3RW44 PN (All versions), SIRIUS Motor starter M200D PROFINET (All versions), SIMOCODE pro V PROFINET (All versions), SINAMICS DCM (All versions before V1.4 SP1 HF5), SINAMICS DCP (All versions), SINAMICS G110M / G120(C/P/D) w. PN (All versions before V4.7 SP6 HF3), SINAMICS G130 and G150 (All versions before V4.7 HF27 and V4.8 before HF4), SINAMICS S110 w. PN (All versions before V4.4 SP1 HF5), SINAMICS S120 (All versions before V4.7 HF27 and V4.8 before HF4), SINAMICS S150 (All versions before V4.7 HF27 and V4.8 before HF4), SINAMICS V90 w. PN (All versions before V1.1), SIMOTION (All versions before V4.5 HF1), SINUMERIK 828D (All versions before V4.5 SP6 HF2 and V4.7 before SP6 HF8), SINUMERIK 840D sl (All versions before V4.5 SP6 HF8 and V4.7 before SP4 HF1), SIMATIC HMI Comfort Panels, HMI Multi Panels, HMI Mobile Panels (All versions) could be affected by a Denial-of-Service condition induced by a specially crafted PROFINET DCP broadcast (Layer 2 - Ethernet) packet. Siemens SIMATIC S7-200 Smart, etc. Siemens SIMATIC S7-200 Smart is a programmable logic controller (PLC) used in small and medium-sized automation systems. Siemens SIMATIC CP 343-1 Advanced is an Ethernet communication module used to support PROFINET (a new generation of automation bus standard based on industrial Ethernet technology). SIRIUS Motor starter M200D PROFINET is a motor starter. The following products and versions are affected: Siemens Extension Unit 12\" PROFINET prior to V01.01.01; Extension Unit 15\" PROFINET prior to V01.01.01; Extension Unit 19\" PROFINET prior to V01.01.01; Extension Unit 22\" PROFINET SIMATIC CP 1242-7 GPRS V2 prior to V2.1.82; SIMATIC CP 1243-7 LTE/US prior to V2.1.82; SIMATIC CP 1243-8 prior to V2.1.82; SIMATIC CP 1626 V1.1 previous version

Show details on source website


{
  "@context": {
    "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
    "affected_products": {
      "@id": "https://www.variotdbs.pl/ref/affected_products"
    },
    "configurations": {
      "@id": "https://www.variotdbs.pl/ref/configurations"
    },
    "credits": {
      "@id": "https://www.variotdbs.pl/ref/credits"
    },
    "cvss": {
      "@id": "https://www.variotdbs.pl/ref/cvss/"
    },
    "description": {
      "@id": "https://www.variotdbs.pl/ref/description/"
    },
    "exploit_availability": {
      "@id": "https://www.variotdbs.pl/ref/exploit_availability/"
    },
    "external_ids": {
      "@id": "https://www.variotdbs.pl/ref/external_ids/"
    },
    "iot": {
      "@id": "https://www.variotdbs.pl/ref/iot/"
    },
    "iot_taxonomy": {
      "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
    },
    "patch": {
      "@id": "https://www.variotdbs.pl/ref/patch/"
    },
    "problemtype_data": {
      "@id": "https://www.variotdbs.pl/ref/problemtype_data/"
    },
    "references": {
      "@id": "https://www.variotdbs.pl/ref/references/"
    },
    "sources": {
      "@id": "https://www.variotdbs.pl/ref/sources/"
    },
    "sources_release_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_release_date/"
    },
    "sources_update_date": {
      "@id": "https://www.variotdbs.pl/ref/sources_update_date/"
    },
    "threat_type": {
      "@id": "https://www.variotdbs.pl/ref/threat_type/"
    },
    "title": {
      "@id": "https://www.variotdbs.pl/ref/title/"
    },
    "type": {
      "@id": "https://www.variotdbs.pl/ref/type/"
    }
  },
  "@id": "https://www.variotdbs.pl/vuln/VAR-201705-3220",
  "affected_products": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/affected_products#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "model": "simatic dk-16xx pn io",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf685r",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf650r",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf680r",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1543sp-1",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1542sp-1 irc",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1542sp-1",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xr500",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance s615",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance m-800",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance xm400",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance w700",
        "scope": null,
        "trust": 1.4,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics gm150",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics gh150",
        "scope": "eq",
        "trust": 1.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics dcp",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.2"
      },
      {
        "model": "simatic teleservice adapter ie advanced",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic teleservice adapter ie basic",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic cp 343-1 lean",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1.3"
      },
      {
        "model": "sinamics g150",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics g130",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance s615",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.03"
      },
      {
        "model": "simatic rf685r",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simotion",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic et 200mp",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.0.1"
      },
      {
        "model": "simatic dk-1616 pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "simatic cp 1543sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "sitop psu8600",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.2.0"
      },
      {
        "model": "softnet profinet io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "14"
      },
      {
        "model": "simatic et 200m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics g120\\ w. pn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic hmi comfort panels",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "15.1"
      },
      {
        "model": "sinamics gm150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic cp 1543-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "ek-ertec 200 pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.1"
      },
      {
        "model": "simatic cp 1616",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "simatic cp 443-1 std",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2.17"
      },
      {
        "model": "ie\\/as-i link pn io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics gl150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics dcm",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.4"
      },
      {
        "model": "simatic s7-200 smart",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.3"
      },
      {
        "model": "ups1600 profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.2.0"
      },
      {
        "model": "sinamics dcp",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.2"
      },
      {
        "model": "pn\\/pn coupler",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.0"
      },
      {
        "model": "simatic cp 1542sp-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "simatic winac rtx",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2010"
      },
      {
        "model": "simatic cp 443-1 adv",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.2.17"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.1"
      },
      {
        "model": "extension unit 19 profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "01.01.01"
      },
      {
        "model": "simatic cp 343-1 std",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.1.3"
      },
      {
        "model": "scalance x408",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "sinamics g150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "ek-ertec 200p pn io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4.0"
      },
      {
        "model": "simatic cp 1243-1 iec",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic cp 343-1 adv",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "softnet profinet io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "14"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic hmi multi panels",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "15.1"
      },
      {
        "model": "simatic cm 1542-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0"
      },
      {
        "model": "sinamics s120",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sm120",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics v90 pn",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.01"
      },
      {
        "model": "simatic cp 443-1 opc-ua",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics g120\\ w. pn",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance xm400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "extension unit 22 profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "01.01.01"
      },
      {
        "model": "simatic winac rtx",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2010"
      },
      {
        "model": "sinamics gl150",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic hmi mobile panels",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "15.1"
      },
      {
        "model": "sinamics g110m",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic et 200pro",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic s7-1200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.1"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "simatic tdc cpu555",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.1"
      },
      {
        "model": "scalance xr500",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "simatic cp 1604",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "simatic cp 1243-1 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.1"
      },
      {
        "model": "simatic cp 1542sp-1 irc",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.15"
      },
      {
        "model": "simatic teleservice adapter ie standard",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simatic s7-400",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.0.6"
      },
      {
        "model": "sirius act 3su1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.0"
      },
      {
        "model": "sinamics s150",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance x200",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.2.2"
      },
      {
        "model": "sinamics dcm",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.4"
      },
      {
        "model": "sinamics sm120",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic et 200al",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.0.2"
      },
      {
        "model": "simatic rf650r",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "extension unit 12 profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "01.01.01"
      },
      {
        "model": "ek-ertec 200p pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4.0"
      },
      {
        "model": "simatic cp 1243-8",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "sinamics s110 pn",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4"
      },
      {
        "model": "simatic s7-300",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s120",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance x300",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "ie\\/pb-link",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "scalance m-800",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.03"
      },
      {
        "model": "simatic et 200sp",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.1.0"
      },
      {
        "model": "simatic cp 1242-7 gprs",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "simatic dk-1604 pn io",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "sinamics sl150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinumerik 828d",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "scalance x200 irt",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "5.4.0"
      },
      {
        "model": "sirius motor starter m200d profinet",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "extension unit 15 profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "01.01.01"
      },
      {
        "model": "simatic et 200ecopn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics g130",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "scalance x414",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.10.2"
      },
      {
        "model": "simatic tdc cp51m1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1.8"
      },
      {
        "model": "sinamics g110m",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic s7-1500",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "ek-ertec 200 pn io",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.2.1"
      },
      {
        "model": "sinamics s110 pn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.4"
      },
      {
        "model": "simatic rf680r",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic cp 1243-7 lte\\/us",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "simotion",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "sirius soft starter 3rw44 pn",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "sinamics s150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic cp 1243-1",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1.82"
      },
      {
        "model": "simatic cp 1626",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "1.1"
      },
      {
        "model": "simatic cp 1243-1 dnp3",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "scalance w700",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "sinumerik 828d",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.5"
      },
      {
        "model": "sinamics gh150",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "simatic et 200s",
        "scope": "eq",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "*"
      },
      {
        "model": "simocode pro v profinet",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.0.0"
      },
      {
        "model": "simatic s7-1500 software controller",
        "scope": "lt",
        "trust": 1.0,
        "vendor": "siemens",
        "version": "2.1"
      },
      {
        "model": "dk standard ethernet controller",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ek-ertec 200 pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ek-ertec 200p pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ie/as-i link pn io",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "ie/pb-link",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "pn/pn coupler",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x200 irt",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x200",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x300",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x408",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "scalance x414",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cm 1542-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1243-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1543-1",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1604",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1616",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 adv",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 lean",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 std",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 adv",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 opc-ua",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 std",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200al",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200ecopn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200m",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200mp",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200pro",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200s",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic et 200sp",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic hmi comfort panels",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic hmi mobile panels",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic hmi multi panels",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-1200",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-1500 software controller",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-1500",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-200 smart",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-300",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic s7-400",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic teleservice adapter ie advanced",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic teleservice adapter ie basic",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic teleservice adapter standard modem",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic winac rtx 2010",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simocode pro v profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simotion",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics dcm",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics dcp",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g110m",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g120 w. pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g130",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics g150",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s110 w. pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s120",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics s150",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinamics v90 w. pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinumerik 828d",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sinumerik 840d sl",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sirius act 3su1 interface module profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sirius motor starter m200d profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sirius soft starter 3rw44 pn",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sitop psu8600",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "sitop ups1600 profinet",
        "scope": null,
        "trust": 0.8,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "softnet profinet io",
        "scope": "eq",
        "trust": 0.8,
        "vendor": "siemens",
        "version": "for pc-based windows systems firmware"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1616"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1604"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1543-1"
      },
      {
        "model": "simatic cm",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1542-1"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "1243-1"
      },
      {
        "model": "simatic cp opc-ua",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "443-1"
      },
      {
        "model": "simatic cp adv",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "443-1"
      },
      {
        "model": "simatic cp std",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "443-1"
      },
      {
        "model": "simatic cp std",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "simatic cp lean",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "simatic cp adv",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "343-1"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x408"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x414"
      },
      {
        "model": "scalance irt",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x200"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x200"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": "x300"
      },
      {
        "model": "simatic rf650r",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 opc-ua",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cm 1542-1",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1542sp-1 irc",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 443-1 adv",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 343-1 std",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1543-1",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1543sp-1",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic cp 1542sp-1",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": "simatic rf680r",
        "scope": "eq",
        "trust": 0.6,
        "vendor": "siemens",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "sinumerik 828d",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.4,
        "vendor": "sinumerik 840d sl",
        "version": "*"
      },
      {
        "model": "ups1600 profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "softnet profinet io",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sitop psu8600",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sirius soft starter 3rw44 pn",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sirius act 3su1",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinumerik 840d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinumerik 828d",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinamics sm150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sm120",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7.5"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7.4"
      },
      {
        "model": "sinamics sl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics gl150",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simotion",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic winac rtx",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "20100"
      },
      {
        "model": "simatic teleservice adapter standard modem",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-400",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-300",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-200 smart",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic s7-1500",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic rf685r",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic rf680r",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic rf650r",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic et",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "2000"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "443-10"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "343-10"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16260"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16160"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16040"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1543-12.0.28"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1543-10"
      },
      {
        "model": "simatic cp 1542sp-1",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "simatic cp irc",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-80"
      },
      {
        "model": "simatic cp lte eu/us",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-70"
      },
      {
        "model": "simatic cp",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-10"
      },
      {
        "model": "simatic cp gprs",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1242-7v20"
      },
      {
        "model": "scalance xr500",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance xm400",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x4140"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x4084.0"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x4083.0"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x3000"
      },
      {
        "model": "scalance irt",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x2000"
      },
      {
        "model": "scalance",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "x2000"
      },
      {
        "model": "scalance w700 series",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.4"
      },
      {
        "model": "scalance w700 series",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.5.4"
      },
      {
        "model": "scalance s615",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.02"
      },
      {
        "model": "scalance m-800",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "ie/as-i link pn io",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "22?0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "19?0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "15?0"
      },
      {
        "model": "extension unit profinet",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "12?0"
      },
      {
        "model": "e/pb-link",
        "scope": "eq",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "0"
      },
      {
        "model": "sinumerik 840d sl",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinumerik 828d",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.7"
      },
      {
        "model": "sinamics sm120 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics sl150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics gm150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics gl150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "sinamics gh150 sp2",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "4.8"
      },
      {
        "model": "simatic rf685r",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic rf680r",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic cp",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "16162.7"
      },
      {
        "model": "simatic cp 1604d",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "2.7"
      },
      {
        "model": "simatic cp irc",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-82.1.82"
      },
      {
        "model": "simatic cp lte eu/us",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1243-72.1.82"
      },
      {
        "model": "simatic cp gprs",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1242-7v22.1.82"
      },
      {
        "model": "simatic rf650r",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "3.0"
      },
      {
        "model": "simatic cp",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "443-13.2.17"
      },
      {
        "model": "simatic cp",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "15431.2.1"
      },
      {
        "model": "simatic cm1542",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "1.2"
      },
      {
        "model": "scalance w700",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "6.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "22?1.1.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "19?1.1.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "15?1.1.1"
      },
      {
        "model": "extension unit profinet",
        "scope": "ne",
        "trust": 0.3,
        "vendor": "siemens",
        "version": "12?1.1.1"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 std",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1542sp 1 irc",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1543sp 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1543 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf650r",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf680r",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic rf685r",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1616",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1604",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic dk 16xx pn io",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x200",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 lean",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x200 irt",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x300",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x408",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance x414",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xm400",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance xr500",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance w700",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance m 800",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "scalance s615",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "softnet profinet io",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 343 1 adv",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ie pb link",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ie as i link pn io",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic teleservice adapter standard modem",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic teleservice adapter ie basic modem",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic teleservice adapter ie advanced modem",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sitop psu8600",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ups1600 profinet",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200al",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200ecopn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200m",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 std",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200mp",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200pro",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200s",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic et 200sp",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "pn pn coupler",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "dk standard ethernet controller",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ek ertec 200p pn io",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "ek ertec 200 pn io",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 200 smart",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 300",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 adv",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 400",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 1200",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 1500",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic s7 1500 controller",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic winac rtx 2010",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sirius act 3su1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sirius soft starter 3rw44 pn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sirius motor starter m200d profinet",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simocode pro v profinet",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics dcm",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 443 1 opc ua",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics dcp",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g110m",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g120 c p d w pn",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g130",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics g150",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics s110 w pn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics s120",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics s150",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "sinamics v90 w pn",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simotion",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1243 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic hmi comfort panels",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic hmi multi panels",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic hmi mobile panels",
        "version": "*"
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cm 1542 1",
        "version": null
      },
      {
        "model": null,
        "scope": "eq",
        "trust": 0.2,
        "vendor": "simatic cp 1542sp 1",
        "version": null
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "configurations": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/configurations#",
      "children": {
        "@container": "@list"
      },
      "cpe_match": {
        "@container": "@list"
      },
      "data": {
        "@container": "@list"
      },
      "nodes": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "CVE_data_version": "4.0",
        "nodes": [
          {
            "cpe_match": [
              {
                "cpe22Uri": "cpe:/o:siemens:dk_standard_ethernet_controller_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ek-ertec_200_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ek-ertec_200p_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ie%2Fpb-link_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ie%2Fas-i_link_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:pn%2Fpn_coupler_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_m-800_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_s615_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_w700_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x200irt_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x200_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x300_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x408_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_x414_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_xm400_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:scalance_xr500_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cm_1542-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1243-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1542sp-1_irc_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1542sp-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1543-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1543sp-1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1604_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_1616_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_343-1_lean_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_343-1_adv_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_343-1_std_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_adv_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_std_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_cp_443-1_opc-ua_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_dk-16xx_pn_io_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200al_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200ecopn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200m_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200mp_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200pro_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200s_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_et_200sp_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_hmi_comfort_panels",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_hmi_mobile_panels",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_hmi_multi_panels",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_rf650r_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_rf680r_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_rf685r_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-1200_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-1500_software_controller_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-1500_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-200_smart_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-300_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_s7-400_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_teleservice_adapter_ie_advanced_modem_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_teleservice_adapter_ie_basic_modem_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_teleservice_adapter_standard_modem_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simatic_winac_rtx_2010_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simocode_pro_v_profinet_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:simotion_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_dcm_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_dcp_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g110m_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g120%28c%2Fp%2Fd%29_w._pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g130_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_g150_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics__s110_w._pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_s120_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_s150_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinamics_v90_w._pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinumerik_828d_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sinumerik_840d_sl_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sirius_act_3su1_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sirius_motor_starter_m200d_profinet_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sirius_soft_starter_3rw44_pn_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:sitop_psu8600_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:ups1600_profinet_firmware",
                "vulnerable": true
              },
              {
                "cpe22Uri": "cpe:/o:siemens:softnet_profinet_io_firmware",
                "vulnerable": true
              }
            ],
            "operator": "OR"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      }
    ]
  },
  "credits": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/credits#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Duan JinTong, Ma ShaoShuai, and Cheng Lei from NSFOCUS Security Team.",
    "sources": [
      {
        "db": "BID",
        "id": "98369"
      }
    ],
    "trust": 0.3
  },
  "cve": "CVE-2017-2680",
  "cvss": {
    "@context": {
      "cvssV2": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
      },
      "cvssV3": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
      },
      "severity": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/cvss/severity#"
        },
        "@id": "https://www.variotdbs.pl/ref/cvss/severity"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        },
        "@id": "https://www.variotdbs.pl/ref/sources"
      }
    },
    "data": [
      {
        "cvssV2": [
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "nvd@nist.gov",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "CVE-2017-2680",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 1.8,
            "vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "CNVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "CNVD-2017-06151",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.6,
            "vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.0"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "IVD",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.2,
            "vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
            "version": "2.9 [IVD]"
          },
          {
            "accessComplexity": "LOW",
            "accessVector": "ADJACENT_NETWORK",
            "authentication": "NONE",
            "author": "VULHUB",
            "availabilityImpact": "COMPLETE",
            "baseScore": 6.1,
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 6.5,
            "id": "VHN-110883",
            "impactScore": 6.9,
            "integrityImpact": "NONE",
            "severity": "MEDIUM",
            "trust": 0.1,
            "vectorString": "AV:A/AC:L/AU:N/C:N/I:N/A:C",
            "version": "2.0"
          }
        ],
        "cvssV3": [
          {
            "attackComplexity": "LOW",
            "attackVector": "ADJACENT",
            "author": "nvd@nist.gov",
            "availabilityImpact": "HIGH",
            "baseScore": 6.5,
            "baseSeverity": "MEDIUM",
            "confidentialityImpact": "NONE",
            "exploitabilityScore": 2.8,
            "id": "CVE-2017-2680",
            "impactScore": 3.6,
            "integrityImpact": "NONE",
            "privilegesRequired": "NONE",
            "scope": "UNCHANGED",
            "trust": 2.0,
            "userInteraction": "NONE",
            "vectorString": "CVSS:3.1/AV:A/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.1"
          },
          {
            "attackComplexity": "Low",
            "attackVector": "Adjacent Network",
            "author": "NVD",
            "availabilityImpact": "High",
            "baseScore": 6.5,
            "baseSeverity": "Medium",
            "confidentialityImpact": "None",
            "exploitabilityScore": null,
            "id": "CVE-2017-2680",
            "impactScore": null,
            "integrityImpact": "None",
            "privilegesRequired": "None",
            "scope": "Unchanged",
            "trust": 0.8,
            "userInteraction": "None",
            "vectorString": "CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
            "version": "3.0"
          }
        ],
        "severity": [
          {
            "author": "nvd@nist.gov",
            "id": "CVE-2017-2680",
            "trust": 1.0,
            "value": "MEDIUM"
          },
          {
            "author": "productcert@siemens.com",
            "id": "CVE-2017-2680",
            "trust": 1.0,
            "value": "High"
          },
          {
            "author": "NVD",
            "id": "CVE-2017-2680",
            "trust": 0.8,
            "value": "Medium"
          },
          {
            "author": "CNVD",
            "id": "CNVD-2017-06151",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "CNNVD",
            "id": "CNNVD-201705-574",
            "trust": 0.6,
            "value": "MEDIUM"
          },
          {
            "author": "IVD",
            "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4",
            "trust": 0.2,
            "value": "MEDIUM"
          },
          {
            "author": "VULHUB",
            "id": "VHN-110883",
            "trust": 0.1,
            "value": "MEDIUM"
          }
        ]
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "description": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/description#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "Specially crafted PROFINET DCP broadcast packets could cause a denial of service condition of affected products on a local Ethernet segment (Layer 2). Human interaction is required to recover the systems. PROFIBUS interfaces are not affected. SIMATIC CP, SIMATIC RF600, SCALANCE W700, etc. are all industrial automation products from Siemens AG. A denial of service vulnerability exists in several industrial devices from Siemens. Multiple Siemens Products is prone to multiple denial-of-service vulnerabilities. \nAttackers can exploit these issues to cause a denial-of-service condition. Manual restart of the server is required to resume normal operation. SIEMENS SIMATIC CP 343-1 Std, CP 343-1 Lean (All versions), SIMATIC CP 343-1 Adv (All versions), SIMATIC CP 443-1 Std, CP 443-1 Adv (All versions before V3.2.17), SIMATIC CP 443-1 OPC-UA (All versions), SIMATIC CP 1243-1 (All versions before V2.1.82), SIMATIC CP 1243-1 IRC (All versions before V2.1.82), SIMATIC CP 1243-1 IEC (All versions), SIMATIC CP 1243-1 DNP3 (All versions), SIMATIC CM 1542-1 (All versions before V2.0), SIMATIC CP 1542SP-1, CP 1542SP-1 IRC, and CP 1543SP-1 (All versions before to V1.0.15), SIMATIC CP 1543-1 (All versions before V2.1), SIMATIC RF650R, RF680R, RF685R (All versions before V3.0), SIMATIC CP 1616, CP 1604, DK-16xx PN IO (All versions before V2.7), SCALANCE X-200 (All versions before V5.2.2), SCALANCE X200 IRT (All versions before V5.4.0), SCALANCE X-300/X408 (All versions before V4.1.0), SCALANCE X414 (All versions before V3.10.2), SCALANCE XM400, XR500 (All versions before V6.1), SCALANCE W700 (All versions before V6.1), SCALANCE M-800, S615 (All versions before V04.03), Softnet PROFINET IO for PC-based Windows systems (All versions before V14 SP1), IE/PB-Link (All versions before V3.0), IE/AS-i Link PN IO (All versions), SIMATIC Teleservice Adapter Standard Modem, IE Basic, IE Advanced (All versions), SITOP PSU8600 PROFINET (All versions before V1.2.0), SITOP UPS1600 PROFINET (All versions before V2.2.0), SIMATIC ET 200AL (All versions before V1.0.2), SIMATIC ET 200ecoPN (All versions), SIMATIC ET 200M (All versions), SIMATIC ET 200MP (All versions before V4.0.1), SIMATIC ET 200pro (All versions), SIMATIC ET 200S (All versions), SIMATIC ET 200SP (All versions before V4.1.0), SIMATIC PN/PN Coupler (All versions before V4.0), DK Standard Ethernet Controller (All versions before V4.1.1 Patch04), EK-ERTEC 200P PN IO (All versions before V4.4.0 Patch01), EK-ERTEC 200 PN IO (All versions before V4.2.1 Patch03), SIMATIC S7-200 SMART (All versions before V2.3), SIMATIC S7-300 incl. F and T (All versions before V3.X.14), SIMATIC S7-400 PN/DP V6 Incl. F (All versions before V6.0.6), SIMATIC S7-400-H V6 (All versions before V6.0.7), SIMATIC S7-400 PN/DP V7 incl. F (All versions), SIMATIC S7-CPU 410 (All versions before V8.2), SIMATIC S7-1200 incl. F (All versions before V4.2.1), SIMATIC S7-1500 incl. F, T, and TF (All versions before V2.1), SIMATIC S7-1500 Software Controller incl. F (All versions before V2.1), SIMATIC WinAC RTX 2010 incl. F (All versions), SIRIUS ACT 3SU1 interface module PROFINET (All versions), SIRIUS Soft starter 3RW44 PN (All versions), SIRIUS Motor starter M200D PROFINET (All versions), SIMOCODE pro V PROFINET (All versions), SINAMICS DCM (All versions before V1.4 SP1 HF5), SINAMICS DCP (All versions), SINAMICS G110M / G120(C/P/D) w. PN (All versions before V4.7 SP6 HF3), SINAMICS G130 and G150 (All versions before V4.7 HF27 and V4.8 before HF4), SINAMICS S110 w. PN (All versions before V4.4 SP1 HF5), SINAMICS S120 (All versions before V4.7 HF27 and V4.8 before HF4), SINAMICS S150 (All versions before V4.7 HF27 and V4.8 before HF4), SINAMICS V90 w. PN (All versions before V1.1), SIMOTION (All versions before V4.5 HF1), SINUMERIK 828D (All versions before V4.5 SP6 HF2 and V4.7 before SP6 HF8), SINUMERIK 840D sl (All versions before V4.5 SP6 HF8 and V4.7 before SP4 HF1), SIMATIC HMI Comfort Panels, HMI Multi Panels, HMI Mobile Panels (All versions) could be affected by a Denial-of-Service condition induced by a specially crafted PROFINET DCP broadcast (Layer 2 - Ethernet) packet. Siemens SIMATIC S7-200 Smart, etc. Siemens SIMATIC S7-200 Smart is a programmable logic controller (PLC) used in small and medium-sized automation systems. Siemens SIMATIC CP 343-1 Advanced is an Ethernet communication module used to support PROFINET (a new generation of automation bus standard based on industrial Ethernet technology). SIRIUS Motor starter M200D PROFINET is a motor starter. The following products and versions are affected: Siemens Extension Unit 12\\\" PROFINET prior to V01.01.01; Extension Unit 15\\\" PROFINET prior to V01.01.01; Extension Unit 19\\\" PROFINET prior to V01.01.01; Extension Unit 22\\\" PROFINET SIMATIC CP 1242-7 GPRS V2 prior to V2.1.82; SIMATIC CP 1243-7 LTE/US prior to V2.1.82; SIMATIC CP 1243-8 prior to V2.1.82; SIMATIC CP 1626 V1.1 previous version",
    "sources": [
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      }
    ],
    "trust": 2.7
  },
  "external_ids": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/external_ids#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "db": "NVD",
        "id": "CVE-2017-2680",
        "trust": 3.6
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-18-023-02",
        "trust": 2.8
      },
      {
        "db": "SIEMENS",
        "id": "SSA-293562",
        "trust": 2.6
      },
      {
        "db": "SIEMENS",
        "id": "SSA-284673",
        "trust": 2.0
      },
      {
        "db": "BID",
        "id": "98369",
        "trust": 2.0
      },
      {
        "db": "SIEMENS",
        "id": "SSA-546832",
        "trust": 1.7
      },
      {
        "db": "SECTRACK",
        "id": "1038463",
        "trust": 1.7
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-17-129-02",
        "trust": 1.7
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574",
        "trust": 0.9
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151",
        "trust": 0.8
      },
      {
        "db": "ICS CERT",
        "id": "ICSA-18-128-01",
        "trust": 0.8
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134",
        "trust": 0.8
      },
      {
        "db": "IVD",
        "id": "296C9514-B30D-4FA5-BCDC-9D8B2E9620C4",
        "trust": 0.2
      },
      {
        "db": "SEEBUG",
        "id": "SSVID-99023",
        "trust": 0.1
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883",
        "trust": 0.1
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "id": "VAR-201705-3220",
  "iot": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": true,
    "sources": [
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      }
    ],
    "trust": 1.5465332084000005
  },
  "iot_taxonomy": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "category": [
          "ICS"
        ],
        "sub_category": null,
        "trust": 0.8
      }
    ],
    "sources": [
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      }
    ]
  },
  "last_update_date": "2024-09-10T22:44:00.390000Z",
  "patch": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/patch#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "title": "SSA-293562",
        "trust": 0.8,
        "url": "https://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-293562.pdf"
      },
      {
        "title": "Patch for a number of Siemens products with a denial of service vulnerability (CNVD-2017-06151)",
        "trust": 0.6,
        "url": "https://www.cnvd.org.cn/patchInfo/show/93364"
      },
      {
        "title": "Multiple Siemens Product security vulnerabilities",
        "trust": 0.6,
        "url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=70052"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      }
    ]
  },
  "problemtype_data": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "problemtype": "CWE-400",
        "trust": 1.0
      },
      {
        "problemtype": "CWE-20",
        "trust": 0.9
      }
    ],
    "sources": [
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "references": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/references#",
      "data": {
        "@container": "@list"
      },
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": [
      {
        "trust": 2.8,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-18-023-02"
      },
      {
        "trust": 2.0,
        "url": "https://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-284673.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://www.securityfocus.com/bid/98369"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-293562.pdf"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-546832.pdf"
      },
      {
        "trust": 1.7,
        "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-284673.pdf"
      },
      {
        "trust": 1.7,
        "url": "http://www.securitytracker.com/id/1038463"
      },
      {
        "trust": 1.1,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-17-129-02"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-284673.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-293562.html"
      },
      {
        "trust": 1.0,
        "url": "https://cert-portal.siemens.com/productcert/html/ssa-546832.html"
      },
      {
        "trust": 0.9,
        "url": "https://www.siemens.com/cert/pool/cert/siemens_security_advisory_ssa-293562.pdf"
      },
      {
        "trust": 0.8,
        "url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-2680"
      },
      {
        "trust": 0.8,
        "url": "https://ics-cert.us-cert.gov/advisories/icsa-18-128-01"
      },
      {
        "trust": 0.8,
        "url": "https://nvd.nist.gov/vuln/detail/cve-2017-2680"
      },
      {
        "trust": 0.6,
        "url": "https://us-cert.cisa.gov/ics/advisories/icsa-17-129-02"
      },
      {
        "trust": 0.3,
        "url": "http://subscriber.communications.siemens.com/"
      }
    ],
    "sources": [
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "sources": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "db": "BID",
        "id": "98369"
      },
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "sources_release_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-05-09T00:00:00",
        "db": "IVD",
        "id": "296c9514-b30d-4fa5-bcdc-9d8b2e9620c4"
      },
      {
        "date": "2017-05-09T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "date": "2017-05-11T00:00:00",
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "date": "2017-05-08T00:00:00",
        "db": "BID",
        "id": "98369"
      },
      {
        "date": "2017-06-16T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "date": "2017-05-12T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "date": "2017-05-11T01:29:05.400000",
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "sources_update_date": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
      "data": {
        "@container": "@list"
      }
    },
    "data": [
      {
        "date": "2017-05-09T00:00:00",
        "db": "CNVD",
        "id": "CNVD-2017-06151"
      },
      {
        "date": "2020-09-29T00:00:00",
        "db": "VULHUB",
        "id": "VHN-110883"
      },
      {
        "date": "2018-05-09T14:00:00",
        "db": "BID",
        "id": "98369"
      },
      {
        "date": "2018-05-10T00:00:00",
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      },
      {
        "date": "2022-02-11T00:00:00",
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      },
      {
        "date": "2024-09-10T10:15:02.153000",
        "db": "NVD",
        "id": "CVE-2017-2680"
      }
    ]
  },
  "threat_type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/threat_type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "remote or local",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      }
    ],
    "trust": 0.6
  },
  "title": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/title#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "plural  Siemens Service disruption in products  (DoS) Vulnerabilities",
    "sources": [
      {
        "db": "JVNDB",
        "id": "JVNDB-2017-004134"
      }
    ],
    "trust": 0.8
  },
  "type": {
    "@context": {
      "@vocab": "https://www.variotdbs.pl/ref/type#",
      "sources": {
        "@container": "@list",
        "@context": {
          "@vocab": "https://www.variotdbs.pl/ref/sources#"
        }
      }
    },
    "data": "resource management error",
    "sources": [
      {
        "db": "CNNVD",
        "id": "CNNVD-201705-574"
      }
    ],
    "trust": 0.6
  }
}